chore: Add laravel ide helper

app/Application.php

@@ -3,9 +3,42 @@
 namespace App;
 
 use GuzzleHttp\Exception\GuzzleException;
+use Illuminate\Database\Eloquent\Builder;
 use Illuminate\Database\Eloquent\Model;
+use Illuminate\Support\Collection;
 use Illuminate\Support\Facades\Log;
 
+/**
+ * App\Application
+ *
+ * @property string $appid
+ * @property string $name
+ * @property string|null $sha
+ * @property string|null $icon
+ * @property string|null $website
+ * @property string|null $license
+ * @property string|null $description
+ * @property int $enhanced
+ * @property string $tile_background
+ * @property \Illuminate\Support\Carbon|null $created_at
+ * @property \Illuminate\Support\Carbon|null $updated_at
+ * @property string|null $class
+ * @method static Builder|Application newModelQuery()
+ * @method static Builder|Application newQuery()
+ * @method static Builder|Application query()
+ * @method static Builder|Application whereAppid($value)
+ * @method static Builder|Application whereClass($value)
+ * @method static Builder|Application whereCreatedAt($value)
+ * @method static Builder|Application whereDescription($value)
+ * @method static Builder|Application whereEnhanced($value)
+ * @method static Builder|Application whereIcon($value)
+ * @method static Builder|Application whereLicense($value)
+ * @method static Builder|Application whereName($value)
+ * @method static Builder|Application whereSha($value)
+ * @method static Builder|Application whereTileBackground($value)
+ * @method static Builder|Application whereUpdatedAt($value)
+ * @method static Builder|Application whereWebsite($value)
+ */
 class Application extends Model
 {
     /**
@@ -79,9 +112,9 @@ class Application extends Model
     }
 
     /**
-     * @return \Illuminate\Support\Collection
+     * @return Collection
      */
-    public static function apps(): \Illuminate\Support\Collection
+    public static function apps(): Collection
     {
         $json = json_decode(file_get_contents(storage_path('app/supportedapps.json'))) ?? [];
         $apps = collect($json->apps);

app/Console/Commands/RegisterApp.php

@@ -36,7 +36,7 @@ class RegisterApp extends Command
     /**
      * Execute the console command.
      *
-     * @return mixed
+     * @return void
      */
     public function handle()
     {

app/Http/Controllers/ItemController.php

@@ -6,18 +6,20 @@ use App\Application;
 use App\Item;
 use App\Jobs\ProcessApps;
 use App\User;
-use Artisan;
 use GuzzleHttp\Client;
 use GuzzleHttp\Exception\ConnectException;
 use GuzzleHttp\Exception\GuzzleException;
 use GuzzleHttp\Exception\ServerException;
 use Illuminate\Contracts\View\View;
-use Illuminate\Database\Eloquent\Model;
+use Illuminate\Database\Eloquent\Collection;
 use Illuminate\Http\RedirectResponse;
 use Illuminate\Http\Request;
+use Illuminate\Routing\Redirector;
 use Illuminate\Support\Facades\Log;
 use Illuminate\Support\Facades\Storage;
 use Illuminate\Support\Facades\URL;
+use Psr\Http\Message\ResponseInterface;
+use Psr\Http\Message\StreamInterface;
 
 class ItemController extends Controller
 {
@@ -105,11 +107,11 @@ class ItemController extends Controller
         $new = !(((bool)$item->pinned === true));
         $item->pinned = $new;
         $item->save();
-        if ($ajax) {
 
+        if ($ajax) {
             $item = Item::whereId($tag)->first();
 
-            $data['apps'] = new \Illuminate\Database\Eloquent\Collection;
+            $data['apps'] = new Collection;
 
             if ((int)$tag === 0) {
                 $tags = Item::where('type', 1)->pinned()->orderBy('order', 'asc')->get();
@@ -133,9 +135,10 @@ class ItemController extends Controller
     /**
      * Display a listing of the resource.
      *
+     * @param Request $request
      * @return View
      */
-    public function index(Request $request)
+    public function index(Request $request): View
     {
         $trash = (bool) $request->input('trash');
 
@@ -411,6 +414,10 @@ class ItemController extends Controller
         return json_encode($output);
     }
 
+    /**
+     * @param Request $request
+     * @return void
+     */
     public function testConfig(Request $request)
     {
         $data = $request->input('data');
@@ -419,8 +426,7 @@ class ItemController extends Controller
         $app = $single->class;
 
         // If password is not resubmitted fill it from the database when in edit mode
-        if (
+        if (array_key_exists('password', $data) &&
-            array_key_exists('password', $data) &&
             $data['password'] === null &&
             array_key_exists('id', $data)
         ) {
@@ -436,10 +442,15 @@ class ItemController extends Controller
         $app_details->test();
     }
 
-    public function execute($url, $attrs = [], $overridevars = false)
+    /**
+     * @param $url
+     * @param array $attrs
+     * @param array|bool $overridevars
+     * @return ResponseInterface|null
+     * @throws GuzzleException
+     */
+    public function execute($url, array $attrs = [], $overridevars = false): ?ResponseInterface
     {
-        $res = null;
-
         $vars = ($overridevars !== false) ?
             $overridevars : [
                 'http_errors' => false,
@@ -461,10 +472,15 @@ class ItemController extends Controller
             Log::debug($e->getMessage());
         }
 
-        return $res;
+        return null;
     }
 
-    public function websitelookup($url)
+    /**
+     * @param $url
+     * @return StreamInterface
+     * @throws GuzzleException
+     */
+    public function websitelookup($url): StreamInterface
     {
         $url = base64_decode($url);
         $data = $this->execute($url);
@@ -472,6 +488,10 @@ class ItemController extends Controller
         return $data->getBody();
     }
 
+    /**
+     * @param $id
+     * @return void
+     */
     public function getStats($id)
     {
         $item = Item::find($id);
@@ -484,6 +504,9 @@ class ItemController extends Controller
         }
     }
 
+    /**
+     * @return \Illuminate\Contracts\Foundation\Application|RedirectResponse|Redirector
+     */
     public function checkAppList()
     {
         ProcessApps::dispatch();

app/Http/Controllers/ItemRestController.php

@@ -5,6 +5,7 @@ namespace App\Http\Controllers;
 use App\Item;
 use Illuminate\Http\Request;
 use Illuminate\Http\Response;
+use Illuminate\Support\Collection;
 
 class ItemRestController extends Controller
 {
@@ -17,7 +18,7 @@ class ItemRestController extends Controller
     /**
      * Display a listing of the resource.
      *
-     * @return Response
+     * @return Collection
      */
     public function index()
     {

app/Http/Controllers/SearchController.php

@@ -3,10 +3,17 @@
 namespace App\Http\Controllers;
 
 use App\Search;
+use Illuminate\Contracts\Foundation\Application;
+use Illuminate\Http\RedirectResponse;
 use Illuminate\Http\Request;
+use Illuminate\Routing\Redirector;
 
 class SearchController extends Controller
 {
+    /**
+     * @param Request $request
+     * @return Application|RedirectResponse|Redirector|mixed|void
+     */
     public function index(Request $request)
     {
         $requestprovider = $request->input('provider');

app/Http/Middleware/CheckAllowed.php

@@ -4,6 +4,7 @@ namespace App\Http\Middleware;
 
 use App\User;
 use Closure;
+use Illuminate\Auth\AuthenticationException;
 use Illuminate\Http\Request;
 use Illuminate\Support\Facades\Auth;
 use Illuminate\Support\Facades\Route;
@@ -17,6 +18,7 @@ class CheckAllowed
      * @param Request $request
      * @param Closure $next
      * @return mixed
+     * @throws AuthenticationException
      */
     public function handle(Request $request, Closure $next)
     {

app/Http/Middleware/RedirectIfAuthenticated.php

@@ -16,7 +16,7 @@ class RedirectIfAuthenticated
      * @param string|null $guard
      * @return mixed
      */
-    public function handle($request, Closure $next, $guard = null)
+    public function handle(Request $request, Closure $next, string $guard = null)
     {
         if (Auth::guard($guard)->check()) {
             return redirect()->intended();

app/Item.php

@@ -12,6 +12,62 @@ use Illuminate\Database\Eloquent\SoftDeletes;
 use stdClass;
 use Symfony\Component\ClassLoader\ClassMapGenerator;
 
+/**
+ * App\Item
+ *
+ * @property int $id
+ * @property string $title
+ * @property string|null $colour
+ * @property string|null $icon
+ * @property string $url
+ * @property string|null $description
+ * @property int $pinned
+ * @property int $order
+ * @property \Illuminate\Support\Carbon|null $deleted_at
+ * @property \Illuminate\Support\Carbon|null $created_at
+ * @property \Illuminate\Support\Carbon|null $updated_at
+ * @property int $type
+ * @property int $user_id
+ * @property string|null $class
+ * @property string|null $appid
+ * @property string|null $appdescription
+ * @property-read \Illuminate\Database\Eloquent\Collection|Item[] $children
+ * @property-read int|null $children_count
+ * @property-read string $droppable
+ * @property-read \Illuminate\Contracts\Foundation\Application|\Illuminate\Contracts\Routing\UrlGenerator|mixed|string $link
+ * @property-read string $link_icon
+ * @property-read string $link_target
+ * @property-read string $link_type
+ * @property-read \Illuminate\Database\Eloquent\Collection|Item[] $parents
+ * @property-read int|null $parents_count
+ * @property-read \App\User|null $user
+ * @method static \Database\Factories\ItemFactory factory(...$parameters)
+ * @method static Builder|Item newModelQuery()
+ * @method static Builder|Item newQuery()
+ * @method static Builder|Item ofType($type)
+ * @method static \Illuminate\Database\Query\Builder|Item onlyTrashed()
+ * @method static Builder|Item pinned()
+ * @method static Builder|Item query()
+ * @method static Builder|Item whereAppdescription($value)
+ * @method static Builder|Item whereAppid($value)
+ * @method static Builder|Item whereClass($value)
+ * @method static Builder|Item whereColour($value)
+ * @method static Builder|Item whereCreatedAt($value)
+ * @method static Builder|Item whereDeletedAt($value)
+ * @method static Builder|Item whereDescription($value)
+ * @method static Builder|Item whereIcon($value)
+ * @method static Builder|Item whereId($value)
+ * @method static Builder|Item whereOrder($value)
+ * @method static Builder|Item wherePinned($value)
+ * @method static Builder|Item whereTitle($value)
+ * @method static Builder|Item whereType($value)
+ * @method static Builder|Item whereUpdatedAt($value)
+ * @method static Builder|Item whereUrl($value)
+ * @method static Builder|Item whereUserId($value)
+ * @method static \Illuminate\Database\Query\Builder|Item withTrashed()
+ * @method static \Illuminate\Database\Query\Builder|Item withoutTrashed()
+ * @mixin \Eloquent
+ */
 class Item extends Model
 {
     use SoftDeletes;
@@ -294,9 +350,9 @@ class Item extends Model
 
     /**
      * @param $class
-     * @return false
+     * @return Application|null
      */
-    public static function applicationDetails($class): bool
+    public static function applicationDetails($class): ?Application
     {
         if (! empty($class)) {
             $name = self::nameFromClass($class);
@@ -306,7 +362,7 @@ class Item extends Model
             }
         }
 
-        return false;
+        return null;
     }
 
     /**
@@ -316,7 +372,7 @@ class Item extends Model
     public static function getApplicationDescription($class): string
     {
         $details = self::applicationDetails($class);
-        if ($details !== false) {
+        if ($details !== null) {
             return $details->description.' - '.$details->license;
         }
 

app/ItemTag.php

@@ -4,6 +4,22 @@ namespace App;
 
 use Illuminate\Database\Eloquent\Relations\Pivot;
 
+/**
+ * App\ItemTag
+ *
+ * @property int $item_id
+ * @property int $tag_id
+ * @property \Illuminate\Support\Carbon|null $created_at
+ * @property \Illuminate\Support\Carbon|null $updated_at
+ * @method static \Illuminate\Database\Eloquent\Builder|ItemTag newModelQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|ItemTag newQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|ItemTag query()
+ * @method static \Illuminate\Database\Eloquent\Builder|ItemTag whereCreatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|ItemTag whereItemId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|ItemTag whereTagId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|ItemTag whereUpdatedAt($value)
+ * @mixin \Eloquent
+ */
 class ItemTag extends Pivot
 {
 }

app/Providers/AppServiceProvider.php

@@ -7,6 +7,7 @@ use App\Jobs\ProcessApps;
 use App\Jobs\UpdateApps;
 use App\Setting;
 use App\User;
+use Barryvdh\LaravelIdeHelper\IdeHelperServiceProvider;
 use Illuminate\Support\Facades\Artisan;
 use Illuminate\Support\Facades\Cache;
 use Illuminate\Support\Facades\Schema;
@@ -116,6 +117,10 @@ class AppServiceProvider extends ServiceProvider
      */
     public function register()
     {
+        if ($this->app->isLocal()) {
+            $this->app->register(IdeHelperServiceProvider::class);
+        }
+
         $this->app->singleton('settings', function () {
             return new Setting();
         });

app/Search.php

@@ -14,7 +14,7 @@ abstract class Search
      *
      * @return Collection
      */
-    public static function providers()
+    public static function providers(): Collection
     {
         $providers = self::standardProviders();
         $providers = $providers + self::appProviders();
@@ -62,7 +62,7 @@ abstract class Search
      *
      * @return array
      */
-    public static function appProviders()
+    public static function appProviders(): array
     {
         $providers = [];
         $userapps = Item::all();

app/Setting.php

@@ -3,6 +3,7 @@
 namespace App;
 
 use Form;
+use Illuminate\Database\Eloquent\Builder;
 use Illuminate\Database\Eloquent\Model;
 use Illuminate\Database\Eloquent\Relations\BelongsTo;
 use Illuminate\Database\Eloquent\Relations\BelongsToMany;
@@ -11,6 +12,37 @@ use Illuminate\Session\SessionManager;
 use Illuminate\Session\Store;
 use Illuminate\Support\Facades\Input;
 
+/**
+ * App\Setting
+ *
+ * @mixin Builder
+ * @property int $id
+ * @property int $group_id
+ * @property string $key
+ * @property string $type
+ * @property string|null $options
+ * @property string $label
+ * @property string|null $value
+ * @property string $order
+ * @property int $system
+ * @property-read mixed $edit_value
+ * @property-read mixed $list_value
+ * @property-read \App\SettingGroup|null $group
+ * @property-read \Illuminate\Database\Eloquent\Collection|\App\User[] $users
+ * @property-read int|null $users_count
+ * @method static Builder|Setting newModelQuery()
+ * @method static Builder|Setting newQuery()
+ * @method static Builder|Setting query()
+ * @method static Builder|Setting whereGroupId($value)
+ * @method static Builder|Setting whereId($value)
+ * @method static Builder|Setting whereKey($value)
+ * @method static Builder|Setting whereLabel($value)
+ * @method static Builder|Setting whereOptions($value)
+ * @method static Builder|Setting whereOrder($value)
+ * @method static Builder|Setting whereSystem($value)
+ * @method static Builder|Setting whereType($value)
+ * @method static Builder|Setting whereValue($value)
+ */
 class Setting extends Model
 {
     /**

app/SettingGroup.php

@@ -5,6 +5,22 @@ namespace App;
 use Illuminate\Database\Eloquent\Model;
 use Illuminate\Database\Eloquent\Relations\HasMany;
 
+/**
+ * App\SettingGroup
+ *
+ * @property int $id
+ * @property string $title
+ * @property int $order
+ * @property-read \Illuminate\Database\Eloquent\Collection|\App\Setting[] $settings
+ * @property-read int|null $settings_count
+ * @method static \Illuminate\Database\Eloquent\Builder|SettingGroup newModelQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|SettingGroup newQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|SettingGroup query()
+ * @method static \Illuminate\Database\Eloquent\Builder|SettingGroup whereId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|SettingGroup whereOrder($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|SettingGroup whereTitle($value)
+ * @mixin \Eloquent
+ */
 class SettingGroup extends Model
 {
     /**

app/SettingUser.php

@@ -4,6 +4,20 @@ namespace App;
 
 use Illuminate\Database\Eloquent\Relations\Pivot;
 
+/**
+ * App\SettingUser
+ *
+ * @property int $setting_id
+ * @property int $user_id
+ * @property string|null $uservalue
+ * @method static \Illuminate\Database\Eloquent\Builder|SettingUser newModelQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|SettingUser newQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|SettingUser query()
+ * @method static \Illuminate\Database\Eloquent\Builder|SettingUser whereSettingId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|SettingUser whereUserId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|SettingUser whereUservalue($value)
+ * @mixin \Eloquent
+ */
 class SettingUser extends Pivot
 {
     //

app/User.php

@@ -7,6 +7,40 @@ use Illuminate\Database\Eloquent\Relations\HasMany;
 use Illuminate\Foundation\Auth\User as Authenticatable;
 use Illuminate\Notifications\Notifiable;
 
+/**
+ * App\User
+ *
+ * @property int $id
+ * @property string $username
+ * @property string $email
+ * @property string|null $avatar
+ * @property string|null $password
+ * @property string|null $autologin
+ * @property int $public_front
+ * @property string|null $remember_token
+ * @property \Illuminate\Support\Carbon|null $created_at
+ * @property \Illuminate\Support\Carbon|null $updated_at
+ * @property-read \Illuminate\Database\Eloquent\Collection|\App\Item[] $items
+ * @property-read int|null $items_count
+ * @property-read \Illuminate\Notifications\DatabaseNotificationCollection|\Illuminate\Notifications\DatabaseNotification[] $notifications
+ * @property-read int|null $notifications_count
+ * @property-read \Illuminate\Database\Eloquent\Collection|\App\Setting[] $settings
+ * @property-read int|null $settings_count
+ * @method static \Illuminate\Database\Eloquent\Builder|User newModelQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|User newQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|User query()
+ * @method static \Illuminate\Database\Eloquent\Builder|User whereAutologin($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|User whereAvatar($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|User whereCreatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|User whereEmail($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|User whereId($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|User wherePassword($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|User wherePublicFront($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|User whereRememberToken($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|User whereUpdatedAt($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|User whereUsername($value)
+ * @mixin \Eloquent
+ */
 class User extends Authenticatable
 {
     use Notifiable;

composer.json

@@ -23,12 +23,13 @@
         "ext-intl": "*"
     },
     "require-dev": {
+        "barryvdh/laravel-ide-helper": "^2.12",
         "filp/whoops": "~2.0",
         "fzaninotto/faker": "~1.4",
         "mockery/mockery": "~1.0",
         "phpunit/phpunit": "~9.0",
-        "symfony/thanks": "^1.0",
+        "squizlabs/php_codesniffer": "3.*",
-        "squizlabs/php_codesniffer": "3.*"
+        "symfony/thanks": "^1.0"
     },
     "autoload": {
         "classmap": [
@@ -52,6 +53,7 @@
     "extra": {
         "laravel": {
             "dont-discover": [
+                "barryvdh/laravel-ide-helper"
             ]
         }
     },
@@ -65,6 +67,11 @@
         "post-autoload-dump": [
             "Illuminate\\Foundation\\ComposerScripts::postAutoloadDump",
             "@php artisan package:discover"
+        ],
+        "post-update-cmd": [
+            "Illuminate\\Foundation\\ComposerScripts::postUpdate",
+            "@php artisan ide-helper:generate",
+            "@php artisan ide-helper:meta"
         ]
     },
     "config": {

composer.lock

@@ -4,7 +4,7 @@
         "Read more about it at https://getcomposer.org/doc/01-basic-usage.md#installing-dependencies",
         "This file is @generated automatically"
     ],
-    "content-hash": "c1478972b2e1dbdb27f39255a644f4be",
+    "content-hash": "23969e2624fec1e93e31a8fa1e94c471",
     "packages": [
         {
             "name": "brick/math",
@@ -7100,6 +7100,562 @@
         }
     ],
     "packages-dev": [
+        {
+            "name": "barryvdh/laravel-ide-helper",
+            "version": "v2.12.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/barryvdh/laravel-ide-helper.git",
+                "reference": "3ba1e2573b38f72107b8aacc4ee177fcab30a550"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/barryvdh/laravel-ide-helper/zipball/3ba1e2573b38f72107b8aacc4ee177fcab30a550",
+                "reference": "3ba1e2573b38f72107b8aacc4ee177fcab30a550",
+                "shasum": ""
+            },
+            "require": {
+                "barryvdh/reflection-docblock": "^2.0.6",
+                "composer/pcre": "^1 || ^2 || ^3",
+                "doctrine/dbal": "^2.6 || ^3",
+                "ext-json": "*",
+                "illuminate/console": "^8 || ^9",
+                "illuminate/filesystem": "^8 || ^9",
+                "illuminate/support": "^8 || ^9",
+                "nikic/php-parser": "^4.7",
+                "php": "^7.3 || ^8.0",
+                "phpdocumentor/type-resolver": "^1.1.0"
+            },
+            "require-dev": {
+                "ext-pdo_sqlite": "*",
+                "friendsofphp/php-cs-fixer": "^2",
+                "illuminate/config": "^8 || ^9",
+                "illuminate/view": "^8 || ^9",
+                "mockery/mockery": "^1.4",
+                "orchestra/testbench": "^6 || ^7",
+                "phpunit/phpunit": "^8.5 || ^9",
+                "spatie/phpunit-snapshot-assertions": "^3 || ^4",
+                "vimeo/psalm": "^3.12"
+            },
+            "suggest": {
+                "illuminate/events": "Required for automatic helper generation (^6|^7|^8|^9)."
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.12-dev"
+                },
+                "laravel": {
+                    "providers": [
+                        "Barryvdh\\LaravelIdeHelper\\IdeHelperServiceProvider"
+                    ]
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Barryvdh\\LaravelIdeHelper\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Barry vd. Heuvel",
+                    "email": "barryvdh@gmail.com"
+                }
+            ],
+            "description": "Laravel IDE Helper, generates correct PHPDocs for all Facade classes, to improve auto-completion.",
+            "keywords": [
+                "autocomplete",
+                "codeintel",
+                "helper",
+                "ide",
+                "laravel",
+                "netbeans",
+                "phpdoc",
+                "phpstorm",
+                "sublime"
+            ],
+            "support": {
+                "issues": "https://github.com/barryvdh/laravel-ide-helper/issues",
+                "source": "https://github.com/barryvdh/laravel-ide-helper/tree/v2.12.3"
+            },
+            "funding": [
+                {
+                    "url": "https://fruitcake.nl",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/barryvdh",
+                    "type": "github"
+                }
+            ],
+            "time": "2022-03-06T14:33:42+00:00"
+        },
+        {
+            "name": "barryvdh/reflection-docblock",
+            "version": "v2.1.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/barryvdh/ReflectionDocBlock.git",
+                "reference": "bf44b757feb8ba1734659029357646466ded673e"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/barryvdh/ReflectionDocBlock/zipball/bf44b757feb8ba1734659029357646466ded673e",
+                "reference": "bf44b757feb8ba1734659029357646466ded673e",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^8.5.14|^9"
+            },
+            "suggest": {
+                "dflydev/markdown": "~1.0",
+                "erusev/parsedown": "~1.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.0.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-0": {
+                    "Barryvdh": [
+                        "src/"
+                    ]
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Mike van Riel",
+                    "email": "mike.vanriel@naenius.com"
+                }
+            ],
+            "support": {
+                "source": "https://github.com/barryvdh/ReflectionDocBlock/tree/v2.1.0"
+            },
+            "time": "2022-10-31T15:35:43+00:00"
+        },
+        {
+            "name": "composer/pcre",
+            "version": "3.1.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/composer/pcre.git",
+                "reference": "4bff79ddd77851fe3cdd11616ed3f92841ba5bd2"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/composer/pcre/zipball/4bff79ddd77851fe3cdd11616ed3f92841ba5bd2",
+                "reference": "4bff79ddd77851fe3cdd11616ed3f92841ba5bd2",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.4 || ^8.0"
+            },
+            "require-dev": {
+                "phpstan/phpstan": "^1.3",
+                "phpstan/phpstan-strict-rules": "^1.1",
+                "symfony/phpunit-bridge": "^5"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "3.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Composer\\Pcre\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Jordi Boggiano",
+                    "email": "j.boggiano@seld.be",
+                    "homepage": "http://seld.be"
+                }
+            ],
+            "description": "PCRE wrapping library that offers type-safe preg_* replacements.",
+            "keywords": [
+                "PCRE",
+                "preg",
+                "regex",
+                "regular expression"
+            ],
+            "support": {
+                "issues": "https://github.com/composer/pcre/issues",
+                "source": "https://github.com/composer/pcre/tree/3.1.0"
+            },
+            "funding": [
+                {
+                    "url": "https://packagist.com",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/composer",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/composer/composer",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2022-11-17T09:50:14+00:00"
+        },
+        {
+            "name": "doctrine/cache",
+            "version": "2.2.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/doctrine/cache.git",
+                "reference": "1ca8f21980e770095a31456042471a57bc4c68fb"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/doctrine/cache/zipball/1ca8f21980e770095a31456042471a57bc4c68fb",
+                "reference": "1ca8f21980e770095a31456042471a57bc4c68fb",
+                "shasum": ""
+            },
+            "require": {
+                "php": "~7.1 || ^8.0"
+            },
+            "conflict": {
+                "doctrine/common": ">2.2,<2.4"
+            },
+            "require-dev": {
+                "cache/integration-tests": "dev-master",
+                "doctrine/coding-standard": "^9",
+                "phpunit/phpunit": "^7.5 || ^8.5 || ^9.5",
+                "psr/cache": "^1.0 || ^2.0 || ^3.0",
+                "symfony/cache": "^4.4 || ^5.4 || ^6",
+                "symfony/var-exporter": "^4.4 || ^5.4 || ^6"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Doctrine\\Common\\Cache\\": "lib/Doctrine/Common/Cache"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Guilherme Blanco",
+                    "email": "guilhermeblanco@gmail.com"
+                },
+                {
+                    "name": "Roman Borschel",
+                    "email": "roman@code-factory.org"
+                },
+                {
+                    "name": "Benjamin Eberlei",
+                    "email": "kontakt@beberlei.de"
+                },
+                {
+                    "name": "Jonathan Wage",
+                    "email": "jonwage@gmail.com"
+                },
+                {
+                    "name": "Johannes Schmitt",
+                    "email": "schmittjoh@gmail.com"
+                }
+            ],
+            "description": "PHP Doctrine Cache library is a popular cache implementation that supports many different drivers such as redis, memcache, apc, mongodb and others.",
+            "homepage": "https://www.doctrine-project.org/projects/cache.html",
+            "keywords": [
+                "abstraction",
+                "apcu",
+                "cache",
+                "caching",
+                "couchdb",
+                "memcached",
+                "php",
+                "redis",
+                "xcache"
+            ],
+            "support": {
+                "issues": "https://github.com/doctrine/cache/issues",
+                "source": "https://github.com/doctrine/cache/tree/2.2.0"
+            },
+            "funding": [
+                {
+                    "url": "https://www.doctrine-project.org/sponsorship.html",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://www.patreon.com/phpdoctrine",
+                    "type": "patreon"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/doctrine%2Fcache",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2022-05-20T20:07:39+00:00"
+        },
+        {
+            "name": "doctrine/dbal",
+            "version": "3.5.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/doctrine/dbal.git",
+                "reference": "f38ee8aaca2d58ee88653cb34a6a3880c23f38a5"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/doctrine/dbal/zipball/f38ee8aaca2d58ee88653cb34a6a3880c23f38a5",
+                "reference": "f38ee8aaca2d58ee88653cb34a6a3880c23f38a5",
+                "shasum": ""
+            },
+            "require": {
+                "composer-runtime-api": "^2",
+                "doctrine/cache": "^1.11|^2.0",
+                "doctrine/deprecations": "^0.5.3|^1",
+                "doctrine/event-manager": "^1|^2",
+                "php": "^7.4 || ^8.0",
+                "psr/cache": "^1|^2|^3",
+                "psr/log": "^1|^2|^3"
+            },
+            "require-dev": {
+                "doctrine/coding-standard": "10.0.0",
+                "jetbrains/phpstorm-stubs": "2022.2",
+                "phpstan/phpstan": "1.8.10",
+                "phpstan/phpstan-strict-rules": "^1.4",
+                "phpunit/phpunit": "9.5.25",
+                "psalm/plugin-phpunit": "0.17.0",
+                "squizlabs/php_codesniffer": "3.7.1",
+                "symfony/cache": "^5.4|^6.0",
+                "symfony/console": "^4.4|^5.4|^6.0",
+                "vimeo/psalm": "4.29.0"
+            },
+            "suggest": {
+                "symfony/console": "For helpful console commands such as SQL execution and import of files."
+            },
+            "bin": [
+                "bin/doctrine-dbal"
+            ],
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Doctrine\\DBAL\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Guilherme Blanco",
+                    "email": "guilhermeblanco@gmail.com"
+                },
+                {
+                    "name": "Roman Borschel",
+                    "email": "roman@code-factory.org"
+                },
+                {
+                    "name": "Benjamin Eberlei",
+                    "email": "kontakt@beberlei.de"
+                },
+                {
+                    "name": "Jonathan Wage",
+                    "email": "jonwage@gmail.com"
+                }
+            ],
+            "description": "Powerful PHP database abstraction layer (DBAL) with many features for database schema introspection and management.",
+            "homepage": "https://www.doctrine-project.org/projects/dbal.html",
+            "keywords": [
+                "abstraction",
+                "database",
+                "db2",
+                "dbal",
+                "mariadb",
+                "mssql",
+                "mysql",
+                "oci8",
+                "oracle",
+                "pdo",
+                "pgsql",
+                "postgresql",
+                "queryobject",
+                "sasql",
+                "sql",
+                "sqlite",
+                "sqlserver",
+                "sqlsrv"
+            ],
+            "support": {
+                "issues": "https://github.com/doctrine/dbal/issues",
+                "source": "https://github.com/doctrine/dbal/tree/3.5.1"
+            },
+            "funding": [
+                {
+                    "url": "https://www.doctrine-project.org/sponsorship.html",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://www.patreon.com/phpdoctrine",
+                    "type": "patreon"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/doctrine%2Fdbal",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2022-10-24T07:26:18+00:00"
+        },
+        {
+            "name": "doctrine/deprecations",
+            "version": "v1.0.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/doctrine/deprecations.git",
+                "reference": "0e2a4f1f8cdfc7a92ec3b01c9334898c806b30de"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/doctrine/deprecations/zipball/0e2a4f1f8cdfc7a92ec3b01c9334898c806b30de",
+                "reference": "0e2a4f1f8cdfc7a92ec3b01c9334898c806b30de",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.1|^8.0"
+            },
+            "require-dev": {
+                "doctrine/coding-standard": "^9",
+                "phpunit/phpunit": "^7.5|^8.5|^9.5",
+                "psr/log": "^1|^2|^3"
+            },
+            "suggest": {
+                "psr/log": "Allows logging deprecations via PSR-3 logger implementation"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Doctrine\\Deprecations\\": "lib/Doctrine/Deprecations"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "description": "A small layer on top of trigger_error(E_USER_DEPRECATED) or PSR-3 logging with options to disable all deprecations or selectively for packages.",
+            "homepage": "https://www.doctrine-project.org/",
+            "support": {
+                "issues": "https://github.com/doctrine/deprecations/issues",
+                "source": "https://github.com/doctrine/deprecations/tree/v1.0.0"
+            },
+            "time": "2022-05-02T15:47:09+00:00"
+        },
+        {
+            "name": "doctrine/event-manager",
+            "version": "1.2.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/doctrine/event-manager.git",
+                "reference": "95aa4cb529f1e96576f3fda9f5705ada4056a520"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/doctrine/event-manager/zipball/95aa4cb529f1e96576f3fda9f5705ada4056a520",
+                "reference": "95aa4cb529f1e96576f3fda9f5705ada4056a520",
+                "shasum": ""
+            },
+            "require": {
+                "doctrine/deprecations": "^0.5.3 || ^1",
+                "php": "^7.1 || ^8.0"
+            },
+            "conflict": {
+                "doctrine/common": "<2.9"
+            },
+            "require-dev": {
+                "doctrine/coding-standard": "^9 || ^10",
+                "phpstan/phpstan": "~1.4.10 || ^1.8.8",
+                "phpunit/phpunit": "^7.5 || ^8.5 || ^9.5",
+                "vimeo/psalm": "^4.24"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Doctrine\\Common\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Guilherme Blanco",
+                    "email": "guilhermeblanco@gmail.com"
+                },
+                {
+                    "name": "Roman Borschel",
+                    "email": "roman@code-factory.org"
+                },
+                {
+                    "name": "Benjamin Eberlei",
+                    "email": "kontakt@beberlei.de"
+                },
+                {
+                    "name": "Jonathan Wage",
+                    "email": "jonwage@gmail.com"
+                },
+                {
+                    "name": "Johannes Schmitt",
+                    "email": "schmittjoh@gmail.com"
+                },
+                {
+                    "name": "Marco Pivetta",
+                    "email": "ocramius@gmail.com"
+                }
+            ],
+            "description": "The Doctrine Event Manager is a simple PHP event system that was built to be used with the various Doctrine projects.",
+            "homepage": "https://www.doctrine-project.org/projects/event-manager.html",
+            "keywords": [
+                "event",
+                "event dispatcher",
+                "event manager",
+                "event system",
+                "events"
+            ],
+            "support": {
+                "issues": "https://github.com/doctrine/event-manager/issues",
+                "source": "https://github.com/doctrine/event-manager/tree/1.2.0"
+            },
+            "funding": [
+                {
+                    "url": "https://www.doctrine-project.org/sponsorship.html",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://www.patreon.com/phpdoctrine",
+                    "type": "patreon"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/doctrine%2Fevent-manager",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2022-10-12T20:51:15+00:00"
+        },
         {
             "name": "doctrine/instantiator",
             "version": "1.4.1",
@@ -7518,6 +8074,114 @@
             },
             "time": "2022-02-21T01:04:05+00:00"
         },
+        {
+            "name": "phpdocumentor/reflection-common",
+            "version": "2.2.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phpDocumentor/ReflectionCommon.git",
+                "reference": "1d01c49d4ed62f25aa84a747ad35d5a16924662b"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phpDocumentor/ReflectionCommon/zipball/1d01c49d4ed62f25aa84a747ad35d5a16924662b",
+                "reference": "1d01c49d4ed62f25aa84a747ad35d5a16924662b",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.2 || ^8.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-2.x": "2.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "phpDocumentor\\Reflection\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Jaap van Otterdijk",
+                    "email": "opensource@ijaap.nl"
+                }
+            ],
+            "description": "Common reflection classes used by phpdocumentor to reflect the code structure",
+            "homepage": "http://www.phpdoc.org",
+            "keywords": [
+                "FQSEN",
+                "phpDocumentor",
+                "phpdoc",
+                "reflection",
+                "static analysis"
+            ],
+            "support": {
+                "issues": "https://github.com/phpDocumentor/ReflectionCommon/issues",
+                "source": "https://github.com/phpDocumentor/ReflectionCommon/tree/2.x"
+            },
+            "time": "2020-06-27T09:03:43+00:00"
+        },
+        {
+            "name": "phpdocumentor/type-resolver",
+            "version": "1.6.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phpDocumentor/TypeResolver.git",
+                "reference": "48f445a408c131e38cab1c235aa6d2bb7a0bb20d"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phpDocumentor/TypeResolver/zipball/48f445a408c131e38cab1c235aa6d2bb7a0bb20d",
+                "reference": "48f445a408c131e38cab1c235aa6d2bb7a0bb20d",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.4 || ^8.0",
+                "phpdocumentor/reflection-common": "^2.0"
+            },
+            "require-dev": {
+                "ext-tokenizer": "*",
+                "phpstan/extension-installer": "^1.1",
+                "phpstan/phpstan": "^1.8",
+                "phpstan/phpstan-phpunit": "^1.1",
+                "phpunit/phpunit": "^9.5",
+                "rector/rector": "^0.13.9",
+                "vimeo/psalm": "^4.25"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-1.x": "1.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "phpDocumentor\\Reflection\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Mike van Riel",
+                    "email": "me@mikevanriel.com"
+                }
+            ],
+            "description": "A PSR-5 based resolver of Class names, Types and Structural Element Names",
+            "support": {
+                "issues": "https://github.com/phpDocumentor/TypeResolver/issues",
+                "source": "https://github.com/phpDocumentor/TypeResolver/tree/1.6.2"
+            },
+            "time": "2022-10-14T12:47:21+00:00"
+        },
         {
             "name": "phpunit/php-code-coverage",
             "version": "9.2.19",

routes/web.php

@@ -10,8 +10,8 @@ use App\Http\Controllers\SearchController;
 use App\Http\Controllers\SettingsController;
 use App\Http\Controllers\TagController;
 use App\Http\Controllers\UserController;
-use Illuminate\Http\Request;
 use Illuminate\Support\Facades\Auth;
+use Illuminate\Support\Facades\Request;
 use Illuminate\Support\Facades\Route;
 
 /*
@@ -87,6 +87,7 @@ Route::get('titlecolour', function (Request $request) {
     if ($color) {
         return title_color($color);
     }
+    return '';
 })->name('titlecolour');
 
 Route::resource('users', UserController::class);

vendor/barryvdh/laravel-ide-helper/.editorconfig

@@ -0,0 +1,15 @@
+; This file is for unifying the coding style for different editors and IDEs.
+; More information at http://editorconfig.org
+
+root = true
+
+[*]
+charset = utf-8
+indent_size = 4
+indent_style = space
+end_of_line = lf
+insert_final_newline = true
+trim_trailing_whitespace = true
+
+[*.md]
+trim_trailing_whitespace = false

vendor/barryvdh/laravel-ide-helper/.php_cs.common.php

@@ -0,0 +1,63 @@
+<?php
+
+// Share common rules between non-test and test files
+return [
+    '@PSR12' => true,
+    'blank_line_after_opening_tag' => true,
+    'braces' => [
+        'allow_single_line_anonymous_class_with_empty_body' => true,
+    ],
+    'compact_nullable_typehint' => true,
+    'declare_equal_normalize' => true,
+    'lowercase_cast' => true,
+    'lowercase_static_reference' => true,
+    'new_with_braces' => true,
+    'no_blank_lines_after_class_opening' => true,
+    'no_leading_import_slash' => true,
+    'no_whitespace_in_blank_line' => true,
+    'ordered_class_elements' => [
+        'order' => [
+            'use_trait',
+        ],
+    ],
+    'ordered_imports' => [
+        'imports_order' => [
+            'class',
+            'function',
+            'const',
+        ],
+        'sort_algorithm' => 'alpha',
+    ],
+    'return_type_declaration' => true,
+    'short_scalar_cast' => true,
+    'single_blank_line_before_namespace' => true,
+    'single_trait_insert_per_statement' => true,
+    'ternary_operator_spaces' => true,
+    'visibility_required' => [
+        'elements' => [
+            'const',
+            'method',
+            'property',
+        ],
+    ],
+
+    // Further quality-of-life improvements
+    'array_syntax' => [
+        'syntax' => 'short',
+    ],
+    'concat_space' => [
+        'spacing' => 'one',
+    ],
+    'fully_qualified_strict_types' => true,
+    'native_function_invocation' => [
+        'include' => [],
+        'strict' => true,
+    ],
+    'no_unused_imports' => true,
+    'single_quote' => true,
+    'space_after_semicolon' => true,
+    'trailing_comma_in_multiline_array' => true,
+    'trim_array_spaces' => true,
+    'unary_operator_spaces' => true,
+    'whitespace_after_comma_in_array' => true,
+];

vendor/barryvdh/laravel-ide-helper/.php_cs.dist

@@ -0,0 +1,14 @@
+<?php
+require __DIR__ . '/vendor/autoload.php';
+
+$finder = PhpCsFixer\Finder::create()
+    ->in(__DIR__)
+    ->exclude('tests');
+
+$config = require __DIR__ . '/.php_cs.common.php';
+
+return PhpCsFixer\Config::create()
+    ->setFinder($finder)
+    ->setRules($config)
+    ->setRiskyAllowed(true)
+    ->setCacheFile(__DIR__ . '/.php_cs.cache');

vendor/barryvdh/laravel-ide-helper/.php_cs.tests.php

@@ -0,0 +1,22 @@
+<?php
+require __DIR__ . '/vendor/autoload.php';
+
+$finder = PhpCsFixer\Finder::create()
+    ->in(__DIR__ . '/tests')
+    ->exclude('__snapshots__');
+
+$config = require __DIR__ . '/.php_cs.common.php';
+
+// Additional rules for tests
+$config = array_merge(
+    $config,
+    [
+        'declare_strict_types' => true,
+    ]
+);
+
+return PhpCsFixer\Config::create()
+    ->setFinder($finder)
+    ->setRules($config)
+    ->setRiskyAllowed(true)
+    ->setCacheFile(__DIR__ . '/.php_cs.tests.cache');

vendor/barryvdh/laravel-ide-helper/CHANGELOG.md

@@ -0,0 +1,175 @@
+# Changelog
+
+All notable changes to this project will be documented in this file.
+
+[Next release](https://github.com/barryvdh/laravel-ide-helper/compare/v2.12.3...master)
+--------------
+
+2022-03-06, 2.12.3
+------------------
+
+### Fixed
+- Fix date and datetime handling for attributes that set a serialization format option for the Carbon instance [#1324 / FLeudts](https://github.com/barryvdh/laravel-ide-helper/pull/1324)
+- Fix composer conflict with composer/pcre version 2/3. [#1327 / barryvdh](https://github.com/barryvdh/laravel-ide-helper/pull/1327)
+
+2022-02-08, 2.12.2
+------------------
+### Fixed
+- Remove composer dependecy, use copy of ClassMapGenerator [#1313 / barryvdh](https://github.com/barryvdh/laravel-ide-helper/pull/1313)
+
+2022-01-24, 2.12.1
+------------------
+### Fixed
+- Properly handle `Castable`s without return type. [#1306 / binotaliu](https://github.com/barryvdh/laravel-ide-helper/pull/1306)
+
+2022-01-23, 2.12.0
+------------------
+### Added
+- Add support for custom casts that using `Castable` [#1287 / binotaliu](https://github.com/barryvdh/laravel-ide-helper/pull/1287)
+- Added Laravel 9 support [#1297 / rcerljenko](https://github.com/barryvdh/laravel-ide-helper/pull/1297)
+
+2022-01-03, 2.11.0
+------------------
+### Added
+- Add support for Laravel 8.77 Attributes [\#1289 / SimonJnsson](https://github.com/barryvdh/laravel-ide-helper/pull/1289)
+- Add support for cast types `decimal:*`, `encrypted:*`, `immutable_date`, `immutable_datetime`, `custom_datetime`, and `immutable_custom_datetime` [#1262 / miken32](https://github.com/barryvdh/laravel-ide-helper/pull/1262)
+- Add support of variadic parameters in `ide-helper:models` [\#1234 / shaffe-fr](https://github.com/barryvdh/laravel-ide-helper/pull/1234)
+- Add support of custom casts without properties [\#1267 / sparclex](https://github.com/barryvdh/laravel-ide-helper/pull/1267)
+
+### Fixed
+- Fix recursively searching for `HasFactory` and `Macroable` traits [\#1216 / daniel-de-wit](https://github.com/barryvdh/laravel-ide-helper/pull/1216)
+- Use platformName to determine db type when casting boolean types [\#1212 / stockalexander](https://github.com/barryvdh/laravel-ide-helper/pull/1212)
+
+### Changed
+- Move default models helper filename to config [\#1241 / wimski](https://github.com/barryvdh/laravel-ide-helper/pull/1241)
+
+2021-06-18, 2.10.1
+------------------
+### Added
+- Added Type registration according to [Custom Mapping Types documentation](https://www.doctrine-project.org/projects/doctrine-dbal/en/latest/reference/types.html#custom-mapping-types) [\#1228 / wimski](https://github.com/barryvdh/laravel-ide-helper/pull/1241)
+
+### Fixed
+- Fixing issue where configured custom_db_types could cause a DBAL exception to be thrown while running `ide-helper:models` [\#1228 / wimski](https://github.com/barryvdh/laravel-ide-helper/pull/1241)
+
+2021-04-09, 2.10.0
+------------------
+### Added
+- Allowing Methods to be set or unset in ModelHooks [\#1198 / jenga201](https://github.com/barryvdh/laravel-ide-helper/pull/1198)\
+  Note: the visibility of `\Barryvdh\LaravelIdeHelper\Console\ModelsCommand::setMethod` has been changed to **public**!
+
+### Fixed
+- Fixing issue where incorrect autoloader unregistered [\#1210 / tezhm](https://github.com/barryvdh/laravel-ide-helper/pull/1210)
+
+2021-04-02, 2.9.3
+-----------------
+### Fixed
+- Support both customized namespace factories as well as default resolvable ones [\#1201 / wimski](https://github.com/barryvdh/laravel-ide-helper/pull/1201)
+
+2021-04-01, 2.9.2
+-----------------
+### Added
+- Model hooks for adding custom information from external sources to model classes through the ModelsCommand [\#945 / wimski](https://github.com/barryvdh/laravel-ide-helper/pull/945)
+
+### Fixed
+- Fix ide-helper:models exception if model doesn't have factory [\#1196 / ahmed-aliraqi](https://github.com/barryvdh/laravel-ide-helper/pull/1196)
+- Running tests triggering post_migrate hooks [\#1193 / netpok](https://github.com/barryvdh/laravel-ide-helper/pull/1193)
+- Array_merge error when config is cached prior to package install [\#1184 / netpok](https://github.com/barryvdh/laravel-ide-helper/pull/1184)
+
+2021-03-15, 2.9.1
+-----------------
+### Added
+- Generate PHPDoc for Laravel 8.x factories [\#1074 / ahmed-aliraqi](https://github.com/barryvdh/laravel-ide-helper/pull/1074)
+- Add a comment to a property like table columns [\#1168 / biiiiiigmonster](https://github.com/barryvdh/laravel-ide-helper/pull/1168)
+- Added `post_migrate` hook to run commands after a migration [\#1163 / netpok](https://github.com/barryvdh/laravel-ide-helper/pull/1163)
+- Allow for PhpDoc for macros with union types [\#1148 / riesjart](https://github.com/barryvdh/laravel-ide-helper/pull/1148)
+
+### Fixed
+- Error when generating helper for invokable classes [\#1124 / standaniels](https://github.com/barryvdh/laravel-ide-helper/pull/1124)
+- Fix broken ReflectionUnionTypes [\#1132 / def-studio](https://github.com/barryvdh/laravel-ide-helper/pull/1132)
+- Relative class names are not converted to fully-qualified class names [\#1005 / SavKS](https://github.com/barryvdh/laravel-ide-helper/pull/1005)
+
+2020-12-30, 2.9.0
+-----------------
+### Changed
+- Dropped support for Laravel 6 and Laravel 7, as well as support for PHP 7.2 and added support for doctrine/dbal:^3 [\#1114 / mfn](https://github.com/barryvdh/laravel-ide-helper/pull/1114)
+
+### Fixed
+- `Macro::initPhpDoc()` will save original docblock if present [\#1116 / LastDragon-ru](https://github.com/barryvdh/laravel-ide-helper/pull/1116)
+- `Alias` will grab macros from `\Illuminate\Database\Eloquent\Builder` too [\#1118 / LastDragon-ru](https://github.com/barryvdh/laravel-ide-helper/pull/1118)
+
+2020-12-08, 2.8.2
+-----------------
+### Added
+- Fix phpdoc generate for custom cast with parameter [\#986 / artelkr](https://github.com/barryvdh/laravel-ide-helper/pull/986)
+- Created a possibility to add custom relation type [\#987 / efinder2](https://github.com/barryvdh/laravel-ide-helper/pull/987)
+- Added `@see` with macro/mixin definition location to PhpDoc [\#1054 / riesjart](https://github.com/barryvdh/laravel-ide-helper/pull/1054)
+- Initial compatibility for PHP8 [\#1106 / mfn](https://github.com/barryvdh/laravel-ide-helper/pull/1106)
+
+### Changed
+- Implement DeferrableProvider [\#914 / kon-shou](https://github.com/barryvdh/laravel-ide-helper/pull/914)
+
+### Fixed
+- Compatibility with Lumen [\#1043 / mfn](https://github.com/barryvdh/laravel-ide-helper/pull/1043)
+- Allow model_locations to have glob patterns [\#1059 / saackearl](https://github.com/barryvdh/laravel-ide-helper/pull/1059)
+- Error when generating helper for macroable classes which are not facades and contain a "fake" method [\#1066 / domkrm] (https://github.com/barryvdh/laravel-ide-helper/pull/1066)
+- Casts with a return type of `static` or `$this` now resolve to an instance of the cast [\#1103 / riesjart](https://github.com/barryvdh/laravel-ide-helper/pull/1103)
+
+### Removed
+- Removed format and broken generateJsonHelper [\#1053 / mfn](https://github.com/barryvdh/laravel-ide-helper/pull/1053)
+
+2020-09-07, 2.8.1
+-----------------
+### Added
+- Support Laravel 8 [\#1022 / barryvdh](https://github.com/barryvdh/laravel-ide-helper/pull/1022)
+- Add option to force usage of FQN [\#1031 / edvordo](https://github.com/barryvdh/laravel-ide-helper/pull/1031)
+- Add support for macros of all macroable classes [\#1006 / domkrm](https://github.com/barryvdh/laravel-ide-helper/pull/1006)
+
+2020-08-11, 2.8.0
+-----------------
+### Added
+- Add static return type to builder methods [\#924 / dmason30](https://github.com/barryvdh/laravel-ide-helper/pull/924)
+- Add `optonal` to meta generator for PhpStorm [\#932 / halaei](https://github.com/barryvdh/laravel-ide-helper/pull/932)
+- Decimal columns as string in Models [\#948 / fgibaux](https://github.com/barryvdh/laravel-ide-helper/pull/948)
+- Simplify full namespaces for already included resources [\#954 / LANGERGabriel](https://github.com/barryvdh/laravel-ide-helper/pull/954)
+- Make writing relation count properties optional [\#969 / AegirLeet](https://github.com/barryvdh/laravel-ide-helper/pull/969)
+- Add more methods able to resolve container instances [\#996 / mfn](https://github.com/barryvdh/laravel-ide-helper/pull/996)
+
+### Fixed
+- Test `auth` is bound before detect Auth driver [\#946 / zhwei](https://github.com/barryvdh/laravel-ide-helper/pull/946)
+- Fix inline doc-block for final models [\#944 / Gummibeer](https://github.com/barryvdh/laravel-ide-helper/pull/955)
+
+2020-04-22, 2.7.0
+-----------------
+### Added
+- Add `ignored_models` as config option [\#890 / pataar](https://github.com/barryvdh/laravel-ide-helper/pull/890)
+- Infer return type from reflection if no phpdoc given [\#906 / mfn](https://github.com/barryvdh/laravel-ide-helper/pull/906)
+- Add custom collection support for get and all methods [\#903 / dmason30](https://github.com/barryvdh/laravel-ide-helper/pull/903)
+- if a model implements interfaces, include them in the stub [\#920 / mr-feek](https://github.com/barryvdh/laravel-ide-helper/pull/920)
+- Generate noinspections PHPStorm tags [\#905 / mzglinski](https://github.com/barryvdh/laravel-ide-helper/pull/905)
+- Added support for Laravel 7 custom casts [\#913 / belamov](https://github.com/barryvdh/laravel-ide-helper/pull/913)
+- Ability to use patterns for model_locations [\#921 / 4n70w4](https://github.com/barryvdh/laravel-ide-helper/pull/921)
+
+### Fixed
+- MorphToMany relations with query not working [\#894 / UksusoFF](https://github.com/barryvdh/laravel-ide-helper/pull/894)
+- Fix camelCase duplicated properties generator [\#881 / bop10](https://github.com/barryvdh/laravel-ide-helper/pull/881)
+- Prevent generation of invalid code for certain parameter default values [\#901 / loilo](https://github.com/barryvdh/laravel-ide-helper/pull/901)
+- Make hasOne and morphOne nullable [\#864 / leo108](https://github.com/barryvdh/laravel-ide-helper/pull/864)
+- Remove unnecessary and wrong definition of SoftDelete methods [\#918 / mfn](https://github.com/barryvdh/laravel-ide-helper/pull/918)
+- Unregister meta command custom autoloader when it is no longer needed [\#919 / mr-feek](https://github.com/barryvdh/laravel-ide-helper/pull/919)
+
+2020-02-25, 2.6.7
+-----------------
+### Added
+- Support for Laravel 7 [commit by barryvdh](https://github.com/barryvdh/laravel-ide-helper/commit/edd69c5e0508972c81f1f7173236de2459c45814)
+
+2019-12-02, 2.6.6
+-----------------
+### Added
+- Add splat operator (...) support [\#860 / ngmy](https://github.com/barryvdh/laravel-ide-helper/pull/860)
+- Add support for custom date class via Date::use() [\#859 / mfn](https://github.com/barryvdh/laravel-ide-helper/pull/859)
+
+### Fixed
+- Prevent undefined property errors [\#877 / matt-allan](https://github.com/barryvdh/laravel-ide-helper/pull/877)
+
+----
+Missing an older changelog? Feel free to submit a PR!

vendor/barryvdh/laravel-ide-helper/LICENSE.md

@@ -0,0 +1,21 @@
+# The MIT License (MIT)
+
+Copyright (c) Barry vd. Heuvel <barryvdh@gmail.com>
+
+> Permission is hereby granted, free of charge, to any person obtaining a copy
+> of this software and associated documentation files (the "Software"), to deal
+> in the Software without restriction, including without limitation the rights
+> to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+> copies of the Software, and to permit persons to whom the Software is
+> furnished to do so, subject to the following conditions:
+>
+> The above copyright notice and this permission notice shall be included in
+> all copies or substantial portions of the Software.
+>
+> THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+> IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+> FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+> AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+> LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+> OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+> THE SOFTWARE.

vendor/barryvdh/laravel-ide-helper/README.md

@@ -0,0 +1,442 @@
+# Laravel IDE Helper Generator
+
+[![Tests](https://github.com/barryvdh/laravel-ide-helper/actions/workflows/run-tests.yml/badge.svg)](https://github.com/barryvdh/laravel-ide-helper/actions)
+[![Packagist License](https://poser.pugx.org/barryvdh/laravel-ide-helper/license.png)](http://choosealicense.com/licenses/mit/)
+[![Latest Stable Version](https://poser.pugx.org/barryvdh/laravel-ide-helper/version.png)](https://packagist.org/packages/barryvdh/laravel-ide-helper)
+[![Total Downloads](https://poser.pugx.org/barryvdh/laravel-ide-helper/d/total.png)](https://packagist.org/packages/barryvdh/laravel-ide-helper)
+[![Fruitcake](https://img.shields.io/badge/Powered%20By-Fruitcake-b2bc35.svg)](https://fruitcake.nl/)
+
+**Complete PHPDocs, directly from the source**
+
+This package generates helper files that enable your IDE to provide accurate autocompletion.
+Generation is done based on the files in your project, so they are always up-to-date.
+
+- [Installation](#installation)
+- [Usage](#usage)
+  - [Automatic PHPDoc generation for Laravel Facades](#automatic-phpdoc-generation-for-laravel-facades)
+  - [Automatic PHPDocs for models](#automatic-phpdocs-for-models)
+    - [Model Directories](#model-directories)
+    - [Ignore Models](#ignore-models)
+    - [Model Hooks](#model-hooks)
+  - [Automatic PHPDocs generation for Laravel Fluent methods](#automatic-phpdocs-generation-for-laravel-fluent-methods)
+  - [Auto-completion for factory builders](#auto-completion-for-factory-builders)
+  - [PhpStorm Meta for Container instances](#phpstorm-meta-for-container-instances)
+- [Usage with Lumen](#usage-with-lumen)
+  - [Enabling Facades](#enabling-facades)
+  - [Adding the Service Provider](#adding-the-service-provider)
+  - [Adding Additional Facades](#adding-additional-facades)
+- [License](#license)
+
+## Installation
+
+Require this package with composer using the following command:
+
+```bash
+composer require --dev barryvdh/laravel-ide-helper
+```
+
+This package makes use of [Laravels package auto-discovery mechanism](https://medium.com/@taylorotwell/package-auto-discovery-in-laravel-5-5-ea9e3ab20518), which means if you don't install dev dependencies in production, it also won't be loaded.
+
+If for some reason you want manually control this:
+- add the package to the `extra.laravel.dont-discover` key in `composer.json`, e.g.
+  ```json
+  "extra": {
+    "laravel": {
+      "dont-discover": [
+        "barryvdh/laravel-ide-helper"
+      ]
+    }
+  }
+  ```
+- Add the following class to the `providers` array in `config/app.php`:
+  ```php
+  Barryvdh\LaravelIdeHelper\IdeHelperServiceProvider::class,
+  ```
+  If you want to manually load it only in non-production environments, instead you can add this to your `AppServiceProvider` with the `register()` method:
+  ```php
+  public function register()
+  {
+      if ($this->app->isLocal()) {
+          $this->app->register(\Barryvdh\LaravelIdeHelper\IdeHelperServiceProvider::class);
+      }
+      // ...
+  }
+  ```
+
+> Note: Avoid caching the configuration in your development environment, it may cause issues after installing this package; respectively clear the cache beforehand via `php artisan cache:clear` if you encounter problems when running the commands
+
+## Usage
+
+_Check out [this Laracasts video](https://laracasts.com/series/how-to-be-awesome-in-phpstorm/episodes/15) for a quick introduction/explanation!_
+
+- `php artisan ide-helper:generate` - [PHPDoc generation for Laravel Facades ](#automatic-phpdoc-generation-for-laravel-facades)
+- `php artisan ide-helper:models` - [PHPDocs for models](#automatic-PHPDocs-for-models)
+- `php artisan ide-helper:meta` - [PhpStorm Meta file](#phpstorm-meta-for-container-instances)
+
+
+Note: You do need CodeComplice for Sublime Text: https://github.com/spectacles/CodeComplice
+
+### Automatic PHPDoc generation for Laravel Facades
+
+You can now re-generate the docs yourself (for future updates)
+
+```bash
+php artisan ide-helper:generate
+```
+
+Note: `bootstrap/compiled.php` has to be cleared first, so run `php artisan clear-compiled` before generating.
+
+This will generate the file `_ide_helper.php` which is expected to be additionally parsed by your IDE for autocomplete. You can use the config `filename` to change its name.
+
+You can configure your `composer.json` to do this each time you update your dependencies:
+
+```js
+"scripts": {
+    "post-update-cmd": [
+        "Illuminate\\Foundation\\ComposerScripts::postUpdate",
+        "@php artisan ide-helper:generate",
+        "@php artisan ide-helper:meta"
+    ]
+},
+```
+
+You can also publish the config file to change implementations (ie. interface to specific class) or set defaults for `--helpers`.
+
+```bash
+php artisan vendor:publish --provider="Barryvdh\LaravelIdeHelper\IdeHelperServiceProvider" --tag=config
+```
+
+The generator tries to identify the real class, but if it cannot be found, you can define it in the config file.
+
+Some classes need a working database connection. If you do not have a default working connection, some facades will not be included.
+You can use an in-memory SQLite driver by adding the `-M` option.
+
+You can choose to include helper files. This is not enabled by default, but you can override it with the `--helpers (-H)` option.
+The `Illuminate/Support/helpers.php` is already set up, but you can add/remove your own files in the config file.
+
+### Automatic PHPDoc generation for macros and mixins
+
+This package can generate PHPDocs for macros and mixins which will be added to the `_ide_helper.php` file.
+
+But this only works if you use type hinting when declaring a macro.
+
+```php
+Str::macro('concat', function(string $str1, string $str2) : string {
+    return $str1 . $str2;
+});
+```
+
+### Automatic PHPDocs for models
+
+If you don't want to write your properties yourself, you can use the command `php artisan ide-helper:models` to generate
+PHPDocs, based on table columns, relations and getters/setters.
+
+> Note: this command requires a working database connection to introspect the table of each model
+
+By default, you are asked to overwrite or write to a separate file (`_ide_helper_models.php`).
+You can write the comments directly to your Model file, using the `--write (-W)` option, or
+force to not write with `--nowrite (-N)`.
+
+Alternatively using the `--write-mixin (-M)` option will only add a mixin tag to your Model file,
+writing the rest in (`_ide_helper_models.php`).
+The class name will be different from the model, avoiding the IDE duplicate annoyance.
+
+> Please make sure to back up your models, before writing the info.
+
+Writing to the models should keep the existing comments and only append new properties/methods.
+The existing PHPDoc is replaced, or added if not found.
+With the `--reset (-R)` option, the existing PHPDocs are ignored, and only the newly found columns/relations are saved as PHPDocs.
+
+```bash
+php artisan ide-helper:models "App\Models\Post"
+```
+
+```php
+/**
+ * App\Models\Post
+ *
+ * @property integer $id
+ * @property integer $author_id
+ * @property string $title
+ * @property string $text
+ * @property \Illuminate\Support\Carbon $created_at
+ * @property \Illuminate\Support\Carbon $updated_at
+ * @property-read \User $author
+ * @property-read \Illuminate\Database\Eloquent\Collection|\Comment[] $comments
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Models\Post newModelQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Models\Post newQuery()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Models\Post query()
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Models\Post whereTitle($value)
+ * @method static \Illuminate\Database\Eloquent\Builder|\App\Models\Post forAuthors(\User ...$authors)
+ * …
+ */
+```
+
+With the `--write-mixin (-M)` option
+```php
+/**
+ * …
+ * @mixin IdeHelperPost
+ */
+```
+
+#### Model Directories
+
+By default, models in `app/models` are scanned. The optional argument tells what models to use (also outside app/models).
+
+```bash
+php artisan ide-helper:models "App\Models\Post" "App\Models\User"
+```
+
+You can also scan a different directory, using the `--dir` option (relative from the base path):
+
+```bash
+php artisan ide-helper:models --dir="path/to/models" --dir="app/src/Model"
+```
+
+You can publish the config file (`php artisan vendor:publish`) and set the default directories.
+
+#### Ignore Models
+
+Models can be ignored using the `--ignore (-I)` option
+
+```bash
+php artisan ide-helper:models --ignore="App\Models\Post,App\Models\User"
+```
+
+Or can be ignored by setting the `ignored_models` config
+
+```php
+'ignored_models' => [
+    App\Post::class,
+    Api\User::class
+],
+```
+
+#### Magic `where*` methods
+
+Eloquent allows calling `where<Attribute>` on your models, e.g. `Post::whereTitle(…)` and automatically translates this to e.g. `Post::where('title', '=', '…')`.
+
+If for some reason it's undesired to have them generated (one for each column), you can disable this via config `write_model_magic_where` and setting it to `false`.
+
+#### Magic `*_count` properties
+
+You may use the [`::withCount`](https://laravel.com/docs/master/eloquent-relationships#counting-related-models) method to count the number results from a relationship without actually loading them. Those results are then placed in attributes following the `<columname>_count` convention.
+
+By default, these attributes are generated in the phpdoc. You can turn them off by setting the config `write_model_relation_count_properties` to `false`.
+
+#### Support `@comment` based on DocBlock
+
+In order to better support IDEs, relations and getters/setters can also add a comment to a property like table columns. Therefore a custom docblock `@comment` is used:
+```php
+class Users extends Model
+{
+    /**
+     * @comment Get User's full name
+     *
+     * @return string
+     */
+    public function getFullNameAttribute(): string
+    {
+        return $this->first_name . ' ' .$this->last_name ;
+    }
+}
+
+// => after generate models
+
+/**
+ * App\Models\Users
+ * 
+ * @property-read string $full_name Get User's full name
+ * …
+ */
+```
+
+#### Dedicated Eloquent Builder methods
+
+A new method to the eloquent models was added called `newEloquentBuilder` [Reference](https://timacdonald.me/dedicated-eloquent-model-query-builders/) where we can 
+add support for creating a new dedicated class instead of using local scopes in the model itself.
+
+If for some reason it's undesired to have them generated (one for each column), you can disable this via config `write_model_external_builder_methods` and setting it to `false`.
+
+#### Unsupported or custom database types
+
+Common column types (e.g. varchar, integer) are correctly mapped to PHP types (`string`, `int`).
+
+But sometimes you may want to use custom column types in your database like `geography`, `jsonb`, `citext`, `bit`, etc. which may throw an "Unknown database type"-Exception.
+
+For those special cases, you can map them via the config `custom_db_types`. Example:
+```php
+'custom_db_types' => [
+    'mysql' => [
+        'geography' => 'array',
+        'point' => 'array',
+    ],
+    'postgresql' => [
+        'jsonb' => 'string',
+        '_int4' => 'array',
+    ],
+],
+```
+
+#### Model Hooks
+
+If you need additional information on your model from sources that are not handled by default, you can hook in to the
+ generation process with model hooks to add extra information on the fly.
+ Simply create a class that implements `ModelHookInterface` and add it to the `model_hooks` array in the config:
+ 
+ ```php
+'model_hooks' => [
+    MyCustomHook::class,
+],
+```
+
+The `run` method will be called during generation for every model and receives the current running `ModelsCommand` and the current `Model`, e.g.:
+
+```php
+class MyCustomHook implements ModelHookInterface
+{
+    public function run(ModelsCommand $command, Model $model): void
+    {
+        if (! $model instanceof MyModel) {
+            return;
+        }
+
+        $command->setProperty('custom', 'string', true, false, 'My custom property');
+        $command->unsetMethod('method');
+        $command->setMethod('method', $command->getMethodType($model, '\Some\Class'), ['$param']);
+    }
+}
+```
+
+```php
+/**
+ * MyModel
+ *
+ * @property integer $id
+ * @property-read string $custom
+```
+
+### Automatic PHPDocs generation for Laravel Fluent methods
+
+If you need PHPDocs support for Fluent methods in migration, for example
+
+```php
+$table->string("somestring")->nullable()->index();
+```
+
+After publishing vendor, simply change the `include_fluent` line your `config/ide-helper.php` file into:
+
+```php
+'include_fluent' => true,
+```
+
+Then run `php artisan ide-helper:generate`, you will now see all Fluent methods recognized by your IDE.
+
+### Auto-completion for factory builders
+
+If you would like the `factory()->create()` and `factory()->make()` methods to return the correct model class,
+you can enable custom factory builders with the `include_factory_builders` line your `config/ide-helper.php` file.
+Deprecated for Laravel 8 or latest.
+
+```php
+'include_factory_builders' => true,
+```
+
+For this to work, you must also publish the PhpStorm Meta file (see below).
+
+## PhpStorm Meta for Container instances
+
+It's possible to generate a PhpStorm meta file to [add support for factory design pattern](https://www.jetbrains.com/help/phpstorm/ide-advanced-metadata.html).
+For Laravel, this means we can make PhpStorm understand what kind of object we are resolving from the IoC Container.
+For example, `events` will return an `Illuminate\Events\Dispatcher` object,
+so with the meta file you can call `app('events')` and it will autocomplete the Dispatcher methods.
+
+```bash
+php artisan ide-helper:meta
+```
+
+```php
+app('events')->fire();
+\App::make('events')->fire();
+
+/** @var \Illuminate\Foundation\Application $app */
+$app->make('events')->fire();
+
+// When the key is not found, it uses the argument as class name
+app('App\SomeClass');
+// Also works with
+app(App\SomeClass::class);
+```
+
+> Note: You might need to restart PhpStorm and make sure `.phpstorm.meta.php` is indexed.
+>
+> Note: When you receive a FatalException: class not found, check your config
+> (for example, remove S3 as cloud driver when you don't have S3 configured. Remove Redis ServiceProvider when you don't use it).
+
+You can change the generated filename via the config `meta_filename`. This can be useful for cases you want to take advantage the PhpStorm also supports the _directory_ `.phpstorm.meta.php/` which would parse any file places there, should your want provide additional files to PhpStorm.
+
+## Usage with Lumen
+
+This package is focused on Laravel development, but it can also be used in Lumen with some workarounds.
+Because Lumen works a little different, as it is like a bare bone version of Laravel and the main configuration
+parameters are instead located in `bootstrap/app.php`, some alterations must be made.
+
+### Enabling Facades
+
+While Laravel IDE Helper can generate automatically default Facades for code hinting,
+Lumen doesn't come with Facades activated. If you plan in using them, you must enable
+them under the `Create The Application` section, uncommenting this line:
+
+```php
+// $app->withFacades();
+```
+
+From there, you should be able to use the `create_alias()` function to add additional Facades into your application.
+
+### Adding the Service Provider
+
+You can install Laravel IDE Helper in `app/Providers/AppServiceProvider.php`,
+and uncommenting this line that registers the App Service Providers, so it can properly load.
+
+```php
+// $app->register(App\Providers\AppServiceProvider::class);
+```
+
+If you are not using that line, that is usually handy to manage gracefully multiple Laravel/Lumen installations,
+you will have to add this line of code under the `Register Service Providers` section of your `bootstrap/app.php`.
+
+```php
+if ($app->environment() !== 'production') {
+    $app->register(\Barryvdh\LaravelIdeHelper\IdeHelperServiceProvider::class);
+}
+```
+
+After that, Laravel IDE Helper should work correctly. During the generation process,
+the script may throw exceptions saying that some Class(s) doesn't exist or there are some undefined indexes.
+This is normal, as Lumen has some default packages stripped away, like Cookies, Storage and Session.
+If you plan to add these packages, you will have to add them manually and create additional Facades if needed.
+
+### Adding Additional Facades
+
+Currently, Lumen IDE Helper doesn't take into account additional Facades created under `bootstrap/app.php` using `create_alias()`,
+so you need to create a `config/app.php` file and add your custom aliases under an `aliases` array again, like so:
+
+```php
+return [
+    'aliases' => [
+        'CustomAliasOne' => Example\Support\Facades\CustomAliasOne::class,
+        'CustomAliasTwo' => Example\Support\Facades\CustomAliasTwo::class,
+        //...
+    ]
+];
+```
+
+After you run `php artisan ide-helper:generate`, it's recommended (but not mandatory) to rename `config/app.php` to something else,
+until you have to re-generate the docs or after passing to production environment.
+Lumen 5.1+ will read this file for configuration parameters if it is present, and may overlap some configurations if it is completely populated.
+
+## License
+
+The Laravel IDE Helper Generator is open-sourced software licensed under the [MIT license](http://opensource.org/licenses/MIT)
+

vendor/barryvdh/laravel-ide-helper/composer.json

@@ -0,0 +1,91 @@
+{
+    "name": "barryvdh/laravel-ide-helper",
+    "description": "Laravel IDE Helper, generates correct PHPDocs for all Facade classes, to improve auto-completion.",
+    "license": "MIT",
+    "keywords": [
+        "laravel",
+        "autocomplete",
+        "ide",
+        "helper",
+        "phpstorm",
+        "netbeans",
+        "sublime",
+        "codeintel",
+        "phpdoc"
+    ],
+    "authors": [
+        {
+            "name": "Barry vd. Heuvel",
+            "email": "barryvdh@gmail.com"
+        }
+    ],
+    "require": {
+        "php": "^7.3 || ^8.0",
+        "ext-json": "*",
+        "barryvdh/reflection-docblock": "^2.0.6",
+        "composer/pcre": "^1 || ^2 || ^3",
+        "doctrine/dbal": "^2.6 || ^3",
+        "illuminate/console": "^8 || ^9",
+        "illuminate/filesystem": "^8 || ^9",
+        "illuminate/support": "^8 || ^9",
+        "nikic/php-parser": "^4.7",
+        "phpdocumentor/type-resolver": "^1.1.0"
+    },
+    "require-dev": {
+        "ext-pdo_sqlite": "*",
+        "friendsofphp/php-cs-fixer": "^2",
+        "illuminate/config": "^8 || ^9",
+        "illuminate/view": "^8 || ^9",
+        "mockery/mockery": "^1.4",
+        "orchestra/testbench": "^6 || ^7",
+        "phpunit/phpunit": "^8.5 || ^9",
+        "spatie/phpunit-snapshot-assertions": "^3 || ^4",
+        "vimeo/psalm": "^3.12"
+    },
+    "suggest": {
+        "illuminate/events": "Required for automatic helper generation (^6|^7|^8|^9)."
+    },
+    "minimum-stability": "dev",
+    "prefer-stable": true,
+    "autoload": {
+        "psr-4": {
+            "Barryvdh\\LaravelIdeHelper\\": "src"
+        }
+    },
+    "autoload-dev": {
+        "psr-4": {
+            "Barryvdh\\LaravelIdeHelper\\Tests\\": "tests"
+        }
+    },
+    "config": {
+        "allow-plugins": {
+            "composer/package-versions-deprecated": true
+        },
+        "sort-packages": true
+    },
+    "extra": {
+        "branch-alias": {
+            "dev-master": "2.12-dev"
+        },
+        "laravel": {
+            "providers": [
+                "Barryvdh\\LaravelIdeHelper\\IdeHelperServiceProvider"
+            ]
+        }
+    },
+    "scripts": {
+        "analyze": "psalm",
+        "check-style": [
+            "php-cs-fixer fix --diff --diff-format=udiff --dry-run",
+            "php-cs-fixer fix --diff --diff-format=udiff --dry-run --config=.php_cs.tests.php"
+        ],
+        "fix-style": [
+            "php-cs-fixer fix",
+            "php-cs-fixer fix --config=.php_cs.tests.php"
+        ],
+        "psalm-set-baseline": "psalm --set-baseline=psalm-baseline.xml",
+        "test": "phpunit",
+        "test-ci": "phpunit -d --without-creating-snapshots",
+        "test-regenerate": "phpunit -d --update-snapshots"
+    }
+}

vendor/barryvdh/laravel-ide-helper/config/ide-helper.php

@@ -0,0 +1,319 @@
+<?php
+
+return [
+
+    /*
+    |--------------------------------------------------------------------------
+    | Filename & Format
+    |--------------------------------------------------------------------------
+    |
+    | The default filename
+    |
+    */
+
+    'filename'  => '_ide_helper.php',
+
+    /*
+    |--------------------------------------------------------------------------
+    | Models filename
+    |--------------------------------------------------------------------------
+    |
+    | The default filename for the models helper file
+    |
+    */
+
+    'models_filename' => '_ide_helper_models.php',
+
+    /*
+    |--------------------------------------------------------------------------
+    | Where to write the PhpStorm specific meta file
+    |--------------------------------------------------------------------------
+    |
+    | PhpStorm also supports the directory `.phpstorm.meta.php/` with arbitrary
+    | files in it, should you need additional files for your project; e.g.
+    | `.phpstorm.meta.php/laravel_ide_Helper.php'.
+    |
+    */
+    'meta_filename' => '.phpstorm.meta.php',
+
+    /*
+    |--------------------------------------------------------------------------
+    | Fluent helpers
+    |--------------------------------------------------------------------------
+    |
+    | Set to true to generate commonly used Fluent methods
+    |
+    */
+
+    'include_fluent' => false,
+
+    /*
+    |--------------------------------------------------------------------------
+    | Factory Builders
+    |--------------------------------------------------------------------------
+    |
+    | Set to true to generate factory generators for better factory()
+    | method auto-completion.
+    |
+    | Deprecated for Laravel 8 or latest.
+    |
+    */
+
+    'include_factory_builders' => false,
+
+    /*
+    |--------------------------------------------------------------------------
+    | Write Model Magic methods
+    |--------------------------------------------------------------------------
+    |
+    | Set to false to disable write magic methods of model
+    |
+    */
+
+    'write_model_magic_where' => true,
+
+    /*
+    |--------------------------------------------------------------------------
+    | Write Model External Eloquent Builder methods
+    |--------------------------------------------------------------------------
+    |
+    | Set to false to disable write external eloquent builder methods
+    |
+    */
+
+    'write_model_external_builder_methods' => true,
+
+    /*
+    |--------------------------------------------------------------------------
+    | Write Model relation count properties
+    |--------------------------------------------------------------------------
+    |
+    | Set to false to disable writing of relation count properties to model DocBlocks.
+    |
+    */
+
+    'write_model_relation_count_properties' => true,
+
+    /*
+    |--------------------------------------------------------------------------
+    | Write Eloquent Model Mixins
+    |--------------------------------------------------------------------------
+    |
+    | This will add the necessary DocBlock mixins to the model class
+    | contained in the Laravel Framework. This helps the IDE with
+    | auto-completion.
+    |
+    | Please be aware that this setting changes a file within the /vendor directory.
+    |
+    */
+
+    'write_eloquent_model_mixins' => false,
+
+    /*
+    |--------------------------------------------------------------------------
+    | Helper files to include
+    |--------------------------------------------------------------------------
+    |
+    | Include helper files. By default not included, but can be toggled with the
+    | -- helpers (-H) option. Extra helper files can be included.
+    |
+    */
+
+    'include_helpers' => false,
+
+    'helper_files' => [
+        base_path() . '/vendor/laravel/framework/src/Illuminate/Support/helpers.php',
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Model locations to include
+    |--------------------------------------------------------------------------
+    |
+    | Define in which directories the ide-helper:models command should look
+    | for models.
+    |
+    | glob patterns are supported to easier reach models in sub-directories,
+    | e.g. `app/Services/* /Models` (without the space)
+    |
+    */
+
+    'model_locations' => [
+        'app',
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Models to ignore
+    |--------------------------------------------------------------------------
+    |
+    | Define which models should be ignored.
+    |
+    */
+
+    'ignored_models' => [
+
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Models hooks
+    |--------------------------------------------------------------------------
+    |
+    | Define which hook classes you want to run for models to add custom information
+    |
+    | Hooks should implement Barryvdh\LaravelIdeHelper\Contracts\ModelHookInterface.
+    |
+    */
+
+    'model_hooks' => [
+        // App\Support\IdeHelper\MyModelHook::class
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Extra classes
+    |--------------------------------------------------------------------------
+    |
+    | These implementations are not really extended, but called with magic functions
+    |
+    */
+
+    'extra' => [
+        'Eloquent' => ['Illuminate\Database\Eloquent\Builder', 'Illuminate\Database\Query\Builder'],
+        'Session' => ['Illuminate\Session\Store'],
+    ],
+
+    'magic' => [],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Interface implementations
+    |--------------------------------------------------------------------------
+    |
+    | These interfaces will be replaced with the implementing class. Some interfaces
+    | are detected by the helpers, others can be listed below.
+    |
+    */
+
+    'interfaces' => [
+
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Support for custom DB types
+    |--------------------------------------------------------------------------
+    |
+    | This setting allow you to map any custom database type (that you may have
+    | created using CREATE TYPE statement or imported using database plugin
+    | / extension to a Doctrine type.
+    |
+    | Each key in this array is a name of the Doctrine2 DBAL Platform. Currently valid names are:
+    | 'postgresql', 'db2', 'drizzle', 'mysql', 'oracle', 'sqlanywhere', 'sqlite', 'mssql'
+    |
+    | This name is returned by getName() method of the specific Doctrine/DBAL/Platforms/AbstractPlatform descendant
+    |
+    | The value of the array is an array of type mappings. Key is the name of the custom type,
+    | (for example, "jsonb" from Postgres 9.4) and the value is the name of the corresponding Doctrine2 type (in
+    | our case it is 'json_array'. Doctrine types are listed here:
+    | https://www.doctrine-project.org/projects/doctrine-dbal/en/latest/reference/types.html#types
+    |
+    | So to support jsonb in your models when working with Postgres, just add the following entry to the array below:
+    |
+    | "postgresql" => array(
+    |       "jsonb" => "json_array",
+    |  ),
+    |
+    */
+    'custom_db_types' => [
+
+    ],
+
+    /*
+     |--------------------------------------------------------------------------
+     | Support for camel cased models
+     |--------------------------------------------------------------------------
+     |
+     | There are some Laravel packages (such as Eloquence) that allow for accessing
+     | Eloquent model properties via camel case, instead of snake case.
+     |
+     | Enabling this option will support these packages by saving all model
+     | properties as camel case, instead of snake case.
+     |
+     | For example, normally you would see this:
+     |
+     |  * @property \Illuminate\Support\Carbon $created_at
+     |  * @property \Illuminate\Support\Carbon $updated_at
+     |
+     | With this enabled, the properties will be this:
+     |
+     |  * @property \Illuminate\Support\Carbon $createdAt
+     |  * @property \Illuminate\Support\Carbon $updatedAt
+     |
+     | Note, it is currently an all-or-nothing option.
+     |
+     */
+    'model_camel_case_properties' => false,
+
+    /*
+    |--------------------------------------------------------------------------
+    | Property Casts
+    |--------------------------------------------------------------------------
+    |
+    | Cast the given "real type" to the given "type".
+    |
+    */
+    'type_overrides' => [
+        'integer' => 'int',
+        'boolean' => 'bool',
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Include DocBlocks from classes
+    |--------------------------------------------------------------------------
+    |
+    | Include DocBlocks from classes to allow additional code inspection for
+    | magic methods and properties.
+    |
+    */
+    'include_class_docblocks' => false,
+
+    /*
+    |--------------------------------------------------------------------------
+    | Force FQN usage
+    |--------------------------------------------------------------------------
+    |
+    | Use the fully qualified (class) name in docBlock,
+    | event if class exists in a given file
+    | or there is an import (use className) of a given class
+    |
+    */
+    'force_fqn' => false,
+
+    /*
+    |--------------------------------------------------------------------------
+    | Additional relation types
+    |--------------------------------------------------------------------------
+    |
+    | Sometimes it's needed to create custom relation types. The key of the array
+    | is the Relationship Method name. The value of the array is the canonical class
+    | name of the Relationship, e.g. `'relationName' => RelationShipClass::class`.
+    |
+    */
+    'additional_relation_types' => [],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Run artisan commands after migrations to generate model helpers
+    |--------------------------------------------------------------------------
+    |
+    | The specified commands should run after migrations are finished running.
+    |
+    */
+    'post_migrate' => [
+        // 'ide-helper:models --nowrite',
+    ],
+
+];

vendor/barryvdh/laravel-ide-helper/psalm-baseline.xml

@@ -0,0 +1,20 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<files psalm-version="3.15@de6e7f324f44dde540ebe7ebd4eb481b97c86f30">
+  <file src="src/Factories.php">
+    <UndefinedClass occurrences="2">
+      <code>Factory</code>
+      <code>Factory</code>
+    </UndefinedClass>
+  </file>
+  <file src="src/Generator.php">
+    <UndefinedClass occurrences="7">
+      <code>\Auth</code>
+      <code>\DB</code>
+      <code>\Cache</code>
+      <code>\Cache</code>
+      <code>\Queue</code>
+      <code>\SSH</code>
+      <code>\Storage</code>
+    </UndefinedClass>
+  </file>
+</files>

vendor/barryvdh/laravel-ide-helper/psalm.xml

@@ -0,0 +1,16 @@
+<?xml version="1.0"?>
+<psalm
+    errorLevel="7"
+    resolveFromConfigFile="true"
+    xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
+    xmlns="https://getpsalm.org/schema/config"
+    xsi:schemaLocation="https://getpsalm.org/schema/config vendor/vimeo/psalm/config.xsd"
+    errorBaseline="psalm-baseline.xml"
+>
+    <projectFiles>
+        <directory name="src" />
+        <ignoreFiles>
+            <directory name="vendor" />
+        </ignoreFiles>
+    </projectFiles>
+</psalm>

vendor/barryvdh/laravel-ide-helper/resources/views/helper.php

@@ -0,0 +1,115 @@
+<?= '<?php' ?>
+<?php
+/**
+ * @var \Barryvdh\LaravelIdeHelper\Alias[][] $namespaces_by_alias_ns
+ * @var \Barryvdh\LaravelIdeHelper\Alias[][] $namespaces_by_extends_ns
+ * @var bool $include_fluent
+ * @var string $helpers
+ */
+?>
+
+// @formatter:off
+// phpcs:ignoreFile
+
+/**
+ * A helper file for Laravel, to provide autocomplete information to your IDE
+ * Generated for Laravel <?= $version ?>.
+ *
+ * This file should not be included in your code, only analyzed by your IDE!
+ *
+ * @author Barry vd. Heuvel <barryvdh@gmail.com>
+ * @see https://github.com/barryvdh/laravel-ide-helper
+ */
+
+<?php foreach ($namespaces_by_extends_ns as $namespace => $aliases) : ?>
+    <?php if ($namespace == '\Illuminate\Database\Eloquent') :
+        continue;
+    endif; ?>
+namespace <?= $namespace == '__root' ? '' : trim($namespace, '\\') ?> { 
+    <?php foreach ($aliases as $alias) : ?>
+        <?= trim($alias->getDocComment('    ')) ?> 
+        <?= $alias->getClassType() ?> <?= $alias->getExtendsClass() ?> {
+        <?php foreach ($alias->getMethods() as $method) : ?>
+            <?= trim($method->getDocComment('        ')) ?> 
+        public static function <?= $method->getName() ?>(<?= $method->getParamsWithDefault() ?>)
+        {<?php if ($method->getDeclaringClass() !== $method->getRoot()) : ?>
+            //Method inherited from <?= $method->getDeclaringClass() ?>
+         <?php endif; ?>
+
+            <?php if ($method->isInstanceCall()) : ?>
+            /** @var <?=$method->getRoot()?> $instance */
+            <?php endif?>
+            <?= $method->shouldReturn() ? 'return ' : '' ?><?= $method->getRootMethodCall() ?>;
+        }
+        <?php endforeach; ?> 
+    }
+    <?php endforeach; ?> 
+}
+
+<?php endforeach; ?>
+
+<?php foreach ($namespaces_by_alias_ns as $namespace => $aliases) : ?>
+namespace <?= $namespace == '__root' ? '' : trim($namespace, '\\') ?> { 
+    <?php foreach ($aliases as $alias) : ?>
+        <?= $alias->getClassType() ?> <?= $alias->getShortName() ?> extends <?= $alias->getExtends() ?> {<?php if ($alias->getExtendsNamespace() == '\Illuminate\Database\Eloquent') : ?>
+            <?php foreach ($alias->getMethods() as $method) : ?> 
+                <?= trim($method->getDocComment('            ')) ?> 
+            public static function <?= $method->getName() ?>(<?= $method->getParamsWithDefault() ?>)
+            {<?php if ($method->getDeclaringClass() !== $method->getRoot()) : ?>
+                //Method inherited from <?= $method->getDeclaringClass() ?>
+             <?php endif; ?>
+
+                <?php if ($method->isInstanceCall()) : ?>
+                /** @var <?=$method->getRoot()?> $instance */
+                <?php endif?>
+                <?= $method->shouldReturn() ? 'return ' : '' ?><?= $method->getRootMethodCall() ?>;
+            }
+            <?php endforeach; ?>
+        <?php endif; ?>}
+    <?php endforeach; ?> 
+}
+
+<?php endforeach; ?>
+
+<?php if ($helpers) : ?>
+namespace {
+    <?= $helpers ?> 
+}
+<?php endif; ?>
+
+<?php if ($include_fluent) : ?>
+namespace Illuminate\Support {
+    /**
+     * Methods commonly used in migrations
+     *
+     * @method Fluent after(string $column) Add the after modifier
+     * @method Fluent charset(string $charset) Add the character set modifier
+     * @method Fluent collation(string $collation) Add the collation modifier
+     * @method Fluent comment(string $comment) Add comment
+     * @method Fluent default($value) Add the default modifier
+     * @method Fluent first() Select first row
+     * @method Fluent index(string $name = null) Add the in dex clause
+     * @method Fluent on(string $table) `on` of a foreign key
+     * @method Fluent onDelete(string $action) `on delete` of a foreign key
+     * @method Fluent onUpdate(string $action) `on update` of a foreign key
+     * @method Fluent primary() Add the primary key modifier
+     * @method Fluent references(string $column) `references` of a foreign key
+     * @method Fluent nullable(bool $value = true) Add the nullable modifier
+     * @method Fluent unique(string $name = null) Add unique index clause
+     * @method Fluent unsigned() Add the unsigned modifier
+     * @method Fluent useCurrent() Add the default timestamp value
+     * @method Fluent change() Add the change modifier
+     */
+    class Fluent {}
+}
+<?php endif ?>
+
+<?php foreach ($factories as $factory) : ?>
+namespace <?=$factory->getNamespaceName()?> {
+    /**
+    * @method \Illuminate\Database\Eloquent\Collection|<?=$factory->getShortName()?>[]|<?=$factory->getShortName()?> create($attributes = [])
+    * @method \Illuminate\Database\Eloquent\Collection|<?=$factory->getShortName()?>[]|<?=$factory->getShortName()?> make($attributes = [])
+    */
+    class <?=$factory->getShortName()?>FactoryBuilder extends \Illuminate\Database\Eloquent\FactoryBuilder {}
+}
+<?php endforeach; ?>

vendor/barryvdh/laravel-ide-helper/resources/views/meta.php

@@ -0,0 +1,62 @@
+<?= '<?php' ?>
+
+// @formatter:off
+
+namespace PHPSTORM_META {
+
+   /**
+    * PhpStorm Meta file, to provide autocomplete information for PhpStorm
+    *
+    * @author Barry vd. Heuvel <barryvdh@gmail.com>
+    * @see https://github.com/barryvdh/laravel-ide-helper
+    */
+<?php foreach ($methods as $method) : ?>
+    override(<?= $method ?>, map([
+        '' => '@',
+    <?php foreach ($bindings as $abstract => $class) : ?>
+        '<?= $abstract ?>' => \<?= $class ?>::class,
+    <?php endforeach; ?>
+    ]));
+<?php endforeach; ?>
+
+<?php if (count($factories)) : ?>
+    override(\factory(0), map([
+        '' => '@FactoryBuilder',
+    <?php foreach ($factories as $factory) : ?>
+        '<?= $factory->getName() ?>' => \<?= $factory->getName() ?>FactoryBuilder::class,
+    <?php endforeach; ?>
+    ]));
+<?php endif; ?>
+
+    override(\Illuminate\Support\Arr::add(0), type(0));
+    override(\Illuminate\Support\Arr::except(0), type(0));
+    override(\Illuminate\Support\Arr::first(0), elementType(0));
+    override(\Illuminate\Support\Arr::last(0), elementType(0));
+    override(\Illuminate\Support\Arr::get(0), elementType(0));
+    override(\Illuminate\Support\Arr::only(0), type(0));
+    override(\Illuminate\Support\Arr::prepend(0), type(0));
+    override(\Illuminate\Support\Arr::pull(0), elementType(0));
+    override(\Illuminate\Support\Arr::set(0), type(0));
+    override(\Illuminate\Support\Arr::shuffle(0), type(0));
+    override(\Illuminate\Support\Arr::sort(0), type(0));
+    override(\Illuminate\Support\Arr::sortRecursive(0), type(0));
+    override(\Illuminate\Support\Arr::where(0), type(0));
+    override(\array_add(0), type(0));
+    override(\array_except(0), type(0));
+    override(\array_first(0), elementType(0));
+    override(\array_last(0), elementType(0));
+    override(\array_get(0), elementType(0));
+    override(\array_only(0), type(0));
+    override(\array_prepend(0), type(0));
+    override(\array_pull(0), elementType(0));
+    override(\array_set(0), type(0));
+    override(\array_sort(0), type(0));
+    override(\array_sort_recursive(0), type(0));
+    override(\array_where(0), type(0));
+    override(\head(0), elementType(0));
+    override(\last(0), elementType(0));
+    override(\with(0), type(0));
+    override(\tap(0), type(0));
+    override(\optional(0), type(0));
+
+}

vendor/barryvdh/laravel-ide-helper/src/Alias.php

@@ -0,0 +1,473 @@
+<?php
+
+/**
+ * Laravel IDE Helper Generator
+ *
+ * @author    Barry vd. Heuvel <barryvdh@gmail.com>
+ * @copyright 2014 Barry vd. Heuvel / Fruitcake Studio (http://www.fruitcakestudio.nl)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      https://github.com/barryvdh/laravel-ide-helper
+ */
+
+namespace Barryvdh\LaravelIdeHelper;
+
+use Barryvdh\Reflection\DocBlock;
+use Barryvdh\Reflection\DocBlock\Context;
+use Barryvdh\Reflection\DocBlock\Serializer as DocBlockSerializer;
+use Barryvdh\Reflection\DocBlock\Tag\MethodTag;
+use Closure;
+use Illuminate\Config\Repository as ConfigRepository;
+use Illuminate\Database\Eloquent\Builder as EloquentBuilder;
+use Illuminate\Support\Facades\Facade;
+use ReflectionClass;
+
+class Alias
+{
+    protected $alias;
+    /** @psalm-var class-string $facade */
+    protected $facade;
+    protected $extends = null;
+    protected $extendsClass = null;
+    protected $extendsNamespace = null;
+    protected $classType = 'class';
+    protected $short;
+    protected $namespace = '__root';
+    protected $root = null;
+    protected $classes = [];
+    protected $methods = [];
+    protected $usedMethods = [];
+    protected $valid = false;
+    protected $magicMethods = [];
+    protected $interfaces = [];
+    protected $phpdoc = null;
+    protected $classAliases = [];
+
+    /** @var ConfigRepository  */
+    protected $config;
+
+    /**
+     * @param ConfigRepository $config
+     * @param string           $alias
+     * @psalm-param class-string $facade
+     * @param string           $facade
+     * @param array            $magicMethods
+     * @param array            $interfaces
+     */
+    public function __construct($config, $alias, $facade, $magicMethods = [], $interfaces = [])
+    {
+        $this->alias = $alias;
+        $this->magicMethods = $magicMethods;
+        $this->interfaces = $interfaces;
+        $this->config = $config;
+
+        // Make the class absolute
+        $facade = '\\' . ltrim($facade, '\\');
+        $this->facade = $facade;
+
+        $this->detectRoot();
+
+        if (!$this->root || $this->isTrait()) {
+            return;
+        }
+
+        $this->valid = true;
+
+        $this->addClass($this->root);
+        $this->detectFake();
+        $this->detectNamespace();
+        $this->detectClassType();
+        $this->detectExtendsNamespace();
+
+        if (!empty($this->namespace)) {
+            $this->classAliases = (new UsesResolver())->loadFromClass($this->root);
+
+            //Create a DocBlock and serializer instance
+            $this->phpdoc = new DocBlock(new ReflectionClass($alias), new Context($this->namespace, $this->classAliases));
+        }
+
+        if ($facade === '\Illuminate\Database\Eloquent\Model') {
+            $this->usedMethods = ['decrement', 'increment'];
+        }
+    }
+
+    /**
+     * Add one or more classes to analyze
+     *
+     * @param array|string $classes
+     */
+    public function addClass($classes)
+    {
+        $classes = (array)$classes;
+        foreach ($classes as $class) {
+            if (class_exists($class) || interface_exists($class)) {
+                $this->classes[] = $class;
+            } else {
+                echo "Class not exists: $class\r\n";
+            }
+        }
+    }
+
+    /**
+     * Check if this class is valid to process.
+     * @return bool
+     */
+    public function isValid()
+    {
+        return $this->valid;
+    }
+
+    /**
+     * Get the classtype, 'interface' or 'class'
+     *
+     * @return string
+     */
+    public function getClasstype()
+    {
+        return $this->classType;
+    }
+
+    /**
+     * Get the class which this alias extends
+     *
+     * @return null|string
+     */
+    public function getExtends()
+    {
+        return $this->extends;
+    }
+
+    /**
+     * Get the class short name which this alias extends
+     *
+     * @return null|string
+     */
+    public function getExtendsClass()
+    {
+        return $this->extendsClass;
+    }
+
+    /**
+     * Get the namespace of the class which this alias extends
+     *
+     * @return null|string
+     */
+    public function getExtendsNamespace()
+    {
+        return $this->extendsNamespace;
+    }
+
+    /**
+     * Get the Alias by which this class is called
+     *
+     * @return string
+     */
+    public function getAlias()
+    {
+        return $this->alias;
+    }
+
+    /**
+     * Return the short name (without namespace)
+     */
+    public function getShortName()
+    {
+        return $this->short;
+    }
+    /**
+     * Get the namespace from the alias
+     *
+     * @return string
+     */
+    public function getNamespace()
+    {
+        return $this->namespace;
+    }
+
+    /**
+     * Get the methods found by this Alias
+     *
+     * @return array|Method[]
+     */
+    public function getMethods()
+    {
+        if (count($this->methods) > 0) {
+            return $this->methods;
+        }
+
+        $this->addMagicMethods();
+        $this->detectMethods();
+        return $this->methods;
+    }
+
+    /**
+     * Detect class returned by ::fake()
+     */
+    protected function detectFake()
+    {
+        $facade = $this->facade;
+
+        if (!is_subclass_of($facade, Facade::class)) {
+            return;
+        }
+
+        if (!method_exists($facade, 'fake')) {
+            return;
+        }
+
+        $real = $facade::getFacadeRoot();
+
+        try {
+            $facade::fake();
+            $fake = $facade::getFacadeRoot();
+            if ($fake !== $real) {
+                $this->addClass(get_class($fake));
+            }
+        } finally {
+            $facade::swap($real);
+        }
+    }
+
+    /**
+     * Detect the namespace
+     */
+    protected function detectNamespace()
+    {
+        if (strpos($this->alias, '\\')) {
+            $nsParts = explode('\\', $this->alias);
+            $this->short = array_pop($nsParts);
+            $this->namespace = implode('\\', $nsParts);
+        } else {
+            $this->short = $this->alias;
+        }
+    }
+
+    /**
+     * Detect the extends namespace
+     */
+    protected function detectExtendsNamespace()
+    {
+        if (strpos($this->extends, '\\') !== false) {
+            $nsParts = explode('\\', $this->extends);
+            $this->extendsClass = array_pop($nsParts);
+            $this->extendsNamespace = implode('\\', $nsParts);
+        }
+    }
+
+    /**
+     * Detect the class type
+     */
+    protected function detectClassType()
+    {
+        //Some classes extend the facade
+        if (interface_exists($this->facade)) {
+            $this->classType = 'interface';
+            $this->extends = $this->facade;
+        } else {
+            $this->classType = 'class';
+            if (class_exists($this->facade)) {
+                $this->extends = $this->facade;
+            }
+        }
+    }
+
+    /**
+     * Get the real root of a facade
+     *
+     * @return bool|string
+     */
+    protected function detectRoot()
+    {
+        $facade = $this->facade;
+
+        try {
+            //If possible, get the facade root
+            if (method_exists($facade, 'getFacadeRoot')) {
+                $root = get_class($facade::getFacadeRoot());
+            } else {
+                $root = $facade;
+            }
+
+            //If it doesn't exist, skip it
+            if (!class_exists($root) && !interface_exists($root)) {
+                return;
+            }
+
+            $this->root = $root;
+
+            //When the database connection is not set, some classes will be skipped
+        } catch (\PDOException $e) {
+            $this->error(
+                'PDOException: ' . $e->getMessage() .
+                "\nPlease configure your database connection correctly, or use the sqlite memory driver (-M)." .
+                " Skipping $facade."
+            );
+        } catch (\Exception $e) {
+            $this->error('Exception: ' . $e->getMessage() . "\nSkipping $facade.");
+        }
+    }
+
+    /**
+     * Detect if this class is a trait or not.
+     *
+     * @return bool
+     */
+    protected function isTrait()
+    {
+        // Check if the facade is not a Trait
+        return trait_exists($this->facade);
+    }
+
+    /**
+     * Add magic methods, as defined in the configuration files
+     */
+    protected function addMagicMethods()
+    {
+        foreach ($this->magicMethods as $magic => $real) {
+            list($className, $name) = explode('::', $real);
+            if ((!class_exists($className) && !interface_exists($className)) || !method_exists($className, $name)) {
+                continue;
+            }
+            $method = new \ReflectionMethod($className, $name);
+            $class = new \ReflectionClass($className);
+
+            if (!in_array($magic, $this->usedMethods)) {
+                if ($class !== $this->root) {
+                    $this->methods[] = new Method($method, $this->alias, $class, $magic, $this->interfaces, $this->classAliases);
+                }
+                $this->usedMethods[] = $magic;
+            }
+        }
+    }
+
+    /**
+     * Get the methods for one or multiple classes.
+     *
+     * @return string
+     */
+    protected function detectMethods()
+    {
+        foreach ($this->classes as $class) {
+            $reflection = new \ReflectionClass($class);
+
+            $methods = $reflection->getMethods(\ReflectionMethod::IS_PUBLIC);
+            if ($methods) {
+                foreach ($methods as $method) {
+                    if (!in_array($method->name, $this->usedMethods)) {
+                        // Only add the methods to the output when the root is not the same as the class.
+                        // And don't add the __*() methods
+                        if ($this->extends !== $class && substr($method->name, 0, 2) !== '__') {
+                            $this->methods[] = new Method(
+                                $method,
+                                $this->alias,
+                                $reflection,
+                                $method->name,
+                                $this->interfaces,
+                                $this->classAliases
+                            );
+                        }
+                        $this->usedMethods[] = $method->name;
+                    }
+                }
+            }
+
+            // Check if the class is macroable
+            // (Eloquent\Builder is also macroable but doesn't use Macroable trait)
+            $traits = collect($reflection->getTraitNames());
+            if ($traits->contains('Illuminate\Support\Traits\Macroable') || $class === EloquentBuilder::class) {
+                $properties = $reflection->getStaticProperties();
+                $macros = isset($properties['macros']) ? $properties['macros'] : [];
+                foreach ($macros as $macro_name => $macro_func) {
+                    if (!in_array($macro_name, $this->usedMethods)) {
+                        // Add macros
+                        $this->methods[] = new Macro(
+                            $this->getMacroFunction($macro_func),
+                            $this->alias,
+                            $reflection,
+                            $macro_name,
+                            $this->interfaces,
+                            $this->classAliases
+                        );
+                        $this->usedMethods[] = $macro_name;
+                    }
+                }
+            }
+        }
+    }
+
+    /**
+     * @param $macro_func
+     *
+     * @return \ReflectionFunctionAbstract
+     * @throws \ReflectionException
+     */
+    protected function getMacroFunction($macro_func)
+    {
+        if (is_array($macro_func) && is_callable($macro_func)) {
+            return new \ReflectionMethod($macro_func[0], $macro_func[1]);
+        }
+
+        if (is_object($macro_func) && is_callable($macro_func) && !$macro_func instanceof Closure) {
+            return new \ReflectionMethod($macro_func, '__invoke');
+        }
+
+        return new \ReflectionFunction($macro_func);
+    }
+
+    /*
+     * Get the docblock for this alias
+     *
+     * @param string $prefix
+     * @return mixed
+     */
+    public function getDocComment($prefix = "\t\t")
+    {
+        $serializer = new DocBlockSerializer(1, $prefix);
+
+        if (!$this->phpdoc) {
+            return '';
+        }
+
+        if ($this->config->get('ide-helper.include_class_docblocks')) {
+            // if a class doesn't expose any DocBlock tags
+            // we can perform reflection on the class and
+            // add in the original class DocBlock
+            if (count($this->phpdoc->getTags()) === 0) {
+                $class = new ReflectionClass($this->root);
+                $this->phpdoc = new DocBlock($class->getDocComment());
+            }
+        }
+
+        $this->removeDuplicateMethodsFromPhpDoc();
+        return $serializer->getDocComment($this->phpdoc);
+    }
+
+    /**
+     * Removes method tags from the doc comment that already appear as functions inside the class.
+     * This prevents duplicate function errors in the IDE.
+     *
+     * @return void
+     */
+    protected function removeDuplicateMethodsFromPhpDoc()
+    {
+        $methodNames = array_map(function (Method $method) {
+            return $method->getName();
+        }, $this->getMethods());
+
+        foreach ($this->phpdoc->getTags() as $tag) {
+            if ($tag instanceof MethodTag && in_array($tag->getMethodName(), $methodNames)) {
+                $this->phpdoc->deleteTag($tag);
+            }
+        }
+    }
+
+    /**
+     * Output an error.
+     *
+     * @param  string  $string
+     * @return void
+     */
+    protected function error($string)
+    {
+        echo $string . "\r\n";
+    }
+}

vendor/barryvdh/laravel-ide-helper/src/ClassMapGenerator.php

@@ -0,0 +1,415 @@
+<?php
+
+/*
+ * This file is part of Composer.
+ *
+ * (c) Nils Adermann <naderman@naderman.de>
+ *     Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+/*
+ * This file is copied from the Symfony package to composer/composer and then copied again here.
+ *
+ * (c) Fabien Potencier <fabien@symfony.com>
+ */
+
+namespace Barryvdh\LaravelIdeHelper;
+
+use Composer\Pcre\Preg;
+use Symfony\Component\Finder\Finder;
+
+/**
+ * ClassMapGenerator
+ *
+ * @author Gyula Sallai <salla016@gmail.com>
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class ClassMapGenerator
+{
+    /** @var array<array{name: string, length: int, pattern: non-empty-string}> */
+    private static $typeConfig;
+
+    /** @var non-empty-string */
+    private static $restPattern;
+
+    /**
+     * Generate a class map file
+     *
+     * @param \Traversable<string>|array<string> $dirs Directories or a single path to search in
+     * @param string                     $file The name of the class map file
+     * @return void
+     */
+    public static function dump($dirs, $file)
+    {
+        $maps = [];
+
+        foreach ($dirs as $dir) {
+            $maps = array_merge($maps, static::createMap($dir));
+        }
+
+        file_put_contents($file, sprintf('<?php return %s;', var_export($maps, true)));
+    }
+
+    /**
+     * Checks if the given path is absolute
+     *
+     * @param  string $path
+     * @return bool
+     *
+     * @see \Composer\Util\Filesystem
+     * @author Jordi Boggiano <j.boggiano@seld.be>
+     * @author Johannes M. Schmitt <schmittjoh@gmail.com>
+     */
+    public static function isAbsolutePath($path)
+    {
+        return substr($path, 0, 1) === '/' || substr($path, 1, 1) === ':' || substr($path, 0, 2) === '\\\\';
+    }
+
+    /**
+     * Normalize a path. This replaces backslashes with slashes, removes ending
+     * slash and collapses redundant separators and up-level references.
+     *
+     * @param  string $path Path to the file or directory
+     * @return string
+     *
+     * @see \Composer\Util\Filesystem
+     * @author Jordi Boggiano <j.boggiano@seld.be>
+     * @author Johannes M. Schmitt <schmittjoh@gmail.com>
+     */
+    public static function normalizePath($path)
+    {
+        $parts = [];
+        $path = strtr($path, '\\', '/');
+        $prefix = '';
+        $absolute = false;
+
+        // extract a prefix being a protocol://, protocol:, protocol://drive: or simply drive:
+        if (preg_match('{^( [0-9a-z]{2,}+: (?: // (?: [a-z]: )? )? | [a-z]: )}ix', $path, $match)) {
+            $prefix = $match[1];
+            $path = substr($path, strlen($prefix));
+        }
+
+        if (substr($path, 0, 1) === '/') {
+            $absolute = true;
+            $path = substr($path, 1);
+        }
+
+        $up = false;
+        foreach (explode('/', $path) as $chunk) {
+            if ('..' === $chunk && ($absolute || $up)) {
+                array_pop($parts);
+                $up = !(empty($parts) || '..' === end($parts));
+            } elseif ('.' !== $chunk && '' !== $chunk) {
+                $parts[] = $chunk;
+                $up = '..' !== $chunk;
+            }
+        }
+
+        return $prefix . ($absolute ? '/' : '') . implode('/', $parts);
+    }
+
+    /**
+     * Iterate over all files in the given directory searching for classes
+     *
+     * @param \Traversable<\SplFileInfo>|string|array<string> $path The path to search in or an iterator
+     * @param string              $excluded     Regex that matches file paths to be excluded from the classmap
+     * @param ?\Composer\IO\IOInterface        $io           IO object
+     * @param ?string             $namespace    Optional namespace prefix to filter by
+     * @param ?string             $autoloadType psr-0|psr-4 Optional autoload standard to use mapping rules
+     * @param array<string, true> $scannedFiles
+     * @return array<class-string, string> A class map array
+     * @throws \RuntimeException When the path is neither an existing file nor directory
+     */
+    public static function createMap($path, $excluded = null, $io = null, $namespace = null, $autoloadType = null, &$scannedFiles = [])
+    {
+        $basePath = $path;
+        if (is_string($path)) {
+            if (is_file($path)) {
+                $path = [new \SplFileInfo($path)];
+            } elseif (is_dir($path) || strpos($path, '*') !== false) {
+                $path = Finder::create()->files()->followLinks()->name('/\.(php|inc|hh)$/')->in($path);
+            } else {
+                throw new \RuntimeException(
+                    'Could not scan for classes inside "' . $path .
+                    '" which does not appear to be a file nor a folder'
+                );
+            }
+        } elseif (null !== $autoloadType) {
+            throw new \RuntimeException('Path must be a string when specifying an autoload type');
+        }
+
+        $map = [];
+        $cwd = realpath(getcwd());
+
+        foreach ($path as $file) {
+            $filePath = $file->getPathname();
+            if (!in_array(pathinfo($filePath, PATHINFO_EXTENSION), ['php', 'inc', 'hh'])) {
+                continue;
+            }
+
+            if (!self::isAbsolutePath($filePath)) {
+                $filePath = $cwd . '/' . $filePath;
+                $filePath = self::normalizePath($filePath);
+            } else {
+                $filePath = Preg::replace('{[\\\\/]{2,}}', '/', $filePath);
+            }
+
+            $realPath = realpath($filePath);
+
+            // if a list of scanned files is given, avoid scanning twice the same file to save cycles and avoid generating warnings
+            // in case a PSR-0/4 declaration follows another more specific one, or a classmap declaration, which covered this file already
+            if (isset($scannedFiles[$realPath])) {
+                continue;
+            }
+
+            // check the realpath of the file against the excluded paths as the path might be a symlink and the excluded path is realpath'd so symlink are resolved
+            if ($excluded && Preg::isMatch($excluded, strtr($realPath, '\\', '/'))) {
+                continue;
+            }
+            // check non-realpath of file for directories symlink in project dir
+            if ($excluded && Preg::isMatch($excluded, strtr($filePath, '\\', '/'))) {
+                continue;
+            }
+
+            $classes = self::findClasses($filePath);
+            if (null !== $autoloadType) {
+                $classes = self::filterByNamespace($classes, $filePath, $namespace, $autoloadType, $basePath, $io);
+
+                // if no valid class was found in the file then we do not mark it as scanned as it might still be matched by another rule later
+                if ($classes) {
+                    $scannedFiles[$realPath] = true;
+                }
+            } else {
+                // classmap autoload rules always collect all classes so for these we definitely do not want to scan again
+                $scannedFiles[$realPath] = true;
+            }
+
+            foreach ($classes as $class) {
+                // skip classes not within the given namespace prefix
+                if (null === $autoloadType && null !== $namespace && '' !== $namespace && 0 !== strpos($class, $namespace)) {
+                    continue;
+                }
+
+                if (!isset($map[$class])) {
+                    $map[$class] = $filePath;
+                } elseif ($io && $map[$class] !== $filePath && !Preg::isMatch('{/(test|fixture|example|stub)s?/}i', strtr($map[$class] . ' ' . $filePath, '\\', '/'))) {
+                    $io->writeError(
+                        '<warning>Warning: Ambiguous class resolution, "' . $class . '"' .
+                        ' was found in both "' . $map[$class] . '" and "' . $filePath . '", the first will be used.</warning>'
+                    );
+                }
+            }
+        }
+
+        return $map;
+    }
+
+    /**
+     * Remove classes which could not have been loaded by namespace autoloaders
+     *
+     * @param  array<int, class-string> $classes       found classes in given file
+     * @param  string                   $filePath      current file
+     * @param  string                   $baseNamespace prefix of given autoload mapping
+     * @param  string                   $namespaceType psr-0|psr-4
+     * @param  string                   $basePath      root directory of given autoload mapping
+     * @param  ?\Composer\IO\IOInterface             $io            IO object
+     * @return array<int, class-string> valid classes
+     */
+    private static function filterByNamespace($classes, $filePath, $baseNamespace, $namespaceType, $basePath, $io)
+    {
+        $validClasses = [];
+        $rejectedClasses = [];
+
+        $realSubPath = substr($filePath, strlen($basePath) + 1);
+        $dotPosition = strrpos($realSubPath, '.');
+        $realSubPath = substr($realSubPath, 0, $dotPosition === false ? PHP_INT_MAX : $dotPosition);
+
+        foreach ($classes as $class) {
+            // silently skip if ns doesn't have common root
+            if ('' !== $baseNamespace && 0 !== strpos($class, $baseNamespace)) {
+                continue;
+            }
+            // transform class name to file path and validate
+            if ('psr-0' === $namespaceType) {
+                $namespaceLength = strrpos($class, '\\');
+                if (false !== $namespaceLength) {
+                    $namespace = substr($class, 0, $namespaceLength + 1);
+                    $className = substr($class, $namespaceLength + 1);
+                    $subPath = str_replace('\\', DIRECTORY_SEPARATOR, $namespace)
+                        . str_replace('_', DIRECTORY_SEPARATOR, $className);
+                } else {
+                    $subPath = str_replace('_', DIRECTORY_SEPARATOR, $class);
+                }
+            } elseif ('psr-4' === $namespaceType) {
+                $subNamespace = ('' !== $baseNamespace) ? substr($class, strlen($baseNamespace)) : $class;
+                $subPath = str_replace('\\', DIRECTORY_SEPARATOR, $subNamespace);
+            } else {
+                throw new \RuntimeException("namespaceType must be psr-0 or psr-4, $namespaceType given");
+            }
+            if ($subPath === $realSubPath) {
+                $validClasses[] = $class;
+            } else {
+                $rejectedClasses[] = $class;
+            }
+        }
+        // warn only if no valid classes, else silently skip invalid
+        if (empty($validClasses)) {
+            foreach ($rejectedClasses as $class) {
+                if ($io) {
+                    $io->writeError("<warning>Class $class located in " . Preg::replace('{^' . preg_quote(getcwd()) . '}', '.', $filePath, 1) . " does not comply with $namespaceType autoloading standard. Skipping.</warning>");
+                }
+            }
+
+            return [];
+        }
+
+        return $validClasses;
+    }
+
+    /**
+     * Extract the classes in the given file
+     *
+     * @param  string            $path The file to check
+     * @throws \RuntimeException
+     * @return array<int, class-string> The found classes
+     */
+    private static function findClasses($path)
+    {
+        $extraTypes = self::getExtraTypes();
+
+        // Use @ here instead of Silencer to actively suppress 'unhelpful' output
+        // @link https://github.com/composer/composer/pull/4886
+        $contents = @php_strip_whitespace($path);
+        if (!$contents) {
+            if (!file_exists($path)) {
+                $message = 'File at "%s" does not exist, check your classmap definitions';
+            } elseif (!is_readable($path)) {
+                $message = 'File at "%s" is not readable, check its permissions';
+            } elseif ('' === trim((string) file_get_contents($path))) {
+                // The input file was really empty and thus contains no classes
+                return [];
+            } else {
+                $message = 'File at "%s" could not be parsed as PHP, it may be binary or corrupted';
+            }
+            $error = error_get_last();
+            if (isset($error['message'])) {
+                $message .= PHP_EOL . 'The following message may be helpful:' . PHP_EOL . $error['message'];
+            }
+            throw new \RuntimeException(sprintf($message, $path));
+        }
+
+        // return early if there is no chance of matching anything in this file
+        Preg::matchAll('{\b(?:class|interface|trait' . $extraTypes . ')\s}i', $contents, $matches);
+        if (!$matches) {
+            return [];
+        }
+
+        // strip heredocs/nowdocs
+        $contents = preg_replace('{<<<[ \t]*([\'"]?)(\w+)\\1(?:\r\n|\n|\r)(?:.*?)(?:\r\n|\n|\r)(?:\s*)\\2(?=\s+|[;,.)])}s', 'null', $contents);
+        // strip strings
+        $contents = preg_replace('{"[^"\\\\]*+(\\\\.[^"\\\\]*+)*+"|\'[^\'\\\\]*+(\\\\.[^\'\\\\]*+)*+\'}s', 'null', $contents);
+        // strip leading non-php code if needed
+        if (substr($contents, 0, 2) !== '<?') {
+            $contents = preg_replace('{^.+?<\?}s', '<?', $contents, 1, $replacements);
+            if ($replacements === 0) {
+                return [];
+            }
+        }
+        // strip non-php blocks in the file
+        $contents = preg_replace('{\?>(?:[^<]++|<(?!\?))*+<\?}s', '?><?', $contents);
+        // strip trailing non-php code if needed
+        $pos = strrpos($contents, '?>');
+        if (false !== $pos && false === strpos(substr($contents, $pos), '<?')) {
+            $contents = substr($contents, 0, $pos);
+        }
+        // strip comments if short open tags are in the file
+        if (preg_match('{(<\?)(?!(php|hh))}i', $contents)) {
+            $contents = preg_replace('{//.* | /\*(?:[^*]++|\*(?!/))*\*/}x', '', $contents);
+        }
+
+        Preg::matchAll('{
+            (?:
+                 \b(?<![\$:>])(?P<type>class|interface|trait' . $extraTypes . ') \s++ (?P<name>[a-zA-Z_\x7f-\xff:][a-zA-Z0-9_\x7f-\xff:\-]*+)
+               | \b(?<![\$:>])(?P<ns>namespace) (?P<nsname>\s++[a-zA-Z_\x7f-\xff][a-zA-Z0-9_\x7f-\xff]*+(?:\s*+\\\\\s*+[a-zA-Z_\x7f-\xff][a-zA-Z0-9_\x7f-\xff]*+)*+)? \s*+ [\{;]
+            )
+        }ix', $contents, $matches);
+
+        $classes = [];
+        $namespace = '';
+
+        for ($i = 0, $len = count($matches['type']); $i < $len; $i++) {
+            if (!empty($matches['ns'][$i])) {
+                $namespace = str_replace([' ', "\t", "\r", "\n"], '', $matches['nsname'][$i]) . '\\';
+            } else {
+                $name = $matches['name'][$i];
+                // skip anon classes extending/implementing
+                if ($name === 'extends' || $name === 'implements') {
+                    continue;
+                }
+                if ($name[0] === ':') {
+                    // This is an XHP class, https://github.com/facebook/xhp
+                    $name = 'xhp' . substr(str_replace(['-', ':'], ['_', '__'], $name), 1);
+                } elseif ($matches['type'][$i] === 'enum') {
+                    // something like:
+                    //   enum Foo: int { HERP = '123'; }
+                    // The regex above captures the colon, which isn't part of
+                    // the class name.
+                    // or:
+                    //   enum Foo:int { HERP = '123'; }
+                    // The regex above captures the colon and type, which isn't part of
+                    // the class name.
+                    $colonPos = strrpos($name, ':');
+                    if (false !== $colonPos) {
+                        $name = substr($name, 0, $colonPos);
+                    }
+                }
+                $classes[] = ltrim($namespace . $name, '\\');
+            }
+        }
+
+        return $classes;
+    }
+
+    /**
+     * @return string
+     */
+    private static function getExtraTypes()
+    {
+        static $extraTypes = null;
+
+        if (null === $extraTypes) {
+            $extraTypes = '';
+            if (PHP_VERSION_ID >= 80100 || (defined('HHVM_VERSION') && version_compare(HHVM_VERSION, '3.3', '>='))) {
+                $extraTypes .= '|enum';
+            }
+
+            self::setTypeConfig(array_merge(['class', 'interface', 'trait'], array_filter(explode('|', $extraTypes))));
+        }
+
+        return $extraTypes;
+    }
+
+    /**
+     * @param string[] $types
+     * @return void
+     *
+     * @see \Composer\Autoload\PhpFileCleaner
+     * @author Jordi Boggiano <j.boggiano@seld.be>
+     * @author Johannes M. Schmitt <schmittjoh@gmail.com>
+     */
+    private static function setTypeConfig($types)
+    {
+        foreach ($types as $type) {
+            self::$typeConfig[$type[0]] = [
+                'name' => $type,
+                'length' => strlen($type),
+                'pattern' => '{.\b(?<![\$:>])' . $type . '\s++[a-zA-Z_\x7f-\xff:][a-zA-Z0-9_\x7f-\xff:\-]*+}Ais',
+            ];
+        }
+
+        self::$restPattern = '{[^?"\'</' . implode('', array_keys(self::$typeConfig)) . ']+}A';
+    }
+}

vendor/barryvdh/laravel-ide-helper/src/Console/EloquentCommand.php

@@ -0,0 +1,62 @@
+<?php
+
+/**
+ * Laravel IDE Helper Generator - Eloquent Model Mixin
+ *
+ * @author    Charles A. Peterson <artistan@gmail.com>
+ * @copyright 2017 Charles A. Peterson / Fruitcake Studio (http://www.fruitcakestudio.nl)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      https://github.com/barryvdh/laravel-ide-helper
+ */
+
+namespace Barryvdh\LaravelIdeHelper\Console;
+
+use Barryvdh\LaravelIdeHelper\Eloquent;
+use Illuminate\Console\Command;
+use Illuminate\Filesystem\Filesystem;
+
+/**
+ * A command to add \Eloquent mixin to Eloquent\Model
+ *
+ * @author Charles A. Peterson <artistan@gmail.com>
+ */
+class EloquentCommand extends Command
+{
+    /**
+     * The console command name.
+     *
+     * @var string
+     */
+    protected $name = 'ide-helper:eloquent';
+
+    /**
+     * @var Filesystem $files
+     */
+    protected $files;
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Add \Eloquent helper to \Eloquent\Model';
+
+    /**
+     * @param Filesystem $files
+     */
+    public function __construct(Filesystem $files)
+    {
+        parent::__construct();
+        $this->files = $files;
+    }
+
+    /**
+     * Execute the console command.
+     *
+     * @return void
+     */
+    public function handle()
+    {
+        Eloquent::writeEloquentModelHelper($this, $this->files);
+    }
+}

vendor/barryvdh/laravel-ide-helper/src/Console/GeneratorCommand.php

@@ -0,0 +1,174 @@
+<?php
+
+/**
+ * Laravel IDE Helper Generator
+ *
+ * @author    Barry vd. Heuvel <barryvdh@gmail.com>
+ * @copyright 2014 Barry vd. Heuvel / Fruitcake Studio (http://www.fruitcakestudio.nl)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      https://github.com/barryvdh/laravel-ide-helper
+ */
+
+namespace Barryvdh\LaravelIdeHelper\Console;
+
+use Barryvdh\LaravelIdeHelper\Eloquent;
+use Barryvdh\LaravelIdeHelper\Generator;
+use Illuminate\Console\Command;
+use Illuminate\Filesystem\Filesystem;
+use Symfony\Component\Console\Input\InputArgument;
+use Symfony\Component\Console\Input\InputOption;
+
+/**
+ * A command to generate autocomplete information for your IDE
+ *
+ * @author Barry vd. Heuvel <barryvdh@gmail.com>
+ */
+class GeneratorCommand extends Command
+{
+    /**
+     * The console command name.
+     *
+     * @var string
+     */
+    protected $name = 'ide-helper:generate';
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Generate a new IDE Helper file.';
+
+    /** @var \Illuminate\Config\Repository */
+    protected $config;
+
+    /** @var \Illuminate\Filesystem\Filesystem */
+    protected $files;
+
+    /** @var \Illuminate\View\Factory */
+    protected $view;
+
+    protected $onlyExtend;
+
+
+    /**
+     *
+     * @param \Illuminate\Config\Repository $config
+     * @param \Illuminate\Filesystem\Filesystem $files
+     * @param \Illuminate\View\Factory $view
+     */
+    public function __construct(
+        /*ConfigRepository */
+        $config,
+        Filesystem $files,
+        /* Illuminate\View\Factory */
+        $view
+    ) {
+        $this->config = $config;
+        $this->files = $files;
+        $this->view = $view;
+        parent::__construct();
+    }
+
+    /**
+     * Execute the console command.
+     *
+     * @return void
+     */
+    public function handle()
+    {
+        if (
+            file_exists(base_path() . '/vendor/compiled.php') ||
+            file_exists(base_path() . '/bootstrap/cache/compiled.php') ||
+            file_exists(base_path() . '/storage/framework/compiled.php')
+        ) {
+            $this->error(
+                'Error generating IDE Helper: first delete your compiled file (php artisan clear-compiled)'
+            );
+            return;
+        }
+
+        $filename = $this->argument('filename');
+
+        // Add the php extension if missing
+        // This is a backwards-compatible shim and can be removed in the future
+        if (substr($filename, -4, 4) !== '.php') {
+            $filename .= '.php';
+        }
+
+        if ($this->option('memory')) {
+            $this->useMemoryDriver();
+        }
+
+
+        $helpers = '';
+        if ($this->option('helpers') || ($this->config->get('ide-helper.include_helpers'))) {
+            foreach ($this->config->get('ide-helper.helper_files', []) as $helper) {
+                if (file_exists($helper)) {
+                    $helpers .= str_replace(['<?php', '?>'], '', $this->files->get($helper));
+                }
+            }
+        } else {
+            $helpers = '';
+        }
+
+        $generator = new Generator($this->config, $this->view, $this->getOutput(), $helpers);
+        $content = $generator->generate();
+        $written = $this->files->put($filename, $content);
+
+        if ($written !== false) {
+            $this->info("A new helper file was written to $filename");
+
+            if ($this->option('write_mixins')) {
+                Eloquent::writeEloquentModelHelper($this, $this->files);
+            }
+        } else {
+            $this->error("The helper file could not be created at $filename");
+        }
+    }
+
+    protected function useMemoryDriver()
+    {
+        //Use a sqlite database in memory, to avoid connection errors on Database facades
+        $this->config->set(
+            'database.connections.sqlite',
+            [
+                'driver' => 'sqlite',
+                'database' => ':memory:',
+            ]
+        );
+        $this->config->set('database.default', 'sqlite');
+    }
+
+    /**
+     * Get the console command arguments.
+     *
+     * @return array
+     */
+    protected function getArguments()
+    {
+        $filename = $this->config->get('ide-helper.filename');
+
+        return [
+            [
+                'filename', InputArgument::OPTIONAL, 'The path to the helper file', $filename,
+            ],
+        ];
+    }
+
+    /**
+     * Get the console command options.
+     *
+     * @return array
+     */
+    protected function getOptions()
+    {
+        $writeMixins = $this->config->get('ide-helper.write_eloquent_model_mixins');
+
+        return [
+            ['write_mixins', 'W', InputOption::VALUE_OPTIONAL, 'Write mixins to Laravel Model?', $writeMixins],
+            ['helpers', 'H', InputOption::VALUE_NONE, 'Include the helper files'],
+            ['memory', 'M', InputOption::VALUE_NONE, 'Use sqlite memory driver'],
+        ];
+    }
+}

vendor/barryvdh/laravel-ide-helper/src/Console/MetaCommand.php

@@ -0,0 +1,181 @@
+<?php
+
+/**
+ * Laravel IDE Helper Generator
+ *
+ * @author    Barry vd. Heuvel <barryvdh@gmail.com>
+ * @copyright 2015 Barry vd. Heuvel / Fruitcake Studio (http://www.fruitcakestudio.nl)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      https://github.com/barryvdh/laravel-ide-helper
+ */
+
+namespace Barryvdh\LaravelIdeHelper\Console;
+
+use Barryvdh\LaravelIdeHelper\Factories;
+use Illuminate\Console\Command;
+use Symfony\Component\Console\Input\InputOption;
+use Symfony\Component\Console\Output\OutputInterface;
+
+/**
+ * A command to generate phpstorm meta data
+ *
+ * @author Barry vd. Heuvel <barryvdh@gmail.com>
+ */
+class MetaCommand extends Command
+{
+    /**
+     * The console command name.
+     *
+     * @var string
+     */
+    protected $name = 'ide-helper:meta';
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Generate metadata for PhpStorm';
+
+    /** @var \Illuminate\Contracts\Filesystem\Filesystem */
+    protected $files;
+
+    /** @var \Illuminate\Contracts\View\Factory */
+    protected $view;
+
+    /** @var \Illuminate\Contracts\Config\Repository */
+    protected $config;
+
+    protected $methods = [
+      'new \Illuminate\Contracts\Container\Container',
+      '\Illuminate\Container\Container::makeWith(0)',
+      '\Illuminate\Contracts\Container\Container::get(0)',
+      '\Illuminate\Contracts\Container\Container::make(0)',
+      '\Illuminate\Contracts\Container\Container::makeWith(0)',
+      '\App::get(0)',
+      '\App::make(0)',
+      '\App::makeWith(0)',
+      '\app(0)',
+      '\resolve(0)',
+      '\Psr\Container\ContainerInterface::get(0)',
+    ];
+
+    /**
+     *
+     * @param \Illuminate\Contracts\Filesystem\Filesystem $files
+     * @param \Illuminate\Contracts\View\Factory $view
+     * @param \Illuminate\Contracts\Config\Repository $config
+     */
+    public function __construct($files, $view, $config)
+    {
+        $this->files = $files;
+        $this->view = $view;
+        $this->config = $config;
+        parent::__construct();
+    }
+
+    /**
+     * Execute the console command.
+     *
+     * @return void
+     */
+    public function handle()
+    {
+        // Needs to run before exception handler is registered
+        $factories = $this->config->get('ide-helper.include_factory_builders') ? Factories::all() : [];
+
+        $ourAutoloader = $this->registerClassAutoloadExceptions();
+
+        $bindings = [];
+        foreach ($this->getAbstracts() as $abstract) {
+            // Validator and seeder cause problems
+            if (in_array($abstract, ['validator', 'seeder'])) {
+                continue;
+            }
+
+            try {
+                $concrete = $this->laravel->make($abstract);
+                $reflectionClass = new \ReflectionClass($concrete);
+                if (is_object($concrete) && !$reflectionClass->isAnonymous()) {
+                    $bindings[$abstract] = get_class($concrete);
+                }
+            } catch (\Throwable $e) {
+                if ($this->output->getVerbosity() >= OutputInterface::VERBOSITY_VERBOSE) {
+                    $this->comment("Cannot make '$abstract': " . $e->getMessage());
+                }
+            }
+        }
+
+        $this->unregisterClassAutoloadExceptions($ourAutoloader);
+
+        $content = $this->view->make('meta', [
+          'bindings' => $bindings,
+          'methods' => $this->methods,
+          'factories' => $factories,
+        ])->render();
+
+        $filename = $this->option('filename');
+        $written = $this->files->put($filename, $content);
+
+        if ($written !== false) {
+            $this->info("A new meta file was written to $filename");
+        } else {
+            $this->error("The meta file could not be created at $filename");
+        }
+    }
+
+    /**
+     * Get a list of abstracts from the Laravel Application.
+     *
+     * @return array
+     */
+    protected function getAbstracts()
+    {
+        $abstracts = $this->laravel->getBindings();
+
+        // Return the abstract names only
+        $keys = array_keys($abstracts);
+
+        sort($keys);
+
+        return $keys;
+    }
+
+    /**
+     * Register an autoloader the throws exceptions when a class is not found.
+     *
+     * @return callable
+     */
+    protected function registerClassAutoloadExceptions(): callable
+    {
+        $autoloader = function ($class) {
+            throw new \ReflectionException("Class '$class' not found.");
+        };
+        spl_autoload_register($autoloader);
+        return $autoloader;
+    }
+
+    /**
+     * Get the console command options.
+     *
+     * @return array
+     */
+    protected function getOptions()
+    {
+        $filename = $this->config->get('ide-helper.meta_filename');
+
+        return [
+            ['filename', 'F', InputOption::VALUE_OPTIONAL, 'The path to the meta file', $filename],
+        ];
+    }
+
+    /**
+     * Remove our custom autoloader that we pushed onto the autoload stack
+     *
+     * @param callable $ourAutoloader
+     */
+    private function unregisterClassAutoloadExceptions(callable $ourAutoloader): void
+    {
+        spl_autoload_unregister($ourAutoloader);
+    }
+}

vendor/barryvdh/laravel-ide-helper/src/Contracts/ModelHookInterface.php

@@ -0,0 +1,11 @@
+<?php
+
+namespace Barryvdh\LaravelIdeHelper\Contracts;
+
+use Barryvdh\LaravelIdeHelper\Console\ModelsCommand;
+use Illuminate\Database\Eloquent\Model;
+
+interface ModelHookInterface
+{
+    public function run(ModelsCommand $command, Model $model): void;
+}

vendor/barryvdh/laravel-ide-helper/src/Eloquent.php

@@ -0,0 +1,113 @@
+<?php
+
+/**
+ * Laravel IDE Helper to add \Eloquent mixin to Eloquent\Model
+ *
+ * @author Charles A. Peterson <artistan@gmail.com>
+ */
+
+namespace Barryvdh\LaravelIdeHelper;
+
+use Barryvdh\Reflection\DocBlock;
+use Barryvdh\Reflection\DocBlock\Context;
+use Barryvdh\Reflection\DocBlock\Serializer as DocBlockSerializer;
+use Barryvdh\Reflection\DocBlock\Tag;
+use Illuminate\Console\Command;
+use Illuminate\Filesystem\Filesystem;
+
+class Eloquent
+{
+    /**
+     * Write mixin helper to the Eloquent\Model
+     * This is needed since laravel/framework v5.4.29
+     *
+     * @param Command    $command
+     * @param Filesystem $files
+     *
+     * @return void
+     */
+    public static function writeEloquentModelHelper(Command $command, Filesystem $files)
+    {
+        $class = 'Illuminate\Database\Eloquent\Model';
+
+        $reflection  = new \ReflectionClass($class);
+        $namespace   = $reflection->getNamespaceName();
+        $originalDoc = $reflection->getDocComment();
+
+        if (!$originalDoc) {
+            $command->info('Unexpected no document on ' . $class);
+        }
+        $phpdoc = new DocBlock($reflection, new Context($namespace));
+
+        $mixins = $phpdoc->getTagsByName('mixin');
+        $expectedMixins = [
+            '\Eloquent'                             => false,
+            '\Illuminate\Database\Eloquent\Builder' => false,
+            '\Illuminate\Database\Query\Builder'    => false,
+        ];
+
+        foreach ($mixins as $m) {
+            $mixin = $m->getContent();
+
+            if (isset($expectedMixins[$mixin])) {
+                $command->info('Tag Exists: @mixin ' . $mixin . ' in ' . $class);
+
+                $expectedMixins[$mixin] = true;
+            }
+        }
+
+        $changed = false;
+        foreach ($expectedMixins as $expectedMixin => $present) {
+            if ($present === false) {
+                $phpdoc->appendTag(Tag::createInstance('@mixin ' . $expectedMixin, $phpdoc));
+
+                $changed = true;
+            }
+        }
+
+        // If nothing's changed, stop here.
+        if (!$changed) {
+            return;
+        }
+
+        $serializer = new DocBlockSerializer();
+        $serializer->getDocComment($phpdoc);
+        $docComment = $serializer->getDocComment($phpdoc);
+
+        /*
+            The new DocBlock is appended to the beginning of the class declaration.
+            Since there is no DocBlock, the declaration is used as a guide.
+        */
+        if (!$originalDoc) {
+            $originalDoc = 'abstract class Model implements';
+
+            $docComment .= "\nabstract class Model implements";
+        }
+
+        $filename = $reflection->getFileName();
+        if (!$filename) {
+            $command->error('Filename not found ' . $class);
+            return;
+        }
+
+        $contents = $files->get($filename);
+        if (!$contents) {
+            $command->error('No file contents found ' . $filename);
+            return;
+        }
+
+        $count = 0;
+        $contents = str_replace($originalDoc, $docComment, $contents, $count);
+        if ($count <= 0) {
+            $command->error('Content did not change ' . $contents);
+            return;
+        }
+
+        if (!$files->put($filename, $contents)) {
+            $command->error('File write failed to ' . $filename);
+            return;
+        }
+
+        $command->info('Wrote expected docblock to ' . $filename);
+    }
+}

vendor/barryvdh/laravel-ide-helper/src/Factories.php

@@ -0,0 +1,36 @@
+<?php
+
+namespace Barryvdh\LaravelIdeHelper;
+
+use Exception;
+use Illuminate\Database\Eloquent\Factory;
+use ReflectionClass;
+
+class Factories
+{
+    public static function all()
+    {
+        $factories = [];
+
+        if (static::isLaravelSevenOrLower()) {
+            $factory = app(Factory::class);
+
+            $definitions = (new ReflectionClass(Factory::class))->getProperty('definitions');
+            $definitions->setAccessible(true);
+
+            foreach ($definitions->getValue($factory) as $factory_target => $config) {
+                try {
+                    $factories[] = new ReflectionClass($factory_target);
+                } catch (Exception $exception) {
+                }
+            }
+        }
+
+        return $factories;
+    }
+
+    protected static function isLaravelSevenOrLower()
+    {
+        return class_exists('Illuminate\Database\Eloquent\Factory');
+    }
+}

vendor/barryvdh/laravel-ide-helper/src/Generator.php

@@ -0,0 +1,313 @@
+<?php
+
+/**
+ * Laravel IDE Helper Generator
+ *
+ * @author    Barry vd. Heuvel <barryvdh@gmail.com>
+ * @copyright 2014 Barry vd. Heuvel / Fruitcake Studio (http://www.fruitcakestudio.nl)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      https://github.com/barryvdh/laravel-ide-helper
+ */
+
+namespace Barryvdh\LaravelIdeHelper;
+
+use Illuminate\Foundation\AliasLoader;
+use Illuminate\Support\Collection;
+use Illuminate\Support\Str;
+use Illuminate\Support\Traits\Macroable;
+use ReflectionClass;
+use Symfony\Component\Console\Output\OutputInterface;
+
+class Generator
+{
+    /** @var \Illuminate\Config\Repository */
+    protected $config;
+
+    /** @var \Illuminate\View\Factory */
+    protected $view;
+
+    /** @var \Symfony\Component\Console\Output\OutputInterface */
+    protected $output;
+
+    protected $extra = [];
+    protected $magic = [];
+    protected $interfaces = [];
+    protected $helpers;
+
+    /**
+     * @param \Illuminate\Config\Repository $config
+     * @param \Illuminate\View\Factory $view
+     * @param \Symfony\Component\Console\Output\OutputInterface $output
+     * @param string $helpers
+     */
+    public function __construct(
+        /*ConfigRepository */
+        $config,
+        /* Illuminate\View\Factory */
+        $view,
+        OutputInterface $output = null,
+        $helpers = ''
+    ) {
+        $this->config = $config;
+        $this->view = $view;
+
+        // Find the drivers to add to the extra/interfaces
+        $this->detectDrivers();
+
+        $this->extra = array_merge($this->extra, $this->config->get('ide-helper.extra'), []);
+        $this->magic = array_merge($this->magic, $this->config->get('ide-helper.magic'), []);
+        $this->interfaces = array_merge($this->interfaces, $this->config->get('ide-helper.interfaces'), []);
+        // Make all interface classes absolute
+        foreach ($this->interfaces as &$interface) {
+            $interface = '\\' . ltrim($interface, '\\');
+        }
+        $this->helpers = $helpers;
+    }
+
+    /**
+     * Generate the helper file contents;
+     *
+     * @return string;
+     */
+    public function generate()
+    {
+        $app = app();
+        return $this->view->make('helper')
+            ->with('namespaces_by_extends_ns', $this->getAliasesByExtendsNamespace())
+            ->with('namespaces_by_alias_ns', $this->getAliasesByAliasNamespace())
+            ->with('helpers', $this->helpers)
+            ->with('version', $app->version())
+            ->with('include_fluent', $this->config->get('ide-helper.include_fluent', true))
+            ->with('factories', $this->config->get('ide-helper.include_factory_builders') ? Factories::all() : [])
+            ->render();
+    }
+
+    protected function detectDrivers()
+    {
+        $defaultUserModel = config('auth.providers.users.model', config('auth.model', 'App\User'));
+        $this->interfaces['\Illuminate\Contracts\Auth\Authenticatable'] = $defaultUserModel;
+
+        try {
+            if (
+                class_exists('Auth') && is_a('Auth', '\Illuminate\Support\Facades\Auth', true)
+                && app()->bound('auth')
+            ) {
+                $class = get_class(\Auth::guard());
+                $this->extra['Auth'] = [$class];
+                $this->interfaces['\Illuminate\Auth\UserProviderInterface'] = $class;
+            }
+        } catch (\Exception $e) {
+        }
+
+        try {
+            if (class_exists('DB') && is_a('DB', '\Illuminate\Support\Facades\DB', true)) {
+                $class = get_class(\DB::connection());
+                $this->extra['DB'] = [$class];
+                $this->interfaces['\Illuminate\Database\ConnectionInterface'] = $class;
+            }
+        } catch (\Exception $e) {
+        }
+
+        try {
+            if (class_exists('Cache') && is_a('Cache', '\Illuminate\Support\Facades\Cache', true)) {
+                $driver = get_class(\Cache::driver());
+                $store = get_class(\Cache::getStore());
+                $this->extra['Cache'] = [$driver, $store];
+                $this->interfaces['\Illuminate\Cache\StoreInterface'] = $store;
+            }
+        } catch (\Exception $e) {
+        }
+
+        try {
+            if (class_exists('Queue') && is_a('Queue', '\Illuminate\Support\Facades\Queue', true)) {
+                $class = get_class(\Queue::connection());
+                $this->extra['Queue'] = [$class];
+                $this->interfaces['\Illuminate\Queue\QueueInterface'] = $class;
+            }
+        } catch (\Exception $e) {
+        }
+
+        try {
+            if (class_exists('SSH') && is_a('SSH', '\Illuminate\Support\Facades\SSH', true)) {
+                $class = get_class(\SSH::connection());
+                $this->extra['SSH'] = [$class];
+                $this->interfaces['\Illuminate\Remote\ConnectionInterface'] = $class;
+            }
+        } catch (\Exception $e) {
+        }
+
+        try {
+            if (class_exists('Storage') && is_a('Storage', '\Illuminate\Support\Facades\Storage', true)) {
+                $class = get_class(\Storage::disk());
+                $this->extra['Storage'] = [$class];
+                $this->interfaces['\Illuminate\Contracts\Filesystem\Filesystem'] = $class;
+            }
+        } catch (\Exception $e) {
+        }
+    }
+
+    /**
+     * Find all aliases that are valid for us to render
+     *
+     * @return Collection
+     */
+    protected function getValidAliases()
+    {
+        $aliases = new Collection();
+
+        // Get all aliases
+        foreach ($this->getAliases() as $name => $facade) {
+            // Skip the Redis facade, if not available (otherwise Fatal PHP Error)
+            if ($facade == 'Illuminate\Support\Facades\Redis' && $name == 'Redis' && !class_exists('Predis\Client')) {
+                continue;
+            }
+
+            $magicMethods = array_key_exists($name, $this->magic) ? $this->magic[$name] : [];
+            $alias = new Alias($this->config, $name, $facade, $magicMethods, $this->interfaces);
+            if ($alias->isValid()) {
+                //Add extra methods, from other classes (magic static calls)
+                if (array_key_exists($name, $this->extra)) {
+                    $alias->addClass($this->extra[$name]);
+                }
+
+                $aliases[] = $alias;
+            }
+        }
+
+        return $aliases;
+    }
+
+    /**
+     * Regroup aliases by namespace of extended classes
+     *
+     * @return Collection
+     */
+    protected function getAliasesByExtendsNamespace()
+    {
+        $aliases = $this->getValidAliases();
+
+        $this->addMacroableClasses($aliases);
+
+        return $aliases->groupBy(function (Alias $alias) {
+            return $alias->getExtendsNamespace();
+        });
+    }
+
+    /**
+     * Regroup aliases by namespace of alias
+     *
+     * @return Collection
+     */
+    protected function getAliasesByAliasNamespace()
+    {
+        return $this->getValidAliases()->groupBy(function (Alias $alias) {
+            return $alias->getNamespace();
+        });
+    }
+
+    protected function getAliases()
+    {
+        // For Laravel, use the AliasLoader
+        if (class_exists('Illuminate\Foundation\AliasLoader')) {
+            return AliasLoader::getInstance()->getAliases();
+        }
+
+        $facades = [
+          'App' => 'Illuminate\Support\Facades\App',
+          'Auth' => 'Illuminate\Support\Facades\Auth',
+          'Bus' => 'Illuminate\Support\Facades\Bus',
+          'DB' => 'Illuminate\Support\Facades\DB',
+          'Cache' => 'Illuminate\Support\Facades\Cache',
+          'Cookie' => 'Illuminate\Support\Facades\Cookie',
+          'Crypt' => 'Illuminate\Support\Facades\Crypt',
+          'Event' => 'Illuminate\Support\Facades\Event',
+          'Hash' => 'Illuminate\Support\Facades\Hash',
+          'Log' => 'Illuminate\Support\Facades\Log',
+          'Mail' => 'Illuminate\Support\Facades\Mail',
+          'Queue' => 'Illuminate\Support\Facades\Queue',
+          'Request' => 'Illuminate\Support\Facades\Request',
+          'Schema' => 'Illuminate\Support\Facades\Schema',
+          'Session' => 'Illuminate\Support\Facades\Session',
+          'Storage' => 'Illuminate\Support\Facades\Storage',
+          'Validator' => 'Illuminate\Support\Facades\Validator',
+          'Gate' => 'Illuminate\Support\Facades\Gate',
+        ];
+
+        $facades = array_merge($facades, $this->config->get('app.aliases', []));
+
+        // Only return the ones that actually exist
+        return array_filter(
+            $facades,
+            function ($alias) {
+                return class_exists($alias);
+            },
+            ARRAY_FILTER_USE_KEY
+        );
+    }
+
+    /**
+     * Write a string as error output.
+     *
+     * @param  string  $string
+     * @return void
+     */
+    protected function error($string)
+    {
+        if ($this->output) {
+            $this->output->writeln("<error>$string</error>");
+        } else {
+            echo $string . "\r\n";
+        }
+    }
+
+    /**
+     * Add all macroable classes which are not already loaded as an alias and have defined macros.
+     *
+     * @param Collection $aliases
+     */
+    protected function addMacroableClasses(Collection $aliases)
+    {
+        $macroable = $this->getMacroableClasses($aliases);
+
+        foreach ($macroable as $class) {
+            $reflection = new ReflectionClass($class);
+
+            if (!$reflection->getStaticProperties()['macros']) {
+                continue;
+            }
+
+            $aliases[] = new Alias($this->config, $class, $class, [], $this->interfaces);
+        }
+    }
+
+    /**
+     * Get all loaded macroable classes which are not loaded as an alias.
+     *
+     * @param Collection $aliases
+     * @return Collection
+     */
+    protected function getMacroableClasses(Collection $aliases)
+    {
+        return (new Collection(get_declared_classes()))
+            ->filter(function ($class) {
+                $reflection = new ReflectionClass($class);
+
+                // Filter out internal classes and class aliases
+                return !$reflection->isInternal() && $reflection->getName() === $class;
+            })
+            ->filter(function ($class) {
+                $traits = class_uses_recursive($class);
+
+                // Filter only classes with the macroable trait
+                return isset($traits[Macroable::class]);
+            })
+            ->filter(function ($class) use ($aliases) {
+                $class = Str::start($class, '\\');
+
+                // Filter out aliases
+                return !$aliases->first(function (Alias $alias) use ($class) {
+                    return $alias->getExtends() === $class;
+                });
+            });
+    }
+}

vendor/barryvdh/laravel-ide-helper/src/IdeHelperServiceProvider.php

@@ -0,0 +1,130 @@
+<?php
+
+/**
+ * Laravel IDE Helper Generator
+ *
+ * @author    Barry vd. Heuvel <barryvdh@gmail.com>
+ * @copyright 2014 Barry vd. Heuvel / Fruitcake Studio (http://www.fruitcakestudio.nl)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      https://github.com/barryvdh/laravel-ide-helper
+ */
+
+namespace Barryvdh\LaravelIdeHelper;
+
+use Barryvdh\LaravelIdeHelper\Console\EloquentCommand;
+use Barryvdh\LaravelIdeHelper\Console\GeneratorCommand;
+use Barryvdh\LaravelIdeHelper\Console\MetaCommand;
+use Barryvdh\LaravelIdeHelper\Console\ModelsCommand;
+use Barryvdh\LaravelIdeHelper\Listeners\GenerateModelHelper;
+use Illuminate\Console\Events\CommandFinished;
+use Illuminate\Contracts\Support\DeferrableProvider;
+use Illuminate\Database\Events\MigrationsEnded;
+use Illuminate\Support\ServiceProvider;
+use Illuminate\View\Engines\EngineResolver;
+use Illuminate\View\Engines\PhpEngine;
+use Illuminate\View\Factory;
+use Illuminate\View\FileViewFinder;
+
+class IdeHelperServiceProvider extends ServiceProvider implements DeferrableProvider
+{
+    /**
+     * Bootstrap the application events.
+     *
+     * @return void
+     */
+    public function boot()
+    {
+        if (!$this->app->runningUnitTests() && $this->app['config']->get('ide-helper.post_migrate', [])) {
+            $this->app['events']->listen(CommandFinished::class, GenerateModelHelper::class);
+            $this->app['events']->listen(MigrationsEnded::class, function () {
+                GenerateModelHelper::$shouldRun = true;
+            });
+        }
+
+        if ($this->app->has('view')) {
+            $viewPath = __DIR__ . '/../resources/views';
+            $this->loadViewsFrom($viewPath, 'ide-helper');
+        }
+
+        $configPath = __DIR__ . '/../config/ide-helper.php';
+        if (function_exists('config_path')) {
+            $publishPath = config_path('ide-helper.php');
+        } else {
+            $publishPath = base_path('config/ide-helper.php');
+        }
+        $this->publishes([$configPath => $publishPath], 'config');
+    }
+
+    /**
+     * Register the service provider.
+     *
+     * @return void
+     */
+    public function register()
+    {
+        $configPath = __DIR__ . '/../config/ide-helper.php';
+        $this->mergeConfigFrom($configPath, 'ide-helper');
+        $localViewFactory = $this->createLocalViewFactory();
+
+        $this->app->singleton(
+            'command.ide-helper.generate',
+            function ($app) use ($localViewFactory) {
+                return new GeneratorCommand($app['config'], $app['files'], $localViewFactory);
+            }
+        );
+
+        $this->app->singleton(
+            'command.ide-helper.models',
+            function ($app) {
+                return new ModelsCommand($app['files']);
+            }
+        );
+
+        $this->app->singleton(
+            'command.ide-helper.meta',
+            function ($app) use ($localViewFactory) {
+                return new MetaCommand($app['files'], $localViewFactory, $app['config']);
+            }
+        );
+
+        $this->app->singleton(
+            'command.ide-helper.eloquent',
+            function ($app) {
+                return new EloquentCommand($app['files']);
+            }
+        );
+
+        $this->commands(
+            'command.ide-helper.generate',
+            'command.ide-helper.models',
+            'command.ide-helper.meta',
+            'command.ide-helper.eloquent'
+        );
+    }
+
+    /**
+     * Get the services provided by the provider.
+     *
+     * @return array
+     */
+    public function provides()
+    {
+        return ['command.ide-helper.generate', 'command.ide-helper.models'];
+    }
+
+    /**
+     * @return Factory
+     */
+    private function createLocalViewFactory()
+    {
+        $resolver = new EngineResolver();
+        $resolver->register('php', function () {
+            return new PhpEngine($this->app['files']);
+        });
+        $finder = new FileViewFinder($this->app['files'], [__DIR__ . '/../resources/views']);
+        $factory = new Factory($resolver, $finder, $this->app['events']);
+        $factory->addExtension('php', 'php');
+
+        return $factory;
+    }
+}

vendor/barryvdh/laravel-ide-helper/src/Listeners/GenerateModelHelper.php

@@ -0,0 +1,52 @@
+<?php
+
+namespace Barryvdh\LaravelIdeHelper\Listeners;
+
+use Illuminate\Console\Events\CommandFinished;
+use Illuminate\Contracts\Config\Repository as Config;
+use Illuminate\Contracts\Console\Kernel as Artisan;
+
+class GenerateModelHelper
+{
+    /**
+     * Tracks whether we should run the models command on the CommandFinished event or not.
+     * Set to true by the MigrationsEnded event, needs to be cleared before artisan call to prevent infinite loop.
+     *
+     * @var bool
+     */
+    public static $shouldRun = false;
+
+    /** @var \Illuminate\Contracts\Console\Kernel */
+    protected $artisan;
+
+    /** @var \Illuminate\Contracts\Config\Repository */
+    protected $config;
+
+    /**
+     * @param  \Illuminate\Contracts\Console\Kernel  $artisan
+     * @param  \Illuminate\Contracts\Config\Repository  $config
+     */
+    public function __construct(Artisan $artisan, Config $config)
+    {
+        $this->artisan = $artisan;
+        $this->config = $config;
+    }
+
+    /**
+     * Handle the event.
+     *
+     * @param  CommandFinished  $event
+     */
+    public function handle(CommandFinished $event)
+    {
+        if (!self::$shouldRun) {
+            return;
+        }
+
+        self::$shouldRun = false;
+
+        foreach ($this->config->get('ide-helper.post_migrate', []) as $command) {
+            $this->artisan->call($command, [], $event->output);
+        }
+    }
+}

vendor/barryvdh/laravel-ide-helper/src/Macro.php

@@ -0,0 +1,127 @@
+<?php
+
+namespace Barryvdh\LaravelIdeHelper;
+
+use Barryvdh\Reflection\DocBlock;
+use Barryvdh\Reflection\DocBlock\Tag;
+use Illuminate\Database\Eloquent\Builder as EloquentBuilder;
+use Illuminate\Support\Collection;
+
+class Macro extends Method
+{
+    /**
+     * Macro constructor.
+     *
+     * @param \ReflectionFunctionAbstract $method
+     * @param string              $alias
+     * @param \ReflectionClass    $class
+     * @param null                $methodName
+     * @param array               $interfaces
+     * @param array               $classAliases
+     */
+    public function __construct(
+        $method,
+        $alias,
+        $class,
+        $methodName = null,
+        $interfaces = [],
+        $classAliases = []
+    ) {
+        parent::__construct($method, $alias, $class, $methodName, $interfaces, $classAliases);
+    }
+
+    /**
+     * @param \ReflectionFunctionAbstract $method
+     */
+    protected function initPhpDoc($method)
+    {
+        $this->phpdoc = new DocBlock($method);
+
+        $this->addLocationToPhpDoc();
+
+        // Add macro parameters if they are missed in original docblock
+        if (!$this->phpdoc->hasTag('param')) {
+            foreach ($method->getParameters() as $parameter) {
+                $reflectionType = $parameter->getType();
+
+                $type = $this->concatReflectionTypes($reflectionType);
+
+                /** @psalm-suppress UndefinedClass */
+                if ($reflectionType && !$reflectionType instanceof \ReflectionUnionType && $reflectionType->allowsNull()) {
+                    $type .= '|null';
+                }
+
+                $type = $type ?: 'mixed';
+
+                $name = $parameter->isVariadic() ? '...' : '';
+                $name .= '$' . $parameter->getName();
+
+                $this->phpdoc->appendTag(Tag::createInstance("@param {$type} {$name}"));
+            }
+        }
+
+        // Add macro return type if it missed in original docblock
+        if ($method->hasReturnType() && !$this->phpdoc->hasTag('return')) {
+            $builder = EloquentBuilder::class;
+            $return = $method->getReturnType();
+
+            $type = $this->concatReflectionTypes($return);
+
+            /** @psalm-suppress UndefinedClass */
+            if (!$return instanceof \ReflectionUnionType) {
+                $type .= $this->root === "\\{$builder}" && $return->getName() === $builder ? '|static' : '';
+                $type .= $return->allowsNull() ? '|null' : '';
+            }
+
+            $this->phpdoc->appendTag(Tag::createInstance("@return {$type}"));
+        }
+    }
+
+    protected function concatReflectionTypes(?\ReflectionType $type): string
+    {
+        /** @psalm-suppress UndefinedClass */
+        $returnTypes = $type instanceof \ReflectionUnionType
+            ? $type->getTypes()
+            : [$type];
+
+        return Collection::make($returnTypes)
+            ->filter()
+            ->map->getName()
+            ->implode('|');
+    }
+
+    protected function addLocationToPhpDoc()
+    {
+        if ($this->method->name === '__invoke') {
+            $enclosingClass = $this->method->getDeclaringClass();
+        } else {
+            $enclosingClass = $this->method->getClosureScopeClass();
+        }
+
+        if (!$enclosingClass) {
+            return;
+        }
+        /** @var \ReflectionMethod $enclosingMethod */
+        $enclosingMethod = Collection::make($enclosingClass->getMethods())
+            ->first(function (\ReflectionMethod $method) {
+                return $method->getStartLine() <= $this->method->getStartLine()
+                    && $method->getEndLine() >= $this->method->getEndLine();
+            });
+
+        if ($enclosingMethod) {
+            $this->phpdoc->appendTag(Tag::createInstance(
+                '@see \\' . $enclosingClass->getName() . '::' . $enclosingMethod->getName() . '()'
+            ));
+        }
+    }
+
+    /**
+     * @param \ReflectionFunctionAbstract $method
+     * @param \ReflectionClass $class
+     */
+    protected function initClassDefinedProperties($method, \ReflectionClass $class)
+    {
+        $this->namespace = $class->getNamespaceName();
+        $this->declaringClassName = '\\' . ltrim($class->name, '\\');
+    }
+}

vendor/barryvdh/laravel-ide-helper/src/Method.php

@@ -0,0 +1,379 @@
+<?php
+
+/**
+ * Laravel IDE Helper Generator
+ *
+ * @author    Barry vd. Heuvel <barryvdh@gmail.com>
+ * @copyright 2014 Barry vd. Heuvel / Fruitcake Studio (http://www.fruitcakestudio.nl)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      https://github.com/barryvdh/laravel-ide-helper
+ */
+
+namespace Barryvdh\LaravelIdeHelper;
+
+use Barryvdh\Reflection\DocBlock;
+use Barryvdh\Reflection\DocBlock\Context;
+use Barryvdh\Reflection\DocBlock\Serializer as DocBlockSerializer;
+use Barryvdh\Reflection\DocBlock\Tag;
+use Barryvdh\Reflection\DocBlock\Tag\ParamTag;
+use Barryvdh\Reflection\DocBlock\Tag\ReturnTag;
+use Illuminate\Database\Eloquent\Builder;
+use Illuminate\Support\Str;
+
+class Method
+{
+    /** @var \Barryvdh\Reflection\DocBlock  */
+    protected $phpdoc;
+
+    /** @var \ReflectionMethod  */
+    protected $method;
+
+    protected $output = '';
+    protected $declaringClassName;
+    protected $name;
+    protected $namespace;
+    protected $params = [];
+    protected $params_with_default = [];
+    protected $interfaces = [];
+    protected $real_name;
+    protected $return = null;
+    protected $root;
+    protected $classAliases;
+
+    /**
+     * @param \ReflectionMethod|\ReflectionFunctionAbstract $method
+     * @param string $alias
+     * @param \ReflectionClass $class
+     * @param string|null $methodName
+     * @param array $interfaces
+     * @param array $classAliases
+     */
+    public function __construct($method, $alias, $class, $methodName = null, $interfaces = [], array $classAliases = [])
+    {
+        $this->method = $method;
+        $this->interfaces = $interfaces;
+        $this->classAliases = $classAliases;
+        $this->name = $methodName ?: $method->name;
+        $this->real_name = $method->isClosure() ? $this->name : $method->name;
+        $this->initClassDefinedProperties($method, $class);
+
+        //Reference the 'real' function in the declaring class
+        $this->root = '\\' . ltrim($method->name === '__invoke' ? $method->getDeclaringClass()->getName() : $class->getName(), '\\');
+
+        //Create a DocBlock and serializer instance
+        $this->initPhpDoc($method);
+
+        //Normalize the description and inherit the docs from parents/interfaces
+        try {
+            $this->normalizeParams($this->phpdoc);
+            $this->normalizeReturn($this->phpdoc);
+            $this->normalizeDescription($this->phpdoc);
+        } catch (\Exception $e) {
+        }
+
+        //Get the parameters, including formatted default values
+        $this->getParameters($method);
+
+        //Make the method static
+        $this->phpdoc->appendTag(Tag::createInstance('@static', $this->phpdoc));
+    }
+
+    /**
+     * @param \ReflectionMethod $method
+     */
+    protected function initPhpDoc($method)
+    {
+        $this->phpdoc = new DocBlock($method, new Context($this->namespace, $this->classAliases));
+    }
+
+    /**
+     * @param \ReflectionMethod $method
+     * @param \ReflectionClass $class
+     */
+    protected function initClassDefinedProperties($method, \ReflectionClass $class)
+    {
+        $declaringClass = $method->getDeclaringClass();
+        $this->namespace = $declaringClass->getNamespaceName();
+        $this->declaringClassName = '\\' . ltrim($declaringClass->name, '\\');
+    }
+
+    /**
+     * Get the class wherein the function resides
+     *
+     * @return string
+     */
+    public function getDeclaringClass()
+    {
+        return $this->declaringClassName;
+    }
+
+    /**
+     * Return the class from which this function would be called
+     *
+     * @return string
+     */
+    public function getRoot()
+    {
+        return $this->root;
+    }
+
+    /**
+     * @return bool
+     */
+    public function isInstanceCall()
+    {
+        return !($this->method->isClosure() || $this->method->isStatic());
+    }
+
+    /**
+     * @return string
+     */
+    public function getRootMethodCall()
+    {
+        if ($this->isInstanceCall()) {
+            return "\$instance->{$this->getRealName()}({$this->getParams()})";
+        } else {
+            return "{$this->getRoot()}::{$this->getRealName()}({$this->getParams()})";
+        }
+    }
+
+    /**
+     * Get the docblock for this method
+     *
+     * @param string $prefix
+     * @return mixed
+     */
+    public function getDocComment($prefix = "\t\t")
+    {
+        $serializer = new DocBlockSerializer(1, $prefix);
+        return $serializer->getDocComment($this->phpdoc);
+    }
+
+    /**
+     * Get the method name
+     *
+     * @return string
+     */
+    public function getName()
+    {
+        return $this->name;
+    }
+
+    /**
+     * Get the real method name
+     *
+     * @return string
+     */
+    public function getRealName()
+    {
+        return $this->real_name;
+    }
+
+    /**
+     * Get the parameters for this method
+     *
+     * @param bool $implode Wether to implode the array or not
+     * @return string
+     */
+    public function getParams($implode = true)
+    {
+        return $implode ? implode(', ', $this->params) : $this->params;
+    }
+
+    /**
+     * Get the parameters for this method including default values
+     *
+     * @param bool $implode Wether to implode the array or not
+     * @return string
+     */
+    public function getParamsWithDefault($implode = true)
+    {
+        return $implode ? implode(', ', $this->params_with_default) : $this->params_with_default;
+    }
+
+    /**
+     * Get the description and get the inherited docs.
+     *
+     * @param DocBlock $phpdoc
+     */
+    protected function normalizeDescription(DocBlock $phpdoc)
+    {
+        //Get the short + long description from the DocBlock
+        $description = $phpdoc->getText();
+
+        //Loop through parents/interfaces, to fill in {@inheritdoc}
+        if (strpos($description, '{@inheritdoc}') !== false) {
+            $inheritdoc = $this->getInheritDoc($this->method);
+            $inheritDescription = $inheritdoc->getText();
+
+            $description = str_replace('{@inheritdoc}', $inheritDescription, $description);
+            $phpdoc->setText($description);
+
+            $this->normalizeParams($inheritdoc);
+            $this->normalizeReturn($inheritdoc);
+
+            //Add the tags that are inherited
+            $inheritTags = $inheritdoc->getTags();
+            if ($inheritTags) {
+                /** @var Tag $tag */
+                foreach ($inheritTags as $tag) {
+                    $tag->setDocBlock();
+                    $phpdoc->appendTag($tag);
+                }
+            }
+        }
+    }
+
+    /**
+     * Normalize the parameters
+     *
+     * @param DocBlock $phpdoc
+     */
+    protected function normalizeParams(DocBlock $phpdoc)
+    {
+        //Get the return type and adjust them for beter autocomplete
+        $paramTags = $phpdoc->getTagsByName('param');
+        if ($paramTags) {
+            /** @var ParamTag $tag */
+            foreach ($paramTags as $tag) {
+                // Convert the keywords
+                $content = $this->convertKeywords($tag->getContent());
+                $tag->setContent($content);
+
+                // Get the expanded type and re-set the content
+                $content = $tag->getType() . ' ' . $tag->getVariableName() . ' ' . $tag->getDescription();
+                $tag->setContent(trim($content));
+            }
+        }
+    }
+
+    /**
+     * Normalize the return tag (make full namespace, replace interfaces)
+     *
+     * @param DocBlock $phpdoc
+     */
+    protected function normalizeReturn(DocBlock $phpdoc)
+    {
+        //Get the return type and adjust them for better autocomplete
+        $returnTags = $phpdoc->getTagsByName('return');
+
+        if (count($returnTags) === 0) {
+            $this->return = null;
+            return;
+        }
+
+        /** @var ReturnTag $tag */
+        $tag = reset($returnTags);
+        // Get the expanded type
+        $returnValue = $tag->getType();
+
+        // Replace the interfaces
+        foreach ($this->interfaces as $interface => $real) {
+            $returnValue = str_replace($interface, $real, $returnValue);
+        }
+
+        // Set the changed content
+        $tag->setContent($returnValue . ' ' . $tag->getDescription());
+        $this->return = $returnValue;
+
+        if ($tag->getType() === '$this') {
+            Str::contains($this->root, Builder::class)
+                ? $tag->setType($this->root . '|static')
+                : $tag->setType($this->root);
+        }
+    }
+
+    /**
+     * Convert keywords that are incorrect.
+     *
+     * @param  string $string
+     * @return string
+     */
+    protected function convertKeywords($string)
+    {
+        $string = str_replace('\Closure', 'Closure', $string);
+        $string = str_replace('Closure', '\Closure', $string);
+        $string = str_replace('dynamic', 'mixed', $string);
+
+        return $string;
+    }
+
+    /**
+     * Should the function return a value?
+     *
+     * @return bool
+     */
+    public function shouldReturn()
+    {
+        if ($this->return !== 'void' && $this->method->name !== '__construct') {
+            return true;
+        }
+
+        return false;
+    }
+
+    /**
+     * Get the parameters and format them correctly
+     *
+     * @param  \ReflectionMethod $method
+     * @return void
+     */
+    public function getParameters($method)
+    {
+        //Loop through the default values for parameters, and make the correct output string
+        $params = [];
+        $paramsWithDefault = [];
+        foreach ($method->getParameters() as $param) {
+            $paramStr = $param->isVariadic() ? '...$' . $param->getName() : '$' . $param->getName();
+            $params[] = $paramStr;
+            if ($param->isOptional() && !$param->isVariadic()) {
+                $default = $param->isDefaultValueAvailable() ? $param->getDefaultValue() : null;
+                if (is_bool($default)) {
+                    $default = $default ? 'true' : 'false';
+                } elseif (is_array($default)) {
+                    $default = '[]';
+                } elseif (is_null($default)) {
+                    $default = 'null';
+                } elseif (is_int($default)) {
+                    //$default = $default;
+                } elseif (is_resource($default)) {
+                    //skip to not fail
+                } else {
+                    $default = var_export($default, true);
+                }
+                $paramStr .= " = $default";
+            }
+            $paramsWithDefault[] = $paramStr;
+        }
+
+        $this->params = $params;
+        $this->params_with_default = $paramsWithDefault;
+    }
+
+    /**
+     * @param \ReflectionMethod $reflectionMethod
+     * @return DocBlock
+     */
+    protected function getInheritDoc($reflectionMethod)
+    {
+        $parentClass = $reflectionMethod->getDeclaringClass()->getParentClass();
+
+        //Get either a parent or the interface
+        if ($parentClass) {
+            $method = $parentClass->getMethod($reflectionMethod->getName());
+        } else {
+            $method = $reflectionMethod->getPrototype();
+        }
+        if ($method) {
+            $namespace = $method->getDeclaringClass()->getNamespaceName();
+            $phpdoc = new DocBlock($method, new Context($namespace, $this->classAliases));
+
+            if (strpos($phpdoc->getText(), '{@inheritdoc}') !== false) {
+                //Not at the end yet, try another parent/interface..
+                return $this->getInheritDoc($method);
+            }
+
+            return $phpdoc;
+        }
+    }
+}

vendor/barryvdh/laravel-ide-helper/src/UsesResolver.php

@@ -0,0 +1,124 @@
+<?php
+
+/**
+ * Laravel IDE Helper Generator
+ *
+ * @author    Barry vd. Heuvel <barryvdh@gmail.com>
+ * @copyright 2014 Barry vd. Heuvel / Fruitcake Studio (http://www.fruitcakestudio.nl)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      https://github.com/barryvdh/laravel-ide-helper
+ */
+
+namespace Barryvdh\LaravelIdeHelper;
+
+use PhpParser\Node\Stmt\GroupUse;
+use PhpParser\Node\Stmt\Namespace_;
+use PhpParser\Node\Stmt\Use_;
+use PhpParser\Node\Stmt\UseUse;
+use PhpParser\ParserFactory;
+
+class UsesResolver
+{
+    /**
+     * @param string $classFQN
+     * @return array
+     */
+    public function loadFromClass(string $classFQN): array
+    {
+        return $this->loadFromFile(
+            $classFQN,
+            (new \ReflectionClass($classFQN))->getFileName()
+        );
+    }
+
+    /**
+     * @param string $classFQN
+     * @param string $filename
+     * @return array
+     */
+    public function loadFromFile(string $classFQN, string $filename): array
+    {
+        return $this->loadFromCode(
+            $classFQN,
+            file_get_contents(
+                $filename
+            )
+        );
+    }
+
+    /**
+     * @param string $classFQN
+     * @param string $code
+     * @return array
+     */
+    public function loadFromCode(string $classFQN, string $code): array
+    {
+        $classFQN = ltrim($classFQN, '\\');
+
+        $namespace = rtrim(
+            preg_replace(
+                '/([^\\\\]+)$/',
+                '',
+                $classFQN
+            ),
+            '\\'
+        );
+
+        $parser = (new ParserFactory())->create(ParserFactory::PREFER_PHP7);
+        $namespaceData = null;
+
+        foreach ($parser->parse($code) as $node) {
+            if ($node instanceof Namespace_ && $node->name->toCodeString() === $namespace) {
+                $namespaceData = $node;
+                break;
+            }
+        }
+
+        if ($namespaceData === null) {
+            return [];
+        }
+
+        /** @var Namespace_ $namespaceData */
+
+        $aliases = [];
+
+        foreach ($namespaceData->stmts as $stmt) {
+            if ($stmt instanceof Use_) {
+                if ($stmt->type !== Use_::TYPE_NORMAL) {
+                    continue;
+                }
+
+                foreach ($stmt->uses as $use) {
+                    /** @var UseUse $use */
+
+                    $alias = $use->alias ?
+                        $use->alias->name :
+                        self::classBasename($use->name->toCodeString());
+
+                    $aliases[$alias] = '\\' . $use->name->toCodeString();
+                }
+            } elseif ($stmt instanceof GroupUse) {
+                foreach ($stmt->uses as $use) {
+                    /** @var UseUse $use */
+
+                    $alias = $use->alias ?
+                        $use->alias->name :
+                        self::classBasename($use->name->toCodeString());
+
+                    $aliases[$alias] = '\\' . $stmt->prefix->toCodeString() . '\\' . $use->name->toCodeString();
+                }
+            }
+        }
+
+        return $aliases;
+    }
+
+    /**
+     * @param string $classFQN
+     * @return string
+     */
+    protected static function classBasename(string $classFQN): string
+    {
+        return preg_replace('/^.*\\\\([^\\\\]+)$/', '$1', $classFQN);
+    }
+}

vendor/barryvdh/reflection-docblock/.github/workflows/run-tests.yml

@@ -0,0 +1,43 @@
+name: Unit Tests
+
+on:
+  push:
+    branches:
+    - master
+  pull_request:
+    branches:
+    - "*"
+  schedule:
+  - cron: '0 0 * * *'
+
+jobs:
+  php-tests:
+    runs-on: ubuntu-latest
+    timeout-minutes: 15
+    env:
+      COMPOSER_NO_INTERACTION: 1
+
+    strategy:
+      matrix:
+        php: [8.1, 8.0, 7.4, 7.3, 7.2]
+        dependency-version: [prefer-lowest, prefer-stable]
+
+    name: P${{ matrix.php }} - ${{ matrix.dependency-version }}
+
+    steps:
+    - name: Checkout code
+      uses: actions/checkout@v2
+
+    - name: Setup PHP
+      uses: shivammathur/setup-php@v2
+      with:
+        php-version: ${{ matrix.php }}
+        coverage: none
+        tools: composer:v2
+
+    - name: Install dependencies
+      run: |
+        composer update --${{ matrix.dependency-version }} --prefer-dist --no-progress
+
+    - name: Execute Unit Tests
+      run: vendor/bin/phpunit

vendor/barryvdh/reflection-docblock/LICENSE

@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2010 Mike van Riel
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.

vendor/barryvdh/reflection-docblock/README.md

@@ -0,0 +1,57 @@
+The ReflectionDocBlock Component [![Build Status](https://secure.travis-ci.org/phpDocumentor/ReflectionDocBlock.png)](https://travis-ci.org/phpDocumentor/ReflectionDocBlock)
+================================
+
+Introduction
+------------
+
+The ReflectionDocBlock component of phpDocumentor provides a DocBlock parser
+that is 100% compatible with the [PHPDoc standard](http://phpdoc.org/docs/latest).
+
+With this component, a library can provide support for annotations via DocBlocks
+or otherwise retrieve information that is embedded in a DocBlock.
+
+> **Note**: *this is a core component of phpDocumentor and is constantly being
+> optimized for performance.*
+
+Installation
+------------
+
+You can install the component in the following ways:
+
+* Use the official Github repository (https://github.com/phpDocumentor/ReflectionDocBlock)
+* Via Composer (http://packagist.org/packages/phpdocumentor/reflection-docblock)
+
+Usage
+-----
+
+The ReflectionDocBlock component is designed to work in an identical fashion to
+PHP's own Reflection extension (http://php.net/manual/en/book.reflection.php).
+
+Parsing can be initiated by instantiating the
+`\phpDocumentor\Reflection\DocBlock()` class and passing it a string containing
+a DocBlock (including asterisks) or by passing an object supporting the
+`getDocComment()` method.
+
+> *Examples of objects having the `getDocComment()` method are the
+> `ReflectionClass` and the `ReflectionMethod` classes of the PHP
+> Reflection extension*
+
+Example:
+
+    $class = new ReflectionClass('MyClass');
+    $phpdoc = new \phpDocumentor\Reflection\DocBlock($class);
+
+or
+
+    $docblock = <<<DOCBLOCK
+    /**
+     * This is a short description.
+     *
+     * This is a *long* description.
+     *
+     * @return void
+     */
+    DOCBLOCK;
+
+    $phpdoc = new \phpDocumentor\Reflection\DocBlock($docblock);
+

vendor/barryvdh/reflection-docblock/composer.json

@@ -0,0 +1,26 @@
+{
+    "name":    "barryvdh/reflection-docblock",
+    "type":    "library",
+    "license": "MIT",
+    "authors": [
+        {"name": "Mike van Riel", "email": "mike.vanriel@naenius.com"}
+    ],
+    "require": {
+        "php": ">=5.3.3"
+    },
+    "autoload": {
+        "psr-0": {"Barryvdh": ["src/"]}
+    },
+    "require-dev": {
+        "phpunit/phpunit": "^8.5.14|^9"
+    },
+    "suggest": {
+        "dflydev/markdown": "~1.0",
+        "erusev/parsedown": "~1.0"
+    },
+    "extra": {
+        "branch-alias": {
+            "dev-master": "2.0.x-dev"
+        }
+    }
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock.php

@@ -0,0 +1,485 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Mike van Riel <mike.vanriel@naenius.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection;
+
+use Barryvdh\Reflection\DocBlock\Tag;
+use Barryvdh\Reflection\DocBlock\Context;
+use Barryvdh\Reflection\DocBlock\Location;
+
+/**
+ * Parses the DocBlock for any structure.
+ *
+ * @author  Mike van Riel <mike.vanriel@naenius.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class DocBlock implements \Reflector
+{
+    /** @var string The opening line for this docblock. */
+    protected $short_description = '';
+
+    /**
+     * @var DocBlock\Description The actual
+     *     description for this docblock.
+     */
+    protected $long_description = null;
+
+    /**
+     * @var Tag[] An array containing all
+     *     the tags in this docblock; except inline.
+     */
+    protected $tags = array();
+
+    /** @var Context Information about the context of this DocBlock. */
+    protected $context = null;
+
+    /** @var Location Information about the location of this DocBlock. */
+    protected $location = null;
+
+    /** @var bool Is this DocBlock (the start of) a template? */
+    protected $isTemplateStart = false;
+
+    /** @var bool Does this DocBlock signify the end of a DocBlock template? */
+    protected $isTemplateEnd = false;
+
+    /**
+     * Parses the given docblock and populates the member fields.
+     *
+     * The constructor may also receive namespace information such as the
+     * current namespace and aliases. This information is used by some tags
+     * (e.g. @return, @param, etc.) to turn a relative Type into a FQCN.
+     *
+     * @param \Reflector|string $docblock A docblock comment (including
+     *     asterisks) or reflector supporting the getDocComment method.
+     * @param Context           $context  The context in which the DocBlock
+     *     occurs.
+     * @param Location          $location The location within the file that this
+     *     DocBlock occurs in.
+     *
+     * @throws \InvalidArgumentException if the given argument does not have the
+     *     getDocComment method.
+     */
+    public function __construct(
+        $docblock,
+        Context $context = null,
+        Location $location = null
+    ) {
+        if (is_object($docblock)) {
+            if (!method_exists($docblock, 'getDocComment')) {
+                throw new \InvalidArgumentException(
+                    'Invalid object passed; the given reflector must support '
+                    . 'the getDocComment method'
+                );
+            }
+
+            $docblock = $docblock->getDocComment();
+        }
+
+        $docblock = $this->cleanInput($docblock);
+
+        list($templateMarker, $short, $long, $tags) = $this->splitDocBlock($docblock);
+        $this->isTemplateStart = $templateMarker === '#@+';
+        $this->isTemplateEnd = $templateMarker === '#@-';
+        $this->short_description = $short;
+        $this->long_description = new DocBlock\Description($long, $this);
+        $this->parseTags($tags);
+
+        $this->context  = $context;
+        $this->location = $location;
+    }
+
+    /**
+     * Strips the asterisks from the DocBlock comment.
+     *
+     * @param string $comment String containing the comment text.
+     *
+     * @return string
+     */
+    protected function cleanInput($comment)
+    {
+        $comment = trim(
+            preg_replace(
+                '#[ \t]*(?:\/\*\*|\*\/|\*)?[ \t]{0,1}(.*)?#u',
+                '$1',
+                $comment
+            )
+        );
+
+        // reg ex above is not able to remove */ from a single line docblock
+        if (substr($comment, -2) == '*/') {
+            $comment = trim(substr($comment, 0, -2));
+        }
+
+        // normalize strings
+        $comment = str_replace(array("\r\n", "\r"), "\n", $comment);
+
+        return $comment;
+    }
+
+    /**
+     * Splits the DocBlock into a template marker, summary, description and block of tags.
+     *
+     * @param string $comment Comment to split into the sub-parts.
+     *
+     * @author Richard van Velzen (@_richardJ) Special thanks to Richard for the regex responsible for the split.
+     * @author Mike van Riel <me@mikevanriel.com> for extending the regex with template marker support.
+     *
+     * @return string[] containing the template marker (if any), summary, description and a string containing the tags.
+     */
+    protected function splitDocBlock($comment)
+    {
+        // Performance improvement cheat: if the first character is an @ then only tags are in this DocBlock. This
+        // method does not split tags so we return this verbatim as the fourth result (tags). This saves us the
+        // performance impact of running a regular expression
+        if (strpos($comment, '@') === 0) {
+            return array('', '', '', $comment);
+        }
+
+        // clears all extra horizontal whitespace from the line endings to prevent parsing issues
+        $comment = preg_replace('/\h*$/Sum', '', $comment);
+
+        /*
+         * Splits the docblock into a template marker, short description, long description and tags section
+         *
+         * - The template marker is empty, #@+ or #@- if the DocBlock starts with either of those (a newline may
+         *   occur after it and will be stripped).
+         * - The short description is started from the first character until a dot is encountered followed by a
+         *   newline OR two consecutive newlines (horizontal whitespace is taken into account to consider spacing
+         *   errors). This is optional.
+         * - The long description, any character until a new line is encountered followed by an @ and word
+         *   characters (a tag). This is optional.
+         * - Tags; the remaining characters
+         *
+         * Big thanks to RichardJ for contributing this Regular Expression
+         */
+        preg_match(
+            '/
+            \A
+            # 1. Extract the template marker
+            (?:(\#\@\+|\#\@\-)\n?)?
+
+            # 2. Extract the summary
+            (?:
+              (?! @\pL ) # The summary may not start with an @
+              (
+                [^\n.]+
+                (?:
+                  (?! \. \n | \n{2} )     # End summary upon a dot followed by newline or two newlines
+                  [\n.] (?! [ \t]* @\pL ) # End summary when an @ is found as first character on a new line
+                  [^\n.]+                 # Include anything else
+                )*
+                \.?
+              )?
+            )
+
+            # 3. Extract the description
+            (?:
+              \s*        # Some form of whitespace _must_ precede a description because a summary must be there
+              (?! @\pL ) # The description may not start with an @
+              (
+                [^\n]+
+                (?: \n+
+                  (?! [ \t]* @\pL ) # End description when an @ is found as first character on a new line
+                  [^\n]+            # Include anything else
+                )*
+              )
+            )?
+
+            # 4. Extract the tags (anything that follows)
+            (\s+ [\s\S]*)? # everything that follows
+            /ux',
+            $comment,
+            $matches
+        );
+        array_shift($matches);
+
+        while (count($matches) < 4) {
+            $matches[] = '';
+        }
+
+        return $matches;
+    }
+
+    /**
+     * Creates the tag objects.
+     *
+     * @param string $tags Tag block to parse.
+     *
+     * @return void
+     */
+    protected function parseTags($tags)
+    {
+        $result = array();
+        $tags = trim($tags);
+        if ('' !== $tags) {
+            if ('@' !== $tags[0]) {
+                throw new \LogicException(
+                    'A tag block started with text instead of an actual tag,'
+                    . ' this makes the tag block invalid: ' . $tags
+                );
+            }
+            foreach (explode("\n", $tags) as $tag_line) {
+                if (isset($tag_line[0]) && ($tag_line[0] === '@')) {
+                    $result[] = $tag_line;
+                } else {
+                    $result[count($result) - 1] .= "\n" . $tag_line;
+                }
+            }
+
+            // create proper Tag objects
+            foreach ($result as $key => $tag_line) {
+                $result[$key] = Tag::createInstance(trim($tag_line), $this);
+            }
+        }
+
+        $this->tags = $result;
+    }
+
+    /**
+     * Gets the text portion of the doc block.
+     * 
+     * Gets the text portion (short and long description combined) of the doc
+     * block.
+     * 
+     * @return string The text portion of the doc block.
+     */
+    public function getText()
+    {
+        $short = $this->getShortDescription();
+        $long = $this->getLongDescription()->getContents();
+
+        if ($long) {
+            return "{$short}\n\n{$long}";
+        } else {
+            return $short;
+        }
+    }
+
+    /**
+     * Set the text portion of the doc block.
+     * 
+     * Sets the text portion (short and long description combined) of the doc
+     * block.
+     *
+     * @param string $docblock The new text portion of the doc block.
+     * 
+     * @return $this This doc block.
+     */
+    public function setText($comment)
+    {
+        list(,$short, $long) = $this->splitDocBlock($comment);
+        $this->short_description = $short;
+        $this->long_description = new DocBlock\Description($long, $this);
+        return $this;
+    }
+    /**
+     * Returns the opening line or also known as short description.
+     *
+     * @return string
+     */
+    public function getShortDescription()
+    {
+        return $this->short_description;
+    }
+
+    /**
+     * Returns the full description or also known as long description.
+     *
+     * @return DocBlock\Description
+     */
+    public function getLongDescription()
+    {
+        return $this->long_description;
+    }
+
+    /**
+     * Returns whether this DocBlock is the start of a Template section.
+     *
+     * A Docblock may serve as template for a series of subsequent DocBlocks. This is indicated by a special marker
+     * (`#@+`) that is appended directly after the opening `/**` of a DocBlock.
+     *
+     * An example of such an opening is:
+     *
+     * ```
+     * /**#@+
+     *  * My DocBlock
+     *  * /
+     * ```
+     *
+     * The description and tags (not the summary!) are copied onto all subsequent DocBlocks and also applied to all
+     * elements that follow until another DocBlock is found that contains the closing marker (`#@-`).
+     *
+     * @see self::isTemplateEnd() for the check whether a closing marker was provided.
+     *
+     * @return boolean
+     */
+    public function isTemplateStart()
+    {
+        return $this->isTemplateStart;
+    }
+
+    /**
+     * Returns whether this DocBlock is the end of a Template section.
+     *
+     * @see self::isTemplateStart() for a more complete description of the Docblock Template functionality.
+     *
+     * @return boolean
+     */
+    public function isTemplateEnd()
+    {
+        return $this->isTemplateEnd;
+    }
+
+    /**
+     * Returns the current context.
+     *
+     * @return Context
+     */
+    public function getContext()
+    {
+        return $this->context;
+    }
+
+    /**
+     * Returns the current location.
+     *
+     * @return Location
+     */
+    public function getLocation()
+    {
+        return $this->location;
+    }
+
+    /**
+     * Returns the tags for this DocBlock.
+     *
+     * @return Tag[]
+     */
+    public function getTags()
+    {
+        return $this->tags;
+    }
+
+    /**
+     * Returns an array of tags matching the given name. If no tags are found
+     * an empty array is returned.
+     *
+     * @param string $name String to search by.
+     *
+     * @return Tag[]
+     */
+    public function getTagsByName($name)
+    {
+        $result = array();
+
+        /** @var Tag $tag */
+        foreach ($this->getTags() as $tag) {
+            if ($tag->getName() != $name) {
+                continue;
+            }
+
+            $result[] = $tag;
+        }
+
+        return $result;
+    }
+
+    /**
+     * Checks if a tag of a certain type is present in this DocBlock.
+     *
+     * @param string $name Tag name to check for.
+     *
+     * @return bool
+     */
+    public function hasTag($name)
+    {
+        /** @var Tag $tag */
+        foreach ($this->getTags() as $tag) {
+            if ($tag->getName() == $name) {
+                return true;
+            }
+        }
+
+        return false;
+    }
+
+    /**
+     * Appends a tag at the end of the list of tags.
+     *
+     * @param Tag $tag The tag to add.
+     *
+     * @return Tag The newly added tag.
+     *
+     * @throws \LogicException When the tag belongs to a different DocBlock.
+     */
+    public function appendTag(Tag $tag)
+    {
+        if (null === $tag->getDocBlock()) {
+            $tag->setDocBlock($this);
+        }
+
+        if ($tag->getDocBlock() === $this) {
+            $this->tags[] = $tag;
+        } else {
+            throw new \LogicException(
+                'This tag belongs to a different DocBlock object.'
+            );
+        }
+
+        return $tag;
+    }
+
+    /**
+     * Deletes a tag from the list of tags.
+     *
+     * @param Tag $tag The tag to be deleted.
+     *
+     * @return bool True if the tag was deleted.
+     */
+    public function deleteTag(Tag $tag)
+    {
+        if (($key = array_search($tag, $this->tags)) !== false) {
+            unset($this->tags[$key]);
+
+            return true;
+        }
+
+        return false;
+    }
+
+    /**
+     * Builds a string representation of this object.
+     *
+     * @todo determine the exact format as used by PHP Reflection and
+     *     implement it.
+     *
+     * @return string
+     * @codeCoverageIgnore Not yet implemented
+     */
+    public static function export()
+    {
+        throw new \Exception('Not yet implemented');
+    }
+
+    /**
+     * Returns the exported information (we should use the export static method
+     * BUT this throws an exception at this point).
+     *
+     * @return string
+     * @codeCoverageIgnore Not yet implemented
+     */
+    public function __toString()
+    {
+        return 'Not yet implemented';
+    }
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Context.php

@@ -0,0 +1,154 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Vasil Rangelov <boen.robot@gmail.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock;
+
+/**
+ * The context in which a DocBlock occurs.
+ *
+ * @author  Vasil Rangelov <boen.robot@gmail.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class Context
+{
+    /** @var string The current namespace. */
+    protected $namespace = '';
+
+    /** @var array List of namespace aliases => Fully Qualified Namespace. */
+    protected $namespace_aliases = array();
+    
+    /** @var string Name of the structural element, within the namespace. */
+    protected $lsen = '';
+    
+    /**
+     * Cteates a new context.
+     * @param string $namespace         The namespace where this DocBlock
+     *     resides in.
+     * @param array  $namespace_aliases List of namespace aliases => Fully
+     *     Qualified Namespace.
+     * @param string $lsen              Name of the structural element, within
+     *     the namespace.
+     */
+    public function __construct(
+        $namespace = '',
+        array $namespace_aliases = array(),
+        $lsen = ''
+    ) {
+        if (!empty($namespace)) {
+            $this->setNamespace($namespace);
+        }
+        $this->setNamespaceAliases($namespace_aliases);
+        $this->setLSEN($lsen);
+    }
+
+    /**
+     * @return string The namespace where this DocBlock resides in.
+     */
+    public function getNamespace()
+    {
+        return $this->namespace;
+    }
+
+    /**
+     * @return array List of namespace aliases => Fully Qualified Namespace.
+     */
+    public function getNamespaceAliases()
+    {
+        return $this->namespace_aliases;
+    }
+    
+    /**
+     * Returns the Local Structural Element Name.
+     * 
+     * @return string Name of the structural element, within the namespace.
+     */
+    public function getLSEN()
+    {
+        return $this->lsen;
+    }
+    
+    /**
+     * Sets a new namespace.
+     * 
+     * Sets a new namespace for the context. Leading and trailing slashes are
+     * trimmed, and the keywords "global" and "default" are treated as aliases
+     * to no namespace.
+     * 
+     * @param string $namespace The new namespace to set.
+     * 
+     * @return $this
+     */
+    public function setNamespace($namespace)
+    {
+        if ('global' !== $namespace
+            && 'default' !== $namespace
+        ) {
+            // Srip leading and trailing slash
+            $this->namespace = trim((string)$namespace, '\\');
+        } else {
+            $this->namespace = '';
+        }
+        return $this;
+    }
+    
+    /**
+     * Sets the namespace aliases, replacing all previous ones.
+     * 
+     * @param array $namespace_aliases List of namespace aliases => Fully
+     *     Qualified Namespace.
+     * 
+     * @return $this
+     */
+    public function setNamespaceAliases(array $namespace_aliases)
+    {
+        $this->namespace_aliases = array();
+        foreach ($namespace_aliases as $alias => $fqnn) {
+            $this->setNamespaceAlias($alias, $fqnn);
+        }
+        return $this;
+    }
+    
+    /**
+     * Adds a namespace alias to the context.
+     * 
+     * @param string $alias The alias name (the part after "as", or the last
+     *     part of the Fully Qualified Namespace Name) to add.
+     * @param string $fqnn  The Fully Qualified Namespace Name for this alias.
+     *     Any form of leading/trailing slashes are accepted, but what will be
+     *     stored is a name, prefixed with a slash, and no trailing slash.
+     * 
+     * @return $this
+     */
+    public function setNamespaceAlias($alias, $fqnn)
+    {
+        $this->namespace_aliases[$alias] = '\\' . trim((string)$fqnn, '\\');
+        return $this;
+    }
+    
+    /**
+     * Sets a new Local Structural Element Name.
+     * 
+     * Sets a new Local Structural Element Name. A local name also contains
+     * punctuation determining the kind of structural element (e.g. trailing "("
+     * and ")" for functions and methods).
+     * 
+     * @param string $lsen The new local name of a structural element.
+     * 
+     * @return $this
+     */
+    public function setLSEN($lsen)
+    {
+        $this->lsen = (string)$lsen;
+        return $this;
+    }
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Description.php

@@ -0,0 +1,223 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Mike van Riel <mike.vanriel@naenius.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock;
+
+use Barryvdh\Reflection\DocBlock;
+
+/**
+ * Parses a Description of a DocBlock or tag.
+ *
+ * @author  Mike van Riel <mike.vanriel@naenius.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class Description implements \Reflector
+{
+    /** @var string */
+    protected $contents = '';
+
+    /** @var array The contents, as an array of strings and Tag objects. */
+    protected $parsedContents = null;
+
+    /** @var DocBlock The DocBlock which this description belongs to. */
+    protected $docblock = null;
+
+    /**
+     * Populates the fields of a description.
+     *
+     * @param string   $content  The description's conetnts.
+     * @param DocBlock $docblock The DocBlock which this description belongs to.
+     */
+    public function __construct($content, DocBlock $docblock = null)
+    {
+        $this->setContent($content)->setDocBlock($docblock);
+    }
+
+    /**
+     * Gets the text of this description.
+     *
+     * @return string
+     */
+    public function getContents()
+    {
+        return $this->contents;
+    }
+
+    /**
+     * Sets the text of this description.
+     *
+     * @param string $content The new text of this description.
+     *
+     * @return $this
+     */
+    public function setContent($content)
+    {
+        $this->contents = trim($content);
+
+        $this->parsedContents = null;
+        return $this;
+    }
+
+    /**
+     * Returns the parsed text of this description.
+     *
+     * @return array An array of strings and tag objects, in the order they
+     *     occur within the description.
+     */
+    public function getParsedContents()
+    {
+        if (null === $this->parsedContents) {
+            $this->parsedContents = preg_split(
+                '/\{
+                    # "{@}" is not a valid inline tag. This ensures that
+                    # we do not treat it as one, but treat it literally.
+                    (?!@\})
+                    # We want to capture the whole tag line, but without the
+                    # inline tag delimiters.
+                    (\@
+                        # Match everything up to the next delimiter.
+                        [^{}]*
+                        # Nested inline tag content should not be captured, or
+                        # it will appear in the result separately.
+                        (?:
+                            # Match nested inline tags.
+                            (?:
+                                # Because we did not catch the tag delimiters
+                                # earlier, we must be explicit with them here.
+                                # Notice that this also matches "{}", as a way
+                                # to later introduce it as an escape sequence.
+                                \{(?1)?\}
+                                |
+                                # Make sure we match hanging "{".
+                                \{
+                            )
+                            # Match content after the nested inline tag.
+                            [^{}]*
+                        )* # If there are more inline tags, match them as well.
+                           # We use "*" since there may not be any nested inline
+                           # tags.
+                    )
+                \}/Sux',
+                $this->contents,
+                -1,
+                PREG_SPLIT_DELIM_CAPTURE
+            );
+
+            $count = count($this->parsedContents);
+            for ($i=1; $i<$count; $i += 2) {
+                $this->parsedContents[$i] = Tag::createInstance(
+                    $this->parsedContents[$i],
+                    $this->docblock
+                );
+            }
+
+            //In order to allow "literal" inline tags, the otherwise invalid
+            //sequence "{@}" is changed to "@", and "{}" is changed to "}".
+            //See unit tests for examples.
+            for ($i=0; $i<$count; $i += 2) {
+                $this->parsedContents[$i] = str_replace(
+                    array('{@}', '{}'),
+                    array('@', '}'),
+                    $this->parsedContents[$i]
+                );
+            }
+        }
+        return $this->parsedContents;
+    }
+
+    /**
+     * Return a formatted variant of the Long Description using MarkDown.
+     *
+     * @todo this should become a more intelligent piece of code where the
+     *     configuration contains a setting what format long descriptions are.
+     *
+     * @codeCoverageIgnore Will be removed soon, in favor of adapters at
+     *     PhpDocumentor itself that will process text in various formats.
+     *
+     * @return string
+     */
+    public function getFormattedContents()
+    {
+        $result = $this->contents;
+
+        // if the long description contains a plain HTML <code> element, surround
+        // it with a pre element. Please note that we explicitly used str_replace
+        // and not preg_replace to gain performance
+        if (strpos($result, '<code>') !== false) {
+            $result = str_replace(
+                array('<code>', "<code>\r\n", "<code>\n", "<code>\r", '</code>'),
+                array('<pre><code>', '<code>', '<code>', '<code>', '</code></pre>'),
+                $result
+            );
+        }
+
+        if (class_exists('Parsedown')) {
+            $markdown = \Parsedown::instance();
+            $result = $markdown->parse($result);
+        } elseif (class_exists('dflydev\markdown\MarkdownExtraParser')) {
+            $markdown = new \dflydev\markdown\MarkdownExtraParser();
+            $result = $markdown->transformMarkdown($result);
+        }
+
+        return trim($result);
+    }
+
+    /**
+     * Gets the docblock this tag belongs to.
+     *
+     * @return DocBlock The docblock this description belongs to.
+     */
+    public function getDocBlock()
+    {
+        return $this->docblock;
+    }
+
+    /**
+     * Sets the docblock this tag belongs to.
+     *
+     * @param DocBlock $docblock The new docblock this description belongs to.
+     *     Setting NULL removes any association.
+     *
+     * @return $this
+     */
+    public function setDocBlock(DocBlock $docblock = null)
+    {
+        $this->docblock = $docblock;
+
+        return $this;
+    }
+
+    /**
+     * Builds a string representation of this object.
+     *
+     * @todo determine the exact format as used by PHP Reflection
+     *     and implement it.
+     *
+     * @return void
+     * @codeCoverageIgnore Not yet implemented
+     */
+    public static function export()
+    {
+        throw new \Exception('Not yet implemented');
+    }
+
+    /**
+     * Returns the long description as a string.
+     *
+     * @return string
+     */
+    public function __toString()
+    {
+        return $this->getContents();
+    }
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Location.php

@@ -0,0 +1,76 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Vasil Rangelov <boen.robot@gmail.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock;
+
+/**
+ * The location a DocBlock occurs within a file.
+ *
+ * @author  Vasil Rangelov <boen.robot@gmail.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class Location
+{
+    /** @var int Line where the DocBlock text starts. */
+    protected $lineNumber = 0;
+
+    /** @var int Column where the DocBlock text starts. */
+    protected $columnNumber = 0;
+    
+    public function __construct(
+        $lineNumber = 0,
+        $columnNumber = 0
+    ) {
+        $this->setLineNumber($lineNumber)->setColumnNumber($columnNumber);
+    }
+
+    /**
+     * @return int Line where the DocBlock text starts.
+     */
+    public function getLineNumber()
+    {
+        return $this->lineNumber;
+    }
+
+    /**
+     * 
+     * @param type $lineNumber
+     * @return $this
+     */
+    public function setLineNumber($lineNumber)
+    {
+        $this->lineNumber = (int)$lineNumber;
+
+        return $this;
+    }
+
+    /**
+     * @return int Column where the DocBlock text starts.
+     */
+    public function getColumnNumber()
+    {
+        return $this->columnNumber;
+    }
+
+    /**
+     * 
+     * @param int $columnNumber
+     * @return $this
+     */
+    public function setColumnNumber($columnNumber)
+    {
+        $this->columnNumber = (int)$columnNumber;
+
+        return $this;
+    }
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Serializer.php

@@ -0,0 +1,235 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Barry vd. Heuvel <barryvdh@gmail.com>
+ * @copyright 2013 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock;
+
+use Barryvdh\Reflection\DocBlock;
+
+/**
+ * Serializes a DocBlock instance.
+ *
+ * @author  Barry vd. Heuvel <barryvdh@gmail.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class Serializer
+{
+
+    /** @var string The string to indent the comment with. */
+    protected $indentString = ' ';
+
+    /** @var int The number of times the indent string is repeated. */
+    protected $indent = 0;
+
+    /** @var bool Whether to indent the first line. */
+    protected $isFirstLineIndented = true;
+
+    /** @var int|null The max length of a line. */
+    protected $lineLength = null;
+
+    /** @var bool Separate tag groups. */
+    protected $separateTags = false;
+
+    /**
+     * Create a Serializer instance.
+     *
+     * @param int      $indent          The number of times the indent string is
+     *     repeated.
+     * @param string   $indentString    The string to indent the comment with.
+     * @param bool     $indentFirstLine Whether to indent the first line.
+     * @param int|null $lineLength      The max length of a line or NULL to
+     *     disable line wrapping.
+     * @param bool     $separateTags    Separate tag groups.
+     */
+    public function __construct(
+        $indent = 0,
+        $indentString = ' ',
+        $indentFirstLine = true,
+        $lineLength = null,
+        $separateTags = false
+    ) {
+        $this->setIndentationString($indentString);
+        $this->setIndent($indent);
+        $this->setIsFirstLineIndented($indentFirstLine);
+        $this->setLineLength($lineLength);
+        $this->setSeparateTags($separateTags);
+    }
+
+    /**
+     * Sets the string to indent comments with.
+     * 
+     * @param string $indentationString The string to indent comments with.
+     * 
+     * @return $this This serializer object.
+     */
+    public function setIndentationString($indentString)
+    {
+        $this->indentString = (string)$indentString;
+        return $this;
+    }
+
+    /**
+     * Gets the string to indent comments with.
+     * 
+     * @return string The indent string.
+     */
+    public function getIndentationString()
+    {
+        return $this->indentString;
+    }
+
+    /**
+     * Sets the number of indents.
+     * 
+     * @param int $indent The number of times the indent string is repeated.
+     * 
+     * @return $this This serializer object.
+     */
+    public function setIndent($indent)
+    {
+        $this->indent = (int)$indent;
+        return $this;
+    }
+
+    /**
+     * Gets the number of indents.
+     * 
+     * @return int The number of times the indent string is repeated.
+     */
+    public function getIndent()
+    {
+        return $this->indent;
+    }
+
+    /**
+     * Sets whether or not the first line should be indented.
+     * 
+     * Sets whether or not the first line (the one with the "/**") should be
+     * indented.
+     * 
+     * @param bool $indentFirstLine The new value for this setting.
+     * 
+     * @return $this This serializer object.
+     */
+    public function setIsFirstLineIndented($indentFirstLine)
+    {
+        $this->isFirstLineIndented = (bool)$indentFirstLine;
+        return $this;
+    }
+
+    /**
+     * Gets whether or not the first line should be indented.
+     * 
+     * @return bool Whether or not the first line should be indented.
+     */
+    public function isFirstLineIndented()
+    {
+        return $this->isFirstLineIndented;
+    }
+
+    /**
+     * Sets the line length.
+     * 
+     * Sets the length of each line in the serialization. Content will be
+     * wrapped within this limit.
+     * 
+     * @param int|null $lineLength The length of each line. NULL to disable line
+     *     wrapping altogether.
+     * 
+     * @return $this This serializer object.
+     */
+    public function setLineLength($lineLength)
+    {
+        $this->lineLength = null === $lineLength ? null : (int)$lineLength;
+        return $this;
+    }
+
+    /**
+     * Gets the line length.
+     * 
+     * @return int|null The length of each line or NULL if line wrapping is
+     *     disabled.
+     */
+    public function getLineLength()
+    {
+        return $this->lineLength;
+    }
+
+    /**
+     * Sets whether there should be an empty line between tag groups.
+     *
+     * @param bool $separateTags The new value for this setting.
+     *
+     * @return $this This serializer object.
+     */
+    public function setSeparateTags($separateTags)
+    {
+        $this->separateTags = (bool)$separateTags;
+        return $this;
+    }
+
+    /**
+     * Gets whether there should be an empty line between tag groups.
+     *
+     * @return bool Whether there should be an empty line between tag groups.
+     */
+    public function getSeparateTags()
+    {
+        return $this->separateTags;
+    }
+
+    /**
+     * Generate a DocBlock comment.
+     *
+     * @param DocBlock The DocBlock to serialize.
+     * 
+     * @return string The serialized doc block.
+     */
+    public function getDocComment(DocBlock $docblock)
+    {
+        $indent = str_repeat($this->indentString, $this->indent);
+        $firstIndent = $this->isFirstLineIndented ? $indent : '';
+
+        $text = $docblock->getText();
+        if ($this->lineLength) {
+            //3 === strlen(' * ')
+            $wrapLength = $this->lineLength - strlen($indent) - 3;
+            $text = wordwrap($text, $wrapLength);
+        }
+        $text = str_replace("\n", "\n{$indent} * ", $text);
+
+        $comment = "{$firstIndent}/**\n{$indent} * {$text}\n{$indent} *\n";
+
+        $tags = array_values($docblock->getTags());
+
+        /** @var Tag $tag */
+        foreach ($tags as $key => $tag) {
+            $nextTag = isset($tags[$key + 1]) ? $tags[$key + 1] : null;
+
+            $tagText = (string) $tag;
+            if ($this->lineLength) {
+                $tagText = wordwrap($tagText, $wrapLength);
+            }
+            $tagText = str_replace("\n", "\n{$indent} * ", $tagText);
+
+            $comment .= "{$indent} * {$tagText}\n";
+
+            if ($this->separateTags && $nextTag !== null && ! $tag->inSameGroup($nextTag)) {
+                $comment .= "{$indent} *\n";
+            }
+        }
+
+        $comment .= $indent . ' */';
+
+        return $comment;
+    }
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag.php

@@ -0,0 +1,410 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Mike van Riel <mike.vanriel@naenius.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock;
+
+use Barryvdh\Reflection\DocBlock;
+
+/**
+ * Parses a tag definition for a DocBlock.
+ *
+ * @author  Mike van Riel <mike.vanriel@naenius.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class Tag implements \Reflector
+{
+    /**
+     * PCRE regular expression matching a tag name.
+     */
+    const REGEX_TAGNAME = '[\w\-\_\\\\]+';
+
+    /** @var string Name of the tag */
+    protected $tag = '';
+
+    /**
+     * @var string|null Content of the tag.
+     *     When set to NULL, it means it needs to be regenerated.
+     */
+    protected $content = '';
+
+    /** @var string Description of the content of this tag */
+    protected $description = '';
+
+    /**
+     * @var array|null The description, as an array of strings and Tag objects.
+     *     When set to NULL, it means it needs to be regenerated.
+     */
+    protected $parsedDescription = null;
+
+    /** @var Location Location of the tag. */
+    protected $location = null;
+
+    /** @var DocBlock The DocBlock which this tag belongs to. */
+    protected $docblock = null;
+    
+    /**
+     * @var array An array with a tag as a key, and an FQCN to a class that
+     *     handles it as an array value. The class is expected to inherit this
+     *     class.
+     */
+    private static $tagHandlerMappings = array(
+        'author'
+            => '\Barryvdh\Reflection\DocBlock\Tag\AuthorTag',
+        'covers'
+            => '\Barryvdh\Reflection\DocBlock\Tag\CoversTag',
+        'deprecated'
+            => '\Barryvdh\Reflection\DocBlock\Tag\DeprecatedTag',
+        'example'
+            => '\Barryvdh\Reflection\DocBlock\Tag\ExampleTag',
+        'link'
+            => '\Barryvdh\Reflection\DocBlock\Tag\LinkTag',
+        'method'
+            => '\Barryvdh\Reflection\DocBlock\Tag\MethodTag',
+        'param'
+            => '\Barryvdh\Reflection\DocBlock\Tag\ParamTag',
+        'property-read'
+            => '\Barryvdh\Reflection\DocBlock\Tag\PropertyReadTag',
+        'property'
+            => '\Barryvdh\Reflection\DocBlock\Tag\PropertyTag',
+        'property-write'
+            => '\Barryvdh\Reflection\DocBlock\Tag\PropertyWriteTag',
+        'return'
+            => '\Barryvdh\Reflection\DocBlock\Tag\ReturnTag',
+        'see'
+            => '\Barryvdh\Reflection\DocBlock\Tag\SeeTag',
+        'since'
+            => '\Barryvdh\Reflection\DocBlock\Tag\SinceTag',
+        'source'
+            => '\Barryvdh\Reflection\DocBlock\Tag\SourceTag',
+        'throw'
+            => '\Barryvdh\Reflection\DocBlock\Tag\ThrowsTag',
+        'throws'
+            => '\Barryvdh\Reflection\DocBlock\Tag\ThrowsTag',
+        'uses'
+            => '\Barryvdh\Reflection\DocBlock\Tag\UsesTag',
+        'var'
+            => '\Barryvdh\Reflection\DocBlock\Tag\VarTag',
+        'version'
+            => '\Barryvdh\Reflection\DocBlock\Tag\VersionTag'
+    );
+
+    /**
+     * Factory method responsible for instantiating the correct sub type.
+     *
+     * @param string   $tag_line The text for this tag, including description.
+     * @param DocBlock $docblock The DocBlock which this tag belongs to.
+     * @param Location $location Location of the tag.
+     *
+     * @throws \InvalidArgumentException if an invalid tag line was presented.
+     *
+     * @return static A new tag object.
+     */
+    final public static function createInstance(
+        $tag_line,
+        DocBlock $docblock = null,
+        Location $location = null
+    ) {
+        if (!preg_match(
+            '/^@(' . self::REGEX_TAGNAME . ')(?:\s*([^\s].*)|$)?/us',
+            $tag_line,
+            $matches
+        )) {
+            throw new \InvalidArgumentException(
+                'Invalid tag_line detected: ' . $tag_line
+            );
+        }
+
+        $handler = __CLASS__;
+        if (isset(self::$tagHandlerMappings[$matches[1]])) {
+            $handler = self::$tagHandlerMappings[$matches[1]];
+        } elseif (isset($docblock)) {
+            $tagName = (string)new Type\Collection(
+                array($matches[1]),
+                $docblock->getContext()
+            );
+
+            if (isset(self::$tagHandlerMappings[$tagName])) {
+                $handler = self::$tagHandlerMappings[$tagName];
+            }
+        }
+
+        return new $handler(
+            $matches[1],
+            isset($matches[2]) ? $matches[2] : '',
+            $docblock,
+            $location
+        );
+    }
+
+    /**
+     * Registers a handler for tags.
+     * 
+     * Registers a handler for tags. The class specified is autoloaded if it's
+     * not available. It must inherit from this class.
+     * 
+     * @param string      $tag     Name of tag to regiser a handler for. When
+     *     registering a namespaced tag, the full name, along with a prefixing
+     *     slash MUST be provided.
+     * @param string|null $handler FQCN of handler. Specifing NULL removes the
+     *     handler for the specified tag, if any.
+     * 
+     * @return bool TRUE on success, FALSE on failure.
+     */
+    final public static function registerTagHandler($tag, $handler)
+    {
+        $tag = trim((string)$tag);
+
+        if (null === $handler) {
+            unset(self::$tagHandlerMappings[$tag]);
+            return true;
+        }
+
+        if ('' !== $tag
+            && class_exists($handler, true)
+            && is_subclass_of($handler, __CLASS__)
+            && !strpos($tag, '\\') //Accept no slash, and 1st slash at offset 0.
+        ) {
+            self::$tagHandlerMappings[$tag] = $handler;
+            return true;
+        }
+
+        return false;
+    }
+
+    /**
+     * Parses a tag and populates the member variables.
+     *
+     * @param string   $name     Name of the tag.
+     * @param string   $content  The contents of the given tag.
+     * @param DocBlock $docblock The DocBlock which this tag belongs to.
+     * @param Location $location Location of the tag.
+     */
+    public function __construct(
+        $name,
+        $content,
+        DocBlock $docblock = null,
+        Location $location = null
+    ) {
+        $this
+            ->setName($name)
+            ->setContent($content)
+            ->setDocBlock($docblock)
+            ->setLocation($location);
+    }
+
+    /**
+     * Gets the name of this tag.
+     *
+     * @return string The name of this tag.
+     */
+    public function getName()
+    {
+        return $this->tag;
+    }
+
+    /**
+     * Sets the name of this tag.
+     * 
+     * @param string $name The new name of this tag.
+     * 
+     * @return $this
+     * @throws \InvalidArgumentException When an invalid tag name is provided.
+     */
+    public function setName($name)
+    {
+        if (!preg_match('/^' . self::REGEX_TAGNAME . '$/u', $name)) {
+            throw new \InvalidArgumentException(
+                'Invalid tag name supplied: ' . $name
+            );
+        }
+
+        $this->tag = $name;
+
+        return $this;
+    }
+
+    /**
+     * Gets the content of this tag.
+     *
+     * @return string
+     */
+    public function getContent()
+    {
+        if (null === $this->content) {
+            $this->content = $this->description;
+        }
+
+        return $this->content;
+    }
+
+    /**
+     * Sets the content of this tag.
+     * 
+     * @param string $content The new content of this tag.
+     * 
+     * @return $this
+     */
+    public function setContent($content)
+    {
+        $this->setDescription($content);
+        $this->content = $content;
+
+        return $this;
+    }
+
+    /**
+     * Gets the description component of this tag.
+     *
+     * @return string
+     */
+    public function getDescription()
+    {
+        return $this->description;
+    }
+
+    /**
+     * Sets the description component of this tag.
+     * 
+     * @param string $description The new description component of this tag.
+     * 
+     * @return $this
+     */
+    public function setDescription($description)
+    {
+        $this->content = null;
+        $this->parsedDescription = null;
+        $this->description = trim($description);
+
+        return $this;
+    }
+
+    /**
+     * Gets the parsed text of this description.
+     * 
+     * @return array An array of strings and tag objects, in the order they
+     *     occur within the description.
+     */
+    public function getParsedDescription()
+    {
+        if (null === $this->parsedDescription) {
+            $description = new Description($this->description, $this->docblock);
+            $this->parsedDescription = $description->getParsedContents();
+        }
+        return $this->parsedDescription;
+    }
+
+    /**
+     * Gets the docblock this tag belongs to.
+     * 
+     * @return DocBlock The docblock this tag belongs to.
+     */
+    public function getDocBlock()
+    {
+        return $this->docblock;
+    }
+
+    /**
+     * Sets the docblock this tag belongs to.
+     * 
+     * @param DocBlock $docblock The new docblock this tag belongs to. Setting
+     *     NULL removes any association.
+     * 
+     * @return $this
+     */
+    public function setDocBlock(DocBlock $docblock = null)
+    {
+        $this->docblock = $docblock;
+
+        return $this;
+    }
+
+    /**
+     * Gets the location of the tag.
+     *
+     * @return Location The tag's location.
+     */
+    public function getLocation()
+    {
+        return $this->location;
+    }
+    
+    /**
+     * Sets the location of the tag.
+     * 
+     * @param Location $location The new location of the tag.
+     * 
+     * @return $this
+     */
+    public function setLocation(Location $location = null)
+    {
+        $this->location = $location;
+
+        return $this;
+    }
+
+    /**
+     * If the given tags should be together or apart.
+     *
+     * @param Tag $tag
+     *
+     * @return bool
+     */
+    public function inSameGroup(Tag $tag)
+    {
+        $firstName = $this->getName();
+        $secondName = $tag->getName();
+
+        if ($firstName === $secondName) {
+            return true;
+        }
+
+        $groups = array(
+            array('deprecated', 'link', 'see', 'since'),
+            array('author', 'copyright', 'license'),
+            array('category', 'package', 'subpackage'),
+            array('property', 'property-read', 'property-write'),
+            array('param', 'return'),
+        );
+
+        foreach ($groups as $group) {
+            if (in_array($firstName, $group, true) && in_array($secondName, $group, true)) {
+                return true;
+            }
+        }
+
+        return false;
+    }
+
+    /**
+     * Builds a string representation of this object.
+     *
+     * @todo determine the exact format as used by PHP Reflection and implement it.
+     *
+     * @return void
+     * @codeCoverageIgnore Not yet implemented
+     */
+    public static function export()
+    {
+        throw new \Exception('Not yet implemented');
+    }
+
+    /**
+     * Returns the tag as a serialized string
+     *
+     * @return string
+     */
+    public function __toString()
+    {
+        return "@{$this->getName()} {$this->getContent()}";
+    }
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/AuthorTag.php

@@ -0,0 +1,131 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Vasil Rangelov <boen.robot@gmail.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Tag;
+
+use Barryvdh\Reflection\DocBlock\Tag;
+
+/**
+ * Reflection class for an @author tag in a Docblock.
+ *
+ * @author  Mike van Riel <mike.vanriel@naenius.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class AuthorTag extends Tag
+{
+    /**
+     * PCRE regular expression matching any valid value for the name component.
+     */
+    const REGEX_AUTHOR_NAME = '[^\<]*';
+
+    /**
+     * PCRE regular expression matching any valid value for the email component.
+     */
+    const REGEX_AUTHOR_EMAIL = '[^\>]*';
+
+    /** @var string The name of the author */
+    protected $authorName = '';
+
+    /** @var string The email of the author */
+    protected $authorEmail = '';
+    
+    public function getContent()
+    {
+        if (null === $this->content) {
+            $this->content = $this->authorName;
+            if ('' != $this->authorEmail) {
+                $this->content .= "<{$this->authorEmail}>";
+            }
+        }
+
+        return $this->content;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function setContent($content)
+    {
+        parent::setContent($content);
+        if (preg_match(
+            '/^(' . self::REGEX_AUTHOR_NAME .
+            ')(\<(' . self::REGEX_AUTHOR_EMAIL .
+            ')\>)?$/u',
+            $this->description,
+            $matches
+        )) {
+            $this->authorName = trim($matches[1]);
+            if (isset($matches[3])) {
+                $this->authorEmail = trim($matches[3]);
+            }
+        }
+
+        return $this;
+    }
+
+    /**
+     * Gets the author's name.
+     * 
+     * @return string The author's name.
+     */
+    public function getAuthorName()
+    {
+        return $this->authorName;
+    }
+    
+    /**
+     * Sets the author's name.
+     * 
+     * @param string $authorName The new author name.
+     *     An invalid value will set an empty string.
+     * 
+     * @return $this
+     */
+    public function setAuthorName($authorName)
+    {
+        $this->content = null;
+        $this->authorName
+            = preg_match('/^' . self::REGEX_AUTHOR_NAME . '$/u', $authorName)
+            ? $authorName : '';
+
+        return $this;
+    }
+
+    /**
+     * Gets the author's email.
+     * 
+     * @return string The author's email.
+     */
+    public function getAuthorEmail()
+    {
+        return $this->authorEmail;
+    }
+    
+    /**
+     * Sets the author's email.
+     * 
+     * @param string $authorEmail The new author email.
+     *     An invalid value will set an empty string.
+     * 
+     * @return $this
+     */
+    public function setAuthorEmail($authorEmail)
+    {
+        $this->authorEmail
+            = preg_match('/^' . self::REGEX_AUTHOR_EMAIL . '$/u', $authorEmail)
+            ? $authorEmail : '';
+
+        $this->content = null;
+        return $this;
+    }
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/CoversTag.php

@@ -0,0 +1,24 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Mike van Riel <mike.vanriel@naenius.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Tag;
+
+/**
+ * Reflection class for a @covers tag in a Docblock.
+ *
+ * @author  Mike van Riel <mike.vanriel@naenius.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class CoversTag extends SeeTag
+{
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/DeprecatedTag.php

@@ -0,0 +1,26 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Vasil Rangelov <boen.robot@gmail.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Tag;
+
+use Barryvdh\Reflection\DocBlock\Tag\VersionTag;
+
+/**
+ * Reflection class for a @deprecated tag in a Docblock.
+ *
+ * @author  Vasil Rangelov <boen.robot@gmail.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class DeprecatedTag extends VersionTag
+{
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/ExampleTag.php

@@ -0,0 +1,156 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Vasil Rangelov <boen.robot@gmail.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Tag;
+
+use Barryvdh\Reflection\DocBlock\Tag;
+
+/**
+ * Reflection class for a @example tag in a Docblock.
+ *
+ * @author  Vasil Rangelov <boen.robot@gmail.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class ExampleTag extends SourceTag
+{
+    /** 
+     * @var string Path to a file to use as an example.
+     *     May also be an absolute URI.
+     */
+    protected $filePath = '';
+
+    /**
+     * @var bool Whether the file path component represents an URI.
+     *     This determines how the file portion appears at {@link getContent()}.
+     */
+    protected $isURI = false;
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getContent()
+    {
+        if (null === $this->content) {
+            $filePath = '';
+            if ($this->isURI) {
+                if (false === strpos($this->filePath, ':')) {
+                    $filePath = str_replace(
+                        '%2F',
+                        '/',
+                        rawurlencode($this->filePath)
+                    );
+                } else {
+                    $filePath = $this->filePath;
+                }
+            } else {
+                $filePath = '"' . $this->filePath . '"';
+            }
+
+            $this->content = $filePath . ' ' . parent::getContent();
+        }
+
+        return $this->content;
+    }
+    /**
+     * {@inheritdoc}
+     */
+    public function setContent($content)
+    {
+        Tag::setContent($content);
+        if (preg_match(
+            '/^
+                # File component
+                (?:
+                    # File path in quotes
+                    \"([^\"]+)\"
+                    |
+                    # File URI
+                    (\S+)
+                )
+                # Remaining content (parsed by SourceTag)
+                (?:\s+(.*))?
+            $/sux',
+            $this->description,
+            $matches
+        )) {
+            if ('' !== $matches[1]) {
+                $this->setFilePath($matches[1]);
+            } else {
+                $this->setFileURI($matches[2]);
+            }
+
+            if (isset($matches[3])) {
+                parent::setContent($matches[3]);
+            } else {
+                $this->setDescription('');
+            }
+            $this->content = $content;
+        }
+
+        return $this;
+    }
+
+    /**
+     * Returns the file path.
+     *
+     * @return string Path to a file to use as an example.
+     *     May also be an absolute URI.
+     */
+    public function getFilePath()
+    {
+        return $this->filePath;
+    }
+    
+    /**
+     * Sets the file path.
+     * 
+     * @param string $filePath The new file path to use for the example.
+     * 
+     * @return $this
+     */
+    public function setFilePath($filePath)
+    {
+        $this->isURI = false;
+        $this->filePath = trim($filePath);
+
+        $this->content = null;
+        return $this;
+    }
+    
+    /**
+     * Sets the file path as an URI.
+     * 
+     * This function is equivalent to {@link setFilePath()}, except that it
+     * convers an URI to a file path before that.
+     * 
+     * There is no getFileURI(), as {@link getFilePath()} is compatible.
+     * 
+     * @param type $uri The new file URI to use as an example.
+     */
+    public function setFileURI($uri)
+    {
+        $this->isURI = true;
+        if (false === strpos($uri, ':')) {
+            //Relative URL
+            $this->filePath = rawurldecode(
+                str_replace(array('/', '\\'), '%2F', $uri)
+            );
+        } else {
+            //Absolute URL or URI.
+            $this->filePath = $uri;
+        }
+
+        $this->content = null;
+        return $this;
+    }
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/LinkTag.php

@@ -0,0 +1,81 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Ben Selby <benmatselby@gmail.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Tag;
+
+use Barryvdh\Reflection\DocBlock\Tag;
+
+/**
+ * Reflection class for a @link tag in a Docblock.
+ *
+ * @author  Ben Selby <benmatselby@gmail.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class LinkTag extends Tag
+{
+    /** @var string */
+    protected $link = '';
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getContent()
+    {
+        if (null === $this->content) {
+            $this->content = "{$this->link} {$this->description}";
+        }
+
+        return $this->content;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function setContent($content)
+    {
+        parent::setContent($content);
+        $parts = preg_split('/\s+/Su', $this->description, 2);
+
+        $this->link = $parts[0];
+
+        $this->setDescription(isset($parts[1]) ? $parts[1] : $parts[0]);
+
+        $this->content = $content;
+        return $this;
+    }
+
+    /**
+    * Gets the link
+    *
+    * @return string
+    */
+    public function getLink()
+    {
+        return $this->link;
+    }
+
+    /**
+    * Sets the link
+    *
+    * @param string $link The link
+    *
+    * @return $this
+    */
+    public function setLink($link)
+    {
+        $this->link = $link;
+
+        $this->content = null;
+        return $this;
+    }
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/MethodTag.php

@@ -0,0 +1,217 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Mike van Riel <mike.vanriel@naenius.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Tag;
+
+use Barryvdh\Reflection\DocBlock\Tag;
+
+/**
+ * Reflection class for a @method in a Docblock.
+ *
+ * @author  Mike van Riel <mike.vanriel@naenius.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class MethodTag extends ReturnTag
+{
+
+    /** @var string */
+    protected $method_name = '';
+
+    /** @var string */
+    protected $arguments = '';
+    
+    /** @var bool */
+    protected $isStatic = false;
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getContent()
+    {
+        if (null === $this->content) {
+            $this->content = '';
+            if ($this->isStatic) {
+                $this->content .= 'static ';
+            }
+            $this->content .= $this->type .
+                " {$this->method_name}({$this->arguments}) " .
+                $this->description;
+        }
+
+        return $this->content;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function setContent($content)
+    {
+        Tag::setContent($content);
+        // 1. none or more whitespace
+        // 2. optionally the keyword "static" followed by whitespace
+        // 3. optionally a word with underscores followed by whitespace : as
+        //    type for the return value
+        // 4. then optionally a word with underscores followed by () and
+        //    whitespace : as method name as used by phpDocumentor
+        // 5. then a word with underscores, followed by ( and any character
+        //    until a ) and whitespace : as method name with signature
+        // 6. any remaining text : as description
+        if (preg_match(
+            '/^
+                # Static keyword
+                # Declates a static method ONLY if type is also present
+                (?:
+                    (static)
+                    \s+
+                )?
+                # Return type
+                (?:
+                    (
+                        (?:[\w\|_\\\\]*\$this[\w\|_\\\\]*)
+                        |
+                        (?:
+                            (?:[\w\|_\\\\]+)
+                            # array notation
+                            (?:\[\])*
+                        )*
+                    )
+                    \s+
+                )?
+                # Legacy method name (not captured)
+                (?:
+                    [\w_]+\(\)\s+
+                )?
+                # Method name
+                ([\w\|_\\\\]+)
+                # Arguments
+                \(([^\)]*)\)
+                \s*
+                # Description
+                (.*)
+            $/sux',
+            $this->description,
+            $matches
+        )) {
+            list(
+                ,
+                $static,
+                $this->type,
+                $this->method_name,
+                $this->arguments,
+                $this->description
+            ) = $matches;
+            if ($static) {
+                if (!$this->type) {
+                    $this->type = 'static';
+                } else {
+                    $this->isStatic = true;
+                }
+            } else {
+                if (!$this->type) {
+                    $this->type = 'void';
+                }
+            }
+            $this->parsedDescription = null;
+        }
+
+        return $this;
+    }
+
+    /**
+     * Sets the name of this method.
+     *
+     * @param string $method_name The name of the method.
+     *
+     * @return $this
+     */
+    public function setMethodName($method_name)
+    {
+        $this->method_name = $method_name;
+
+        $this->content = null;
+        return $this;
+    }
+
+    /**
+     * Retrieves the method name.
+     *
+     * @return string
+     */
+    public function getMethodName()
+    {
+        return $this->method_name;
+    }
+
+    /**
+     * Sets the arguments for this method.
+     *
+     * @param string $arguments A comma-separated arguments line.
+     *
+     * @return void
+     */
+    public function setArguments($arguments)
+    {
+        $this->arguments = $arguments;
+
+        $this->content = null;
+        return $this;
+    }
+
+    /**
+     * Returns an array containing each argument as array of type and name.
+     *
+     * Please note that the argument sub-array may only contain 1 element if no
+     * type was specified.
+     *
+     * @return string[]
+     */
+    public function getArguments()
+    {
+        if (empty($this->arguments)) {
+            return array();
+        }
+
+        $arguments = explode(',', $this->arguments);
+        foreach ($arguments as $key => $value) {
+            $arguments[$key] = explode(' ', trim($value));
+        }
+
+        return $arguments;
+    }
+    
+    /**
+     * Checks whether the method tag describes a static method or not.
+     * 
+     * @return bool TRUE if the method declaration is for a static method, FALSE
+     *     otherwise.
+     */
+    public function isStatic()
+    {
+        return $this->isStatic;
+    }
+    
+    /**
+     * Sets a new value for whether the method is static or not.
+     * 
+     * @param bool $isStatic The new value to set.
+     * 
+     * @return $this
+     */
+    public function setIsStatic($isStatic)
+    {
+        $this->isStatic = $isStatic;
+
+        $this->content = null;
+        return $this;
+    }
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/ParamTag.php

@@ -0,0 +1,119 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Mike van Riel <mike.vanriel@naenius.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Tag;
+
+use Barryvdh\Reflection\DocBlock\Tag;
+
+/**
+ * Reflection class for a @param tag in a Docblock.
+ *
+ * @author  Mike van Riel <mike.vanriel@naenius.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class ParamTag extends ReturnTag
+{
+    /** @var string */
+    protected $variableName = '';
+
+    /** @var bool determines whether this is a variadic argument */
+    protected $isVariadic = false;
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getContent()
+    {
+        if (null === $this->content) {
+            $this->content
+                = "{$this->type} {$this->variableName} {$this->description}";
+        }
+        return $this->content;
+    }
+    /**
+     * {@inheritdoc}
+     */
+    public function setContent($content)
+    {
+        Tag::setContent($content);
+        $parts = preg_split(
+            '/(\s+)/Su',
+            $this->description,
+            3,
+            PREG_SPLIT_DELIM_CAPTURE
+        );
+
+        // if the first item that is encountered is not a variable; it is a type
+        if (isset($parts[0])
+            && (strlen($parts[0]) > 0)
+            && ($parts[0][0] !== '$')
+        ) {
+            $this->type = array_shift($parts);
+            array_shift($parts);
+        }
+
+        // if the next item starts with a $ or ...$ it must be the variable name
+        if (isset($parts[0])
+            && (strlen($parts[0]) > 0)
+            && ($parts[0][0] == '$' || substr($parts[0], 0, 4) === '...$')
+        ) {
+            $this->variableName = array_shift($parts);
+            array_shift($parts);
+
+            if (substr($this->variableName, 0, 3) === '...') {
+                $this->isVariadic = true;
+                $this->variableName = substr($this->variableName, 3);
+            }
+        }
+
+        $this->setDescription(implode('', $parts));
+
+        $this->content = $content;
+        return $this;
+    }
+
+    /**
+     * Returns the variable's name.
+     *
+     * @return string
+     */
+    public function getVariableName()
+    {
+        return $this->variableName;
+    }
+
+    /**
+     * Sets the variable's name.
+     *
+     * @param string $name The new name for this variable.
+     *
+     * @return $this
+     */
+    public function setVariableName($name)
+    {
+        $this->variableName = $name;
+
+        $this->content = null;
+        return $this;
+    }
+
+    /**
+     * Returns whether this tag is variadic.
+     *
+     * @return boolean
+     */
+    public function isVariadic()
+    {
+        return $this->isVariadic;
+    }
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/PropertyReadTag.php

@@ -0,0 +1,24 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Mike van Riel <mike.vanriel@naenius.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Tag;
+
+/**
+ * Reflection class for a @property-read tag in a Docblock.
+ *
+ * @author  Mike van Riel <mike.vanriel@naenius.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class PropertyReadTag extends PropertyTag
+{
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/PropertyTag.php

@@ -0,0 +1,24 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Mike van Riel <mike.vanriel@naenius.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Tag;
+
+/**
+ * Reflection class for a @property tag in a Docblock.
+ *
+ * @author  Mike van Riel <mike.vanriel@naenius.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class PropertyTag extends ParamTag
+{
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/PropertyWriteTag.php

@@ -0,0 +1,24 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Mike van Riel <mike.vanriel@naenius.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Tag;
+
+/**
+ * Reflection class for a @property-write tag in a Docblock.
+ *
+ * @author  Mike van Riel <mike.vanriel@naenius.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class PropertyWriteTag extends PropertyTag
+{
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/ReturnTag.php

@@ -0,0 +1,128 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Mike van Riel <mike.vanriel@naenius.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Tag;
+
+use Barryvdh\Reflection\DocBlock\Tag;
+use Barryvdh\Reflection\DocBlock\Type\Collection;
+
+/**
+ * Reflection class for a @return tag in a Docblock.
+ *
+ * @author  Mike van Riel <mike.vanriel@naenius.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class ReturnTag extends Tag
+{
+    /** @var string The raw type component. */
+    protected $type = '';
+
+    /** @var Collection The parsed type component. */
+    protected $types = null;
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getContent()
+    {
+        if (null === $this->content) {
+            $this->content = "{$this->getType()} {$this->description}";
+        }
+
+        return $this->content;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function setContent($content)
+    {
+        parent::setContent($content);
+
+        $parts = preg_split('/(?<!,)\s+/Su', $this->description, 2);
+
+        // any output is considered a type
+        $this->type = $parts[0];
+        $this->types = null;
+
+        $this->setDescription(isset($parts[1]) ? $parts[1] : '');
+
+        $this->content = $content;
+        return $this;
+    }
+
+    /**
+     * Returns the unique types of the variable.
+     *
+     * @return string[]
+     */
+    public function getTypes()
+    {
+        return $this->getTypesCollection()->getArrayCopy();
+    }
+
+    /**
+     * Returns the type section of the variable.
+     *
+     * @return string
+     */
+    public function getType()
+    {
+        return (string) $this->getTypesCollection();
+    }
+
+    /**
+     * Set the type section of the variable
+     *
+     * @param string $type
+     * @return $this
+     */
+    public function setType($type)
+    {
+        $this->type = $type;
+        $this->types = null;
+        $this->content = null;
+        return $this;
+    }
+
+    /**
+     * Add a type to the type section of the variable
+     *
+     * @param string $type
+     * @return $this
+     */
+    public function addType($type)
+    {
+        $this->type = $this->type . Collection::OPERATOR_OR . $type;
+        $this->types = null;
+        $this->content = null;
+        return $this;
+    }
+
+
+    /**
+     * Returns the type collection.
+     *
+     * @return void
+     */
+    protected function getTypesCollection()
+    {
+        if (null === $this->types) {
+            $this->types = new Collection(
+                array($this->type),
+                $this->docblock ? $this->docblock->getContext() : null
+            );
+        }
+        return $this->types;
+    }
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/SeeTag.php

@@ -0,0 +1,81 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Mike van Riel <mike.vanriel@naenius.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Tag;
+
+use Barryvdh\Reflection\DocBlock\Tag;
+
+/**
+ * Reflection class for a @see tag in a Docblock.
+ *
+ * @author  Mike van Riel <mike.vanriel@naenius.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class SeeTag extends Tag
+{
+    /** @var string */
+    protected $refers = null;
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getContent()
+    {
+        if (null === $this->content) {
+            $this->content = "{$this->refers} {$this->description}";
+        }
+        return $this->content;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function setContent($content)
+    {
+        parent::setContent($content);
+        $parts = preg_split('/\s+/Su', $this->description, 2);
+
+        // any output is considered a type
+        $this->refers = $parts[0];
+
+        $this->setDescription(isset($parts[1]) ? $parts[1] : '');
+
+        $this->content = $content;
+        return $this;
+    }
+
+    /**
+     * Gets the structural element this tag refers to.
+     *
+     * @return string
+     */
+    public function getReference()
+    {
+        return $this->refers;
+    }
+
+    /**
+     * Sets the structural element this tag refers to.
+     * 
+     * @param string $refers The new type this tag refers to.
+     * 
+     * @return $this
+     */
+    public function setReference($refers)
+    {
+        $this->refers = $refers;
+
+        $this->content = null;
+        return $this;
+    }
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/SinceTag.php

@@ -0,0 +1,26 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Vasil Rangelov <boen.robot@gmail.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Tag;
+
+use Barryvdh\Reflection\DocBlock\Tag\VersionTag;
+
+/**
+ * Reflection class for a @since tag in a Docblock.
+ *
+ * @author  Vasil Rangelov <boen.robot@gmail.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class SinceTag extends VersionTag
+{
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/SourceTag.php

@@ -0,0 +1,137 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Vasil Rangelov <boen.robot@gmail.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Tag;
+
+use Barryvdh\Reflection\DocBlock\Tag;
+
+/**
+ * Reflection class for a @source tag in a Docblock.
+ *
+ * @author  Vasil Rangelov <boen.robot@gmail.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class SourceTag extends Tag
+{
+    /**
+     * @var int The starting line, relative to the structural element's
+     *     location.
+     */
+    protected $startingLine = 1;
+
+    /** 
+     * @var int|null The number of lines, relative to the starting line. NULL
+     *     means "to the end".
+     */
+    protected $lineCount = null;
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getContent()
+    {
+        if (null === $this->content) {
+            $this->content
+                = "{$this->startingLine} {$this->lineCount} {$this->description}";
+        }
+
+        return $this->content;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function setContent($content)
+    {
+        parent::setContent($content);
+        if (preg_match(
+            '/^
+                # Starting line
+                ([1-9]\d*)
+                \s*
+                # Number of lines
+                (?:
+                    ((?1))
+                    \s+
+                )?
+                # Description
+                (.*)
+            $/sux',
+            $this->description,
+            $matches
+        )) {
+            $this->startingLine = (int)$matches[1];
+            if (isset($matches[2]) && '' !== $matches[2]) {
+                $this->lineCount = (int)$matches[2];
+            }
+            $this->setDescription($matches[3]);
+            $this->content = $content;
+        }
+
+        return $this;
+    }
+
+    /**
+     * Gets the starting line.
+     *
+     * @return int The starting line, relative to the structural element's
+     *     location.
+     */
+    public function getStartingLine()
+    {
+        return $this->startingLine;
+    }
+
+    /**
+     * Sets the starting line.
+     * 
+     * @param int $startingLine The new starting line, relative to the
+     *     structural element's location.
+     * 
+     * @return $this
+     */
+    public function setStartingLine($startingLine)
+    {
+        $this->startingLine = $startingLine;
+
+        $this->content = null;
+        return $this;
+    }
+
+    /**
+     * Returns the number of lines.
+     *
+     * @return int|null The number of lines, relative to the starting line. NULL
+     *     means "to the end".
+     */
+    public function getLineCount()
+    {
+        return $this->lineCount;
+    }
+
+    /**
+     * Sets the number of lines.
+     * 
+     * @param int|null $lineCount The new number of lines, relative to the
+     *     starting line. NULL means "to the end".
+     * 
+     * @return $this
+     */
+    public function setLineCount($lineCount)
+    {
+        $this->lineCount = $lineCount;
+
+        $this->content = null;
+        return $this;
+    }
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/ThrowsTag.php

@@ -0,0 +1,24 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Mike van Riel <mike.vanriel@naenius.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Tag;
+
+/**
+ * Reflection class for a @throws tag in a Docblock.
+ *
+ * @author  Mike van Riel <mike.vanriel@naenius.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class ThrowsTag extends ReturnTag
+{
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/UsesTag.php

@@ -0,0 +1,24 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Mike van Riel <mike.vanriel@naenius.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Tag;
+
+/**
+ * Reflection class for a @uses tag in a Docblock.
+ *
+ * @author  Mike van Riel <mike.vanriel@naenius.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class UsesTag extends SeeTag
+{
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/VarTag.php

@@ -0,0 +1,24 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Mike van Riel <mike.vanriel@naenius.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Tag;
+
+/**
+ * Reflection class for a @var tag in a Docblock.
+ *
+ * @author  Mike van Riel <mike.vanriel@naenius.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class VarTag extends ParamTag
+{
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/VersionTag.php

@@ -0,0 +1,108 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Vasil Rangelov <boen.robot@gmail.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Tag;
+
+use Barryvdh\Reflection\DocBlock\Tag;
+
+/**
+ * Reflection class for a @version tag in a Docblock.
+ *
+ * @author  Vasil Rangelov <boen.robot@gmail.com>
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ * @link    http://phpdoc.org
+ */
+class VersionTag extends Tag
+{
+    /**
+     * PCRE regular expression matching a version vector.
+     * Assumes the "x" modifier.
+     */
+    const REGEX_VECTOR = '(?:
+        # Normal release vectors.
+        \d\S*
+        |
+        # VCS version vectors. Per PHPCS, they are expected to
+        # follow the form of the VCS name, followed by ":", followed
+        # by the version vector itself.
+        # By convention, popular VCSes like CVS, SVN and GIT use "$"
+        # around the actual version vector.
+        [^\s\:]+\:\s*\$[^\$]+\$
+    )';
+
+    /** @var string The version vector. */
+    protected $version = '';
+    
+    public function getContent()
+    {
+        if (null === $this->content) {
+            $this->content = "{$this->version} {$this->description}";
+        }
+
+        return $this->content;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function setContent($content)
+    {
+        parent::setContent($content);
+
+        if (preg_match(
+            '/^
+                # The version vector
+                (' . self::REGEX_VECTOR . ')
+                \s*
+                # The description
+                (.+)?
+            $/sux',
+            $this->description,
+            $matches
+        )) {
+            $this->version = $matches[1];
+            $this->setDescription(isset($matches[2]) ? $matches[2] : '');
+            $this->content = $content;
+        }
+
+        return $this;
+    }
+
+    /**
+     * Gets the version section of the tag.
+     *
+     * @return string The version section of the tag.
+     */
+    public function getVersion()
+    {
+        return $this->version;
+    }
+    
+    /**
+     * Sets the version section of the tag.
+     * 
+     * @param string $version The new version section of the tag.
+     *     An invalid value will set an empty string.
+     * 
+     * @return $this
+     */
+    public function setVersion($version)
+    {
+        $this->version
+            = preg_match('/^' . self::REGEX_VECTOR . '$/ux', $version)
+            ? $version
+            : '';
+
+        $this->content = null;
+        return $this;
+    }
+}

vendor/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Type/Collection.php

@@ -0,0 +1,283 @@
+<?php
+/**
+ * phpDocumentor
+ *
+ * PHP Version 5.3
+ *
+ * @author    Mike van Riel <mike.vanriel@naenius.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+
+namespace Barryvdh\Reflection\DocBlock\Type;
+
+use Barryvdh\Reflection\DocBlock\Context;
+
+/**
+ * Collection
+ *
+ * @author    Mike van Riel <mike.vanriel@naenius.com>
+ * @copyright 2010-2011 Mike van Riel / Naenius (http://www.naenius.com)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      http://phpdoc.org
+ */
+class Collection extends \ArrayObject
+{
+    /** @var string Definition of the OR operator for types */
+    const OPERATOR_OR = '|';
+
+    /** @var string Definition of the ARRAY operator for types */
+    const OPERATOR_ARRAY = '[]';
+
+    /** @var string Definition of the NAMESPACE operator in PHP */
+    const OPERATOR_NAMESPACE = '\\';
+
+    /** @var string[] List of recognized keywords */
+    protected static $keywords = array(
+        'string', 'int', 'integer', 'bool', 'boolean', 'float', 'double',
+        'object', 'mixed', 'array', 'resource', 'void', 'null', 'scalar',
+        'callback', 'callable', 'false', 'true', 'self', '$this', 'static'
+    );
+
+    /**
+     * Current invoking location.
+     *
+     * This is used to prepend to type with a relative location.
+     * May also be 'default' or 'global', in which case they are ignored.
+     *
+     * @var Context
+     */
+    protected $context = null;
+
+    /**
+     * Registers the namespace and aliases; uses that to add and expand the
+     * given types.
+     *
+     * @param string[] $types    Array containing a list of types to add to this
+     *     container.
+     * @param Context  $location The current invoking location.
+     */
+    public function __construct(
+        array $types = array(),
+        Context $context = null
+    ) {
+        $this->context = null === $context ? new Context() : $context;
+
+        foreach ($types as $type) {
+            $this->add($type);
+        }
+    }
+
+    /**
+     * Returns the current invoking location.
+     *
+     * @return Context
+     */
+    public function getContext()
+    {
+        return $this->context;
+    }
+
+    /**
+     * Adds a new type to the collection and expands it if it contains a
+     * relative namespace.
+     *
+     * If a class in the type contains a relative namespace than this collection
+     * will try to expand that into a FQCN.
+     *
+     * @param string $type A 'Type' as defined in the phpDocumentor
+     *     documentation.
+     *
+     * @throws \InvalidArgumentException if a non-string argument is passed.
+     *
+     * @see http://phpdoc.org/docs/latest/for-users/types.html for the
+     *     definition of a type.
+     *
+     * @return void
+     */
+    public function add($type)
+    {
+        if (!is_string($type)) {
+            throw new \InvalidArgumentException(
+                'A type should be represented by a string, received: '
+                .var_export($type, true)
+            );
+        }
+
+        // separate the type by the OR operator
+        $type_parts = $this->explode($type);
+        foreach ($type_parts as $part) {
+            $expanded_type = $this->expand($part);
+            if ($expanded_type) {
+                $this[] = $expanded_type;
+            }
+        }
+    }
+
+    /**
+     * Returns a string representation of the collection.
+     *
+     * @return string The resolved types across the collection, separated with
+     *     {@link self::OPERATOR_OR}.
+     */
+    public function __toString()
+    {
+        return implode(self::OPERATOR_OR, $this->getArrayCopy());
+    }
+
+    /**
+     * Analyzes the given union of types and returns separated by OR operator
+     * single types.
+     *
+     * @param string $type The type or union of types
+     *
+     * @return array
+     */
+    protected function explode($type)
+    {
+        $type_parts = [];
+        $curr_type = '';
+        $nest_level = 0;
+
+        foreach (str_split($type) as $char) {
+            if ($char === self::OPERATOR_OR && $nest_level === 0) {
+                $type_parts[] = $curr_type;
+                $curr_type = '';
+            } else {
+                if ($char === '<') {
+                    $nest_level++;
+                } else if ($char === '>') {
+                    $nest_level--;
+                }
+
+                $curr_type .= $char;
+            }
+        }
+
+        $type_parts[] = $curr_type;
+
+        return $type_parts;
+    }
+
+    /**
+     * Analyzes the given type and returns the FQCN variant.
+     *
+     * When a type is provided this method checks whether it is not a keyword or
+     * Fully Qualified Class Name. If so it will use the given namespace and
+     * aliases to expand the type to a FQCN representation.
+     *
+     * This method only works as expected if the namespace and aliases are set;
+     * no dynamic reflection is being performed here.
+     *
+     * @param string $type The relative or absolute type.
+     *
+     * @uses getNamespace to determine with what to prefix the type name.
+     * @uses getNamespaceAliases to check whether the first part of the relative
+     *     type name should not be replaced with another namespace.
+     *
+     * @return string
+     */
+    protected function expand($type)
+    {
+        $type = trim($type);
+        if (!$type) {
+            return '';
+        }
+
+        if (substr($type, 0, 6) === 'array<' && substr($type, -1) === '>') {
+            return $type;
+        }
+
+        if ($this->isTypeAnArray($type)) {
+            return $this->expand(substr($type, 0, -2)) . self::OPERATOR_ARRAY;
+        }
+
+        if ($this->isRelativeType($type) && !$this->isTypeAKeyword($type)) {
+
+            if($this->shouldBeAbsolute($type)){
+                return self::OPERATOR_NAMESPACE . $type;
+            }
+
+            $type_parts = explode(self::OPERATOR_NAMESPACE, $type, 2);
+
+            $namespace_aliases = $this->context->getNamespaceAliases();
+            // if the first segment is not an alias; prepend namespace name and
+            // return
+            if (!isset($namespace_aliases[$type_parts[0]]) &&
+                !isset($namespace_aliases[strstr($type_parts[0], '::', true)])) {
+                $namespace = $this->context->getNamespace();
+                if ('' !== $namespace) {
+                    $namespace .= self::OPERATOR_NAMESPACE;
+                }
+                return self::OPERATOR_NAMESPACE . $namespace . $type;
+            }
+
+            if (strpos($type_parts[0], '::')) {
+                $type_parts[] = strstr($type_parts[0], '::');
+                $type_parts[0] = $namespace_aliases[strstr($type_parts[0], '::', true)];
+                return implode('', $type_parts);
+            }
+
+            $type_parts[0] = $namespace_aliases[$type_parts[0]];
+            $type = implode(self::OPERATOR_NAMESPACE, $type_parts);
+        }
+
+        return $type;
+    }
+
+    /**
+     * Detects whether the given type represents an array.
+     *
+     * @param string $type A relative or absolute type as defined in the
+     *     phpDocumentor documentation.
+     *
+     * @return bool
+     */
+    protected function isTypeAnArray($type)
+    {
+        return substr($type, -2) === self::OPERATOR_ARRAY;
+    }
+
+    /**
+     * Detects whether the given type represents a PHPDoc keyword.
+     *
+     * @param string $type A relative or absolute type as defined in the
+     *     phpDocumentor documentation.
+     *
+     * @return bool
+     */
+    protected function isTypeAKeyword($type)
+    {
+        return in_array(strtolower($type), static::$keywords, true);
+    }
+
+    /**
+     * Detects whether the given type represents a relative or absolute path.
+     *
+     * This method will detect keywords as being absolute; even though they are
+     * not preceeded by a namespace separator.
+     *
+     * @param string $type A relative or absolute type as defined in the
+     *     phpDocumentor documentation.
+     *
+     * @return bool
+     */
+    protected function isRelativeType($type)
+    {
+        return ($type[0] !== self::OPERATOR_NAMESPACE)
+            || $this->isTypeAKeyword($type);
+    }
+
+    /**
+     * Detects if the type should actually be absolute, by checking if it exists.
+     *
+     * @param string $type A relative or absolute type as defined in the
+     *     phpDocumentor documentation.
+     *
+     * @return bool
+     */
+    protected function shouldBeAbsolute($type){
+        return class_exists($type);
+    }
+}

vendor/bin/doctrine-dbal

@@ -0,0 +1,120 @@
+#!/usr/bin/env php
+<?php
+
+/**
+ * Proxy PHP file generated by Composer
+ *
+ * This file includes the referenced bin path (../doctrine/dbal/bin/doctrine-dbal)
+ * using a stream wrapper to prevent the shebang from being output on PHP<8
+ *
+ * @generated
+ */
+
+namespace Composer;
+
+$GLOBALS['_composer_bin_dir'] = __DIR__;
+$GLOBALS['_composer_autoload_path'] = __DIR__ . '/..'.'/autoload.php';
+
+if (PHP_VERSION_ID < 80000) {
+    if (!class_exists('Composer\BinProxyWrapper')) {
+        /**
+         * @internal
+         */
+        final class BinProxyWrapper
+        {
+            private $handle;
+            private $position;
+            private $realpath;
+
+            public function stream_open($path, $mode, $options, &$opened_path)
+            {
+                // get rid of phpvfscomposer:// prefix for __FILE__ & __DIR__ resolution
+                $opened_path = substr($path, 17);
+                $this->realpath = realpath($opened_path) ?: $opened_path;
+                $opened_path = $this->realpath;
+                $this->handle = fopen($this->realpath, $mode);
+                $this->position = 0;
+
+                return (bool) $this->handle;
+            }
+
+            public function stream_read($count)
+            {
+                $data = fread($this->handle, $count);
+
+                if ($this->position === 0) {
+                    $data = preg_replace('{^#!.*\r?\n}', '', $data);
+                }
+
+                $this->position += strlen($data);
+
+                return $data;
+            }
+
+            public function stream_cast($castAs)
+            {
+                return $this->handle;
+            }
+
+            public function stream_close()
+            {
+                fclose($this->handle);
+            }
+
+            public function stream_lock($operation)
+            {
+                return $operation ? flock($this->handle, $operation) : true;
+            }
+
+            public function stream_seek($offset, $whence)
+            {
+                if (0 === fseek($this->handle, $offset, $whence)) {
+                    $this->position = ftell($this->handle);
+                    return true;
+                }
+
+                return false;
+            }
+
+            public function stream_tell()
+            {
+                return $this->position;
+            }
+
+            public function stream_eof()
+            {
+                return feof($this->handle);
+            }
+
+            public function stream_stat()
+            {
+                return array();
+            }
+
+            public function stream_set_option($option, $arg1, $arg2)
+            {
+                return true;
+            }
+
+            public function url_stat($path, $flags)
+            {
+                $path = substr($path, 17);
+                if (file_exists($path)) {
+                    return stat($path);
+                }
+
+                return false;
+            }
+        }
+    }
+
+    if (
+        (function_exists('stream_get_wrappers') && in_array('phpvfscomposer', stream_get_wrappers(), true))
+        || (function_exists('stream_wrapper_register') && stream_wrapper_register('phpvfscomposer', 'Composer\BinProxyWrapper'))
+    ) {
+        include("phpvfscomposer://" . __DIR__ . '/..'.'/doctrine/dbal/bin/doctrine-dbal');
+        exit(0);
+    }
+}
+
+include __DIR__ . '/..'.'/doctrine/dbal/bin/doctrine-dbal';

vendor/composer/autoload_classmap.php

@@ -17,6 +17,7 @@ return array(
     'App\\Http\\Controllers\\Auth\\ResetPasswordController' => $baseDir . '/app/Http/Controllers/Auth/ResetPasswordController.php',
     'App\\Http\\Controllers\\Controller' => $baseDir . '/app/Http/Controllers/Controller.php',
     'App\\Http\\Controllers\\HomeController' => $baseDir . '/app/Http/Controllers/HomeController.php',
+    'App\\Http\\Controllers\\ImportController' => $baseDir . '/app/Http/Controllers/ImportController.php',
     'App\\Http\\Controllers\\ItemController' => $baseDir . '/app/Http/Controllers/ItemController.php',
     'App\\Http\\Controllers\\ItemRestController' => $baseDir . '/app/Http/Controllers/ItemRestController.php',
     'App\\Http\\Controllers\\SearchController' => $baseDir . '/app/Http/Controllers/SearchController.php',
@@ -54,6 +55,7 @@ return array(
     'App\\SupportedApps\\AriaNg\\AriaNg' => $baseDir . '/app/SupportedApps/AriaNg/AriaNg.php',
     'App\\SupportedApps\\Atlantis\\Atlantis' => $baseDir . '/app/SupportedApps/Atlantis/Atlantis.php',
     'App\\SupportedApps\\Bastillion\\Bastillion' => $baseDir . '/app/SupportedApps/Bastillion/Bastillion.php',
+    'App\\SupportedApps\\Jellyfin\\Jellyfin' => $baseDir . '/app/SupportedApps/Jellyfin/Jellyfin.php',
     'App\\SupportedApps\\Jira\\Jira' => $baseDir . '/app/SupportedApps/Jira/Jira.php',
     'App\\SupportedApps\\Kibana\\Kibana' => $baseDir . '/app/SupportedApps/Kibana/Kibana.php',
     'App\\SupportedApps\\MotionEye\\MotionEye' => $baseDir . '/app/SupportedApps/MotionEye/MotionEye.php',
@@ -74,6 +76,46 @@ return array(
     'App\\SupportedApps\\UniFi\\UniFi' => $baseDir . '/app/SupportedApps/UniFi/UniFi.php',
     'App\\User' => $baseDir . '/app/User.php',
     'Attribute' => $vendorDir . '/symfony/polyfill-php80/Resources/stubs/Attribute.php',
+    'Barryvdh\\LaravelIdeHelper\\Alias' => $vendorDir . '/barryvdh/laravel-ide-helper/src/Alias.php',
+    'Barryvdh\\LaravelIdeHelper\\ClassMapGenerator' => $vendorDir . '/barryvdh/laravel-ide-helper/src/ClassMapGenerator.php',
+    'Barryvdh\\LaravelIdeHelper\\Console\\EloquentCommand' => $vendorDir . '/barryvdh/laravel-ide-helper/src/Console/EloquentCommand.php',
+    'Barryvdh\\LaravelIdeHelper\\Console\\GeneratorCommand' => $vendorDir . '/barryvdh/laravel-ide-helper/src/Console/GeneratorCommand.php',
+    'Barryvdh\\LaravelIdeHelper\\Console\\MetaCommand' => $vendorDir . '/barryvdh/laravel-ide-helper/src/Console/MetaCommand.php',
+    'Barryvdh\\LaravelIdeHelper\\Console\\ModelsCommand' => $vendorDir . '/barryvdh/laravel-ide-helper/src/Console/ModelsCommand.php',
+    'Barryvdh\\LaravelIdeHelper\\Contracts\\ModelHookInterface' => $vendorDir . '/barryvdh/laravel-ide-helper/src/Contracts/ModelHookInterface.php',
+    'Barryvdh\\LaravelIdeHelper\\Eloquent' => $vendorDir . '/barryvdh/laravel-ide-helper/src/Eloquent.php',
+    'Barryvdh\\LaravelIdeHelper\\Factories' => $vendorDir . '/barryvdh/laravel-ide-helper/src/Factories.php',
+    'Barryvdh\\LaravelIdeHelper\\Generator' => $vendorDir . '/barryvdh/laravel-ide-helper/src/Generator.php',
+    'Barryvdh\\LaravelIdeHelper\\IdeHelperServiceProvider' => $vendorDir . '/barryvdh/laravel-ide-helper/src/IdeHelperServiceProvider.php',
+    'Barryvdh\\LaravelIdeHelper\\Listeners\\GenerateModelHelper' => $vendorDir . '/barryvdh/laravel-ide-helper/src/Listeners/GenerateModelHelper.php',
+    'Barryvdh\\LaravelIdeHelper\\Macro' => $vendorDir . '/barryvdh/laravel-ide-helper/src/Macro.php',
+    'Barryvdh\\LaravelIdeHelper\\Method' => $vendorDir . '/barryvdh/laravel-ide-helper/src/Method.php',
+    'Barryvdh\\LaravelIdeHelper\\UsesResolver' => $vendorDir . '/barryvdh/laravel-ide-helper/src/UsesResolver.php',
+    'Barryvdh\\Reflection\\DocBlock' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock.php',
+    'Barryvdh\\Reflection\\DocBlock\\Context' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Context.php',
+    'Barryvdh\\Reflection\\DocBlock\\Description' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Description.php',
+    'Barryvdh\\Reflection\\DocBlock\\Location' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Location.php',
+    'Barryvdh\\Reflection\\DocBlock\\Serializer' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Serializer.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag\\AuthorTag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/AuthorTag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag\\CoversTag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/CoversTag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag\\DeprecatedTag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/DeprecatedTag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag\\ExampleTag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/ExampleTag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag\\LinkTag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/LinkTag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag\\MethodTag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/MethodTag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag\\ParamTag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/ParamTag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag\\PropertyReadTag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/PropertyReadTag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag\\PropertyTag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/PropertyTag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag\\PropertyWriteTag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/PropertyWriteTag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag\\ReturnTag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/ReturnTag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag\\SeeTag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/SeeTag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag\\SinceTag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/SinceTag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag\\SourceTag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/SourceTag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag\\ThrowsTag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/ThrowsTag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag\\UsesTag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/UsesTag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag\\VarTag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/VarTag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Tag\\VersionTag' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/VersionTag.php',
+    'Barryvdh\\Reflection\\DocBlock\\Type\\Collection' => $vendorDir . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Type/Collection.php',
     'Brick\\Math\\BigDecimal' => $vendorDir . '/brick/math/src/BigDecimal.php',
     'Brick\\Math\\BigInteger' => $vendorDir . '/brick/math/src/BigInteger.php',
     'Brick\\Math\\BigNumber' => $vendorDir . '/brick/math/src/BigNumber.php',
@@ -178,6 +220,17 @@ return array(
     'Collective\\Html\\HtmlFacade' => $vendorDir . '/laravelcollective/html/src/HtmlFacade.php',
     'Collective\\Html\\HtmlServiceProvider' => $vendorDir . '/laravelcollective/html/src/HtmlServiceProvider.php',
     'Composer\\InstalledVersions' => $vendorDir . '/composer/InstalledVersions.php',
+    'Composer\\Pcre\\MatchAllResult' => $vendorDir . '/composer/pcre/src/MatchAllResult.php',
+    'Composer\\Pcre\\MatchAllStrictGroupsResult' => $vendorDir . '/composer/pcre/src/MatchAllStrictGroupsResult.php',
+    'Composer\\Pcre\\MatchAllWithOffsetsResult' => $vendorDir . '/composer/pcre/src/MatchAllWithOffsetsResult.php',
+    'Composer\\Pcre\\MatchResult' => $vendorDir . '/composer/pcre/src/MatchResult.php',
+    'Composer\\Pcre\\MatchStrictGroupsResult' => $vendorDir . '/composer/pcre/src/MatchStrictGroupsResult.php',
+    'Composer\\Pcre\\MatchWithOffsetsResult' => $vendorDir . '/composer/pcre/src/MatchWithOffsetsResult.php',
+    'Composer\\Pcre\\PcreException' => $vendorDir . '/composer/pcre/src/PcreException.php',
+    'Composer\\Pcre\\Preg' => $vendorDir . '/composer/pcre/src/Preg.php',
+    'Composer\\Pcre\\Regex' => $vendorDir . '/composer/pcre/src/Regex.php',
+    'Composer\\Pcre\\ReplaceResult' => $vendorDir . '/composer/pcre/src/ReplaceResult.php',
+    'Composer\\Pcre\\UnexpectedNullMatchException' => $vendorDir . '/composer/pcre/src/UnexpectedNullMatchException.php',
     'Cron\\AbstractField' => $vendorDir . '/dragonmantank/cron-expression/src/Cron/AbstractField.php',
     'Cron\\CronExpression' => $vendorDir . '/dragonmantank/cron-expression/src/Cron/CronExpression.php',
     'Cron\\DayOfMonthField' => $vendorDir . '/dragonmantank/cron-expression/src/Cron/DayOfMonthField.php',
@@ -188,6 +241,7 @@ return array(
     'Cron\\HoursField' => $vendorDir . '/dragonmantank/cron-expression/src/Cron/HoursField.php',
     'Cron\\MinutesField' => $vendorDir . '/dragonmantank/cron-expression/src/Cron/MinutesField.php',
     'Cron\\MonthField' => $vendorDir . '/dragonmantank/cron-expression/src/Cron/MonthField.php',
+    'Database\\Factories\\ItemFactory' => $baseDir . '/database/factories/ItemFactory.php',
     'Database\\Factories\\UserFactory' => $baseDir . '/database/factories/UserFactory.php',
     'Database\\Seeders\\DatabaseSeeder' => $baseDir . '/database/seeders/DatabaseSeeder.php',
     'Database\\Seeders\\SettingsSeeder' => $baseDir . '/database/seeders/SettingsSeeder.php',
@@ -222,7 +276,333 @@ return array(
     'Dflydev\\DotAccessData\\Exception\\InvalidPathException' => $vendorDir . '/dflydev/dot-access-data/src/Exception/InvalidPathException.php',
     'Dflydev\\DotAccessData\\Exception\\MissingPathException' => $vendorDir . '/dflydev/dot-access-data/src/Exception/MissingPathException.php',
     'Dflydev\\DotAccessData\\Util' => $vendorDir . '/dflydev/dot-access-data/src/Util.php',
+    'Doctrine\\Common\\Cache\\Cache' => $vendorDir . '/doctrine/cache/lib/Doctrine/Common/Cache/Cache.php',
+    'Doctrine\\Common\\Cache\\CacheProvider' => $vendorDir . '/doctrine/cache/lib/Doctrine/Common/Cache/CacheProvider.php',
+    'Doctrine\\Common\\Cache\\ClearableCache' => $vendorDir . '/doctrine/cache/lib/Doctrine/Common/Cache/ClearableCache.php',
+    'Doctrine\\Common\\Cache\\FlushableCache' => $vendorDir . '/doctrine/cache/lib/Doctrine/Common/Cache/FlushableCache.php',
+    'Doctrine\\Common\\Cache\\MultiDeleteCache' => $vendorDir . '/doctrine/cache/lib/Doctrine/Common/Cache/MultiDeleteCache.php',
+    'Doctrine\\Common\\Cache\\MultiGetCache' => $vendorDir . '/doctrine/cache/lib/Doctrine/Common/Cache/MultiGetCache.php',
+    'Doctrine\\Common\\Cache\\MultiOperationCache' => $vendorDir . '/doctrine/cache/lib/Doctrine/Common/Cache/MultiOperationCache.php',
+    'Doctrine\\Common\\Cache\\MultiPutCache' => $vendorDir . '/doctrine/cache/lib/Doctrine/Common/Cache/MultiPutCache.php',
+    'Doctrine\\Common\\Cache\\Psr6\\CacheAdapter' => $vendorDir . '/doctrine/cache/lib/Doctrine/Common/Cache/Psr6/CacheAdapter.php',
+    'Doctrine\\Common\\Cache\\Psr6\\CacheItem' => $vendorDir . '/doctrine/cache/lib/Doctrine/Common/Cache/Psr6/CacheItem.php',
+    'Doctrine\\Common\\Cache\\Psr6\\DoctrineProvider' => $vendorDir . '/doctrine/cache/lib/Doctrine/Common/Cache/Psr6/DoctrineProvider.php',
+    'Doctrine\\Common\\Cache\\Psr6\\InvalidArgument' => $vendorDir . '/doctrine/cache/lib/Doctrine/Common/Cache/Psr6/InvalidArgument.php',
+    'Doctrine\\Common\\Cache\\Psr6\\TypedCacheItem' => $vendorDir . '/doctrine/cache/lib/Doctrine/Common/Cache/Psr6/TypedCacheItem.php',
+    'Doctrine\\Common\\EventArgs' => $vendorDir . '/doctrine/event-manager/src/EventArgs.php',
+    'Doctrine\\Common\\EventManager' => $vendorDir . '/doctrine/event-manager/src/EventManager.php',
+    'Doctrine\\Common\\EventSubscriber' => $vendorDir . '/doctrine/event-manager/src/EventSubscriber.php',
     'Doctrine\\Common\\Lexer\\AbstractLexer' => $vendorDir . '/doctrine/lexer/lib/Doctrine/Common/Lexer/AbstractLexer.php',
+    'Doctrine\\DBAL\\ArrayParameters\\Exception' => $vendorDir . '/doctrine/dbal/src/ArrayParameters/Exception.php',
+    'Doctrine\\DBAL\\ArrayParameters\\Exception\\MissingNamedParameter' => $vendorDir . '/doctrine/dbal/src/ArrayParameters/Exception/MissingNamedParameter.php',
+    'Doctrine\\DBAL\\ArrayParameters\\Exception\\MissingPositionalParameter' => $vendorDir . '/doctrine/dbal/src/ArrayParameters/Exception/MissingPositionalParameter.php',
+    'Doctrine\\DBAL\\Cache\\ArrayResult' => $vendorDir . '/doctrine/dbal/src/Cache/ArrayResult.php',
+    'Doctrine\\DBAL\\Cache\\CacheException' => $vendorDir . '/doctrine/dbal/src/Cache/CacheException.php',
+    'Doctrine\\DBAL\\Cache\\QueryCacheProfile' => $vendorDir . '/doctrine/dbal/src/Cache/QueryCacheProfile.php',
+    'Doctrine\\DBAL\\ColumnCase' => $vendorDir . '/doctrine/dbal/src/ColumnCase.php',
+    'Doctrine\\DBAL\\Configuration' => $vendorDir . '/doctrine/dbal/src/Configuration.php',
+    'Doctrine\\DBAL\\Connection' => $vendorDir . '/doctrine/dbal/src/Connection.php',
+    'Doctrine\\DBAL\\ConnectionException' => $vendorDir . '/doctrine/dbal/src/ConnectionException.php',
+    'Doctrine\\DBAL\\Connections\\PrimaryReadReplicaConnection' => $vendorDir . '/doctrine/dbal/src/Connections/PrimaryReadReplicaConnection.php',
+    'Doctrine\\DBAL\\Driver' => $vendorDir . '/doctrine/dbal/src/Driver.php',
+    'Doctrine\\DBAL\\DriverManager' => $vendorDir . '/doctrine/dbal/src/DriverManager.php',
+    'Doctrine\\DBAL\\Driver\\API\\ExceptionConverter' => $vendorDir . '/doctrine/dbal/src/Driver/API/ExceptionConverter.php',
+    'Doctrine\\DBAL\\Driver\\API\\IBMDB2\\ExceptionConverter' => $vendorDir . '/doctrine/dbal/src/Driver/API/IBMDB2/ExceptionConverter.php',
+    'Doctrine\\DBAL\\Driver\\API\\MySQL\\ExceptionConverter' => $vendorDir . '/doctrine/dbal/src/Driver/API/MySQL/ExceptionConverter.php',
+    'Doctrine\\DBAL\\Driver\\API\\OCI\\ExceptionConverter' => $vendorDir . '/doctrine/dbal/src/Driver/API/OCI/ExceptionConverter.php',
+    'Doctrine\\DBAL\\Driver\\API\\PostgreSQL\\ExceptionConverter' => $vendorDir . '/doctrine/dbal/src/Driver/API/PostgreSQL/ExceptionConverter.php',
+    'Doctrine\\DBAL\\Driver\\API\\SQLSrv\\ExceptionConverter' => $vendorDir . '/doctrine/dbal/src/Driver/API/SQLSrv/ExceptionConverter.php',
+    'Doctrine\\DBAL\\Driver\\API\\SQLite\\ExceptionConverter' => $vendorDir . '/doctrine/dbal/src/Driver/API/SQLite/ExceptionConverter.php',
+    'Doctrine\\DBAL\\Driver\\API\\SQLite\\UserDefinedFunctions' => $vendorDir . '/doctrine/dbal/src/Driver/API/SQLite/UserDefinedFunctions.php',
+    'Doctrine\\DBAL\\Driver\\AbstractDB2Driver' => $vendorDir . '/doctrine/dbal/src/Driver/AbstractDB2Driver.php',
+    'Doctrine\\DBAL\\Driver\\AbstractException' => $vendorDir . '/doctrine/dbal/src/Driver/AbstractException.php',
+    'Doctrine\\DBAL\\Driver\\AbstractMySQLDriver' => $vendorDir . '/doctrine/dbal/src/Driver/AbstractMySQLDriver.php',
+    'Doctrine\\DBAL\\Driver\\AbstractOracleDriver' => $vendorDir . '/doctrine/dbal/src/Driver/AbstractOracleDriver.php',
+    'Doctrine\\DBAL\\Driver\\AbstractOracleDriver\\EasyConnectString' => $vendorDir . '/doctrine/dbal/src/Driver/AbstractOracleDriver/EasyConnectString.php',
+    'Doctrine\\DBAL\\Driver\\AbstractPostgreSQLDriver' => $vendorDir . '/doctrine/dbal/src/Driver/AbstractPostgreSQLDriver.php',
+    'Doctrine\\DBAL\\Driver\\AbstractSQLServerDriver' => $vendorDir . '/doctrine/dbal/src/Driver/AbstractSQLServerDriver.php',
+    'Doctrine\\DBAL\\Driver\\AbstractSQLServerDriver\\Exception\\PortWithoutHost' => $vendorDir . '/doctrine/dbal/src/Driver/AbstractSQLServerDriver/Exception/PortWithoutHost.php',
+    'Doctrine\\DBAL\\Driver\\AbstractSQLiteDriver' => $vendorDir . '/doctrine/dbal/src/Driver/AbstractSQLiteDriver.php',
+    'Doctrine\\DBAL\\Driver\\AbstractSQLiteDriver\\Middleware\\EnableForeignKeys' => $vendorDir . '/doctrine/dbal/src/Driver/AbstractSQLiteDriver/Middleware/EnableForeignKeys.php',
+    'Doctrine\\DBAL\\Driver\\Connection' => $vendorDir . '/doctrine/dbal/src/Driver/Connection.php',
+    'Doctrine\\DBAL\\Driver\\Exception' => $vendorDir . '/doctrine/dbal/src/Driver/Exception.php',
+    'Doctrine\\DBAL\\Driver\\Exception\\UnknownParameterType' => $vendorDir . '/doctrine/dbal/src/Driver/Exception/UnknownParameterType.php',
+    'Doctrine\\DBAL\\Driver\\FetchUtils' => $vendorDir . '/doctrine/dbal/src/Driver/FetchUtils.php',
+    'Doctrine\\DBAL\\Driver\\IBMDB2\\Connection' => $vendorDir . '/doctrine/dbal/src/Driver/IBMDB2/Connection.php',
+    'Doctrine\\DBAL\\Driver\\IBMDB2\\DataSourceName' => $vendorDir . '/doctrine/dbal/src/Driver/IBMDB2/DataSourceName.php',
+    'Doctrine\\DBAL\\Driver\\IBMDB2\\Driver' => $vendorDir . '/doctrine/dbal/src/Driver/IBMDB2/Driver.php',
+    'Doctrine\\DBAL\\Driver\\IBMDB2\\Exception\\CannotCopyStreamToStream' => $vendorDir . '/doctrine/dbal/src/Driver/IBMDB2/Exception/CannotCopyStreamToStream.php',
+    'Doctrine\\DBAL\\Driver\\IBMDB2\\Exception\\CannotCreateTemporaryFile' => $vendorDir . '/doctrine/dbal/src/Driver/IBMDB2/Exception/CannotCreateTemporaryFile.php',
+    'Doctrine\\DBAL\\Driver\\IBMDB2\\Exception\\ConnectionError' => $vendorDir . '/doctrine/dbal/src/Driver/IBMDB2/Exception/ConnectionError.php',
+    'Doctrine\\DBAL\\Driver\\IBMDB2\\Exception\\ConnectionFailed' => $vendorDir . '/doctrine/dbal/src/Driver/IBMDB2/Exception/ConnectionFailed.php',
+    'Doctrine\\DBAL\\Driver\\IBMDB2\\Exception\\Factory' => $vendorDir . '/doctrine/dbal/src/Driver/IBMDB2/Exception/Factory.php',
+    'Doctrine\\DBAL\\Driver\\IBMDB2\\Exception\\PrepareFailed' => $vendorDir . '/doctrine/dbal/src/Driver/IBMDB2/Exception/PrepareFailed.php',
+    'Doctrine\\DBAL\\Driver\\IBMDB2\\Exception\\StatementError' => $vendorDir . '/doctrine/dbal/src/Driver/IBMDB2/Exception/StatementError.php',
+    'Doctrine\\DBAL\\Driver\\IBMDB2\\Result' => $vendorDir . '/doctrine/dbal/src/Driver/IBMDB2/Result.php',
+    'Doctrine\\DBAL\\Driver\\IBMDB2\\Statement' => $vendorDir . '/doctrine/dbal/src/Driver/IBMDB2/Statement.php',
+    'Doctrine\\DBAL\\Driver\\Middleware' => $vendorDir . '/doctrine/dbal/src/Driver/Middleware.php',
+    'Doctrine\\DBAL\\Driver\\Middleware\\AbstractConnectionMiddleware' => $vendorDir . '/doctrine/dbal/src/Driver/Middleware/AbstractConnectionMiddleware.php',
+    'Doctrine\\DBAL\\Driver\\Middleware\\AbstractDriverMiddleware' => $vendorDir . '/doctrine/dbal/src/Driver/Middleware/AbstractDriverMiddleware.php',
+    'Doctrine\\DBAL\\Driver\\Middleware\\AbstractResultMiddleware' => $vendorDir . '/doctrine/dbal/src/Driver/Middleware/AbstractResultMiddleware.php',
+    'Doctrine\\DBAL\\Driver\\Middleware\\AbstractStatementMiddleware' => $vendorDir . '/doctrine/dbal/src/Driver/Middleware/AbstractStatementMiddleware.php',
+    'Doctrine\\DBAL\\Driver\\Mysqli\\Connection' => $vendorDir . '/doctrine/dbal/src/Driver/Mysqli/Connection.php',
+    'Doctrine\\DBAL\\Driver\\Mysqli\\Driver' => $vendorDir . '/doctrine/dbal/src/Driver/Mysqli/Driver.php',
+    'Doctrine\\DBAL\\Driver\\Mysqli\\Exception\\ConnectionError' => $vendorDir . '/doctrine/dbal/src/Driver/Mysqli/Exception/ConnectionError.php',
+    'Doctrine\\DBAL\\Driver\\Mysqli\\Exception\\ConnectionFailed' => $vendorDir . '/doctrine/dbal/src/Driver/Mysqli/Exception/ConnectionFailed.php',
+    'Doctrine\\DBAL\\Driver\\Mysqli\\Exception\\FailedReadingStreamOffset' => $vendorDir . '/doctrine/dbal/src/Driver/Mysqli/Exception/FailedReadingStreamOffset.php',
+    'Doctrine\\DBAL\\Driver\\Mysqli\\Exception\\HostRequired' => $vendorDir . '/doctrine/dbal/src/Driver/Mysqli/Exception/HostRequired.php',
+    'Doctrine\\DBAL\\Driver\\Mysqli\\Exception\\InvalidCharset' => $vendorDir . '/doctrine/dbal/src/Driver/Mysqli/Exception/InvalidCharset.php',
+    'Doctrine\\DBAL\\Driver\\Mysqli\\Exception\\InvalidOption' => $vendorDir . '/doctrine/dbal/src/Driver/Mysqli/Exception/InvalidOption.php',
+    'Doctrine\\DBAL\\Driver\\Mysqli\\Exception\\NonStreamResourceUsedAsLargeObject' => $vendorDir . '/doctrine/dbal/src/Driver/Mysqli/Exception/NonStreamResourceUsedAsLargeObject.php',
+    'Doctrine\\DBAL\\Driver\\Mysqli\\Exception\\StatementError' => $vendorDir . '/doctrine/dbal/src/Driver/Mysqli/Exception/StatementError.php',
+    'Doctrine\\DBAL\\Driver\\Mysqli\\Initializer' => $vendorDir . '/doctrine/dbal/src/Driver/Mysqli/Initializer.php',
+    'Doctrine\\DBAL\\Driver\\Mysqli\\Initializer\\Charset' => $vendorDir . '/doctrine/dbal/src/Driver/Mysqli/Initializer/Charset.php',
+    'Doctrine\\DBAL\\Driver\\Mysqli\\Initializer\\Options' => $vendorDir . '/doctrine/dbal/src/Driver/Mysqli/Initializer/Options.php',
+    'Doctrine\\DBAL\\Driver\\Mysqli\\Initializer\\Secure' => $vendorDir . '/doctrine/dbal/src/Driver/Mysqli/Initializer/Secure.php',
+    'Doctrine\\DBAL\\Driver\\Mysqli\\Result' => $vendorDir . '/doctrine/dbal/src/Driver/Mysqli/Result.php',
+    'Doctrine\\DBAL\\Driver\\Mysqli\\Statement' => $vendorDir . '/doctrine/dbal/src/Driver/Mysqli/Statement.php',
+    'Doctrine\\DBAL\\Driver\\OCI8\\Connection' => $vendorDir . '/doctrine/dbal/src/Driver/OCI8/Connection.php',
+    'Doctrine\\DBAL\\Driver\\OCI8\\ConvertPositionalToNamedPlaceholders' => $vendorDir . '/doctrine/dbal/src/Driver/OCI8/ConvertPositionalToNamedPlaceholders.php',
+    'Doctrine\\DBAL\\Driver\\OCI8\\Driver' => $vendorDir . '/doctrine/dbal/src/Driver/OCI8/Driver.php',
+    'Doctrine\\DBAL\\Driver\\OCI8\\Exception\\ConnectionFailed' => $vendorDir . '/doctrine/dbal/src/Driver/OCI8/Exception/ConnectionFailed.php',
+    'Doctrine\\DBAL\\Driver\\OCI8\\Exception\\Error' => $vendorDir . '/doctrine/dbal/src/Driver/OCI8/Exception/Error.php',
+    'Doctrine\\DBAL\\Driver\\OCI8\\Exception\\NonTerminatedStringLiteral' => $vendorDir . '/doctrine/dbal/src/Driver/OCI8/Exception/NonTerminatedStringLiteral.php',
+    'Doctrine\\DBAL\\Driver\\OCI8\\Exception\\SequenceDoesNotExist' => $vendorDir . '/doctrine/dbal/src/Driver/OCI8/Exception/SequenceDoesNotExist.php',
+    'Doctrine\\DBAL\\Driver\\OCI8\\Exception\\UnknownParameterIndex' => $vendorDir . '/doctrine/dbal/src/Driver/OCI8/Exception/UnknownParameterIndex.php',
+    'Doctrine\\DBAL\\Driver\\OCI8\\ExecutionMode' => $vendorDir . '/doctrine/dbal/src/Driver/OCI8/ExecutionMode.php',
+    'Doctrine\\DBAL\\Driver\\OCI8\\Middleware\\InitializeSession' => $vendorDir . '/doctrine/dbal/src/Driver/OCI8/Middleware/InitializeSession.php',
+    'Doctrine\\DBAL\\Driver\\OCI8\\Result' => $vendorDir . '/doctrine/dbal/src/Driver/OCI8/Result.php',
+    'Doctrine\\DBAL\\Driver\\OCI8\\Statement' => $vendorDir . '/doctrine/dbal/src/Driver/OCI8/Statement.php',
+    'Doctrine\\DBAL\\Driver\\PDO\\Connection' => $vendorDir . '/doctrine/dbal/src/Driver/PDO/Connection.php',
+    'Doctrine\\DBAL\\Driver\\PDO\\Exception' => $vendorDir . '/doctrine/dbal/src/Driver/PDO/Exception.php',
+    'Doctrine\\DBAL\\Driver\\PDO\\MySQL\\Driver' => $vendorDir . '/doctrine/dbal/src/Driver/PDO/MySQL/Driver.php',
+    'Doctrine\\DBAL\\Driver\\PDO\\OCI\\Driver' => $vendorDir . '/doctrine/dbal/src/Driver/PDO/OCI/Driver.php',
+    'Doctrine\\DBAL\\Driver\\PDO\\PgSQL\\Driver' => $vendorDir . '/doctrine/dbal/src/Driver/PDO/PgSQL/Driver.php',
+    'Doctrine\\DBAL\\Driver\\PDO\\Result' => $vendorDir . '/doctrine/dbal/src/Driver/PDO/Result.php',
+    'Doctrine\\DBAL\\Driver\\PDO\\SQLSrv\\Connection' => $vendorDir . '/doctrine/dbal/src/Driver/PDO/SQLSrv/Connection.php',
+    'Doctrine\\DBAL\\Driver\\PDO\\SQLSrv\\Driver' => $vendorDir . '/doctrine/dbal/src/Driver/PDO/SQLSrv/Driver.php',
+    'Doctrine\\DBAL\\Driver\\PDO\\SQLSrv\\Statement' => $vendorDir . '/doctrine/dbal/src/Driver/PDO/SQLSrv/Statement.php',
+    'Doctrine\\DBAL\\Driver\\PDO\\SQLite\\Driver' => $vendorDir . '/doctrine/dbal/src/Driver/PDO/SQLite/Driver.php',
+    'Doctrine\\DBAL\\Driver\\PDO\\Statement' => $vendorDir . '/doctrine/dbal/src/Driver/PDO/Statement.php',
+    'Doctrine\\DBAL\\Driver\\Result' => $vendorDir . '/doctrine/dbal/src/Driver/Result.php',
+    'Doctrine\\DBAL\\Driver\\SQLSrv\\Connection' => $vendorDir . '/doctrine/dbal/src/Driver/SQLSrv/Connection.php',
+    'Doctrine\\DBAL\\Driver\\SQLSrv\\Driver' => $vendorDir . '/doctrine/dbal/src/Driver/SQLSrv/Driver.php',
+    'Doctrine\\DBAL\\Driver\\SQLSrv\\Exception\\Error' => $vendorDir . '/doctrine/dbal/src/Driver/SQLSrv/Exception/Error.php',
+    'Doctrine\\DBAL\\Driver\\SQLSrv\\Result' => $vendorDir . '/doctrine/dbal/src/Driver/SQLSrv/Result.php',
+    'Doctrine\\DBAL\\Driver\\SQLSrv\\Statement' => $vendorDir . '/doctrine/dbal/src/Driver/SQLSrv/Statement.php',
+    'Doctrine\\DBAL\\Driver\\SQLite3\\Connection' => $vendorDir . '/doctrine/dbal/src/Driver/SQLite3/Connection.php',
+    'Doctrine\\DBAL\\Driver\\SQLite3\\Driver' => $vendorDir . '/doctrine/dbal/src/Driver/SQLite3/Driver.php',
+    'Doctrine\\DBAL\\Driver\\SQLite3\\Exception' => $vendorDir . '/doctrine/dbal/src/Driver/SQLite3/Exception.php',
+    'Doctrine\\DBAL\\Driver\\SQLite3\\Result' => $vendorDir . '/doctrine/dbal/src/Driver/SQLite3/Result.php',
+    'Doctrine\\DBAL\\Driver\\SQLite3\\Statement' => $vendorDir . '/doctrine/dbal/src/Driver/SQLite3/Statement.php',
+    'Doctrine\\DBAL\\Driver\\ServerInfoAwareConnection' => $vendorDir . '/doctrine/dbal/src/Driver/ServerInfoAwareConnection.php',
+    'Doctrine\\DBAL\\Driver\\Statement' => $vendorDir . '/doctrine/dbal/src/Driver/Statement.php',
+    'Doctrine\\DBAL\\Event\\ConnectionEventArgs' => $vendorDir . '/doctrine/dbal/src/Event/ConnectionEventArgs.php',
+    'Doctrine\\DBAL\\Event\\Listeners\\OracleSessionInit' => $vendorDir . '/doctrine/dbal/src/Event/Listeners/OracleSessionInit.php',
+    'Doctrine\\DBAL\\Event\\Listeners\\SQLSessionInit' => $vendorDir . '/doctrine/dbal/src/Event/Listeners/SQLSessionInit.php',
+    'Doctrine\\DBAL\\Event\\Listeners\\SQLiteSessionInit' => $vendorDir . '/doctrine/dbal/src/Event/Listeners/SQLiteSessionInit.php',
+    'Doctrine\\DBAL\\Event\\SchemaAlterTableAddColumnEventArgs' => $vendorDir . '/doctrine/dbal/src/Event/SchemaAlterTableAddColumnEventArgs.php',
+    'Doctrine\\DBAL\\Event\\SchemaAlterTableChangeColumnEventArgs' => $vendorDir . '/doctrine/dbal/src/Event/SchemaAlterTableChangeColumnEventArgs.php',
+    'Doctrine\\DBAL\\Event\\SchemaAlterTableEventArgs' => $vendorDir . '/doctrine/dbal/src/Event/SchemaAlterTableEventArgs.php',
+    'Doctrine\\DBAL\\Event\\SchemaAlterTableRemoveColumnEventArgs' => $vendorDir . '/doctrine/dbal/src/Event/SchemaAlterTableRemoveColumnEventArgs.php',
+    'Doctrine\\DBAL\\Event\\SchemaAlterTableRenameColumnEventArgs' => $vendorDir . '/doctrine/dbal/src/Event/SchemaAlterTableRenameColumnEventArgs.php',
+    'Doctrine\\DBAL\\Event\\SchemaColumnDefinitionEventArgs' => $vendorDir . '/doctrine/dbal/src/Event/SchemaColumnDefinitionEventArgs.php',
+    'Doctrine\\DBAL\\Event\\SchemaCreateTableColumnEventArgs' => $vendorDir . '/doctrine/dbal/src/Event/SchemaCreateTableColumnEventArgs.php',
+    'Doctrine\\DBAL\\Event\\SchemaCreateTableEventArgs' => $vendorDir . '/doctrine/dbal/src/Event/SchemaCreateTableEventArgs.php',
+    'Doctrine\\DBAL\\Event\\SchemaDropTableEventArgs' => $vendorDir . '/doctrine/dbal/src/Event/SchemaDropTableEventArgs.php',
+    'Doctrine\\DBAL\\Event\\SchemaEventArgs' => $vendorDir . '/doctrine/dbal/src/Event/SchemaEventArgs.php',
+    'Doctrine\\DBAL\\Event\\SchemaIndexDefinitionEventArgs' => $vendorDir . '/doctrine/dbal/src/Event/SchemaIndexDefinitionEventArgs.php',
+    'Doctrine\\DBAL\\Event\\TransactionBeginEventArgs' => $vendorDir . '/doctrine/dbal/src/Event/TransactionBeginEventArgs.php',
+    'Doctrine\\DBAL\\Event\\TransactionCommitEventArgs' => $vendorDir . '/doctrine/dbal/src/Event/TransactionCommitEventArgs.php',
+    'Doctrine\\DBAL\\Event\\TransactionEventArgs' => $vendorDir . '/doctrine/dbal/src/Event/TransactionEventArgs.php',
+    'Doctrine\\DBAL\\Event\\TransactionRollBackEventArgs' => $vendorDir . '/doctrine/dbal/src/Event/TransactionRollBackEventArgs.php',
+    'Doctrine\\DBAL\\Events' => $vendorDir . '/doctrine/dbal/src/Events.php',
+    'Doctrine\\DBAL\\Exception' => $vendorDir . '/doctrine/dbal/src/Exception.php',
+    'Doctrine\\DBAL\\Exception\\ConnectionException' => $vendorDir . '/doctrine/dbal/src/Exception/ConnectionException.php',
+    'Doctrine\\DBAL\\Exception\\ConnectionLost' => $vendorDir . '/doctrine/dbal/src/Exception/ConnectionLost.php',
+    'Doctrine\\DBAL\\Exception\\ConstraintViolationException' => $vendorDir . '/doctrine/dbal/src/Exception/ConstraintViolationException.php',
+    'Doctrine\\DBAL\\Exception\\DatabaseDoesNotExist' => $vendorDir . '/doctrine/dbal/src/Exception/DatabaseDoesNotExist.php',
+    'Doctrine\\DBAL\\Exception\\DatabaseObjectExistsException' => $vendorDir . '/doctrine/dbal/src/Exception/DatabaseObjectExistsException.php',
+    'Doctrine\\DBAL\\Exception\\DatabaseObjectNotFoundException' => $vendorDir . '/doctrine/dbal/src/Exception/DatabaseObjectNotFoundException.php',
+    'Doctrine\\DBAL\\Exception\\DatabaseRequired' => $vendorDir . '/doctrine/dbal/src/Exception/DatabaseRequired.php',
+    'Doctrine\\DBAL\\Exception\\DeadlockException' => $vendorDir . '/doctrine/dbal/src/Exception/DeadlockException.php',
+    'Doctrine\\DBAL\\Exception\\DriverException' => $vendorDir . '/doctrine/dbal/src/Exception/DriverException.php',
+    'Doctrine\\DBAL\\Exception\\ForeignKeyConstraintViolationException' => $vendorDir . '/doctrine/dbal/src/Exception/ForeignKeyConstraintViolationException.php',
+    'Doctrine\\DBAL\\Exception\\InvalidArgumentException' => $vendorDir . '/doctrine/dbal/src/Exception/InvalidArgumentException.php',
+    'Doctrine\\DBAL\\Exception\\InvalidFieldNameException' => $vendorDir . '/doctrine/dbal/src/Exception/InvalidFieldNameException.php',
+    'Doctrine\\DBAL\\Exception\\InvalidLockMode' => $vendorDir . '/doctrine/dbal/src/Exception/InvalidLockMode.php',
+    'Doctrine\\DBAL\\Exception\\LockWaitTimeoutException' => $vendorDir . '/doctrine/dbal/src/Exception/LockWaitTimeoutException.php',
+    'Doctrine\\DBAL\\Exception\\NoKeyValue' => $vendorDir . '/doctrine/dbal/src/Exception/NoKeyValue.php',
+    'Doctrine\\DBAL\\Exception\\NonUniqueFieldNameException' => $vendorDir . '/doctrine/dbal/src/Exception/NonUniqueFieldNameException.php',
+    'Doctrine\\DBAL\\Exception\\NotNullConstraintViolationException' => $vendorDir . '/doctrine/dbal/src/Exception/NotNullConstraintViolationException.php',
+    'Doctrine\\DBAL\\Exception\\ReadOnlyException' => $vendorDir . '/doctrine/dbal/src/Exception/ReadOnlyException.php',
+    'Doctrine\\DBAL\\Exception\\RetryableException' => $vendorDir . '/doctrine/dbal/src/Exception/RetryableException.php',
+    'Doctrine\\DBAL\\Exception\\SchemaDoesNotExist' => $vendorDir . '/doctrine/dbal/src/Exception/SchemaDoesNotExist.php',
+    'Doctrine\\DBAL\\Exception\\ServerException' => $vendorDir . '/doctrine/dbal/src/Exception/ServerException.php',
+    'Doctrine\\DBAL\\Exception\\SyntaxErrorException' => $vendorDir . '/doctrine/dbal/src/Exception/SyntaxErrorException.php',
+    'Doctrine\\DBAL\\Exception\\TableExistsException' => $vendorDir . '/doctrine/dbal/src/Exception/TableExistsException.php',
+    'Doctrine\\DBAL\\Exception\\TableNotFoundException' => $vendorDir . '/doctrine/dbal/src/Exception/TableNotFoundException.php',
+    'Doctrine\\DBAL\\Exception\\UniqueConstraintViolationException' => $vendorDir . '/doctrine/dbal/src/Exception/UniqueConstraintViolationException.php',
+    'Doctrine\\DBAL\\ExpandArrayParameters' => $vendorDir . '/doctrine/dbal/src/ExpandArrayParameters.php',
+    'Doctrine\\DBAL\\FetchMode' => $vendorDir . '/doctrine/dbal/src/FetchMode.php',
+    'Doctrine\\DBAL\\Id\\TableGenerator' => $vendorDir . '/doctrine/dbal/src/Id/TableGenerator.php',
+    'Doctrine\\DBAL\\Id\\TableGeneratorSchemaVisitor' => $vendorDir . '/doctrine/dbal/src/Id/TableGeneratorSchemaVisitor.php',
+    'Doctrine\\DBAL\\LockMode' => $vendorDir . '/doctrine/dbal/src/LockMode.php',
+    'Doctrine\\DBAL\\Logging\\Connection' => $vendorDir . '/doctrine/dbal/src/Logging/Connection.php',
+    'Doctrine\\DBAL\\Logging\\DebugStack' => $vendorDir . '/doctrine/dbal/src/Logging/DebugStack.php',
+    'Doctrine\\DBAL\\Logging\\Driver' => $vendorDir . '/doctrine/dbal/src/Logging/Driver.php',
+    'Doctrine\\DBAL\\Logging\\LoggerChain' => $vendorDir . '/doctrine/dbal/src/Logging/LoggerChain.php',
+    'Doctrine\\DBAL\\Logging\\Middleware' => $vendorDir . '/doctrine/dbal/src/Logging/Middleware.php',
+    'Doctrine\\DBAL\\Logging\\SQLLogger' => $vendorDir . '/doctrine/dbal/src/Logging/SQLLogger.php',
+    'Doctrine\\DBAL\\Logging\\Statement' => $vendorDir . '/doctrine/dbal/src/Logging/Statement.php',
+    'Doctrine\\DBAL\\ParameterType' => $vendorDir . '/doctrine/dbal/src/ParameterType.php',
+    'Doctrine\\DBAL\\Platforms\\AbstractMySQLPlatform' => $vendorDir . '/doctrine/dbal/src/Platforms/AbstractMySQLPlatform.php',
+    'Doctrine\\DBAL\\Platforms\\AbstractPlatform' => $vendorDir . '/doctrine/dbal/src/Platforms/AbstractPlatform.php',
+    'Doctrine\\DBAL\\Platforms\\DB2Platform' => $vendorDir . '/doctrine/dbal/src/Platforms/DB2Platform.php',
+    'Doctrine\\DBAL\\Platforms\\DateIntervalUnit' => $vendorDir . '/doctrine/dbal/src/Platforms/DateIntervalUnit.php',
+    'Doctrine\\DBAL\\Platforms\\Keywords\\DB2Keywords' => $vendorDir . '/doctrine/dbal/src/Platforms/Keywords/DB2Keywords.php',
+    'Doctrine\\DBAL\\Platforms\\Keywords\\KeywordList' => $vendorDir . '/doctrine/dbal/src/Platforms/Keywords/KeywordList.php',
+    'Doctrine\\DBAL\\Platforms\\Keywords\\MariaDBKeywords' => $vendorDir . '/doctrine/dbal/src/Platforms/Keywords/MariaDBKeywords.php',
+    'Doctrine\\DBAL\\Platforms\\Keywords\\MariaDb102Keywords' => $vendorDir . '/doctrine/dbal/src/Platforms/Keywords/MariaDb102Keywords.php',
+    'Doctrine\\DBAL\\Platforms\\Keywords\\MySQL57Keywords' => $vendorDir . '/doctrine/dbal/src/Platforms/Keywords/MySQL57Keywords.php',
+    'Doctrine\\DBAL\\Platforms\\Keywords\\MySQL80Keywords' => $vendorDir . '/doctrine/dbal/src/Platforms/Keywords/MySQL80Keywords.php',
+    'Doctrine\\DBAL\\Platforms\\Keywords\\MySQLKeywords' => $vendorDir . '/doctrine/dbal/src/Platforms/Keywords/MySQLKeywords.php',
+    'Doctrine\\DBAL\\Platforms\\Keywords\\OracleKeywords' => $vendorDir . '/doctrine/dbal/src/Platforms/Keywords/OracleKeywords.php',
+    'Doctrine\\DBAL\\Platforms\\Keywords\\PostgreSQL100Keywords' => $vendorDir . '/doctrine/dbal/src/Platforms/Keywords/PostgreSQL100Keywords.php',
+    'Doctrine\\DBAL\\Platforms\\Keywords\\PostgreSQL94Keywords' => $vendorDir . '/doctrine/dbal/src/Platforms/Keywords/PostgreSQL94Keywords.php',
+    'Doctrine\\DBAL\\Platforms\\Keywords\\PostgreSQLKeywords' => $vendorDir . '/doctrine/dbal/src/Platforms/Keywords/PostgreSQLKeywords.php',
+    'Doctrine\\DBAL\\Platforms\\Keywords\\ReservedKeywordsValidator' => $vendorDir . '/doctrine/dbal/src/Platforms/Keywords/ReservedKeywordsValidator.php',
+    'Doctrine\\DBAL\\Platforms\\Keywords\\SQLServer2012Keywords' => $vendorDir . '/doctrine/dbal/src/Platforms/Keywords/SQLServer2012Keywords.php',
+    'Doctrine\\DBAL\\Platforms\\Keywords\\SQLServerKeywords' => $vendorDir . '/doctrine/dbal/src/Platforms/Keywords/SQLServerKeywords.php',
+    'Doctrine\\DBAL\\Platforms\\Keywords\\SQLiteKeywords' => $vendorDir . '/doctrine/dbal/src/Platforms/Keywords/SQLiteKeywords.php',
+    'Doctrine\\DBAL\\Platforms\\MariaDBPlatform' => $vendorDir . '/doctrine/dbal/src/Platforms/MariaDBPlatform.php',
+    'Doctrine\\DBAL\\Platforms\\MariaDb1027Platform' => $vendorDir . '/doctrine/dbal/src/Platforms/MariaDb1027Platform.php',
+    'Doctrine\\DBAL\\Platforms\\MySQL57Platform' => $vendorDir . '/doctrine/dbal/src/Platforms/MySQL57Platform.php',
+    'Doctrine\\DBAL\\Platforms\\MySQL80Platform' => $vendorDir . '/doctrine/dbal/src/Platforms/MySQL80Platform.php',
+    'Doctrine\\DBAL\\Platforms\\MySQLPlatform' => $vendorDir . '/doctrine/dbal/src/Platforms/MySQLPlatform.php',
+    'Doctrine\\DBAL\\Platforms\\MySQL\\CollationMetadataProvider' => $vendorDir . '/doctrine/dbal/src/Platforms/MySQL/CollationMetadataProvider.php',
+    'Doctrine\\DBAL\\Platforms\\MySQL\\CollationMetadataProvider\\CachingCollationMetadataProvider' => $vendorDir . '/doctrine/dbal/src/Platforms/MySQL/CollationMetadataProvider/CachingCollationMetadataProvider.php',
+    'Doctrine\\DBAL\\Platforms\\MySQL\\CollationMetadataProvider\\ConnectionCollationMetadataProvider' => $vendorDir . '/doctrine/dbal/src/Platforms/MySQL/CollationMetadataProvider/ConnectionCollationMetadataProvider.php',
+    'Doctrine\\DBAL\\Platforms\\MySQL\\Comparator' => $vendorDir . '/doctrine/dbal/src/Platforms/MySQL/Comparator.php',
+    'Doctrine\\DBAL\\Platforms\\OraclePlatform' => $vendorDir . '/doctrine/dbal/src/Platforms/OraclePlatform.php',
+    'Doctrine\\DBAL\\Platforms\\PostgreSQL100Platform' => $vendorDir . '/doctrine/dbal/src/Platforms/PostgreSQL100Platform.php',
+    'Doctrine\\DBAL\\Platforms\\PostgreSQL94Platform' => $vendorDir . '/doctrine/dbal/src/Platforms/PostgreSQL94Platform.php',
+    'Doctrine\\DBAL\\Platforms\\PostgreSQLPlatform' => $vendorDir . '/doctrine/dbal/src/Platforms/PostgreSQLPlatform.php',
+    'Doctrine\\DBAL\\Platforms\\SQLServer2012Platform' => $vendorDir . '/doctrine/dbal/src/Platforms/SQLServer2012Platform.php',
+    'Doctrine\\DBAL\\Platforms\\SQLServerPlatform' => $vendorDir . '/doctrine/dbal/src/Platforms/SQLServerPlatform.php',
+    'Doctrine\\DBAL\\Platforms\\SQLServer\\Comparator' => $vendorDir . '/doctrine/dbal/src/Platforms/SQLServer/Comparator.php',
+    'Doctrine\\DBAL\\Platforms\\SQLite\\Comparator' => $vendorDir . '/doctrine/dbal/src/Platforms/SQLite/Comparator.php',
+    'Doctrine\\DBAL\\Platforms\\SqlitePlatform' => $vendorDir . '/doctrine/dbal/src/Platforms/SqlitePlatform.php',
+    'Doctrine\\DBAL\\Platforms\\TrimMode' => $vendorDir . '/doctrine/dbal/src/Platforms/TrimMode.php',
+    'Doctrine\\DBAL\\Portability\\Connection' => $vendorDir . '/doctrine/dbal/src/Portability/Connection.php',
+    'Doctrine\\DBAL\\Portability\\Converter' => $vendorDir . '/doctrine/dbal/src/Portability/Converter.php',
+    'Doctrine\\DBAL\\Portability\\Driver' => $vendorDir . '/doctrine/dbal/src/Portability/Driver.php',
+    'Doctrine\\DBAL\\Portability\\Middleware' => $vendorDir . '/doctrine/dbal/src/Portability/Middleware.php',
+    'Doctrine\\DBAL\\Portability\\OptimizeFlags' => $vendorDir . '/doctrine/dbal/src/Portability/OptimizeFlags.php',
+    'Doctrine\\DBAL\\Portability\\Result' => $vendorDir . '/doctrine/dbal/src/Portability/Result.php',
+    'Doctrine\\DBAL\\Portability\\Statement' => $vendorDir . '/doctrine/dbal/src/Portability/Statement.php',
+    'Doctrine\\DBAL\\Query' => $vendorDir . '/doctrine/dbal/src/Query.php',
+    'Doctrine\\DBAL\\Query\\Expression\\CompositeExpression' => $vendorDir . '/doctrine/dbal/src/Query/Expression/CompositeExpression.php',
+    'Doctrine\\DBAL\\Query\\Expression\\ExpressionBuilder' => $vendorDir . '/doctrine/dbal/src/Query/Expression/ExpressionBuilder.php',
+    'Doctrine\\DBAL\\Query\\QueryBuilder' => $vendorDir . '/doctrine/dbal/src/Query/QueryBuilder.php',
+    'Doctrine\\DBAL\\Query\\QueryException' => $vendorDir . '/doctrine/dbal/src/Query/QueryException.php',
+    'Doctrine\\DBAL\\Result' => $vendorDir . '/doctrine/dbal/src/Result.php',
+    'Doctrine\\DBAL\\SQL\\Builder\\CreateSchemaObjectsSQLBuilder' => $vendorDir . '/doctrine/dbal/src/SQL/Builder/CreateSchemaObjectsSQLBuilder.php',
+    'Doctrine\\DBAL\\SQL\\Builder\\DropSchemaObjectsSQLBuilder' => $vendorDir . '/doctrine/dbal/src/SQL/Builder/DropSchemaObjectsSQLBuilder.php',
+    'Doctrine\\DBAL\\SQL\\Parser' => $vendorDir . '/doctrine/dbal/src/SQL/Parser.php',
+    'Doctrine\\DBAL\\SQL\\Parser\\Exception' => $vendorDir . '/doctrine/dbal/src/SQL/Parser/Exception.php',
+    'Doctrine\\DBAL\\SQL\\Parser\\Exception\\RegularExpressionError' => $vendorDir . '/doctrine/dbal/src/SQL/Parser/Exception/RegularExpressionError.php',
+    'Doctrine\\DBAL\\SQL\\Parser\\Visitor' => $vendorDir . '/doctrine/dbal/src/SQL/Parser/Visitor.php',
+    'Doctrine\\DBAL\\Schema\\AbstractAsset' => $vendorDir . '/doctrine/dbal/src/Schema/AbstractAsset.php',
+    'Doctrine\\DBAL\\Schema\\AbstractSchemaManager' => $vendorDir . '/doctrine/dbal/src/Schema/AbstractSchemaManager.php',
+    'Doctrine\\DBAL\\Schema\\Column' => $vendorDir . '/doctrine/dbal/src/Schema/Column.php',
+    'Doctrine\\DBAL\\Schema\\ColumnDiff' => $vendorDir . '/doctrine/dbal/src/Schema/ColumnDiff.php',
+    'Doctrine\\DBAL\\Schema\\Comparator' => $vendorDir . '/doctrine/dbal/src/Schema/Comparator.php',
+    'Doctrine\\DBAL\\Schema\\Constraint' => $vendorDir . '/doctrine/dbal/src/Schema/Constraint.php',
+    'Doctrine\\DBAL\\Schema\\DB2SchemaManager' => $vendorDir . '/doctrine/dbal/src/Schema/DB2SchemaManager.php',
+    'Doctrine\\DBAL\\Schema\\Exception\\ColumnAlreadyExists' => $vendorDir . '/doctrine/dbal/src/Schema/Exception/ColumnAlreadyExists.php',
+    'Doctrine\\DBAL\\Schema\\Exception\\ColumnDoesNotExist' => $vendorDir . '/doctrine/dbal/src/Schema/Exception/ColumnDoesNotExist.php',
+    'Doctrine\\DBAL\\Schema\\Exception\\ForeignKeyDoesNotExist' => $vendorDir . '/doctrine/dbal/src/Schema/Exception/ForeignKeyDoesNotExist.php',
+    'Doctrine\\DBAL\\Schema\\Exception\\IndexAlreadyExists' => $vendorDir . '/doctrine/dbal/src/Schema/Exception/IndexAlreadyExists.php',
+    'Doctrine\\DBAL\\Schema\\Exception\\IndexDoesNotExist' => $vendorDir . '/doctrine/dbal/src/Schema/Exception/IndexDoesNotExist.php',
+    'Doctrine\\DBAL\\Schema\\Exception\\IndexNameInvalid' => $vendorDir . '/doctrine/dbal/src/Schema/Exception/IndexNameInvalid.php',
+    'Doctrine\\DBAL\\Schema\\Exception\\InvalidTableName' => $vendorDir . '/doctrine/dbal/src/Schema/Exception/InvalidTableName.php',
+    'Doctrine\\DBAL\\Schema\\Exception\\NamedForeignKeyRequired' => $vendorDir . '/doctrine/dbal/src/Schema/Exception/NamedForeignKeyRequired.php',
+    'Doctrine\\DBAL\\Schema\\Exception\\NamespaceAlreadyExists' => $vendorDir . '/doctrine/dbal/src/Schema/Exception/NamespaceAlreadyExists.php',
+    'Doctrine\\DBAL\\Schema\\Exception\\SequenceAlreadyExists' => $vendorDir . '/doctrine/dbal/src/Schema/Exception/SequenceAlreadyExists.php',
+    'Doctrine\\DBAL\\Schema\\Exception\\SequenceDoesNotExist' => $vendorDir . '/doctrine/dbal/src/Schema/Exception/SequenceDoesNotExist.php',
+    'Doctrine\\DBAL\\Schema\\Exception\\TableAlreadyExists' => $vendorDir . '/doctrine/dbal/src/Schema/Exception/TableAlreadyExists.php',
+    'Doctrine\\DBAL\\Schema\\Exception\\TableDoesNotExist' => $vendorDir . '/doctrine/dbal/src/Schema/Exception/TableDoesNotExist.php',
+    'Doctrine\\DBAL\\Schema\\Exception\\UniqueConstraintDoesNotExist' => $vendorDir . '/doctrine/dbal/src/Schema/Exception/UniqueConstraintDoesNotExist.php',
+    'Doctrine\\DBAL\\Schema\\Exception\\UnknownColumnOption' => $vendorDir . '/doctrine/dbal/src/Schema/Exception/UnknownColumnOption.php',
+    'Doctrine\\DBAL\\Schema\\ForeignKeyConstraint' => $vendorDir . '/doctrine/dbal/src/Schema/ForeignKeyConstraint.php',
+    'Doctrine\\DBAL\\Schema\\Identifier' => $vendorDir . '/doctrine/dbal/src/Schema/Identifier.php',
+    'Doctrine\\DBAL\\Schema\\Index' => $vendorDir . '/doctrine/dbal/src/Schema/Index.php',
+    'Doctrine\\DBAL\\Schema\\MySQLSchemaManager' => $vendorDir . '/doctrine/dbal/src/Schema/MySQLSchemaManager.php',
+    'Doctrine\\DBAL\\Schema\\OracleSchemaManager' => $vendorDir . '/doctrine/dbal/src/Schema/OracleSchemaManager.php',
+    'Doctrine\\DBAL\\Schema\\PostgreSQLSchemaManager' => $vendorDir . '/doctrine/dbal/src/Schema/PostgreSQLSchemaManager.php',
+    'Doctrine\\DBAL\\Schema\\SQLServerSchemaManager' => $vendorDir . '/doctrine/dbal/src/Schema/SQLServerSchemaManager.php',
+    'Doctrine\\DBAL\\Schema\\Schema' => $vendorDir . '/doctrine/dbal/src/Schema/Schema.php',
+    'Doctrine\\DBAL\\Schema\\SchemaConfig' => $vendorDir . '/doctrine/dbal/src/Schema/SchemaConfig.php',
+    'Doctrine\\DBAL\\Schema\\SchemaDiff' => $vendorDir . '/doctrine/dbal/src/Schema/SchemaDiff.php',
+    'Doctrine\\DBAL\\Schema\\SchemaException' => $vendorDir . '/doctrine/dbal/src/Schema/SchemaException.php',
+    'Doctrine\\DBAL\\Schema\\Sequence' => $vendorDir . '/doctrine/dbal/src/Schema/Sequence.php',
+    'Doctrine\\DBAL\\Schema\\SqliteSchemaManager' => $vendorDir . '/doctrine/dbal/src/Schema/SqliteSchemaManager.php',
+    'Doctrine\\DBAL\\Schema\\Table' => $vendorDir . '/doctrine/dbal/src/Schema/Table.php',
+    'Doctrine\\DBAL\\Schema\\TableDiff' => $vendorDir . '/doctrine/dbal/src/Schema/TableDiff.php',
+    'Doctrine\\DBAL\\Schema\\UniqueConstraint' => $vendorDir . '/doctrine/dbal/src/Schema/UniqueConstraint.php',
+    'Doctrine\\DBAL\\Schema\\View' => $vendorDir . '/doctrine/dbal/src/Schema/View.php',
+    'Doctrine\\DBAL\\Schema\\Visitor\\AbstractVisitor' => $vendorDir . '/doctrine/dbal/src/Schema/Visitor/AbstractVisitor.php',
+    'Doctrine\\DBAL\\Schema\\Visitor\\CreateSchemaSqlCollector' => $vendorDir . '/doctrine/dbal/src/Schema/Visitor/CreateSchemaSqlCollector.php',
+    'Doctrine\\DBAL\\Schema\\Visitor\\DropSchemaSqlCollector' => $vendorDir . '/doctrine/dbal/src/Schema/Visitor/DropSchemaSqlCollector.php',
+    'Doctrine\\DBAL\\Schema\\Visitor\\Graphviz' => $vendorDir . '/doctrine/dbal/src/Schema/Visitor/Graphviz.php',
+    'Doctrine\\DBAL\\Schema\\Visitor\\NamespaceVisitor' => $vendorDir . '/doctrine/dbal/src/Schema/Visitor/NamespaceVisitor.php',
+    'Doctrine\\DBAL\\Schema\\Visitor\\RemoveNamespacedAssets' => $vendorDir . '/doctrine/dbal/src/Schema/Visitor/RemoveNamespacedAssets.php',
+    'Doctrine\\DBAL\\Schema\\Visitor\\Visitor' => $vendorDir . '/doctrine/dbal/src/Schema/Visitor/Visitor.php',
+    'Doctrine\\DBAL\\Statement' => $vendorDir . '/doctrine/dbal/src/Statement.php',
+    'Doctrine\\DBAL\\Tools\\Console\\Command\\ReservedWordsCommand' => $vendorDir . '/doctrine/dbal/src/Tools/Console/Command/ReservedWordsCommand.php',
+    'Doctrine\\DBAL\\Tools\\Console\\Command\\RunSqlCommand' => $vendorDir . '/doctrine/dbal/src/Tools/Console/Command/RunSqlCommand.php',
+    'Doctrine\\DBAL\\Tools\\Console\\ConnectionNotFound' => $vendorDir . '/doctrine/dbal/src/Tools/Console/ConnectionNotFound.php',
+    'Doctrine\\DBAL\\Tools\\Console\\ConnectionProvider' => $vendorDir . '/doctrine/dbal/src/Tools/Console/ConnectionProvider.php',
+    'Doctrine\\DBAL\\Tools\\Console\\ConnectionProvider\\SingleConnectionProvider' => $vendorDir . '/doctrine/dbal/src/Tools/Console/ConnectionProvider/SingleConnectionProvider.php',
+    'Doctrine\\DBAL\\Tools\\Console\\ConsoleRunner' => $vendorDir . '/doctrine/dbal/src/Tools/Console/ConsoleRunner.php',
+    'Doctrine\\DBAL\\TransactionIsolationLevel' => $vendorDir . '/doctrine/dbal/src/TransactionIsolationLevel.php',
+    'Doctrine\\DBAL\\Types\\ArrayType' => $vendorDir . '/doctrine/dbal/src/Types/ArrayType.php',
+    'Doctrine\\DBAL\\Types\\AsciiStringType' => $vendorDir . '/doctrine/dbal/src/Types/AsciiStringType.php',
+    'Doctrine\\DBAL\\Types\\BigIntType' => $vendorDir . '/doctrine/dbal/src/Types/BigIntType.php',
+    'Doctrine\\DBAL\\Types\\BinaryType' => $vendorDir . '/doctrine/dbal/src/Types/BinaryType.php',
+    'Doctrine\\DBAL\\Types\\BlobType' => $vendorDir . '/doctrine/dbal/src/Types/BlobType.php',
+    'Doctrine\\DBAL\\Types\\BooleanType' => $vendorDir . '/doctrine/dbal/src/Types/BooleanType.php',
+    'Doctrine\\DBAL\\Types\\ConversionException' => $vendorDir . '/doctrine/dbal/src/Types/ConversionException.php',
+    'Doctrine\\DBAL\\Types\\DateImmutableType' => $vendorDir . '/doctrine/dbal/src/Types/DateImmutableType.php',
+    'Doctrine\\DBAL\\Types\\DateIntervalType' => $vendorDir . '/doctrine/dbal/src/Types/DateIntervalType.php',
+    'Doctrine\\DBAL\\Types\\DateTimeImmutableType' => $vendorDir . '/doctrine/dbal/src/Types/DateTimeImmutableType.php',
+    'Doctrine\\DBAL\\Types\\DateTimeType' => $vendorDir . '/doctrine/dbal/src/Types/DateTimeType.php',
+    'Doctrine\\DBAL\\Types\\DateTimeTzImmutableType' => $vendorDir . '/doctrine/dbal/src/Types/DateTimeTzImmutableType.php',
+    'Doctrine\\DBAL\\Types\\DateTimeTzType' => $vendorDir . '/doctrine/dbal/src/Types/DateTimeTzType.php',
+    'Doctrine\\DBAL\\Types\\DateType' => $vendorDir . '/doctrine/dbal/src/Types/DateType.php',
+    'Doctrine\\DBAL\\Types\\DecimalType' => $vendorDir . '/doctrine/dbal/src/Types/DecimalType.php',
+    'Doctrine\\DBAL\\Types\\FloatType' => $vendorDir . '/doctrine/dbal/src/Types/FloatType.php',
+    'Doctrine\\DBAL\\Types\\GuidType' => $vendorDir . '/doctrine/dbal/src/Types/GuidType.php',
+    'Doctrine\\DBAL\\Types\\IntegerType' => $vendorDir . '/doctrine/dbal/src/Types/IntegerType.php',
+    'Doctrine\\DBAL\\Types\\JsonType' => $vendorDir . '/doctrine/dbal/src/Types/JsonType.php',
+    'Doctrine\\DBAL\\Types\\ObjectType' => $vendorDir . '/doctrine/dbal/src/Types/ObjectType.php',
+    'Doctrine\\DBAL\\Types\\PhpDateTimeMappingType' => $vendorDir . '/doctrine/dbal/src/Types/PhpDateTimeMappingType.php',
+    'Doctrine\\DBAL\\Types\\PhpIntegerMappingType' => $vendorDir . '/doctrine/dbal/src/Types/PhpIntegerMappingType.php',
+    'Doctrine\\DBAL\\Types\\SimpleArrayType' => $vendorDir . '/doctrine/dbal/src/Types/SimpleArrayType.php',
+    'Doctrine\\DBAL\\Types\\SmallIntType' => $vendorDir . '/doctrine/dbal/src/Types/SmallIntType.php',
+    'Doctrine\\DBAL\\Types\\StringType' => $vendorDir . '/doctrine/dbal/src/Types/StringType.php',
+    'Doctrine\\DBAL\\Types\\TextType' => $vendorDir . '/doctrine/dbal/src/Types/TextType.php',
+    'Doctrine\\DBAL\\Types\\TimeImmutableType' => $vendorDir . '/doctrine/dbal/src/Types/TimeImmutableType.php',
+    'Doctrine\\DBAL\\Types\\TimeType' => $vendorDir . '/doctrine/dbal/src/Types/TimeType.php',
+    'Doctrine\\DBAL\\Types\\Type' => $vendorDir . '/doctrine/dbal/src/Types/Type.php',
+    'Doctrine\\DBAL\\Types\\TypeRegistry' => $vendorDir . '/doctrine/dbal/src/Types/TypeRegistry.php',
+    'Doctrine\\DBAL\\Types\\Types' => $vendorDir . '/doctrine/dbal/src/Types/Types.php',
+    'Doctrine\\DBAL\\Types\\VarDateTimeImmutableType' => $vendorDir . '/doctrine/dbal/src/Types/VarDateTimeImmutableType.php',
+    'Doctrine\\DBAL\\Types\\VarDateTimeType' => $vendorDir . '/doctrine/dbal/src/Types/VarDateTimeType.php',
+    'Doctrine\\DBAL\\VersionAwarePlatformDriver' => $vendorDir . '/doctrine/dbal/src/VersionAwarePlatformDriver.php',
+    'Doctrine\\Deprecations\\Deprecation' => $vendorDir . '/doctrine/deprecations/lib/Doctrine/Deprecations/Deprecation.php',
+    'Doctrine\\Deprecations\\PHPUnit\\VerifyDeprecations' => $vendorDir . '/doctrine/deprecations/lib/Doctrine/Deprecations/PHPUnit/VerifyDeprecations.php',
     'Doctrine\\Inflector\\CachedWordInflector' => $vendorDir . '/doctrine/inflector/lib/Doctrine/Inflector/CachedWordInflector.php',
     'Doctrine\\Inflector\\GenericLanguageInflectorFactory' => $vendorDir . '/doctrine/inflector/lib/Doctrine/Inflector/GenericLanguageInflectorFactory.php',
     'Doctrine\\Inflector\\Inflector' => $vendorDir . '/doctrine/inflector/lib/Doctrine/Inflector/Inflector.php',
@@ -5281,6 +5661,7 @@ return array(
     'Symfony\\Thanks\\Thanks' => $vendorDir . '/symfony/thanks/src/Thanks.php',
     'Tests\\CreatesApplication' => $baseDir . '/tests/CreatesApplication.php',
     'Tests\\Feature\\ExampleTest' => $baseDir . '/tests/Feature/ExampleTest.php',
+    'Tests\\Feature\\ItemExportTest' => $baseDir . '/tests/Feature/ItemExportTest.php',
     'Tests\\TestCase' => $baseDir . '/tests/TestCase.php',
     'Tests\\Unit\\database\\seeders\\SettingsSeederTest' => $baseDir . '/tests/Unit/database/seeders/SettingsSeederTest.php',
     'Tests\\Unit\\lang\\LangTest' => $baseDir . '/tests/Unit/lang/LangTest.php',
@@ -5321,5 +5702,60 @@ return array(
     'Whoops\\Util\\Misc' => $vendorDir . '/filp/whoops/src/Whoops/Util/Misc.php',
     'Whoops\\Util\\SystemFacade' => $vendorDir . '/filp/whoops/src/Whoops/Util/SystemFacade.php',
     'Whoops\\Util\\TemplateHelper' => $vendorDir . '/filp/whoops/src/Whoops/Util/TemplateHelper.php',
+    'phpDocumentor\\Reflection\\Element' => $vendorDir . '/phpdocumentor/reflection-common/src/Element.php',
+    'phpDocumentor\\Reflection\\File' => $vendorDir . '/phpdocumentor/reflection-common/src/File.php',
+    'phpDocumentor\\Reflection\\Fqsen' => $vendorDir . '/phpdocumentor/reflection-common/src/Fqsen.php',
+    'phpDocumentor\\Reflection\\FqsenResolver' => $vendorDir . '/phpdocumentor/type-resolver/src/FqsenResolver.php',
+    'phpDocumentor\\Reflection\\Location' => $vendorDir . '/phpdocumentor/reflection-common/src/Location.php',
+    'phpDocumentor\\Reflection\\Project' => $vendorDir . '/phpdocumentor/reflection-common/src/Project.php',
+    'phpDocumentor\\Reflection\\ProjectFactory' => $vendorDir . '/phpdocumentor/reflection-common/src/ProjectFactory.php',
+    'phpDocumentor\\Reflection\\PseudoType' => $vendorDir . '/phpdocumentor/type-resolver/src/PseudoType.php',
+    'phpDocumentor\\Reflection\\PseudoTypes\\CallableString' => $vendorDir . '/phpdocumentor/type-resolver/src/PseudoTypes/CallableString.php',
+    'phpDocumentor\\Reflection\\PseudoTypes\\False_' => $vendorDir . '/phpdocumentor/type-resolver/src/PseudoTypes/False_.php',
+    'phpDocumentor\\Reflection\\PseudoTypes\\HtmlEscapedString' => $vendorDir . '/phpdocumentor/type-resolver/src/PseudoTypes/HtmlEscapedString.php',
+    'phpDocumentor\\Reflection\\PseudoTypes\\IntegerRange' => $vendorDir . '/phpdocumentor/type-resolver/src/PseudoTypes/IntegerRange.php',
+    'phpDocumentor\\Reflection\\PseudoTypes\\List_' => $vendorDir . '/phpdocumentor/type-resolver/src/PseudoTypes/List_.php',
+    'phpDocumentor\\Reflection\\PseudoTypes\\LiteralString' => $vendorDir . '/phpdocumentor/type-resolver/src/PseudoTypes/LiteralString.php',
+    'phpDocumentor\\Reflection\\PseudoTypes\\LowercaseString' => $vendorDir . '/phpdocumentor/type-resolver/src/PseudoTypes/LowercaseString.php',
+    'phpDocumentor\\Reflection\\PseudoTypes\\NegativeInteger' => $vendorDir . '/phpdocumentor/type-resolver/src/PseudoTypes/NegativeInteger.php',
+    'phpDocumentor\\Reflection\\PseudoTypes\\NonEmptyLowercaseString' => $vendorDir . '/phpdocumentor/type-resolver/src/PseudoTypes/NonEmptyLowercaseString.php',
+    'phpDocumentor\\Reflection\\PseudoTypes\\NonEmptyString' => $vendorDir . '/phpdocumentor/type-resolver/src/PseudoTypes/NonEmptyString.php',
+    'phpDocumentor\\Reflection\\PseudoTypes\\NumericString' => $vendorDir . '/phpdocumentor/type-resolver/src/PseudoTypes/NumericString.php',
+    'phpDocumentor\\Reflection\\PseudoTypes\\Numeric_' => $vendorDir . '/phpdocumentor/type-resolver/src/PseudoTypes/Numeric_.php',
+    'phpDocumentor\\Reflection\\PseudoTypes\\PositiveInteger' => $vendorDir . '/phpdocumentor/type-resolver/src/PseudoTypes/PositiveInteger.php',
+    'phpDocumentor\\Reflection\\PseudoTypes\\TraitString' => $vendorDir . '/phpdocumentor/type-resolver/src/PseudoTypes/TraitString.php',
+    'phpDocumentor\\Reflection\\PseudoTypes\\True_' => $vendorDir . '/phpdocumentor/type-resolver/src/PseudoTypes/True_.php',
+    'phpDocumentor\\Reflection\\Type' => $vendorDir . '/phpdocumentor/type-resolver/src/Type.php',
+    'phpDocumentor\\Reflection\\TypeResolver' => $vendorDir . '/phpdocumentor/type-resolver/src/TypeResolver.php',
+    'phpDocumentor\\Reflection\\Types\\AbstractList' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/AbstractList.php',
+    'phpDocumentor\\Reflection\\Types\\AggregatedType' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/AggregatedType.php',
+    'phpDocumentor\\Reflection\\Types\\ArrayKey' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/ArrayKey.php',
+    'phpDocumentor\\Reflection\\Types\\Array_' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Array_.php',
+    'phpDocumentor\\Reflection\\Types\\Boolean' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Boolean.php',
+    'phpDocumentor\\Reflection\\Types\\Callable_' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Callable_.php',
+    'phpDocumentor\\Reflection\\Types\\ClassString' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/ClassString.php',
+    'phpDocumentor\\Reflection\\Types\\Collection' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Collection.php',
+    'phpDocumentor\\Reflection\\Types\\Compound' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Compound.php',
+    'phpDocumentor\\Reflection\\Types\\Context' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Context.php',
+    'phpDocumentor\\Reflection\\Types\\ContextFactory' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/ContextFactory.php',
+    'phpDocumentor\\Reflection\\Types\\Expression' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Expression.php',
+    'phpDocumentor\\Reflection\\Types\\Float_' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Float_.php',
+    'phpDocumentor\\Reflection\\Types\\Integer' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Integer.php',
+    'phpDocumentor\\Reflection\\Types\\InterfaceString' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/InterfaceString.php',
+    'phpDocumentor\\Reflection\\Types\\Intersection' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Intersection.php',
+    'phpDocumentor\\Reflection\\Types\\Iterable_' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Iterable_.php',
+    'phpDocumentor\\Reflection\\Types\\Mixed_' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Mixed_.php',
+    'phpDocumentor\\Reflection\\Types\\Never_' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Never_.php',
+    'phpDocumentor\\Reflection\\Types\\Null_' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Null_.php',
+    'phpDocumentor\\Reflection\\Types\\Nullable' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Nullable.php',
+    'phpDocumentor\\Reflection\\Types\\Object_' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Object_.php',
+    'phpDocumentor\\Reflection\\Types\\Parent_' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Parent_.php',
+    'phpDocumentor\\Reflection\\Types\\Resource_' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Resource_.php',
+    'phpDocumentor\\Reflection\\Types\\Scalar' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Scalar.php',
+    'phpDocumentor\\Reflection\\Types\\Self_' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Self_.php',
+    'phpDocumentor\\Reflection\\Types\\Static_' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Static_.php',
+    'phpDocumentor\\Reflection\\Types\\String_' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/String_.php',
+    'phpDocumentor\\Reflection\\Types\\This' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/This.php',
+    'phpDocumentor\\Reflection\\Types\\Void_' => $vendorDir . '/phpdocumentor/type-resolver/src/Types/Void_.php',
     'voku\\helper\\ASCII' => $vendorDir . '/voku/portable-ascii/src/voku/helper/ASCII.php',
 );

vendor/composer/autoload_namespaces.php

@@ -7,4 +7,5 @@ $baseDir = dirname($vendorDir);
 
 return array(
     'Mockery' => array($vendorDir . '/mockery/mockery/library'),
+    'Barryvdh' => array($vendorDir . '/barryvdh/reflection-docblock/src'),
 );

vendor/composer/autoload_psr4.php

@@ -7,6 +7,7 @@ $baseDir = dirname($vendorDir);
 
 return array(
     'voku\\' => array($vendorDir . '/voku/portable-ascii/src/voku'),
+    'phpDocumentor\\Reflection\\' => array($vendorDir . '/phpdocumentor/reflection-common/src', $vendorDir . '/phpdocumentor/type-resolver/src'),
     'Whoops\\' => array($vendorDir . '/filp/whoops/src/Whoops'),
     'Webmozart\\Assert\\' => array($vendorDir . '/webmozart/assert/src'),
     'TijsVerkoyen\\CssToInlineStyles\\' => array($vendorDir . '/tijsverkoyen/css-to-inline-styles/src'),
@@ -92,15 +93,21 @@ return array(
     'Dotenv\\' => array($vendorDir . '/vlucas/phpdotenv/src'),
     'Doctrine\\Instantiator\\' => array($vendorDir . '/doctrine/instantiator/src/Doctrine/Instantiator'),
     'Doctrine\\Inflector\\' => array($vendorDir . '/doctrine/inflector/lib/Doctrine/Inflector'),
+    'Doctrine\\Deprecations\\' => array($vendorDir . '/doctrine/deprecations/lib/Doctrine/Deprecations'),
+    'Doctrine\\DBAL\\' => array($vendorDir . '/doctrine/dbal/src'),
     'Doctrine\\Common\\Lexer\\' => array($vendorDir . '/doctrine/lexer/lib/Doctrine/Common/Lexer'),
+    'Doctrine\\Common\\Cache\\' => array($vendorDir . '/doctrine/cache/lib/Doctrine/Common/Cache'),
+    'Doctrine\\Common\\' => array($vendorDir . '/doctrine/event-manager/src'),
     'Dflydev\\DotAccessData\\' => array($vendorDir . '/dflydev/dot-access-data/src'),
     'DeepCopy\\' => array($vendorDir . '/myclabs/deep-copy/src/DeepCopy'),
     'Database\\Seeders\\' => array($baseDir . '/database/seeders'),
     'Database\\Factories\\' => array($baseDir . '/database/factories'),
     'Cron\\' => array($vendorDir . '/dragonmantank/cron-expression/src/Cron'),
+    'Composer\\Pcre\\' => array($vendorDir . '/composer/pcre/src'),
     'Collective\\Html\\' => array($vendorDir . '/laravelcollective/html/src'),
     'Clue\\StreamFilter\\' => array($vendorDir . '/clue/stream-filter/src'),
     'Carbon\\' => array($vendorDir . '/nesbot/carbon/src/Carbon'),
     'Brick\\Math\\' => array($vendorDir . '/brick/math/src'),
+    'Barryvdh\\LaravelIdeHelper\\' => array($vendorDir . '/barryvdh/laravel-ide-helper/src'),
     'App\\' => array($baseDir . '/app'),
 );

vendor/composer/autoload_static.php

@@ -47,6 +47,10 @@ class ComposerStaticInitb2555e5ff7197b9e020da74bbd3b7cfa
         array (
             'voku\\' => 5,
         ),
+        'p' => 
+        array (
+            'phpDocumentor\\Reflection\\' => 25,
+        ),
         'W' => 
         array (
             'Whoops\\' => 7,
@@ -176,7 +180,11 @@ class ComposerStaticInitb2555e5ff7197b9e020da74bbd3b7cfa
             'Dotenv\\' => 7,
             'Doctrine\\Instantiator\\' => 22,
             'Doctrine\\Inflector\\' => 19,
+            'Doctrine\\Deprecations\\' => 22,
+            'Doctrine\\DBAL\\' => 14,
             'Doctrine\\Common\\Lexer\\' => 22,
+            'Doctrine\\Common\\Cache\\' => 22,
+            'Doctrine\\Common\\' => 16,
             'Dflydev\\DotAccessData\\' => 22,
             'DeepCopy\\' => 9,
             'Database\\Seeders\\' => 17,
@@ -185,6 +193,7 @@ class ComposerStaticInitb2555e5ff7197b9e020da74bbd3b7cfa
         'C' => 
         array (
             'Cron\\' => 5,
+            'Composer\\Pcre\\' => 14,
             'Collective\\Html\\' => 16,
             'Clue\\StreamFilter\\' => 18,
             'Carbon\\' => 7,
@@ -192,6 +201,7 @@ class ComposerStaticInitb2555e5ff7197b9e020da74bbd3b7cfa
         'B' => 
         array (
             'Brick\\Math\\' => 11,
+            'Barryvdh\\LaravelIdeHelper\\' => 26,
         ),
         'A' => 
         array (
@@ -204,6 +214,11 @@ class ComposerStaticInitb2555e5ff7197b9e020da74bbd3b7cfa
         array (
             0 => __DIR__ . '/..' . '/voku/portable-ascii/src/voku',
         ),
+        'phpDocumentor\\Reflection\\' => 
+        array (
+            0 => __DIR__ . '/..' . '/phpdocumentor/reflection-common/src',
+            1 => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src',
+        ),
         'Whoops\\' => 
         array (
             0 => __DIR__ . '/..' . '/filp/whoops/src/Whoops',
@@ -547,10 +562,26 @@ class ComposerStaticInitb2555e5ff7197b9e020da74bbd3b7cfa
         array (
             0 => __DIR__ . '/..' . '/doctrine/inflector/lib/Doctrine/Inflector',
         ),
+        'Doctrine\\Deprecations\\' => 
+        array (
+            0 => __DIR__ . '/..' . '/doctrine/deprecations/lib/Doctrine/Deprecations',
+        ),
+        'Doctrine\\DBAL\\' => 
+        array (
+            0 => __DIR__ . '/..' . '/doctrine/dbal/src',
+        ),
         'Doctrine\\Common\\Lexer\\' => 
         array (
             0 => __DIR__ . '/..' . '/doctrine/lexer/lib/Doctrine/Common/Lexer',
         ),
+        'Doctrine\\Common\\Cache\\' => 
+        array (
+            0 => __DIR__ . '/..' . '/doctrine/cache/lib/Doctrine/Common/Cache',
+        ),
+        'Doctrine\\Common\\' => 
+        array (
+            0 => __DIR__ . '/..' . '/doctrine/event-manager/src',
+        ),
         'Dflydev\\DotAccessData\\' => 
         array (
             0 => __DIR__ . '/..' . '/dflydev/dot-access-data/src',
@@ -571,6 +602,10 @@ class ComposerStaticInitb2555e5ff7197b9e020da74bbd3b7cfa
         array (
             0 => __DIR__ . '/..' . '/dragonmantank/cron-expression/src/Cron',
         ),
+        'Composer\\Pcre\\' => 
+        array (
+            0 => __DIR__ . '/..' . '/composer/pcre/src',
+        ),
         'Collective\\Html\\' => 
         array (
             0 => __DIR__ . '/..' . '/laravelcollective/html/src',
@@ -587,6 +622,10 @@ class ComposerStaticInitb2555e5ff7197b9e020da74bbd3b7cfa
         array (
             0 => __DIR__ . '/..' . '/brick/math/src',
         ),
+        'Barryvdh\\LaravelIdeHelper\\' => 
+        array (
+            0 => __DIR__ . '/..' . '/barryvdh/laravel-ide-helper/src',
+        ),
         'App\\' => 
         array (
             0 => __DIR__ . '/../..' . '/app',
@@ -601,6 +640,13 @@ class ComposerStaticInitb2555e5ff7197b9e020da74bbd3b7cfa
                 0 => __DIR__ . '/..' . '/mockery/mockery/library',
             ),
         ),
+        'B' => 
+        array (
+            'Barryvdh' => 
+            array (
+                0 => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src',
+            ),
+        ),
     );
 
     public static $classMap = array (
@@ -615,6 +661,7 @@ class ComposerStaticInitb2555e5ff7197b9e020da74bbd3b7cfa
         'App\\Http\\Controllers\\Auth\\ResetPasswordController' => __DIR__ . '/../..' . '/app/Http/Controllers/Auth/ResetPasswordController.php',
         'App\\Http\\Controllers\\Controller' => __DIR__ . '/../..' . '/app/Http/Controllers/Controller.php',
         'App\\Http\\Controllers\\HomeController' => __DIR__ . '/../..' . '/app/Http/Controllers/HomeController.php',
+        'App\\Http\\Controllers\\ImportController' => __DIR__ . '/../..' . '/app/Http/Controllers/ImportController.php',
         'App\\Http\\Controllers\\ItemController' => __DIR__ . '/../..' . '/app/Http/Controllers/ItemController.php',
         'App\\Http\\Controllers\\ItemRestController' => __DIR__ . '/../..' . '/app/Http/Controllers/ItemRestController.php',
         'App\\Http\\Controllers\\SearchController' => __DIR__ . '/../..' . '/app/Http/Controllers/SearchController.php',
@@ -643,8 +690,76 @@ class ComposerStaticInitb2555e5ff7197b9e020da74bbd3b7cfa
         'App\\SettingGroup' => __DIR__ . '/../..' . '/app/SettingGroup.php',
         'App\\SettingUser' => __DIR__ . '/../..' . '/app/SettingUser.php',
         'App\\SupportedApps' => __DIR__ . '/../..' . '/app/SupportedApps.php',
+        'App\\SupportedApps\\AMP\\AMP' => __DIR__ . '/../..' . '/app/SupportedApps/AMP/AMP.php',
+        'App\\SupportedApps\\AdGuardHome\\AdGuardHome' => __DIR__ . '/../..' . '/app/SupportedApps/AdGuardHome/AdGuardHome.php',
+        'App\\SupportedApps\\Adminer\\Adminer' => __DIR__ . '/../..' . '/app/SupportedApps/Adminer/Adminer.php',
+        'App\\SupportedApps\\Alertmanager\\Alertmanager' => __DIR__ . '/../..' . '/app/SupportedApps/Alertmanager/Alertmanager.php',
+        'App\\SupportedApps\\ArchiSteamFarm\\ArchiSteamFarm' => __DIR__ . '/../..' . '/app/SupportedApps/ArchiSteamFarm/ArchiSteamFarm.php',
+        'App\\SupportedApps\\ArgoCD\\ArgoCD' => __DIR__ . '/../..' . '/app/SupportedApps/ArgoCD/ArgoCD.php',
+        'App\\SupportedApps\\AriaNg\\AriaNg' => __DIR__ . '/../..' . '/app/SupportedApps/AriaNg/AriaNg.php',
+        'App\\SupportedApps\\Atlantis\\Atlantis' => __DIR__ . '/../..' . '/app/SupportedApps/Atlantis/Atlantis.php',
+        'App\\SupportedApps\\Bastillion\\Bastillion' => __DIR__ . '/../..' . '/app/SupportedApps/Bastillion/Bastillion.php',
+        'App\\SupportedApps\\Jellyfin\\Jellyfin' => __DIR__ . '/../..' . '/app/SupportedApps/Jellyfin/Jellyfin.php',
+        'App\\SupportedApps\\Jira\\Jira' => __DIR__ . '/../..' . '/app/SupportedApps/Jira/Jira.php',
+        'App\\SupportedApps\\Kibana\\Kibana' => __DIR__ . '/../..' . '/app/SupportedApps/Kibana/Kibana.php',
+        'App\\SupportedApps\\MotionEye\\MotionEye' => __DIR__ . '/../..' . '/app/SupportedApps/MotionEye/MotionEye.php',
+        'App\\SupportedApps\\Munin\\Munin' => __DIR__ . '/../..' . '/app/SupportedApps/Munin/Munin.php',
+        'App\\SupportedApps\\MusicBrainz\\MusicBrainz' => __DIR__ . '/../..' . '/app/SupportedApps/MusicBrainz/MusicBrainz.php',
+        'App\\SupportedApps\\Pihole\\Pihole' => __DIR__ . '/../..' . '/app/SupportedApps/Pihole/Pihole.php',
+        'App\\SupportedApps\\Plex\\Plex' => __DIR__ . '/../..' . '/app/SupportedApps/Plex/Plex.php',
+        'App\\SupportedApps\\Portainer\\Portainer' => __DIR__ . '/../..' . '/app/SupportedApps/Portainer/Portainer.php',
+        'App\\SupportedApps\\Poste\\Poste' => __DIR__ . '/../..' . '/app/SupportedApps/Poste/Poste.php',
+        'App\\SupportedApps\\Printer\\Printer' => __DIR__ . '/../..' . '/app/SupportedApps/Printer/Printer.php',
+        'App\\SupportedApps\\Rancher\\Rancher' => __DIR__ . '/../..' . '/app/SupportedApps/Rancher/Rancher.php',
+        'App\\SupportedApps\\TYPO3\\TYPO3' => __DIR__ . '/../..' . '/app/SupportedApps/TYPO3/TYPO3.php',
+        'App\\SupportedApps\\Tar1090\\Tar1090' => __DIR__ . '/../..' . '/app/SupportedApps/Tar1090/Tar1090.php',
+        'App\\SupportedApps\\Transmission\\Transmission' => __DIR__ . '/../..' . '/app/SupportedApps/Transmission/Transmission.php',
+        'App\\SupportedApps\\Trilium\\Trilium' => __DIR__ . '/../..' . '/app/SupportedApps/Trilium/Trilium.php',
+        'App\\SupportedApps\\TrueNAS\\TrueNAS' => __DIR__ . '/../..' . '/app/SupportedApps/TrueNAS/TrueNAS.php',
+        'App\\SupportedApps\\Ubooquity\\Ubooquity' => __DIR__ . '/../..' . '/app/SupportedApps/Ubooquity/Ubooquity.php',
+        'App\\SupportedApps\\UniFi\\UniFi' => __DIR__ . '/../..' . '/app/SupportedApps/UniFi/UniFi.php',
         'App\\User' => __DIR__ . '/../..' . '/app/User.php',
         'Attribute' => __DIR__ . '/..' . '/symfony/polyfill-php80/Resources/stubs/Attribute.php',
+        'Barryvdh\\LaravelIdeHelper\\Alias' => __DIR__ . '/..' . '/barryvdh/laravel-ide-helper/src/Alias.php',
+        'Barryvdh\\LaravelIdeHelper\\ClassMapGenerator' => __DIR__ . '/..' . '/barryvdh/laravel-ide-helper/src/ClassMapGenerator.php',
+        'Barryvdh\\LaravelIdeHelper\\Console\\EloquentCommand' => __DIR__ . '/..' . '/barryvdh/laravel-ide-helper/src/Console/EloquentCommand.php',
+        'Barryvdh\\LaravelIdeHelper\\Console\\GeneratorCommand' => __DIR__ . '/..' . '/barryvdh/laravel-ide-helper/src/Console/GeneratorCommand.php',
+        'Barryvdh\\LaravelIdeHelper\\Console\\MetaCommand' => __DIR__ . '/..' . '/barryvdh/laravel-ide-helper/src/Console/MetaCommand.php',
+        'Barryvdh\\LaravelIdeHelper\\Console\\ModelsCommand' => __DIR__ . '/..' . '/barryvdh/laravel-ide-helper/src/Console/ModelsCommand.php',
+        'Barryvdh\\LaravelIdeHelper\\Contracts\\ModelHookInterface' => __DIR__ . '/..' . '/barryvdh/laravel-ide-helper/src/Contracts/ModelHookInterface.php',
+        'Barryvdh\\LaravelIdeHelper\\Eloquent' => __DIR__ . '/..' . '/barryvdh/laravel-ide-helper/src/Eloquent.php',
+        'Barryvdh\\LaravelIdeHelper\\Factories' => __DIR__ . '/..' . '/barryvdh/laravel-ide-helper/src/Factories.php',
+        'Barryvdh\\LaravelIdeHelper\\Generator' => __DIR__ . '/..' . '/barryvdh/laravel-ide-helper/src/Generator.php',
+        'Barryvdh\\LaravelIdeHelper\\IdeHelperServiceProvider' => __DIR__ . '/..' . '/barryvdh/laravel-ide-helper/src/IdeHelperServiceProvider.php',
+        'Barryvdh\\LaravelIdeHelper\\Listeners\\GenerateModelHelper' => __DIR__ . '/..' . '/barryvdh/laravel-ide-helper/src/Listeners/GenerateModelHelper.php',
+        'Barryvdh\\LaravelIdeHelper\\Macro' => __DIR__ . '/..' . '/barryvdh/laravel-ide-helper/src/Macro.php',
+        'Barryvdh\\LaravelIdeHelper\\Method' => __DIR__ . '/..' . '/barryvdh/laravel-ide-helper/src/Method.php',
+        'Barryvdh\\LaravelIdeHelper\\UsesResolver' => __DIR__ . '/..' . '/barryvdh/laravel-ide-helper/src/UsesResolver.php',
+        'Barryvdh\\Reflection\\DocBlock' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock.php',
+        'Barryvdh\\Reflection\\DocBlock\\Context' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Context.php',
+        'Barryvdh\\Reflection\\DocBlock\\Description' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Description.php',
+        'Barryvdh\\Reflection\\DocBlock\\Location' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Location.php',
+        'Barryvdh\\Reflection\\DocBlock\\Serializer' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Serializer.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag\\AuthorTag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/AuthorTag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag\\CoversTag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/CoversTag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag\\DeprecatedTag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/DeprecatedTag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag\\ExampleTag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/ExampleTag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag\\LinkTag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/LinkTag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag\\MethodTag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/MethodTag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag\\ParamTag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/ParamTag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag\\PropertyReadTag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/PropertyReadTag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag\\PropertyTag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/PropertyTag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag\\PropertyWriteTag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/PropertyWriteTag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag\\ReturnTag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/ReturnTag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag\\SeeTag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/SeeTag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag\\SinceTag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/SinceTag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag\\SourceTag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/SourceTag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag\\ThrowsTag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/ThrowsTag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag\\UsesTag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/UsesTag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag\\VarTag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/VarTag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Tag\\VersionTag' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Tag/VersionTag.php',
+        'Barryvdh\\Reflection\\DocBlock\\Type\\Collection' => __DIR__ . '/..' . '/barryvdh/reflection-docblock/src/Barryvdh/Reflection/DocBlock/Type/Collection.php',
         'Brick\\Math\\BigDecimal' => __DIR__ . '/..' . '/brick/math/src/BigDecimal.php',
         'Brick\\Math\\BigInteger' => __DIR__ . '/..' . '/brick/math/src/BigInteger.php',
         'Brick\\Math\\BigNumber' => __DIR__ . '/..' . '/brick/math/src/BigNumber.php',
@@ -749,6 +864,17 @@ class ComposerStaticInitb2555e5ff7197b9e020da74bbd3b7cfa
         'Collective\\Html\\HtmlFacade' => __DIR__ . '/..' . '/laravelcollective/html/src/HtmlFacade.php',
         'Collective\\Html\\HtmlServiceProvider' => __DIR__ . '/..' . '/laravelcollective/html/src/HtmlServiceProvider.php',
         'Composer\\InstalledVersions' => __DIR__ . '/..' . '/composer/InstalledVersions.php',
+        'Composer\\Pcre\\MatchAllResult' => __DIR__ . '/..' . '/composer/pcre/src/MatchAllResult.php',
+        'Composer\\Pcre\\MatchAllStrictGroupsResult' => __DIR__ . '/..' . '/composer/pcre/src/MatchAllStrictGroupsResult.php',
+        'Composer\\Pcre\\MatchAllWithOffsetsResult' => __DIR__ . '/..' . '/composer/pcre/src/MatchAllWithOffsetsResult.php',
+        'Composer\\Pcre\\MatchResult' => __DIR__ . '/..' . '/composer/pcre/src/MatchResult.php',
+        'Composer\\Pcre\\MatchStrictGroupsResult' => __DIR__ . '/..' . '/composer/pcre/src/MatchStrictGroupsResult.php',
+        'Composer\\Pcre\\MatchWithOffsetsResult' => __DIR__ . '/..' . '/composer/pcre/src/MatchWithOffsetsResult.php',
+        'Composer\\Pcre\\PcreException' => __DIR__ . '/..' . '/composer/pcre/src/PcreException.php',
+        'Composer\\Pcre\\Preg' => __DIR__ . '/..' . '/composer/pcre/src/Preg.php',
+        'Composer\\Pcre\\Regex' => __DIR__ . '/..' . '/composer/pcre/src/Regex.php',
+        'Composer\\Pcre\\ReplaceResult' => __DIR__ . '/..' . '/composer/pcre/src/ReplaceResult.php',
+        'Composer\\Pcre\\UnexpectedNullMatchException' => __DIR__ . '/..' . '/composer/pcre/src/UnexpectedNullMatchException.php',
         'Cron\\AbstractField' => __DIR__ . '/..' . '/dragonmantank/cron-expression/src/Cron/AbstractField.php',
         'Cron\\CronExpression' => __DIR__ . '/..' . '/dragonmantank/cron-expression/src/Cron/CronExpression.php',
         'Cron\\DayOfMonthField' => __DIR__ . '/..' . '/dragonmantank/cron-expression/src/Cron/DayOfMonthField.php',
@@ -759,6 +885,7 @@ class ComposerStaticInitb2555e5ff7197b9e020da74bbd3b7cfa
         'Cron\\HoursField' => __DIR__ . '/..' . '/dragonmantank/cron-expression/src/Cron/HoursField.php',
         'Cron\\MinutesField' => __DIR__ . '/..' . '/dragonmantank/cron-expression/src/Cron/MinutesField.php',
         'Cron\\MonthField' => __DIR__ . '/..' . '/dragonmantank/cron-expression/src/Cron/MonthField.php',
+        'Database\\Factories\\ItemFactory' => __DIR__ . '/../..' . '/database/factories/ItemFactory.php',
         'Database\\Factories\\UserFactory' => __DIR__ . '/../..' . '/database/factories/UserFactory.php',
         'Database\\Seeders\\DatabaseSeeder' => __DIR__ . '/../..' . '/database/seeders/DatabaseSeeder.php',
         'Database\\Seeders\\SettingsSeeder' => __DIR__ . '/../..' . '/database/seeders/SettingsSeeder.php',
@@ -793,7 +920,333 @@ class ComposerStaticInitb2555e5ff7197b9e020da74bbd3b7cfa
         'Dflydev\\DotAccessData\\Exception\\InvalidPathException' => __DIR__ . '/..' . '/dflydev/dot-access-data/src/Exception/InvalidPathException.php',
         'Dflydev\\DotAccessData\\Exception\\MissingPathException' => __DIR__ . '/..' . '/dflydev/dot-access-data/src/Exception/MissingPathException.php',
         'Dflydev\\DotAccessData\\Util' => __DIR__ . '/..' . '/dflydev/dot-access-data/src/Util.php',
+        'Doctrine\\Common\\Cache\\Cache' => __DIR__ . '/..' . '/doctrine/cache/lib/Doctrine/Common/Cache/Cache.php',
+        'Doctrine\\Common\\Cache\\CacheProvider' => __DIR__ . '/..' . '/doctrine/cache/lib/Doctrine/Common/Cache/CacheProvider.php',
+        'Doctrine\\Common\\Cache\\ClearableCache' => __DIR__ . '/..' . '/doctrine/cache/lib/Doctrine/Common/Cache/ClearableCache.php',
+        'Doctrine\\Common\\Cache\\FlushableCache' => __DIR__ . '/..' . '/doctrine/cache/lib/Doctrine/Common/Cache/FlushableCache.php',
+        'Doctrine\\Common\\Cache\\MultiDeleteCache' => __DIR__ . '/..' . '/doctrine/cache/lib/Doctrine/Common/Cache/MultiDeleteCache.php',
+        'Doctrine\\Common\\Cache\\MultiGetCache' => __DIR__ . '/..' . '/doctrine/cache/lib/Doctrine/Common/Cache/MultiGetCache.php',
+        'Doctrine\\Common\\Cache\\MultiOperationCache' => __DIR__ . '/..' . '/doctrine/cache/lib/Doctrine/Common/Cache/MultiOperationCache.php',
+        'Doctrine\\Common\\Cache\\MultiPutCache' => __DIR__ . '/..' . '/doctrine/cache/lib/Doctrine/Common/Cache/MultiPutCache.php',
+        'Doctrine\\Common\\Cache\\Psr6\\CacheAdapter' => __DIR__ . '/..' . '/doctrine/cache/lib/Doctrine/Common/Cache/Psr6/CacheAdapter.php',
+        'Doctrine\\Common\\Cache\\Psr6\\CacheItem' => __DIR__ . '/..' . '/doctrine/cache/lib/Doctrine/Common/Cache/Psr6/CacheItem.php',
+        'Doctrine\\Common\\Cache\\Psr6\\DoctrineProvider' => __DIR__ . '/..' . '/doctrine/cache/lib/Doctrine/Common/Cache/Psr6/DoctrineProvider.php',
+        'Doctrine\\Common\\Cache\\Psr6\\InvalidArgument' => __DIR__ . '/..' . '/doctrine/cache/lib/Doctrine/Common/Cache/Psr6/InvalidArgument.php',
+        'Doctrine\\Common\\Cache\\Psr6\\TypedCacheItem' => __DIR__ . '/..' . '/doctrine/cache/lib/Doctrine/Common/Cache/Psr6/TypedCacheItem.php',
+        'Doctrine\\Common\\EventArgs' => __DIR__ . '/..' . '/doctrine/event-manager/src/EventArgs.php',
+        'Doctrine\\Common\\EventManager' => __DIR__ . '/..' . '/doctrine/event-manager/src/EventManager.php',
+        'Doctrine\\Common\\EventSubscriber' => __DIR__ . '/..' . '/doctrine/event-manager/src/EventSubscriber.php',
         'Doctrine\\Common\\Lexer\\AbstractLexer' => __DIR__ . '/..' . '/doctrine/lexer/lib/Doctrine/Common/Lexer/AbstractLexer.php',
+        'Doctrine\\DBAL\\ArrayParameters\\Exception' => __DIR__ . '/..' . '/doctrine/dbal/src/ArrayParameters/Exception.php',
+        'Doctrine\\DBAL\\ArrayParameters\\Exception\\MissingNamedParameter' => __DIR__ . '/..' . '/doctrine/dbal/src/ArrayParameters/Exception/MissingNamedParameter.php',
+        'Doctrine\\DBAL\\ArrayParameters\\Exception\\MissingPositionalParameter' => __DIR__ . '/..' . '/doctrine/dbal/src/ArrayParameters/Exception/MissingPositionalParameter.php',
+        'Doctrine\\DBAL\\Cache\\ArrayResult' => __DIR__ . '/..' . '/doctrine/dbal/src/Cache/ArrayResult.php',
+        'Doctrine\\DBAL\\Cache\\CacheException' => __DIR__ . '/..' . '/doctrine/dbal/src/Cache/CacheException.php',
+        'Doctrine\\DBAL\\Cache\\QueryCacheProfile' => __DIR__ . '/..' . '/doctrine/dbal/src/Cache/QueryCacheProfile.php',
+        'Doctrine\\DBAL\\ColumnCase' => __DIR__ . '/..' . '/doctrine/dbal/src/ColumnCase.php',
+        'Doctrine\\DBAL\\Configuration' => __DIR__ . '/..' . '/doctrine/dbal/src/Configuration.php',
+        'Doctrine\\DBAL\\Connection' => __DIR__ . '/..' . '/doctrine/dbal/src/Connection.php',
+        'Doctrine\\DBAL\\ConnectionException' => __DIR__ . '/..' . '/doctrine/dbal/src/ConnectionException.php',
+        'Doctrine\\DBAL\\Connections\\PrimaryReadReplicaConnection' => __DIR__ . '/..' . '/doctrine/dbal/src/Connections/PrimaryReadReplicaConnection.php',
+        'Doctrine\\DBAL\\Driver' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver.php',
+        'Doctrine\\DBAL\\DriverManager' => __DIR__ . '/..' . '/doctrine/dbal/src/DriverManager.php',
+        'Doctrine\\DBAL\\Driver\\API\\ExceptionConverter' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/API/ExceptionConverter.php',
+        'Doctrine\\DBAL\\Driver\\API\\IBMDB2\\ExceptionConverter' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/API/IBMDB2/ExceptionConverter.php',
+        'Doctrine\\DBAL\\Driver\\API\\MySQL\\ExceptionConverter' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/API/MySQL/ExceptionConverter.php',
+        'Doctrine\\DBAL\\Driver\\API\\OCI\\ExceptionConverter' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/API/OCI/ExceptionConverter.php',
+        'Doctrine\\DBAL\\Driver\\API\\PostgreSQL\\ExceptionConverter' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/API/PostgreSQL/ExceptionConverter.php',
+        'Doctrine\\DBAL\\Driver\\API\\SQLSrv\\ExceptionConverter' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/API/SQLSrv/ExceptionConverter.php',
+        'Doctrine\\DBAL\\Driver\\API\\SQLite\\ExceptionConverter' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/API/SQLite/ExceptionConverter.php',
+        'Doctrine\\DBAL\\Driver\\API\\SQLite\\UserDefinedFunctions' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/API/SQLite/UserDefinedFunctions.php',
+        'Doctrine\\DBAL\\Driver\\AbstractDB2Driver' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/AbstractDB2Driver.php',
+        'Doctrine\\DBAL\\Driver\\AbstractException' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/AbstractException.php',
+        'Doctrine\\DBAL\\Driver\\AbstractMySQLDriver' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/AbstractMySQLDriver.php',
+        'Doctrine\\DBAL\\Driver\\AbstractOracleDriver' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/AbstractOracleDriver.php',
+        'Doctrine\\DBAL\\Driver\\AbstractOracleDriver\\EasyConnectString' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/AbstractOracleDriver/EasyConnectString.php',
+        'Doctrine\\DBAL\\Driver\\AbstractPostgreSQLDriver' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/AbstractPostgreSQLDriver.php',
+        'Doctrine\\DBAL\\Driver\\AbstractSQLServerDriver' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/AbstractSQLServerDriver.php',
+        'Doctrine\\DBAL\\Driver\\AbstractSQLServerDriver\\Exception\\PortWithoutHost' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/AbstractSQLServerDriver/Exception/PortWithoutHost.php',
+        'Doctrine\\DBAL\\Driver\\AbstractSQLiteDriver' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/AbstractSQLiteDriver.php',
+        'Doctrine\\DBAL\\Driver\\AbstractSQLiteDriver\\Middleware\\EnableForeignKeys' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/AbstractSQLiteDriver/Middleware/EnableForeignKeys.php',
+        'Doctrine\\DBAL\\Driver\\Connection' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Connection.php',
+        'Doctrine\\DBAL\\Driver\\Exception' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Exception.php',
+        'Doctrine\\DBAL\\Driver\\Exception\\UnknownParameterType' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Exception/UnknownParameterType.php',
+        'Doctrine\\DBAL\\Driver\\FetchUtils' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/FetchUtils.php',
+        'Doctrine\\DBAL\\Driver\\IBMDB2\\Connection' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/IBMDB2/Connection.php',
+        'Doctrine\\DBAL\\Driver\\IBMDB2\\DataSourceName' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/IBMDB2/DataSourceName.php',
+        'Doctrine\\DBAL\\Driver\\IBMDB2\\Driver' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/IBMDB2/Driver.php',
+        'Doctrine\\DBAL\\Driver\\IBMDB2\\Exception\\CannotCopyStreamToStream' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/IBMDB2/Exception/CannotCopyStreamToStream.php',
+        'Doctrine\\DBAL\\Driver\\IBMDB2\\Exception\\CannotCreateTemporaryFile' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/IBMDB2/Exception/CannotCreateTemporaryFile.php',
+        'Doctrine\\DBAL\\Driver\\IBMDB2\\Exception\\ConnectionError' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/IBMDB2/Exception/ConnectionError.php',
+        'Doctrine\\DBAL\\Driver\\IBMDB2\\Exception\\ConnectionFailed' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/IBMDB2/Exception/ConnectionFailed.php',
+        'Doctrine\\DBAL\\Driver\\IBMDB2\\Exception\\Factory' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/IBMDB2/Exception/Factory.php',
+        'Doctrine\\DBAL\\Driver\\IBMDB2\\Exception\\PrepareFailed' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/IBMDB2/Exception/PrepareFailed.php',
+        'Doctrine\\DBAL\\Driver\\IBMDB2\\Exception\\StatementError' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/IBMDB2/Exception/StatementError.php',
+        'Doctrine\\DBAL\\Driver\\IBMDB2\\Result' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/IBMDB2/Result.php',
+        'Doctrine\\DBAL\\Driver\\IBMDB2\\Statement' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/IBMDB2/Statement.php',
+        'Doctrine\\DBAL\\Driver\\Middleware' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Middleware.php',
+        'Doctrine\\DBAL\\Driver\\Middleware\\AbstractConnectionMiddleware' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Middleware/AbstractConnectionMiddleware.php',
+        'Doctrine\\DBAL\\Driver\\Middleware\\AbstractDriverMiddleware' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Middleware/AbstractDriverMiddleware.php',
+        'Doctrine\\DBAL\\Driver\\Middleware\\AbstractResultMiddleware' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Middleware/AbstractResultMiddleware.php',
+        'Doctrine\\DBAL\\Driver\\Middleware\\AbstractStatementMiddleware' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Middleware/AbstractStatementMiddleware.php',
+        'Doctrine\\DBAL\\Driver\\Mysqli\\Connection' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Mysqli/Connection.php',
+        'Doctrine\\DBAL\\Driver\\Mysqli\\Driver' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Mysqli/Driver.php',
+        'Doctrine\\DBAL\\Driver\\Mysqli\\Exception\\ConnectionError' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Mysqli/Exception/ConnectionError.php',
+        'Doctrine\\DBAL\\Driver\\Mysqli\\Exception\\ConnectionFailed' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Mysqli/Exception/ConnectionFailed.php',
+        'Doctrine\\DBAL\\Driver\\Mysqli\\Exception\\FailedReadingStreamOffset' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Mysqli/Exception/FailedReadingStreamOffset.php',
+        'Doctrine\\DBAL\\Driver\\Mysqli\\Exception\\HostRequired' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Mysqli/Exception/HostRequired.php',
+        'Doctrine\\DBAL\\Driver\\Mysqli\\Exception\\InvalidCharset' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Mysqli/Exception/InvalidCharset.php',
+        'Doctrine\\DBAL\\Driver\\Mysqli\\Exception\\InvalidOption' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Mysqli/Exception/InvalidOption.php',
+        'Doctrine\\DBAL\\Driver\\Mysqli\\Exception\\NonStreamResourceUsedAsLargeObject' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Mysqli/Exception/NonStreamResourceUsedAsLargeObject.php',
+        'Doctrine\\DBAL\\Driver\\Mysqli\\Exception\\StatementError' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Mysqli/Exception/StatementError.php',
+        'Doctrine\\DBAL\\Driver\\Mysqli\\Initializer' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Mysqli/Initializer.php',
+        'Doctrine\\DBAL\\Driver\\Mysqli\\Initializer\\Charset' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Mysqli/Initializer/Charset.php',
+        'Doctrine\\DBAL\\Driver\\Mysqli\\Initializer\\Options' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Mysqli/Initializer/Options.php',
+        'Doctrine\\DBAL\\Driver\\Mysqli\\Initializer\\Secure' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Mysqli/Initializer/Secure.php',
+        'Doctrine\\DBAL\\Driver\\Mysqli\\Result' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Mysqli/Result.php',
+        'Doctrine\\DBAL\\Driver\\Mysqli\\Statement' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Mysqli/Statement.php',
+        'Doctrine\\DBAL\\Driver\\OCI8\\Connection' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/OCI8/Connection.php',
+        'Doctrine\\DBAL\\Driver\\OCI8\\ConvertPositionalToNamedPlaceholders' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/OCI8/ConvertPositionalToNamedPlaceholders.php',
+        'Doctrine\\DBAL\\Driver\\OCI8\\Driver' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/OCI8/Driver.php',
+        'Doctrine\\DBAL\\Driver\\OCI8\\Exception\\ConnectionFailed' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/OCI8/Exception/ConnectionFailed.php',
+        'Doctrine\\DBAL\\Driver\\OCI8\\Exception\\Error' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/OCI8/Exception/Error.php',
+        'Doctrine\\DBAL\\Driver\\OCI8\\Exception\\NonTerminatedStringLiteral' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/OCI8/Exception/NonTerminatedStringLiteral.php',
+        'Doctrine\\DBAL\\Driver\\OCI8\\Exception\\SequenceDoesNotExist' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/OCI8/Exception/SequenceDoesNotExist.php',
+        'Doctrine\\DBAL\\Driver\\OCI8\\Exception\\UnknownParameterIndex' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/OCI8/Exception/UnknownParameterIndex.php',
+        'Doctrine\\DBAL\\Driver\\OCI8\\ExecutionMode' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/OCI8/ExecutionMode.php',
+        'Doctrine\\DBAL\\Driver\\OCI8\\Middleware\\InitializeSession' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/OCI8/Middleware/InitializeSession.php',
+        'Doctrine\\DBAL\\Driver\\OCI8\\Result' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/OCI8/Result.php',
+        'Doctrine\\DBAL\\Driver\\OCI8\\Statement' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/OCI8/Statement.php',
+        'Doctrine\\DBAL\\Driver\\PDO\\Connection' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/PDO/Connection.php',
+        'Doctrine\\DBAL\\Driver\\PDO\\Exception' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/PDO/Exception.php',
+        'Doctrine\\DBAL\\Driver\\PDO\\MySQL\\Driver' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/PDO/MySQL/Driver.php',
+        'Doctrine\\DBAL\\Driver\\PDO\\OCI\\Driver' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/PDO/OCI/Driver.php',
+        'Doctrine\\DBAL\\Driver\\PDO\\PgSQL\\Driver' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/PDO/PgSQL/Driver.php',
+        'Doctrine\\DBAL\\Driver\\PDO\\Result' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/PDO/Result.php',
+        'Doctrine\\DBAL\\Driver\\PDO\\SQLSrv\\Connection' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/PDO/SQLSrv/Connection.php',
+        'Doctrine\\DBAL\\Driver\\PDO\\SQLSrv\\Driver' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/PDO/SQLSrv/Driver.php',
+        'Doctrine\\DBAL\\Driver\\PDO\\SQLSrv\\Statement' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/PDO/SQLSrv/Statement.php',
+        'Doctrine\\DBAL\\Driver\\PDO\\SQLite\\Driver' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/PDO/SQLite/Driver.php',
+        'Doctrine\\DBAL\\Driver\\PDO\\Statement' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/PDO/Statement.php',
+        'Doctrine\\DBAL\\Driver\\Result' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Result.php',
+        'Doctrine\\DBAL\\Driver\\SQLSrv\\Connection' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/SQLSrv/Connection.php',
+        'Doctrine\\DBAL\\Driver\\SQLSrv\\Driver' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/SQLSrv/Driver.php',
+        'Doctrine\\DBAL\\Driver\\SQLSrv\\Exception\\Error' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/SQLSrv/Exception/Error.php',
+        'Doctrine\\DBAL\\Driver\\SQLSrv\\Result' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/SQLSrv/Result.php',
+        'Doctrine\\DBAL\\Driver\\SQLSrv\\Statement' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/SQLSrv/Statement.php',
+        'Doctrine\\DBAL\\Driver\\SQLite3\\Connection' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/SQLite3/Connection.php',
+        'Doctrine\\DBAL\\Driver\\SQLite3\\Driver' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/SQLite3/Driver.php',
+        'Doctrine\\DBAL\\Driver\\SQLite3\\Exception' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/SQLite3/Exception.php',
+        'Doctrine\\DBAL\\Driver\\SQLite3\\Result' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/SQLite3/Result.php',
+        'Doctrine\\DBAL\\Driver\\SQLite3\\Statement' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/SQLite3/Statement.php',
+        'Doctrine\\DBAL\\Driver\\ServerInfoAwareConnection' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/ServerInfoAwareConnection.php',
+        'Doctrine\\DBAL\\Driver\\Statement' => __DIR__ . '/..' . '/doctrine/dbal/src/Driver/Statement.php',
+        'Doctrine\\DBAL\\Event\\ConnectionEventArgs' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/ConnectionEventArgs.php',
+        'Doctrine\\DBAL\\Event\\Listeners\\OracleSessionInit' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/Listeners/OracleSessionInit.php',
+        'Doctrine\\DBAL\\Event\\Listeners\\SQLSessionInit' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/Listeners/SQLSessionInit.php',
+        'Doctrine\\DBAL\\Event\\Listeners\\SQLiteSessionInit' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/Listeners/SQLiteSessionInit.php',
+        'Doctrine\\DBAL\\Event\\SchemaAlterTableAddColumnEventArgs' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/SchemaAlterTableAddColumnEventArgs.php',
+        'Doctrine\\DBAL\\Event\\SchemaAlterTableChangeColumnEventArgs' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/SchemaAlterTableChangeColumnEventArgs.php',
+        'Doctrine\\DBAL\\Event\\SchemaAlterTableEventArgs' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/SchemaAlterTableEventArgs.php',
+        'Doctrine\\DBAL\\Event\\SchemaAlterTableRemoveColumnEventArgs' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/SchemaAlterTableRemoveColumnEventArgs.php',
+        'Doctrine\\DBAL\\Event\\SchemaAlterTableRenameColumnEventArgs' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/SchemaAlterTableRenameColumnEventArgs.php',
+        'Doctrine\\DBAL\\Event\\SchemaColumnDefinitionEventArgs' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/SchemaColumnDefinitionEventArgs.php',
+        'Doctrine\\DBAL\\Event\\SchemaCreateTableColumnEventArgs' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/SchemaCreateTableColumnEventArgs.php',
+        'Doctrine\\DBAL\\Event\\SchemaCreateTableEventArgs' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/SchemaCreateTableEventArgs.php',
+        'Doctrine\\DBAL\\Event\\SchemaDropTableEventArgs' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/SchemaDropTableEventArgs.php',
+        'Doctrine\\DBAL\\Event\\SchemaEventArgs' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/SchemaEventArgs.php',
+        'Doctrine\\DBAL\\Event\\SchemaIndexDefinitionEventArgs' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/SchemaIndexDefinitionEventArgs.php',
+        'Doctrine\\DBAL\\Event\\TransactionBeginEventArgs' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/TransactionBeginEventArgs.php',
+        'Doctrine\\DBAL\\Event\\TransactionCommitEventArgs' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/TransactionCommitEventArgs.php',
+        'Doctrine\\DBAL\\Event\\TransactionEventArgs' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/TransactionEventArgs.php',
+        'Doctrine\\DBAL\\Event\\TransactionRollBackEventArgs' => __DIR__ . '/..' . '/doctrine/dbal/src/Event/TransactionRollBackEventArgs.php',
+        'Doctrine\\DBAL\\Events' => __DIR__ . '/..' . '/doctrine/dbal/src/Events.php',
+        'Doctrine\\DBAL\\Exception' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception.php',
+        'Doctrine\\DBAL\\Exception\\ConnectionException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/ConnectionException.php',
+        'Doctrine\\DBAL\\Exception\\ConnectionLost' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/ConnectionLost.php',
+        'Doctrine\\DBAL\\Exception\\ConstraintViolationException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/ConstraintViolationException.php',
+        'Doctrine\\DBAL\\Exception\\DatabaseDoesNotExist' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/DatabaseDoesNotExist.php',
+        'Doctrine\\DBAL\\Exception\\DatabaseObjectExistsException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/DatabaseObjectExistsException.php',
+        'Doctrine\\DBAL\\Exception\\DatabaseObjectNotFoundException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/DatabaseObjectNotFoundException.php',
+        'Doctrine\\DBAL\\Exception\\DatabaseRequired' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/DatabaseRequired.php',
+        'Doctrine\\DBAL\\Exception\\DeadlockException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/DeadlockException.php',
+        'Doctrine\\DBAL\\Exception\\DriverException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/DriverException.php',
+        'Doctrine\\DBAL\\Exception\\ForeignKeyConstraintViolationException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/ForeignKeyConstraintViolationException.php',
+        'Doctrine\\DBAL\\Exception\\InvalidArgumentException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/InvalidArgumentException.php',
+        'Doctrine\\DBAL\\Exception\\InvalidFieldNameException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/InvalidFieldNameException.php',
+        'Doctrine\\DBAL\\Exception\\InvalidLockMode' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/InvalidLockMode.php',
+        'Doctrine\\DBAL\\Exception\\LockWaitTimeoutException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/LockWaitTimeoutException.php',
+        'Doctrine\\DBAL\\Exception\\NoKeyValue' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/NoKeyValue.php',
+        'Doctrine\\DBAL\\Exception\\NonUniqueFieldNameException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/NonUniqueFieldNameException.php',
+        'Doctrine\\DBAL\\Exception\\NotNullConstraintViolationException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/NotNullConstraintViolationException.php',
+        'Doctrine\\DBAL\\Exception\\ReadOnlyException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/ReadOnlyException.php',
+        'Doctrine\\DBAL\\Exception\\RetryableException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/RetryableException.php',
+        'Doctrine\\DBAL\\Exception\\SchemaDoesNotExist' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/SchemaDoesNotExist.php',
+        'Doctrine\\DBAL\\Exception\\ServerException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/ServerException.php',
+        'Doctrine\\DBAL\\Exception\\SyntaxErrorException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/SyntaxErrorException.php',
+        'Doctrine\\DBAL\\Exception\\TableExistsException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/TableExistsException.php',
+        'Doctrine\\DBAL\\Exception\\TableNotFoundException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/TableNotFoundException.php',
+        'Doctrine\\DBAL\\Exception\\UniqueConstraintViolationException' => __DIR__ . '/..' . '/doctrine/dbal/src/Exception/UniqueConstraintViolationException.php',
+        'Doctrine\\DBAL\\ExpandArrayParameters' => __DIR__ . '/..' . '/doctrine/dbal/src/ExpandArrayParameters.php',
+        'Doctrine\\DBAL\\FetchMode' => __DIR__ . '/..' . '/doctrine/dbal/src/FetchMode.php',
+        'Doctrine\\DBAL\\Id\\TableGenerator' => __DIR__ . '/..' . '/doctrine/dbal/src/Id/TableGenerator.php',
+        'Doctrine\\DBAL\\Id\\TableGeneratorSchemaVisitor' => __DIR__ . '/..' . '/doctrine/dbal/src/Id/TableGeneratorSchemaVisitor.php',
+        'Doctrine\\DBAL\\LockMode' => __DIR__ . '/..' . '/doctrine/dbal/src/LockMode.php',
+        'Doctrine\\DBAL\\Logging\\Connection' => __DIR__ . '/..' . '/doctrine/dbal/src/Logging/Connection.php',
+        'Doctrine\\DBAL\\Logging\\DebugStack' => __DIR__ . '/..' . '/doctrine/dbal/src/Logging/DebugStack.php',
+        'Doctrine\\DBAL\\Logging\\Driver' => __DIR__ . '/..' . '/doctrine/dbal/src/Logging/Driver.php',
+        'Doctrine\\DBAL\\Logging\\LoggerChain' => __DIR__ . '/..' . '/doctrine/dbal/src/Logging/LoggerChain.php',
+        'Doctrine\\DBAL\\Logging\\Middleware' => __DIR__ . '/..' . '/doctrine/dbal/src/Logging/Middleware.php',
+        'Doctrine\\DBAL\\Logging\\SQLLogger' => __DIR__ . '/..' . '/doctrine/dbal/src/Logging/SQLLogger.php',
+        'Doctrine\\DBAL\\Logging\\Statement' => __DIR__ . '/..' . '/doctrine/dbal/src/Logging/Statement.php',
+        'Doctrine\\DBAL\\ParameterType' => __DIR__ . '/..' . '/doctrine/dbal/src/ParameterType.php',
+        'Doctrine\\DBAL\\Platforms\\AbstractMySQLPlatform' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/AbstractMySQLPlatform.php',
+        'Doctrine\\DBAL\\Platforms\\AbstractPlatform' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/AbstractPlatform.php',
+        'Doctrine\\DBAL\\Platforms\\DB2Platform' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/DB2Platform.php',
+        'Doctrine\\DBAL\\Platforms\\DateIntervalUnit' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/DateIntervalUnit.php',
+        'Doctrine\\DBAL\\Platforms\\Keywords\\DB2Keywords' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/Keywords/DB2Keywords.php',
+        'Doctrine\\DBAL\\Platforms\\Keywords\\KeywordList' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/Keywords/KeywordList.php',
+        'Doctrine\\DBAL\\Platforms\\Keywords\\MariaDBKeywords' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/Keywords/MariaDBKeywords.php',
+        'Doctrine\\DBAL\\Platforms\\Keywords\\MariaDb102Keywords' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/Keywords/MariaDb102Keywords.php',
+        'Doctrine\\DBAL\\Platforms\\Keywords\\MySQL57Keywords' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/Keywords/MySQL57Keywords.php',
+        'Doctrine\\DBAL\\Platforms\\Keywords\\MySQL80Keywords' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/Keywords/MySQL80Keywords.php',
+        'Doctrine\\DBAL\\Platforms\\Keywords\\MySQLKeywords' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/Keywords/MySQLKeywords.php',
+        'Doctrine\\DBAL\\Platforms\\Keywords\\OracleKeywords' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/Keywords/OracleKeywords.php',
+        'Doctrine\\DBAL\\Platforms\\Keywords\\PostgreSQL100Keywords' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/Keywords/PostgreSQL100Keywords.php',
+        'Doctrine\\DBAL\\Platforms\\Keywords\\PostgreSQL94Keywords' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/Keywords/PostgreSQL94Keywords.php',
+        'Doctrine\\DBAL\\Platforms\\Keywords\\PostgreSQLKeywords' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/Keywords/PostgreSQLKeywords.php',
+        'Doctrine\\DBAL\\Platforms\\Keywords\\ReservedKeywordsValidator' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/Keywords/ReservedKeywordsValidator.php',
+        'Doctrine\\DBAL\\Platforms\\Keywords\\SQLServer2012Keywords' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/Keywords/SQLServer2012Keywords.php',
+        'Doctrine\\DBAL\\Platforms\\Keywords\\SQLServerKeywords' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/Keywords/SQLServerKeywords.php',
+        'Doctrine\\DBAL\\Platforms\\Keywords\\SQLiteKeywords' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/Keywords/SQLiteKeywords.php',
+        'Doctrine\\DBAL\\Platforms\\MariaDBPlatform' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/MariaDBPlatform.php',
+        'Doctrine\\DBAL\\Platforms\\MariaDb1027Platform' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/MariaDb1027Platform.php',
+        'Doctrine\\DBAL\\Platforms\\MySQL57Platform' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/MySQL57Platform.php',
+        'Doctrine\\DBAL\\Platforms\\MySQL80Platform' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/MySQL80Platform.php',
+        'Doctrine\\DBAL\\Platforms\\MySQLPlatform' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/MySQLPlatform.php',
+        'Doctrine\\DBAL\\Platforms\\MySQL\\CollationMetadataProvider' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/MySQL/CollationMetadataProvider.php',
+        'Doctrine\\DBAL\\Platforms\\MySQL\\CollationMetadataProvider\\CachingCollationMetadataProvider' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/MySQL/CollationMetadataProvider/CachingCollationMetadataProvider.php',
+        'Doctrine\\DBAL\\Platforms\\MySQL\\CollationMetadataProvider\\ConnectionCollationMetadataProvider' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/MySQL/CollationMetadataProvider/ConnectionCollationMetadataProvider.php',
+        'Doctrine\\DBAL\\Platforms\\MySQL\\Comparator' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/MySQL/Comparator.php',
+        'Doctrine\\DBAL\\Platforms\\OraclePlatform' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/OraclePlatform.php',
+        'Doctrine\\DBAL\\Platforms\\PostgreSQL100Platform' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/PostgreSQL100Platform.php',
+        'Doctrine\\DBAL\\Platforms\\PostgreSQL94Platform' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/PostgreSQL94Platform.php',
+        'Doctrine\\DBAL\\Platforms\\PostgreSQLPlatform' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/PostgreSQLPlatform.php',
+        'Doctrine\\DBAL\\Platforms\\SQLServer2012Platform' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/SQLServer2012Platform.php',
+        'Doctrine\\DBAL\\Platforms\\SQLServerPlatform' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/SQLServerPlatform.php',
+        'Doctrine\\DBAL\\Platforms\\SQLServer\\Comparator' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/SQLServer/Comparator.php',
+        'Doctrine\\DBAL\\Platforms\\SQLite\\Comparator' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/SQLite/Comparator.php',
+        'Doctrine\\DBAL\\Platforms\\SqlitePlatform' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/SqlitePlatform.php',
+        'Doctrine\\DBAL\\Platforms\\TrimMode' => __DIR__ . '/..' . '/doctrine/dbal/src/Platforms/TrimMode.php',
+        'Doctrine\\DBAL\\Portability\\Connection' => __DIR__ . '/..' . '/doctrine/dbal/src/Portability/Connection.php',
+        'Doctrine\\DBAL\\Portability\\Converter' => __DIR__ . '/..' . '/doctrine/dbal/src/Portability/Converter.php',
+        'Doctrine\\DBAL\\Portability\\Driver' => __DIR__ . '/..' . '/doctrine/dbal/src/Portability/Driver.php',
+        'Doctrine\\DBAL\\Portability\\Middleware' => __DIR__ . '/..' . '/doctrine/dbal/src/Portability/Middleware.php',
+        'Doctrine\\DBAL\\Portability\\OptimizeFlags' => __DIR__ . '/..' . '/doctrine/dbal/src/Portability/OptimizeFlags.php',
+        'Doctrine\\DBAL\\Portability\\Result' => __DIR__ . '/..' . '/doctrine/dbal/src/Portability/Result.php',
+        'Doctrine\\DBAL\\Portability\\Statement' => __DIR__ . '/..' . '/doctrine/dbal/src/Portability/Statement.php',
+        'Doctrine\\DBAL\\Query' => __DIR__ . '/..' . '/doctrine/dbal/src/Query.php',
+        'Doctrine\\DBAL\\Query\\Expression\\CompositeExpression' => __DIR__ . '/..' . '/doctrine/dbal/src/Query/Expression/CompositeExpression.php',
+        'Doctrine\\DBAL\\Query\\Expression\\ExpressionBuilder' => __DIR__ . '/..' . '/doctrine/dbal/src/Query/Expression/ExpressionBuilder.php',
+        'Doctrine\\DBAL\\Query\\QueryBuilder' => __DIR__ . '/..' . '/doctrine/dbal/src/Query/QueryBuilder.php',
+        'Doctrine\\DBAL\\Query\\QueryException' => __DIR__ . '/..' . '/doctrine/dbal/src/Query/QueryException.php',
+        'Doctrine\\DBAL\\Result' => __DIR__ . '/..' . '/doctrine/dbal/src/Result.php',
+        'Doctrine\\DBAL\\SQL\\Builder\\CreateSchemaObjectsSQLBuilder' => __DIR__ . '/..' . '/doctrine/dbal/src/SQL/Builder/CreateSchemaObjectsSQLBuilder.php',
+        'Doctrine\\DBAL\\SQL\\Builder\\DropSchemaObjectsSQLBuilder' => __DIR__ . '/..' . '/doctrine/dbal/src/SQL/Builder/DropSchemaObjectsSQLBuilder.php',
+        'Doctrine\\DBAL\\SQL\\Parser' => __DIR__ . '/..' . '/doctrine/dbal/src/SQL/Parser.php',
+        'Doctrine\\DBAL\\SQL\\Parser\\Exception' => __DIR__ . '/..' . '/doctrine/dbal/src/SQL/Parser/Exception.php',
+        'Doctrine\\DBAL\\SQL\\Parser\\Exception\\RegularExpressionError' => __DIR__ . '/..' . '/doctrine/dbal/src/SQL/Parser/Exception/RegularExpressionError.php',
+        'Doctrine\\DBAL\\SQL\\Parser\\Visitor' => __DIR__ . '/..' . '/doctrine/dbal/src/SQL/Parser/Visitor.php',
+        'Doctrine\\DBAL\\Schema\\AbstractAsset' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/AbstractAsset.php',
+        'Doctrine\\DBAL\\Schema\\AbstractSchemaManager' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/AbstractSchemaManager.php',
+        'Doctrine\\DBAL\\Schema\\Column' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Column.php',
+        'Doctrine\\DBAL\\Schema\\ColumnDiff' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/ColumnDiff.php',
+        'Doctrine\\DBAL\\Schema\\Comparator' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Comparator.php',
+        'Doctrine\\DBAL\\Schema\\Constraint' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Constraint.php',
+        'Doctrine\\DBAL\\Schema\\DB2SchemaManager' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/DB2SchemaManager.php',
+        'Doctrine\\DBAL\\Schema\\Exception\\ColumnAlreadyExists' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Exception/ColumnAlreadyExists.php',
+        'Doctrine\\DBAL\\Schema\\Exception\\ColumnDoesNotExist' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Exception/ColumnDoesNotExist.php',
+        'Doctrine\\DBAL\\Schema\\Exception\\ForeignKeyDoesNotExist' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Exception/ForeignKeyDoesNotExist.php',
+        'Doctrine\\DBAL\\Schema\\Exception\\IndexAlreadyExists' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Exception/IndexAlreadyExists.php',
+        'Doctrine\\DBAL\\Schema\\Exception\\IndexDoesNotExist' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Exception/IndexDoesNotExist.php',
+        'Doctrine\\DBAL\\Schema\\Exception\\IndexNameInvalid' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Exception/IndexNameInvalid.php',
+        'Doctrine\\DBAL\\Schema\\Exception\\InvalidTableName' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Exception/InvalidTableName.php',
+        'Doctrine\\DBAL\\Schema\\Exception\\NamedForeignKeyRequired' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Exception/NamedForeignKeyRequired.php',
+        'Doctrine\\DBAL\\Schema\\Exception\\NamespaceAlreadyExists' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Exception/NamespaceAlreadyExists.php',
+        'Doctrine\\DBAL\\Schema\\Exception\\SequenceAlreadyExists' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Exception/SequenceAlreadyExists.php',
+        'Doctrine\\DBAL\\Schema\\Exception\\SequenceDoesNotExist' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Exception/SequenceDoesNotExist.php',
+        'Doctrine\\DBAL\\Schema\\Exception\\TableAlreadyExists' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Exception/TableAlreadyExists.php',
+        'Doctrine\\DBAL\\Schema\\Exception\\TableDoesNotExist' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Exception/TableDoesNotExist.php',
+        'Doctrine\\DBAL\\Schema\\Exception\\UniqueConstraintDoesNotExist' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Exception/UniqueConstraintDoesNotExist.php',
+        'Doctrine\\DBAL\\Schema\\Exception\\UnknownColumnOption' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Exception/UnknownColumnOption.php',
+        'Doctrine\\DBAL\\Schema\\ForeignKeyConstraint' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/ForeignKeyConstraint.php',
+        'Doctrine\\DBAL\\Schema\\Identifier' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Identifier.php',
+        'Doctrine\\DBAL\\Schema\\Index' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Index.php',
+        'Doctrine\\DBAL\\Schema\\MySQLSchemaManager' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/MySQLSchemaManager.php',
+        'Doctrine\\DBAL\\Schema\\OracleSchemaManager' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/OracleSchemaManager.php',
+        'Doctrine\\DBAL\\Schema\\PostgreSQLSchemaManager' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/PostgreSQLSchemaManager.php',
+        'Doctrine\\DBAL\\Schema\\SQLServerSchemaManager' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/SQLServerSchemaManager.php',
+        'Doctrine\\DBAL\\Schema\\Schema' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Schema.php',
+        'Doctrine\\DBAL\\Schema\\SchemaConfig' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/SchemaConfig.php',
+        'Doctrine\\DBAL\\Schema\\SchemaDiff' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/SchemaDiff.php',
+        'Doctrine\\DBAL\\Schema\\SchemaException' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/SchemaException.php',
+        'Doctrine\\DBAL\\Schema\\Sequence' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Sequence.php',
+        'Doctrine\\DBAL\\Schema\\SqliteSchemaManager' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/SqliteSchemaManager.php',
+        'Doctrine\\DBAL\\Schema\\Table' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Table.php',
+        'Doctrine\\DBAL\\Schema\\TableDiff' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/TableDiff.php',
+        'Doctrine\\DBAL\\Schema\\UniqueConstraint' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/UniqueConstraint.php',
+        'Doctrine\\DBAL\\Schema\\View' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/View.php',
+        'Doctrine\\DBAL\\Schema\\Visitor\\AbstractVisitor' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Visitor/AbstractVisitor.php',
+        'Doctrine\\DBAL\\Schema\\Visitor\\CreateSchemaSqlCollector' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Visitor/CreateSchemaSqlCollector.php',
+        'Doctrine\\DBAL\\Schema\\Visitor\\DropSchemaSqlCollector' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Visitor/DropSchemaSqlCollector.php',
+        'Doctrine\\DBAL\\Schema\\Visitor\\Graphviz' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Visitor/Graphviz.php',
+        'Doctrine\\DBAL\\Schema\\Visitor\\NamespaceVisitor' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Visitor/NamespaceVisitor.php',
+        'Doctrine\\DBAL\\Schema\\Visitor\\RemoveNamespacedAssets' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Visitor/RemoveNamespacedAssets.php',
+        'Doctrine\\DBAL\\Schema\\Visitor\\Visitor' => __DIR__ . '/..' . '/doctrine/dbal/src/Schema/Visitor/Visitor.php',
+        'Doctrine\\DBAL\\Statement' => __DIR__ . '/..' . '/doctrine/dbal/src/Statement.php',
+        'Doctrine\\DBAL\\Tools\\Console\\Command\\ReservedWordsCommand' => __DIR__ . '/..' . '/doctrine/dbal/src/Tools/Console/Command/ReservedWordsCommand.php',
+        'Doctrine\\DBAL\\Tools\\Console\\Command\\RunSqlCommand' => __DIR__ . '/..' . '/doctrine/dbal/src/Tools/Console/Command/RunSqlCommand.php',
+        'Doctrine\\DBAL\\Tools\\Console\\ConnectionNotFound' => __DIR__ . '/..' . '/doctrine/dbal/src/Tools/Console/ConnectionNotFound.php',
+        'Doctrine\\DBAL\\Tools\\Console\\ConnectionProvider' => __DIR__ . '/..' . '/doctrine/dbal/src/Tools/Console/ConnectionProvider.php',
+        'Doctrine\\DBAL\\Tools\\Console\\ConnectionProvider\\SingleConnectionProvider' => __DIR__ . '/..' . '/doctrine/dbal/src/Tools/Console/ConnectionProvider/SingleConnectionProvider.php',
+        'Doctrine\\DBAL\\Tools\\Console\\ConsoleRunner' => __DIR__ . '/..' . '/doctrine/dbal/src/Tools/Console/ConsoleRunner.php',
+        'Doctrine\\DBAL\\TransactionIsolationLevel' => __DIR__ . '/..' . '/doctrine/dbal/src/TransactionIsolationLevel.php',
+        'Doctrine\\DBAL\\Types\\ArrayType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/ArrayType.php',
+        'Doctrine\\DBAL\\Types\\AsciiStringType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/AsciiStringType.php',
+        'Doctrine\\DBAL\\Types\\BigIntType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/BigIntType.php',
+        'Doctrine\\DBAL\\Types\\BinaryType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/BinaryType.php',
+        'Doctrine\\DBAL\\Types\\BlobType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/BlobType.php',
+        'Doctrine\\DBAL\\Types\\BooleanType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/BooleanType.php',
+        'Doctrine\\DBAL\\Types\\ConversionException' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/ConversionException.php',
+        'Doctrine\\DBAL\\Types\\DateImmutableType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/DateImmutableType.php',
+        'Doctrine\\DBAL\\Types\\DateIntervalType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/DateIntervalType.php',
+        'Doctrine\\DBAL\\Types\\DateTimeImmutableType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/DateTimeImmutableType.php',
+        'Doctrine\\DBAL\\Types\\DateTimeType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/DateTimeType.php',
+        'Doctrine\\DBAL\\Types\\DateTimeTzImmutableType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/DateTimeTzImmutableType.php',
+        'Doctrine\\DBAL\\Types\\DateTimeTzType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/DateTimeTzType.php',
+        'Doctrine\\DBAL\\Types\\DateType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/DateType.php',
+        'Doctrine\\DBAL\\Types\\DecimalType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/DecimalType.php',
+        'Doctrine\\DBAL\\Types\\FloatType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/FloatType.php',
+        'Doctrine\\DBAL\\Types\\GuidType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/GuidType.php',
+        'Doctrine\\DBAL\\Types\\IntegerType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/IntegerType.php',
+        'Doctrine\\DBAL\\Types\\JsonType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/JsonType.php',
+        'Doctrine\\DBAL\\Types\\ObjectType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/ObjectType.php',
+        'Doctrine\\DBAL\\Types\\PhpDateTimeMappingType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/PhpDateTimeMappingType.php',
+        'Doctrine\\DBAL\\Types\\PhpIntegerMappingType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/PhpIntegerMappingType.php',
+        'Doctrine\\DBAL\\Types\\SimpleArrayType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/SimpleArrayType.php',
+        'Doctrine\\DBAL\\Types\\SmallIntType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/SmallIntType.php',
+        'Doctrine\\DBAL\\Types\\StringType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/StringType.php',
+        'Doctrine\\DBAL\\Types\\TextType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/TextType.php',
+        'Doctrine\\DBAL\\Types\\TimeImmutableType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/TimeImmutableType.php',
+        'Doctrine\\DBAL\\Types\\TimeType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/TimeType.php',
+        'Doctrine\\DBAL\\Types\\Type' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/Type.php',
+        'Doctrine\\DBAL\\Types\\TypeRegistry' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/TypeRegistry.php',
+        'Doctrine\\DBAL\\Types\\Types' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/Types.php',
+        'Doctrine\\DBAL\\Types\\VarDateTimeImmutableType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/VarDateTimeImmutableType.php',
+        'Doctrine\\DBAL\\Types\\VarDateTimeType' => __DIR__ . '/..' . '/doctrine/dbal/src/Types/VarDateTimeType.php',
+        'Doctrine\\DBAL\\VersionAwarePlatformDriver' => __DIR__ . '/..' . '/doctrine/dbal/src/VersionAwarePlatformDriver.php',
+        'Doctrine\\Deprecations\\Deprecation' => __DIR__ . '/..' . '/doctrine/deprecations/lib/Doctrine/Deprecations/Deprecation.php',
+        'Doctrine\\Deprecations\\PHPUnit\\VerifyDeprecations' => __DIR__ . '/..' . '/doctrine/deprecations/lib/Doctrine/Deprecations/PHPUnit/VerifyDeprecations.php',
         'Doctrine\\Inflector\\CachedWordInflector' => __DIR__ . '/..' . '/doctrine/inflector/lib/Doctrine/Inflector/CachedWordInflector.php',
         'Doctrine\\Inflector\\GenericLanguageInflectorFactory' => __DIR__ . '/..' . '/doctrine/inflector/lib/Doctrine/Inflector/GenericLanguageInflectorFactory.php',
         'Doctrine\\Inflector\\Inflector' => __DIR__ . '/..' . '/doctrine/inflector/lib/Doctrine/Inflector/Inflector.php',
@@ -5852,6 +6305,7 @@ class ComposerStaticInitb2555e5ff7197b9e020da74bbd3b7cfa
         'Symfony\\Thanks\\Thanks' => __DIR__ . '/..' . '/symfony/thanks/src/Thanks.php',
         'Tests\\CreatesApplication' => __DIR__ . '/../..' . '/tests/CreatesApplication.php',
         'Tests\\Feature\\ExampleTest' => __DIR__ . '/../..' . '/tests/Feature/ExampleTest.php',
+        'Tests\\Feature\\ItemExportTest' => __DIR__ . '/../..' . '/tests/Feature/ItemExportTest.php',
         'Tests\\TestCase' => __DIR__ . '/../..' . '/tests/TestCase.php',
         'Tests\\Unit\\database\\seeders\\SettingsSeederTest' => __DIR__ . '/../..' . '/tests/Unit/database/seeders/SettingsSeederTest.php',
         'Tests\\Unit\\lang\\LangTest' => __DIR__ . '/../..' . '/tests/Unit/lang/LangTest.php',
@@ -5892,6 +6346,61 @@ class ComposerStaticInitb2555e5ff7197b9e020da74bbd3b7cfa
         'Whoops\\Util\\Misc' => __DIR__ . '/..' . '/filp/whoops/src/Whoops/Util/Misc.php',
         'Whoops\\Util\\SystemFacade' => __DIR__ . '/..' . '/filp/whoops/src/Whoops/Util/SystemFacade.php',
         'Whoops\\Util\\TemplateHelper' => __DIR__ . '/..' . '/filp/whoops/src/Whoops/Util/TemplateHelper.php',
+        'phpDocumentor\\Reflection\\Element' => __DIR__ . '/..' . '/phpdocumentor/reflection-common/src/Element.php',
+        'phpDocumentor\\Reflection\\File' => __DIR__ . '/..' . '/phpdocumentor/reflection-common/src/File.php',
+        'phpDocumentor\\Reflection\\Fqsen' => __DIR__ . '/..' . '/phpdocumentor/reflection-common/src/Fqsen.php',
+        'phpDocumentor\\Reflection\\FqsenResolver' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/FqsenResolver.php',
+        'phpDocumentor\\Reflection\\Location' => __DIR__ . '/..' . '/phpdocumentor/reflection-common/src/Location.php',
+        'phpDocumentor\\Reflection\\Project' => __DIR__ . '/..' . '/phpdocumentor/reflection-common/src/Project.php',
+        'phpDocumentor\\Reflection\\ProjectFactory' => __DIR__ . '/..' . '/phpdocumentor/reflection-common/src/ProjectFactory.php',
+        'phpDocumentor\\Reflection\\PseudoType' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/PseudoType.php',
+        'phpDocumentor\\Reflection\\PseudoTypes\\CallableString' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/PseudoTypes/CallableString.php',
+        'phpDocumentor\\Reflection\\PseudoTypes\\False_' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/PseudoTypes/False_.php',
+        'phpDocumentor\\Reflection\\PseudoTypes\\HtmlEscapedString' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/PseudoTypes/HtmlEscapedString.php',
+        'phpDocumentor\\Reflection\\PseudoTypes\\IntegerRange' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/PseudoTypes/IntegerRange.php',
+        'phpDocumentor\\Reflection\\PseudoTypes\\List_' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/PseudoTypes/List_.php',
+        'phpDocumentor\\Reflection\\PseudoTypes\\LiteralString' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/PseudoTypes/LiteralString.php',
+        'phpDocumentor\\Reflection\\PseudoTypes\\LowercaseString' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/PseudoTypes/LowercaseString.php',
+        'phpDocumentor\\Reflection\\PseudoTypes\\NegativeInteger' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/PseudoTypes/NegativeInteger.php',
+        'phpDocumentor\\Reflection\\PseudoTypes\\NonEmptyLowercaseString' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/PseudoTypes/NonEmptyLowercaseString.php',
+        'phpDocumentor\\Reflection\\PseudoTypes\\NonEmptyString' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/PseudoTypes/NonEmptyString.php',
+        'phpDocumentor\\Reflection\\PseudoTypes\\NumericString' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/PseudoTypes/NumericString.php',
+        'phpDocumentor\\Reflection\\PseudoTypes\\Numeric_' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/PseudoTypes/Numeric_.php',
+        'phpDocumentor\\Reflection\\PseudoTypes\\PositiveInteger' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/PseudoTypes/PositiveInteger.php',
+        'phpDocumentor\\Reflection\\PseudoTypes\\TraitString' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/PseudoTypes/TraitString.php',
+        'phpDocumentor\\Reflection\\PseudoTypes\\True_' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/PseudoTypes/True_.php',
+        'phpDocumentor\\Reflection\\Type' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Type.php',
+        'phpDocumentor\\Reflection\\TypeResolver' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/TypeResolver.php',
+        'phpDocumentor\\Reflection\\Types\\AbstractList' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/AbstractList.php',
+        'phpDocumentor\\Reflection\\Types\\AggregatedType' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/AggregatedType.php',
+        'phpDocumentor\\Reflection\\Types\\ArrayKey' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/ArrayKey.php',
+        'phpDocumentor\\Reflection\\Types\\Array_' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Array_.php',
+        'phpDocumentor\\Reflection\\Types\\Boolean' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Boolean.php',
+        'phpDocumentor\\Reflection\\Types\\Callable_' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Callable_.php',
+        'phpDocumentor\\Reflection\\Types\\ClassString' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/ClassString.php',
+        'phpDocumentor\\Reflection\\Types\\Collection' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Collection.php',
+        'phpDocumentor\\Reflection\\Types\\Compound' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Compound.php',
+        'phpDocumentor\\Reflection\\Types\\Context' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Context.php',
+        'phpDocumentor\\Reflection\\Types\\ContextFactory' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/ContextFactory.php',
+        'phpDocumentor\\Reflection\\Types\\Expression' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Expression.php',
+        'phpDocumentor\\Reflection\\Types\\Float_' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Float_.php',
+        'phpDocumentor\\Reflection\\Types\\Integer' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Integer.php',
+        'phpDocumentor\\Reflection\\Types\\InterfaceString' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/InterfaceString.php',
+        'phpDocumentor\\Reflection\\Types\\Intersection' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Intersection.php',
+        'phpDocumentor\\Reflection\\Types\\Iterable_' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Iterable_.php',
+        'phpDocumentor\\Reflection\\Types\\Mixed_' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Mixed_.php',
+        'phpDocumentor\\Reflection\\Types\\Never_' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Never_.php',
+        'phpDocumentor\\Reflection\\Types\\Null_' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Null_.php',
+        'phpDocumentor\\Reflection\\Types\\Nullable' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Nullable.php',
+        'phpDocumentor\\Reflection\\Types\\Object_' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Object_.php',
+        'phpDocumentor\\Reflection\\Types\\Parent_' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Parent_.php',
+        'phpDocumentor\\Reflection\\Types\\Resource_' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Resource_.php',
+        'phpDocumentor\\Reflection\\Types\\Scalar' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Scalar.php',
+        'phpDocumentor\\Reflection\\Types\\Self_' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Self_.php',
+        'phpDocumentor\\Reflection\\Types\\Static_' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Static_.php',
+        'phpDocumentor\\Reflection\\Types\\String_' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/String_.php',
+        'phpDocumentor\\Reflection\\Types\\This' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/This.php',
+        'phpDocumentor\\Reflection\\Types\\Void_' => __DIR__ . '/..' . '/phpdocumentor/type-resolver/src/Types/Void_.php',
         'voku\\helper\\ASCII' => __DIR__ . '/..' . '/voku/portable-ascii/src/voku/helper/ASCII.php',
     );
 

vendor/composer/installed.json

@@ -1,5 +1,157 @@
 {
     "packages": [
+        {
+            "name": "barryvdh/laravel-ide-helper",
+            "version": "v2.12.3",
+            "version_normalized": "2.12.3.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/barryvdh/laravel-ide-helper.git",
+                "reference": "3ba1e2573b38f72107b8aacc4ee177fcab30a550"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/barryvdh/laravel-ide-helper/zipball/3ba1e2573b38f72107b8aacc4ee177fcab30a550",
+                "reference": "3ba1e2573b38f72107b8aacc4ee177fcab30a550",
+                "shasum": ""
+            },
+            "require": {
+                "barryvdh/reflection-docblock": "^2.0.6",
+                "composer/pcre": "^1 || ^2 || ^3",
+                "doctrine/dbal": "^2.6 || ^3",
+                "ext-json": "*",
+                "illuminate/console": "^8 || ^9",
+                "illuminate/filesystem": "^8 || ^9",
+                "illuminate/support": "^8 || ^9",
+                "nikic/php-parser": "^4.7",
+                "php": "^7.3 || ^8.0",
+                "phpdocumentor/type-resolver": "^1.1.0"
+            },
+            "require-dev": {
+                "ext-pdo_sqlite": "*",
+                "friendsofphp/php-cs-fixer": "^2",
+                "illuminate/config": "^8 || ^9",
+                "illuminate/view": "^8 || ^9",
+                "mockery/mockery": "^1.4",
+                "orchestra/testbench": "^6 || ^7",
+                "phpunit/phpunit": "^8.5 || ^9",
+                "spatie/phpunit-snapshot-assertions": "^3 || ^4",
+                "vimeo/psalm": "^3.12"
+            },
+            "suggest": {
+                "illuminate/events": "Required for automatic helper generation (^6|^7|^8|^9)."
+            },
+            "time": "2022-03-06T14:33:42+00:00",
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.12-dev"
+                },
+                "laravel": {
+                    "providers": [
+                        "Barryvdh\\LaravelIdeHelper\\IdeHelperServiceProvider"
+                    ]
+                }
+            },
+            "installation-source": "dist",
+            "autoload": {
+                "psr-4": {
+                    "Barryvdh\\LaravelIdeHelper\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Barry vd. Heuvel",
+                    "email": "barryvdh@gmail.com"
+                }
+            ],
+            "description": "Laravel IDE Helper, generates correct PHPDocs for all Facade classes, to improve auto-completion.",
+            "keywords": [
+                "autocomplete",
+                "codeintel",
+                "helper",
+                "ide",
+                "laravel",
+                "netbeans",
+                "phpdoc",
+                "phpstorm",
+                "sublime"
+            ],
+            "support": {
+                "issues": "https://github.com/barryvdh/laravel-ide-helper/issues",
+                "source": "https://github.com/barryvdh/laravel-ide-helper/tree/v2.12.3"
+            },
+            "funding": [
+                {
+                    "url": "https://fruitcake.nl",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/barryvdh",
+                    "type": "github"
+                }
+            ],
+            "install-path": "../barryvdh/laravel-ide-helper"
+        },
+        {
+            "name": "barryvdh/reflection-docblock",
+            "version": "v2.1.0",
+            "version_normalized": "2.1.0.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/barryvdh/ReflectionDocBlock.git",
+                "reference": "bf44b757feb8ba1734659029357646466ded673e"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/barryvdh/ReflectionDocBlock/zipball/bf44b757feb8ba1734659029357646466ded673e",
+                "reference": "bf44b757feb8ba1734659029357646466ded673e",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^8.5.14|^9"
+            },
+            "suggest": {
+                "dflydev/markdown": "~1.0",
+                "erusev/parsedown": "~1.0"
+            },
+            "time": "2022-10-31T15:35:43+00:00",
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.0.x-dev"
+                }
+            },
+            "installation-source": "dist",
+            "autoload": {
+                "psr-0": {
+                    "Barryvdh": [
+                        "src/"
+                    ]
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Mike van Riel",
+                    "email": "mike.vanriel@naenius.com"
+                }
+            ],
+            "support": {
+                "source": "https://github.com/barryvdh/ReflectionDocBlock/tree/v2.1.0"
+            },
+            "install-path": "../barryvdh/reflection-docblock"
+        },
         {
             "name": "brick/math",
             "version": "0.9.3",
@@ -132,6 +284,80 @@
             ],
             "install-path": "../clue/stream-filter"
         },
+        {
+            "name": "composer/pcre",
+            "version": "3.1.0",
+            "version_normalized": "3.1.0.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/composer/pcre.git",
+                "reference": "4bff79ddd77851fe3cdd11616ed3f92841ba5bd2"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/composer/pcre/zipball/4bff79ddd77851fe3cdd11616ed3f92841ba5bd2",
+                "reference": "4bff79ddd77851fe3cdd11616ed3f92841ba5bd2",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.4 || ^8.0"
+            },
+            "require-dev": {
+                "phpstan/phpstan": "^1.3",
+                "phpstan/phpstan-strict-rules": "^1.1",
+                "symfony/phpunit-bridge": "^5"
+            },
+            "time": "2022-11-17T09:50:14+00:00",
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "3.x-dev"
+                }
+            },
+            "installation-source": "dist",
+            "autoload": {
+                "psr-4": {
+                    "Composer\\Pcre\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Jordi Boggiano",
+                    "email": "j.boggiano@seld.be",
+                    "homepage": "http://seld.be"
+                }
+            ],
+            "description": "PCRE wrapping library that offers type-safe preg_* replacements.",
+            "keywords": [
+                "PCRE",
+                "preg",
+                "regex",
+                "regular expression"
+            ],
+            "support": {
+                "issues": "https://github.com/composer/pcre/issues",
+                "source": "https://github.com/composer/pcre/tree/3.1.0"
+            },
+            "funding": [
+                {
+                    "url": "https://packagist.com",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/composer",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/composer/composer",
+                    "type": "tidelift"
+                }
+            ],
+            "install-path": "./pcre"
+        },
         {
             "name": "dflydev/dot-access-data",
             "version": "v3.0.2",
@@ -210,6 +436,357 @@
             },
             "install-path": "../dflydev/dot-access-data"
         },
+        {
+            "name": "doctrine/cache",
+            "version": "2.2.0",
+            "version_normalized": "2.2.0.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/doctrine/cache.git",
+                "reference": "1ca8f21980e770095a31456042471a57bc4c68fb"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/doctrine/cache/zipball/1ca8f21980e770095a31456042471a57bc4c68fb",
+                "reference": "1ca8f21980e770095a31456042471a57bc4c68fb",
+                "shasum": ""
+            },
+            "require": {
+                "php": "~7.1 || ^8.0"
+            },
+            "conflict": {
+                "doctrine/common": ">2.2,<2.4"
+            },
+            "require-dev": {
+                "cache/integration-tests": "dev-master",
+                "doctrine/coding-standard": "^9",
+                "phpunit/phpunit": "^7.5 || ^8.5 || ^9.5",
+                "psr/cache": "^1.0 || ^2.0 || ^3.0",
+                "symfony/cache": "^4.4 || ^5.4 || ^6",
+                "symfony/var-exporter": "^4.4 || ^5.4 || ^6"
+            },
+            "time": "2022-05-20T20:07:39+00:00",
+            "type": "library",
+            "installation-source": "dist",
+            "autoload": {
+                "psr-4": {
+                    "Doctrine\\Common\\Cache\\": "lib/Doctrine/Common/Cache"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Guilherme Blanco",
+                    "email": "guilhermeblanco@gmail.com"
+                },
+                {
+                    "name": "Roman Borschel",
+                    "email": "roman@code-factory.org"
+                },
+                {
+                    "name": "Benjamin Eberlei",
+                    "email": "kontakt@beberlei.de"
+                },
+                {
+                    "name": "Jonathan Wage",
+                    "email": "jonwage@gmail.com"
+                },
+                {
+                    "name": "Johannes Schmitt",
+                    "email": "schmittjoh@gmail.com"
+                }
+            ],
+            "description": "PHP Doctrine Cache library is a popular cache implementation that supports many different drivers such as redis, memcache, apc, mongodb and others.",
+            "homepage": "https://www.doctrine-project.org/projects/cache.html",
+            "keywords": [
+                "abstraction",
+                "apcu",
+                "cache",
+                "caching",
+                "couchdb",
+                "memcached",
+                "php",
+                "redis",
+                "xcache"
+            ],
+            "support": {
+                "issues": "https://github.com/doctrine/cache/issues",
+                "source": "https://github.com/doctrine/cache/tree/2.2.0"
+            },
+            "funding": [
+                {
+                    "url": "https://www.doctrine-project.org/sponsorship.html",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://www.patreon.com/phpdoctrine",
+                    "type": "patreon"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/doctrine%2Fcache",
+                    "type": "tidelift"
+                }
+            ],
+            "install-path": "../doctrine/cache"
+        },
+        {
+            "name": "doctrine/dbal",
+            "version": "3.5.1",
+            "version_normalized": "3.5.1.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/doctrine/dbal.git",
+                "reference": "f38ee8aaca2d58ee88653cb34a6a3880c23f38a5"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/doctrine/dbal/zipball/f38ee8aaca2d58ee88653cb34a6a3880c23f38a5",
+                "reference": "f38ee8aaca2d58ee88653cb34a6a3880c23f38a5",
+                "shasum": ""
+            },
+            "require": {
+                "composer-runtime-api": "^2",
+                "doctrine/cache": "^1.11|^2.0",
+                "doctrine/deprecations": "^0.5.3|^1",
+                "doctrine/event-manager": "^1|^2",
+                "php": "^7.4 || ^8.0",
+                "psr/cache": "^1|^2|^3",
+                "psr/log": "^1|^2|^3"
+            },
+            "require-dev": {
+                "doctrine/coding-standard": "10.0.0",
+                "jetbrains/phpstorm-stubs": "2022.2",
+                "phpstan/phpstan": "1.8.10",
+                "phpstan/phpstan-strict-rules": "^1.4",
+                "phpunit/phpunit": "9.5.25",
+                "psalm/plugin-phpunit": "0.17.0",
+                "squizlabs/php_codesniffer": "3.7.1",
+                "symfony/cache": "^5.4|^6.0",
+                "symfony/console": "^4.4|^5.4|^6.0",
+                "vimeo/psalm": "4.29.0"
+            },
+            "suggest": {
+                "symfony/console": "For helpful console commands such as SQL execution and import of files."
+            },
+            "time": "2022-10-24T07:26:18+00:00",
+            "bin": [
+                "bin/doctrine-dbal"
+            ],
+            "type": "library",
+            "installation-source": "dist",
+            "autoload": {
+                "psr-4": {
+                    "Doctrine\\DBAL\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Guilherme Blanco",
+                    "email": "guilhermeblanco@gmail.com"
+                },
+                {
+                    "name": "Roman Borschel",
+                    "email": "roman@code-factory.org"
+                },
+                {
+                    "name": "Benjamin Eberlei",
+                    "email": "kontakt@beberlei.de"
+                },
+                {
+                    "name": "Jonathan Wage",
+                    "email": "jonwage@gmail.com"
+                }
+            ],
+            "description": "Powerful PHP database abstraction layer (DBAL) with many features for database schema introspection and management.",
+            "homepage": "https://www.doctrine-project.org/projects/dbal.html",
+            "keywords": [
+                "abstraction",
+                "database",
+                "db2",
+                "dbal",
+                "mariadb",
+                "mssql",
+                "mysql",
+                "oci8",
+                "oracle",
+                "pdo",
+                "pgsql",
+                "postgresql",
+                "queryobject",
+                "sasql",
+                "sql",
+                "sqlite",
+                "sqlserver",
+                "sqlsrv"
+            ],
+            "support": {
+                "issues": "https://github.com/doctrine/dbal/issues",
+                "source": "https://github.com/doctrine/dbal/tree/3.5.1"
+            },
+            "funding": [
+                {
+                    "url": "https://www.doctrine-project.org/sponsorship.html",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://www.patreon.com/phpdoctrine",
+                    "type": "patreon"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/doctrine%2Fdbal",
+                    "type": "tidelift"
+                }
+            ],
+            "install-path": "../doctrine/dbal"
+        },
+        {
+            "name": "doctrine/deprecations",
+            "version": "v1.0.0",
+            "version_normalized": "1.0.0.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/doctrine/deprecations.git",
+                "reference": "0e2a4f1f8cdfc7a92ec3b01c9334898c806b30de"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/doctrine/deprecations/zipball/0e2a4f1f8cdfc7a92ec3b01c9334898c806b30de",
+                "reference": "0e2a4f1f8cdfc7a92ec3b01c9334898c806b30de",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.1|^8.0"
+            },
+            "require-dev": {
+                "doctrine/coding-standard": "^9",
+                "phpunit/phpunit": "^7.5|^8.5|^9.5",
+                "psr/log": "^1|^2|^3"
+            },
+            "suggest": {
+                "psr/log": "Allows logging deprecations via PSR-3 logger implementation"
+            },
+            "time": "2022-05-02T15:47:09+00:00",
+            "type": "library",
+            "installation-source": "dist",
+            "autoload": {
+                "psr-4": {
+                    "Doctrine\\Deprecations\\": "lib/Doctrine/Deprecations"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "description": "A small layer on top of trigger_error(E_USER_DEPRECATED) or PSR-3 logging with options to disable all deprecations or selectively for packages.",
+            "homepage": "https://www.doctrine-project.org/",
+            "support": {
+                "issues": "https://github.com/doctrine/deprecations/issues",
+                "source": "https://github.com/doctrine/deprecations/tree/v1.0.0"
+            },
+            "install-path": "../doctrine/deprecations"
+        },
+        {
+            "name": "doctrine/event-manager",
+            "version": "1.2.0",
+            "version_normalized": "1.2.0.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/doctrine/event-manager.git",
+                "reference": "95aa4cb529f1e96576f3fda9f5705ada4056a520"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/doctrine/event-manager/zipball/95aa4cb529f1e96576f3fda9f5705ada4056a520",
+                "reference": "95aa4cb529f1e96576f3fda9f5705ada4056a520",
+                "shasum": ""
+            },
+            "require": {
+                "doctrine/deprecations": "^0.5.3 || ^1",
+                "php": "^7.1 || ^8.0"
+            },
+            "conflict": {
+                "doctrine/common": "<2.9"
+            },
+            "require-dev": {
+                "doctrine/coding-standard": "^9 || ^10",
+                "phpstan/phpstan": "~1.4.10 || ^1.8.8",
+                "phpunit/phpunit": "^7.5 || ^8.5 || ^9.5",
+                "vimeo/psalm": "^4.24"
+            },
+            "time": "2022-10-12T20:51:15+00:00",
+            "type": "library",
+            "installation-source": "dist",
+            "autoload": {
+                "psr-4": {
+                    "Doctrine\\Common\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Guilherme Blanco",
+                    "email": "guilhermeblanco@gmail.com"
+                },
+                {
+                    "name": "Roman Borschel",
+                    "email": "roman@code-factory.org"
+                },
+                {
+                    "name": "Benjamin Eberlei",
+                    "email": "kontakt@beberlei.de"
+                },
+                {
+                    "name": "Jonathan Wage",
+                    "email": "jonwage@gmail.com"
+                },
+                {
+                    "name": "Johannes Schmitt",
+                    "email": "schmittjoh@gmail.com"
+                },
+                {
+                    "name": "Marco Pivetta",
+                    "email": "ocramius@gmail.com"
+                }
+            ],
+            "description": "The Doctrine Event Manager is a simple PHP event system that was built to be used with the various Doctrine projects.",
+            "homepage": "https://www.doctrine-project.org/projects/event-manager.html",
+            "keywords": [
+                "event",
+                "event dispatcher",
+                "event manager",
+                "event system",
+                "events"
+            ],
+            "support": {
+                "issues": "https://github.com/doctrine/event-manager/issues",
+                "source": "https://github.com/doctrine/event-manager/tree/1.2.0"
+            },
+            "funding": [
+                {
+                    "url": "https://www.doctrine-project.org/sponsorship.html",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://www.patreon.com/phpdoctrine",
+                    "type": "patreon"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/doctrine%2Fevent-manager",
+                    "type": "tidelift"
+                }
+            ],
+            "install-path": "../doctrine/event-manager"
+        },
         {
             "name": "doctrine/inflector",
             "version": "2.0.6",
@@ -3941,6 +4518,120 @@
             },
             "install-path": "../php-http/promise"
         },
+        {
+            "name": "phpdocumentor/reflection-common",
+            "version": "2.2.0",
+            "version_normalized": "2.2.0.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phpDocumentor/ReflectionCommon.git",
+                "reference": "1d01c49d4ed62f25aa84a747ad35d5a16924662b"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phpDocumentor/ReflectionCommon/zipball/1d01c49d4ed62f25aa84a747ad35d5a16924662b",
+                "reference": "1d01c49d4ed62f25aa84a747ad35d5a16924662b",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.2 || ^8.0"
+            },
+            "time": "2020-06-27T09:03:43+00:00",
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-2.x": "2.x-dev"
+                }
+            },
+            "installation-source": "dist",
+            "autoload": {
+                "psr-4": {
+                    "phpDocumentor\\Reflection\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Jaap van Otterdijk",
+                    "email": "opensource@ijaap.nl"
+                }
+            ],
+            "description": "Common reflection classes used by phpdocumentor to reflect the code structure",
+            "homepage": "http://www.phpdoc.org",
+            "keywords": [
+                "FQSEN",
+                "phpDocumentor",
+                "phpdoc",
+                "reflection",
+                "static analysis"
+            ],
+            "support": {
+                "issues": "https://github.com/phpDocumentor/ReflectionCommon/issues",
+                "source": "https://github.com/phpDocumentor/ReflectionCommon/tree/2.x"
+            },
+            "install-path": "../phpdocumentor/reflection-common"
+        },
+        {
+            "name": "phpdocumentor/type-resolver",
+            "version": "1.6.2",
+            "version_normalized": "1.6.2.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phpDocumentor/TypeResolver.git",
+                "reference": "48f445a408c131e38cab1c235aa6d2bb7a0bb20d"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phpDocumentor/TypeResolver/zipball/48f445a408c131e38cab1c235aa6d2bb7a0bb20d",
+                "reference": "48f445a408c131e38cab1c235aa6d2bb7a0bb20d",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.4 || ^8.0",
+                "phpdocumentor/reflection-common": "^2.0"
+            },
+            "require-dev": {
+                "ext-tokenizer": "*",
+                "phpstan/extension-installer": "^1.1",
+                "phpstan/phpstan": "^1.8",
+                "phpstan/phpstan-phpunit": "^1.1",
+                "phpunit/phpunit": "^9.5",
+                "rector/rector": "^0.13.9",
+                "vimeo/psalm": "^4.25"
+            },
+            "time": "2022-10-14T12:47:21+00:00",
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-1.x": "1.x-dev"
+                }
+            },
+            "installation-source": "dist",
+            "autoload": {
+                "psr-4": {
+                    "phpDocumentor\\Reflection\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Mike van Riel",
+                    "email": "me@mikevanriel.com"
+                }
+            ],
+            "description": "A PSR-5 based resolver of Class names, Types and Structural Element Names",
+            "support": {
+                "issues": "https://github.com/phpDocumentor/TypeResolver/issues",
+                "source": "https://github.com/phpDocumentor/TypeResolver/tree/1.6.2"
+            },
+            "install-path": "../phpdocumentor/type-resolver"
+        },
         {
             "name": "phpoption/phpoption",
             "version": "1.9.0",
@@ -9442,6 +10133,13 @@
     ],
     "dev": true,
     "dev-package-names": [
+        "barryvdh/laravel-ide-helper",
+        "barryvdh/reflection-docblock",
+        "composer/pcre",
+        "doctrine/cache",
+        "doctrine/dbal",
+        "doctrine/deprecations",
+        "doctrine/event-manager",
         "doctrine/instantiator",
         "fzaninotto/faker",
         "hamcrest/hamcrest-php",
@@ -9449,6 +10147,8 @@
         "myclabs/deep-copy",
         "phar-io/manifest",
         "phar-io/version",
+        "phpdocumentor/reflection-common",
+        "phpdocumentor/type-resolver",
         "phpunit/php-code-coverage",
         "phpunit/php-file-iterator",
         "phpunit/php-invoker",

vendor/composer/installed.php

@@ -3,13 +3,31 @@
         'name' => 'laravel/laravel',
         'pretty_version' => '2.x-dev',
         'version' => '2.9999999.9999999.9999999-dev',
-        'reference' => 'bb07ba5964270b9b986bcd4508fd4a4f5a6c2323',
+        'reference' => 'bd76efc613870dd5d72f3b339550889d09aad8d7',
         'type' => 'project',
         'install_path' => __DIR__ . '/../../',
         'aliases' => array(),
         'dev' => true,
     ),
     'versions' => array(
+        'barryvdh/laravel-ide-helper' => array(
+            'pretty_version' => 'v2.12.3',
+            'version' => '2.12.3.0',
+            'reference' => '3ba1e2573b38f72107b8aacc4ee177fcab30a550',
+            'type' => 'library',
+            'install_path' => __DIR__ . '/../barryvdh/laravel-ide-helper',
+            'aliases' => array(),
+            'dev_requirement' => true,
+        ),
+        'barryvdh/reflection-docblock' => array(
+            'pretty_version' => 'v2.1.0',
+            'version' => '2.1.0.0',
+            'reference' => 'bf44b757feb8ba1734659029357646466ded673e',
+            'type' => 'library',
+            'install_path' => __DIR__ . '/../barryvdh/reflection-docblock',
+            'aliases' => array(),
+            'dev_requirement' => true,
+        ),
         'brick/math' => array(
             'pretty_version' => '0.9.3',
             'version' => '0.9.3.0',
@@ -28,6 +46,15 @@
             'aliases' => array(),
             'dev_requirement' => false,
         ),
+        'composer/pcre' => array(
+            'pretty_version' => '3.1.0',
+            'version' => '3.1.0.0',
+            'reference' => '4bff79ddd77851fe3cdd11616ed3f92841ba5bd2',
+            'type' => 'library',
+            'install_path' => __DIR__ . '/./pcre',
+            'aliases' => array(),
+            'dev_requirement' => true,
+        ),
         'cordoval/hamcrest-php' => array(
             'dev_requirement' => true,
             'replaced' => array(
@@ -49,6 +76,42 @@
             'aliases' => array(),
             'dev_requirement' => false,
         ),
+        'doctrine/cache' => array(
+            'pretty_version' => '2.2.0',
+            'version' => '2.2.0.0',
+            'reference' => '1ca8f21980e770095a31456042471a57bc4c68fb',
+            'type' => 'library',
+            'install_path' => __DIR__ . '/../doctrine/cache',
+            'aliases' => array(),
+            'dev_requirement' => true,
+        ),
+        'doctrine/dbal' => array(
+            'pretty_version' => '3.5.1',
+            'version' => '3.5.1.0',
+            'reference' => 'f38ee8aaca2d58ee88653cb34a6a3880c23f38a5',
+            'type' => 'library',
+            'install_path' => __DIR__ . '/../doctrine/dbal',
+            'aliases' => array(),
+            'dev_requirement' => true,
+        ),
+        'doctrine/deprecations' => array(
+            'pretty_version' => 'v1.0.0',
+            'version' => '1.0.0.0',
+            'reference' => '0e2a4f1f8cdfc7a92ec3b01c9334898c806b30de',
+            'type' => 'library',
+            'install_path' => __DIR__ . '/../doctrine/deprecations',
+            'aliases' => array(),
+            'dev_requirement' => true,
+        ),
+        'doctrine/event-manager' => array(
+            'pretty_version' => '1.2.0',
+            'version' => '1.2.0.0',
+            'reference' => '95aa4cb529f1e96576f3fda9f5705ada4056a520',
+            'type' => 'library',
+            'install_path' => __DIR__ . '/../doctrine/event-manager',
+            'aliases' => array(),
+            'dev_requirement' => true,
+        ),
         'doctrine/inflector' => array(
             'pretty_version' => '2.0.6',
             'version' => '2.0.6.0',
@@ -433,7 +496,7 @@
         'laravel/laravel' => array(
             'pretty_version' => '2.x-dev',
             'version' => '2.9999999.9999999.9999999-dev',
-            'reference' => 'bb07ba5964270b9b986bcd4508fd4a4f5a6c2323',
+            'reference' => 'bd76efc613870dd5d72f3b339550889d09aad8d7',
             'type' => 'project',
             'install_path' => __DIR__ . '/../../',
             'aliases' => array(),
@@ -694,6 +757,24 @@
             'aliases' => array(),
             'dev_requirement' => false,
         ),
+        'phpdocumentor/reflection-common' => array(
+            'pretty_version' => '2.2.0',
+            'version' => '2.2.0.0',
+            'reference' => '1d01c49d4ed62f25aa84a747ad35d5a16924662b',
+            'type' => 'library',
+            'install_path' => __DIR__ . '/../phpdocumentor/reflection-common',
+            'aliases' => array(),
+            'dev_requirement' => true,
+        ),
+        'phpdocumentor/type-resolver' => array(
+            'pretty_version' => '1.6.2',
+            'version' => '1.6.2.0',
+            'reference' => '48f445a408c131e38cab1c235aa6d2bb7a0bb20d',
+            'type' => 'library',
+            'install_path' => __DIR__ . '/../phpdocumentor/type-resolver',
+            'aliases' => array(),
+            'dev_requirement' => true,
+        ),
         'phpoption/phpoption' => array(
             'pretty_version' => '1.9.0',
             'version' => '1.9.0.0',

vendor/composer/pcre/LICENSE

@@ -0,0 +1,19 @@
+Copyright (C) 2021 Composer
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.

vendor/composer/pcre/README.md

@@ -0,0 +1,181 @@
+composer/pcre
+=============
+
+PCRE wrapping library that offers type-safe `preg_*` replacements.
+
+This library gives you a way to ensure `preg_*` functions do not fail silently, returning
+unexpected `null`s that may not be handled.
+
+As of 3.0 this library enforces [`PREG_UNMATCHED_AS_NULL`](#preg_unmatched_as_null) usage
+for all matching and replaceCallback functions, [read more below](#preg_unmatched_as_null)
+to understand the implications.
+
+It thus makes it easier to work with static analysis tools like PHPStan or Psalm as it
+simplifies and reduces the possible return values from all the `preg_*` functions which
+are quite packed with edge cases.
+
+This library is a thin wrapper around `preg_*` functions with [some limitations](#restrictions--limitations).
+If you are looking for a richer API to handle regular expressions have a look at
+[rawr/t-regx](https://packagist.org/packages/rawr/t-regx) instead.
+
+[![Continuous Integration](https://github.com/composer/pcre/workflows/Continuous%20Integration/badge.svg?branch=main)](https://github.com/composer/pcre/actions)
+
+
+Installation
+------------
+
+Install the latest version with:
+
+```bash
+$ composer require composer/pcre
+```
+
+
+Requirements
+------------
+
+* PHP 7.4.0 is required for 3.x versions
+* PHP 7.2.0 is required for 2.x versions
+* PHP 5.3.2 is required for 1.x versions
+
+
+Basic usage
+-----------
+
+Instead of:
+
+```php
+if (preg_match('{fo+}', $string, $matches)) { ... }
+if (preg_match('{fo+}', $string, $matches, PREG_OFFSET_CAPTURE)) { ... }
+if (preg_match_all('{fo+}', $string, $matches)) { ... }
+$newString = preg_replace('{fo+}', 'bar', $string);
+$newString = preg_replace_callback('{fo+}', function ($match) { return strtoupper($match[0]); }, $string);
+$newString = preg_replace_callback_array(['{fo+}' => fn ($match) => strtoupper($match[0])], $string);
+$filtered = preg_grep('{[a-z]}', $elements);
+$array = preg_split('{[a-z]+}', $string);
+```
+
+You can now call these on the `Preg` class:
+
+```php
+use Composer\Pcre\Preg;
+
+if (Preg::match('{fo+}', $string, $matches)) { ... }
+if (Preg::matchWithOffsets('{fo+}', $string, $matches)) { ... }
+if (Preg::matchAll('{fo+}', $string, $matches)) { ... }
+$newString = Preg::replace('{fo+}', 'bar', $string);
+$newString = Preg::replaceCallback('{fo+}', function ($match) { return strtoupper($match[0]); }, $string);
+$newString = Preg::replaceCallbackArray(['{fo+}' => fn ($match) => strtoupper($match[0])], $string);
+$filtered = Preg::grep('{[a-z]}', $elements);
+$array = Preg::split('{[a-z]+}', $string);
+```
+
+The main difference is if anything fails to match/replace/.., it will throw a `Composer\Pcre\PcreException`
+instead of returning `null` (or false in some cases), so you can now use the return values safely relying on
+the fact that they can only be strings (for replace), ints (for match) or arrays (for grep/split).
+
+Additionally the `Preg` class provides match methods that return `bool` rather than `int`, for stricter type safety
+when the number of pattern matches is not useful:
+
+```php
+use Composer\Pcre\Preg;
+
+if (Preg::isMatch('{fo+}', $string, $matches)) // bool
+if (Preg::isMatchAll('{fo+}', $string, $matches)) // bool
+```
+
+Finally the `Preg` class provides a few `*StrictGroups` method variants that ensure match groups
+are always present and thus non-nullable, making it easier to write type-safe code:
+
+```php
+use Composer\Pcre\Preg;
+
+// $matches is guaranteed to be an array of strings, if a subpattern does not match and produces a null it will throw
+if (Preg::matchStrictGroups('{fo+}', $string, $matches))
+if (Preg::matchAllStrictGroups('{fo+}', $string, $matches))
+```
+
+**Note:** This is generally safe to use as long as you do not have optional subpatterns (i.e. `(something)?`
+or `(something)*` or branches with a `|` that result in some groups not being matched at all).
+A subpattern that can match an empty string like `(.*)` is **not** optional, it will be present as an
+empty string in the matches. A non-matching subpattern, even if optional like `(?:foo)?` will anyway not be present in
+matches so it is also not a problem to use these with `*StrictGroups` methods.
+
+If you would prefer a slightly more verbose usage, replacing by-ref arguments by result objects, you can use the `Regex` class:
+
+```php
+use Composer\Pcre\Regex;
+
+// this is useful when you are just interested in knowing if something matched
+// as it returns a bool instead of int(1/0) for match
+$bool = Regex::isMatch('{fo+}', $string);
+
+$result = Regex::match('{fo+}', $string);
+if ($result->matched) { something($result->matches); }
+
+$result = Regex::matchWithOffsets('{fo+}', $string);
+if ($result->matched) { something($result->matches); }
+
+$result = Regex::matchAll('{fo+}', $string);
+if ($result->matched && $result->count > 3) { something($result->matches); }
+
+$newString = Regex::replace('{fo+}', 'bar', $string)->result;
+$newString = Regex::replaceCallback('{fo+}', function ($match) { return strtoupper($match[0]); }, $string)->result;
+$newString = Regex::replaceCallbackArray(['{fo+}' => fn ($match) => strtoupper($match[0])], $string)->result;
+```
+
+Note that `preg_grep` and `preg_split` are only callable via the `Preg` class as they do not have
+complex return types warranting a specific result object.
+
+See the [MatchResult](src/MatchResult.php), [MatchWithOffsetsResult](src/MatchWithOffsetsResult.php), [MatchAllResult](src/MatchAllResult.php),
+[MatchAllWithOffsetsResult](src/MatchAllWithOffsetsResult.php), and [ReplaceResult](src/ReplaceResult.php) class sources for more details.
+
+Restrictions / Limitations
+--------------------------
+
+Due to type safety requirements a few restrictions are in place.
+
+- matching using `PREG_OFFSET_CAPTURE` is made available via `matchWithOffsets` and `matchAllWithOffsets`.
+  You cannot pass the flag to `match`/`matchAll`.
+- `Preg::split` will also reject `PREG_SPLIT_OFFSET_CAPTURE` and you should use `splitWithOffsets`
+  instead.
+- `matchAll` rejects `PREG_SET_ORDER` as it also changes the shape of the returned matches. There
+  is no alternative provided as you can fairly easily code around it.
+- `preg_filter` is not supported as it has a rather crazy API, most likely you should rather
+  use `Preg::grep` in combination with some loop and `Preg::replace`.
+- `replace`, `replaceCallback` and `replaceCallbackArray` do not support an array `$subject`,
+  only simple strings.
+- As of 2.0, the library always uses `PREG_UNMATCHED_AS_NULL` for matching, which offers [much
+  saner/more predictable results](#preg_unmatched_as_null). As of 3.0 the flag is also set for
+  `replaceCallback` and `replaceCallbackArray`.
+
+#### PREG_UNMATCHED_AS_NULL
+
+As of 2.0, this library always uses PREG_UNMATCHED_AS_NULL for all `match*` and `isMatch*`
+functions. As of 3.0 it is also done for `replaceCallback` and `replaceCallbackArray`.
+
+This means your matches will always contain all matching groups, either as null if unmatched
+or as string if it matched.
+
+The advantages in clarity and predictability are clearer if you compare the two outputs of
+running this with and without PREG_UNMATCHED_AS_NULL in $flags:
+
+```php
+preg_match('/(a)(b)*(c)(d)*/', 'ac', $matches, $flags);
+```
+
+| no flag | PREG_UNMATCHED_AS_NULL |
+| --- | --- |
+| array (size=4)              | array (size=5) |
+| 0 => string 'ac' (length=2) |   0 => string 'ac' (length=2) |
+| 1 => string 'a' (length=1)  |   1 => string 'a' (length=1) |
+| 2 => string '' (length=0)   |   2 => null |
+| 3 => string 'c' (length=1)  |   3 => string 'c' (length=1) |
+|                             |   4 => null |
+| group 2 (any unmatched group preceding one that matched) is set to `''`. You cannot tell if it matched an empty string or did not match at all | group 2 is `null` when unmatched and a string if it matched, easy to check for |
+| group 4 (any optional group without a matching one following) is missing altogether. So you have to check with `isset()`, but really you want `isset($m[4]) && $m[4] !== ''` for safety unless you are very careful to check that a non-optional group follows it | group 4 is always set, and null in this case as there was no match, easy to check for with `$m[4] !== null` |
+
+License
+-------
+
+composer/pcre is licensed under the MIT License, see the LICENSE file for details.

vendor/composer/pcre/composer.json

@@ -0,0 +1,46 @@
+{
+    "name": "composer/pcre",
+    "description": "PCRE wrapping library that offers type-safe preg_* replacements.",
+    "type": "library",
+    "license": "MIT",
+    "keywords": [
+        "pcre",
+        "regex",
+        "preg",
+        "regular expression"
+    ],
+    "authors": [
+        {
+            "name": "Jordi Boggiano",
+            "email": "j.boggiano@seld.be",
+            "homepage": "http://seld.be"
+        }
+    ],
+    "require": {
+        "php": "^7.4 || ^8.0"
+    },
+    "require-dev": {
+        "symfony/phpunit-bridge": "^5",
+        "phpstan/phpstan": "^1.3",
+        "phpstan/phpstan-strict-rules": "^1.1"
+    },
+    "autoload": {
+        "psr-4": {
+            "Composer\\Pcre\\": "src"
+        }
+    },
+    "autoload-dev": {
+        "psr-4": {
+            "Composer\\Pcre\\": "tests"
+        }
+    },
+    "extra": {
+        "branch-alias": {
+            "dev-main": "3.x-dev"
+        }
+    },
+    "scripts": {
+        "test": "vendor/bin/simple-phpunit",
+        "phpstan": "phpstan analyse"
+    }
+}

vendor/composer/pcre/src/MatchAllResult.php

@@ -0,0 +1,46 @@
+<?php
+
+/*
+ * This file is part of composer/pcre.
+ *
+ * (c) Composer <https://github.com/composer>
+ *
+ * For the full copyright and license information, please view
+ * the LICENSE file that was distributed with this source code.
+ */
+
+namespace Composer\Pcre;
+
+final class MatchAllResult
+{
+    /**
+     * An array of match group => list of matched strings
+     *
+     * @readonly
+     * @var array<int|string, list<string|null>>
+     */
+    public $matches;
+
+    /**
+     * @readonly
+     * @var 0|positive-int
+     */
+    public $count;
+
+    /**
+     * @readonly
+     * @var bool
+     */
+    public $matched;
+
+    /**
+     * @param 0|positive-int $count
+     * @param array<int|string, array<string|null>> $matches
+     */
+    public function __construct(int $count, array $matches)
+    {
+        $this->matches = $matches;
+        $this->matched = (bool) $count;
+        $this->count = $count;
+    }
+}

vendor/composer/pcre/src/MatchAllStrictGroupsResult.php

@@ -0,0 +1,46 @@
+<?php
+
+/*
+ * This file is part of composer/pcre.
+ *
+ * (c) Composer <https://github.com/composer>
+ *
+ * For the full copyright and license information, please view
+ * the LICENSE file that was distributed with this source code.
+ */
+
+namespace Composer\Pcre;
+
+final class MatchAllStrictGroupsResult
+{
+    /**
+     * An array of match group => list of matched strings
+     *
+     * @readonly
+     * @var array<int|string, list<string>>
+     */
+    public $matches;
+
+    /**
+     * @readonly
+     * @var 0|positive-int
+     */
+    public $count;
+
+    /**
+     * @readonly
+     * @var bool
+     */
+    public $matched;
+
+    /**
+     * @param 0|positive-int $count
+     * @param array<array<string>> $matches
+     */
+    public function __construct(int $count, array $matches)
+    {
+        $this->matches = $matches;
+        $this->matched = (bool) $count;
+        $this->count = $count;
+    }
+}

vendor/composer/pcre/src/MatchAllWithOffsetsResult.php

@@ -0,0 +1,48 @@
+<?php
+
+/*
+ * This file is part of composer/pcre.
+ *
+ * (c) Composer <https://github.com/composer>
+ *
+ * For the full copyright and license information, please view
+ * the LICENSE file that was distributed with this source code.
+ */
+
+namespace Composer\Pcre;
+
+final class MatchAllWithOffsetsResult
+{
+    /**
+     * An array of match group => list of matches, every match being a pair of string matched + offset in bytes (or -1 if no match)
+     *
+     * @readonly
+     * @var array<int|string, list<array{string|null, int}>>
+     * @phpstan-var array<int|string, list<array{string|null, int<-1, max>}>>
+     */
+    public $matches;
+
+    /**
+     * @readonly
+     * @var 0|positive-int
+     */
+    public $count;
+
+    /**
+     * @readonly
+     * @var bool
+     */
+    public $matched;
+
+    /**
+     * @param 0|positive-int $count
+     * @param array<int|string, list<array{string|null, int}>> $matches
+     * @phpstan-param array<int|string, list<array{string|null, int<-1, max>}>> $matches
+     */
+    public function __construct(int $count, array $matches)
+    {
+        $this->matches = $matches;
+        $this->matched = (bool) $count;
+        $this->count = $count;
+    }
+}

vendor/composer/pcre/src/MatchResult.php

@@ -0,0 +1,39 @@
+<?php
+
+/*
+ * This file is part of composer/pcre.
+ *
+ * (c) Composer <https://github.com/composer>
+ *
+ * For the full copyright and license information, please view
+ * the LICENSE file that was distributed with this source code.
+ */
+
+namespace Composer\Pcre;
+
+final class MatchResult
+{
+    /**
+     * An array of match group => string matched
+     *
+     * @readonly
+     * @var array<int|string, string|null>
+     */
+    public $matches;
+
+    /**
+     * @readonly
+     * @var bool
+     */
+    public $matched;
+
+    /**
+     * @param 0|positive-int $count
+     * @param array<string|null> $matches
+     */
+    public function __construct(int $count, array $matches)
+    {
+        $this->matches = $matches;
+        $this->matched = (bool) $count;
+    }
+}

vendor/composer/pcre/src/MatchStrictGroupsResult.php

@@ -0,0 +1,39 @@
+<?php
+
+/*
+ * This file is part of composer/pcre.
+ *
+ * (c) Composer <https://github.com/composer>
+ *
+ * For the full copyright and license information, please view
+ * the LICENSE file that was distributed with this source code.
+ */
+
+namespace Composer\Pcre;
+
+final class MatchStrictGroupsResult
+{
+    /**
+     * An array of match group => string matched
+     *
+     * @readonly
+     * @var array<int|string, string>
+     */
+    public $matches;
+
+    /**
+     * @readonly
+     * @var bool
+     */
+    public $matched;
+
+    /**
+     * @param 0|positive-int $count
+     * @param array<string> $matches
+     */
+    public function __construct(int $count, array $matches)
+    {
+        $this->matches = $matches;
+        $this->matched = (bool) $count;
+    }
+}

vendor/composer/pcre/src/MatchWithOffsetsResult.php

@@ -0,0 +1,41 @@
+<?php
+
+/*
+ * This file is part of composer/pcre.
+ *
+ * (c) Composer <https://github.com/composer>
+ *
+ * For the full copyright and license information, please view
+ * the LICENSE file that was distributed with this source code.
+ */
+
+namespace Composer\Pcre;
+
+final class MatchWithOffsetsResult
+{
+    /**
+     * An array of match group => pair of string matched + offset in bytes (or -1 if no match)
+     *
+     * @readonly
+     * @var array<int|string, array{string|null, int}>
+     * @phpstan-var array<int|string, array{string|null, int<-1, max>}>
+     */
+    public $matches;
+
+    /**
+     * @readonly
+     * @var bool
+     */
+    public $matched;
+
+    /**
+     * @param 0|positive-int $count
+     * @param array<array{string|null, int}> $matches
+     * @phpstan-param array<int|string, array{string|null, int<-1, max>}> $matches
+     */
+    public function __construct(int $count, array $matches)
+    {
+        $this->matches = $matches;
+        $this->matched = (bool) $count;
+    }
+}

vendor/composer/pcre/src/PcreException.php

@@ -0,0 +1,60 @@
+<?php
+
+/*
+ * This file is part of composer/pcre.
+ *
+ * (c) Composer <https://github.com/composer>
+ *
+ * For the full copyright and license information, please view
+ * the LICENSE file that was distributed with this source code.
+ */
+
+namespace Composer\Pcre;
+
+class PcreException extends \RuntimeException
+{
+    /**
+     * @param  string $function
+     * @param  string|string[] $pattern
+     * @return self
+     */
+    public static function fromFunction($function, $pattern)
+    {
+        $code = preg_last_error();
+
+        if (is_array($pattern)) {
+            $pattern = implode(', ', $pattern);
+        }
+
+        return new PcreException($function.'(): failed executing "'.$pattern.'": '.self::pcreLastErrorMessage($code), $code);
+    }
+
+    /**
+     * @param  int $code
+     * @return string
+     */
+    private static function pcreLastErrorMessage($code)
+    {
+        if (function_exists('preg_last_error_msg')) {
+            return preg_last_error_msg();
+        }
+
+        // older php versions did not set the code properly in all cases
+        if (PHP_VERSION_ID < 70201 && $code === 0) {
+            return 'UNDEFINED_ERROR';
+        }
+
+        $constants = get_defined_constants(true);
+        if (!isset($constants['pcre'])) {
+            return 'UNDEFINED_ERROR';
+        }
+
+        foreach ($constants['pcre'] as $const => $val) {
+            if ($val === $code && substr($const, -6) === '_ERROR') {
+                return $const;
+            }
+        }
+
+        return 'UNDEFINED_ERROR';
+    }
+}

vendor/composer/pcre/src/Preg.php

@@ -0,0 +1,428 @@
+<?php
+
+/*
+ * This file is part of composer/pcre.
+ *
+ * (c) Composer <https://github.com/composer>
+ *
+ * For the full copyright and license information, please view
+ * the LICENSE file that was distributed with this source code.
+ */
+
+namespace Composer\Pcre;
+
+class Preg
+{
+    /** @internal */
+    public const ARRAY_MSG = '$subject as an array is not supported. You can use \'foreach\' instead.';
+    /** @internal */
+    public const INVALID_TYPE_MSG = '$subject must be a string, %s given.';
+
+    /**
+     * @param non-empty-string   $pattern
+     * @param array<string|null> $matches Set by method
+     * @param int-mask<PREG_UNMATCHED_AS_NULL> $flags PREG_UNMATCHED_AS_NULL is always set, no other flags are supported
+     * @return 0|1
+     *
+     * @param-out array<int|string, string|null> $matches
+     */
+    public static function match(string $pattern, string $subject, ?array &$matches = null, int $flags = 0, int $offset = 0): int
+    {
+        self::checkOffsetCapture($flags, 'matchWithOffsets');
+
+        $result = preg_match($pattern, $subject, $matches, $flags | PREG_UNMATCHED_AS_NULL, $offset);
+        if ($result === false) {
+            throw PcreException::fromFunction('preg_match', $pattern);
+        }
+
+        return $result;
+    }
+
+    /**
+     * Variant of `match()` which outputs non-null matches (or throws)
+     *
+     * @param non-empty-string $pattern
+     * @param array<string> $matches Set by method
+     * @param int-mask<PREG_UNMATCHED_AS_NULL> $flags PREG_UNMATCHED_AS_NULL is always set, no other flags are supported
+     * @return 0|1
+     * @throws UnexpectedNullMatchException
+     *
+     * @param-out array<int|string, string> $matches
+     */
+    public static function matchStrictGroups(string $pattern, string $subject, ?array &$matches = null, int $flags = 0, int $offset = 0): int
+    {
+        $result = self::match($pattern, $subject, $matchesInternal, $flags, $offset);
+        $matches = self::enforceNonNullMatches($pattern, $matchesInternal, 'match');
+
+        return $result;
+    }
+
+    /**
+     * Runs preg_match with PREG_OFFSET_CAPTURE
+     *
+     * @param non-empty-string   $pattern
+     * @param array<int|string, array{string|null, int}> $matches Set by method
+     * @param int-mask<PREG_UNMATCHED_AS_NULL|PREG_OFFSET_CAPTURE> $flags PREG_UNMATCHED_AS_NULL and PREG_OFFSET_CAPTURE are always set, no other flags are supported
+     * @return 0|1
+     *
+     * @param-out array<int|string, array{string|null, int<-1, max>}> $matches
+     */
+    public static function matchWithOffsets(string $pattern, string $subject, ?array &$matches, int $flags = 0, int $offset = 0): int
+    {
+        $result = preg_match($pattern, $subject, $matches, $flags | PREG_UNMATCHED_AS_NULL | PREG_OFFSET_CAPTURE, $offset);
+        if ($result === false) {
+            throw PcreException::fromFunction('preg_match', $pattern);
+        }
+
+        return $result;
+    }
+
+    /**
+     * @param non-empty-string   $pattern
+     * @param array<int|string, list<string|null>> $matches Set by method
+     * @param int-mask<PREG_UNMATCHED_AS_NULL> $flags PREG_UNMATCHED_AS_NULL is always set, no other flags are supported
+     * @return 0|positive-int
+     *
+     * @param-out array<int|string, list<string|null>> $matches
+     */
+    public static function matchAll(string $pattern, string $subject, ?array &$matches = null, int $flags = 0, int $offset = 0): int
+    {
+        self::checkOffsetCapture($flags, 'matchAllWithOffsets');
+        self::checkSetOrder($flags);
+
+        $result = preg_match_all($pattern, $subject, $matches, $flags | PREG_UNMATCHED_AS_NULL, $offset);
+        if (!is_int($result)) { // PHP < 8 may return null, 8+ returns int|false
+            throw PcreException::fromFunction('preg_match_all', $pattern);
+        }
+
+        return $result;
+    }
+
+    /**
+     * Variant of `match()` which outputs non-null matches (or throws)
+     *
+     * @param non-empty-string   $pattern
+     * @param array<int|string, list<string|null>> $matches Set by method
+     * @param int-mask<PREG_UNMATCHED_AS_NULL> $flags PREG_UNMATCHED_AS_NULL is always set, no other flags are supported
+     * @return 0|positive-int
+     * @throws UnexpectedNullMatchException
+     *
+     * @param-out array<int|string, list<string>> $matches
+     */
+    public static function matchAllStrictGroups(string $pattern, string $subject, ?array &$matches = null, int $flags = 0, int $offset = 0): int
+    {
+        $result = self::matchAll($pattern, $subject, $matchesInternal, $flags, $offset);
+        $matches = self::enforceNonNullMatchAll($pattern, $matchesInternal, 'matchAll');
+
+        return $result;
+    }
+
+    /**
+     * Runs preg_match_all with PREG_OFFSET_CAPTURE
+     *
+     * @param non-empty-string   $pattern
+     * @param array<int|string, list<array{string|null, int}>> $matches Set by method
+     * @param int-mask<PREG_UNMATCHED_AS_NULL|PREG_OFFSET_CAPTURE> $flags PREG_UNMATCHED_AS_NULL and PREG_MATCH_OFFSET are always set, no other flags are supported
+     * @return 0|positive-int
+     *
+     * @phpstan-param array<int|string, list<array{string|null, int<-1, max>}>> $matches
+     */
+    public static function matchAllWithOffsets(string $pattern, string $subject, ?array &$matches, int $flags = 0, int $offset = 0): int
+    {
+        self::checkSetOrder($flags);
+
+        $result = preg_match_all($pattern, $subject, $matches, $flags | PREG_UNMATCHED_AS_NULL | PREG_OFFSET_CAPTURE, $offset);
+        if (!is_int($result)) { // PHP < 8 may return null, 8+ returns int|false
+            throw PcreException::fromFunction('preg_match_all', $pattern);
+        }
+
+        return $result;
+    }
+
+    /**
+     * @param string|string[] $pattern
+     * @param string|string[] $replacement
+     * @param string $subject
+     * @param int             $count Set by method
+     *
+     * @param-out int<0, max> $count
+     */
+    public static function replace($pattern, $replacement, $subject, int $limit = -1, int &$count = null): string
+    {
+        if (!is_scalar($subject)) {
+            if (is_array($subject)) {
+                throw new \InvalidArgumentException(static::ARRAY_MSG);
+            }
+
+            throw new \TypeError(sprintf(static::INVALID_TYPE_MSG, gettype($subject)));
+        }
+
+        $result = preg_replace($pattern, $replacement, $subject, $limit, $count);
+        if ($result === null) {
+            throw PcreException::fromFunction('preg_replace', $pattern);
+        }
+
+        return $result;
+    }
+
+    /**
+     * @param string|string[] $pattern
+     * @param callable(array<int|string, string|null>): string $replacement
+     * @param string $subject
+     * @param int             $count Set by method
+     * @param int-mask<PREG_UNMATCHED_AS_NULL|PREG_OFFSET_CAPTURE> $flags PREG_OFFSET_CAPTURE is supported, PREG_UNMATCHED_AS_NULL is always set
+     *
+     * @param-out int<0, max> $count
+     */
+    public static function replaceCallback($pattern, callable $replacement, $subject, int $limit = -1, int &$count = null, int $flags = 0): string
+    {
+        if (!is_scalar($subject)) {
+            if (is_array($subject)) {
+                throw new \InvalidArgumentException(static::ARRAY_MSG);
+            }
+
+            throw new \TypeError(sprintf(static::INVALID_TYPE_MSG, gettype($subject)));
+        }
+
+        $result = preg_replace_callback($pattern, $replacement, $subject, $limit, $count, $flags | PREG_UNMATCHED_AS_NULL);
+        if ($result === null) {
+            throw PcreException::fromFunction('preg_replace_callback', $pattern);
+        }
+
+        return $result;
+    }
+
+    /**
+     * Variant of `replaceCallback()` which outputs non-null matches (or throws)
+     *
+     * @param string $pattern
+     * @param callable(array<int|string, string>): string $replacement
+     * @param string $subject
+     * @param int $count Set by method
+     * @param int-mask<PREG_UNMATCHED_AS_NULL|PREG_OFFSET_CAPTURE> $flags PREG_OFFSET_CAPTURE or PREG_UNMATCHED_AS_NULL, only available on PHP 7.4+
+     *
+     * @param-out int<0, max> $count
+     */
+    public static function replaceCallbackStrictGroups(string $pattern, callable $replacement, $subject, int $limit = -1, int &$count = null, int $flags = 0): string
+    {
+        return self::replaceCallback($pattern, function (array $matches) use ($pattern, $replacement) {
+            return $replacement(self::enforceNonNullMatches($pattern, $matches, 'replaceCallback'));
+        }, $subject, $limit, $count, $flags);
+    }
+
+    /**
+     * @param array<string, callable(array<int|string, string|null>): string> $pattern
+     * @param string $subject
+     * @param int    $count Set by method
+     * @param int-mask<PREG_UNMATCHED_AS_NULL|PREG_OFFSET_CAPTURE> $flags PREG_OFFSET_CAPTURE is supported, PREG_UNMATCHED_AS_NULL is always set
+     *
+     * @param-out int<0, max> $count
+     */
+    public static function replaceCallbackArray(array $pattern, $subject, int $limit = -1, int &$count = null, int $flags = 0): string
+    {
+        if (!is_scalar($subject)) {
+            if (is_array($subject)) {
+                throw new \InvalidArgumentException(static::ARRAY_MSG);
+            }
+
+            throw new \TypeError(sprintf(static::INVALID_TYPE_MSG, gettype($subject)));
+        }
+
+        $result = preg_replace_callback_array($pattern, $subject, $limit, $count, $flags | PREG_UNMATCHED_AS_NULL);
+        if ($result === null) {
+            $pattern = array_keys($pattern);
+            throw PcreException::fromFunction('preg_replace_callback_array', $pattern);
+        }
+
+        return $result;
+    }
+
+    /**
+     * @param int-mask<PREG_SPLIT_NO_EMPTY|PREG_SPLIT_DELIM_CAPTURE|PREG_SPLIT_OFFSET_CAPTURE> $flags PREG_SPLIT_NO_EMPTY or PREG_SPLIT_DELIM_CAPTURE
+     * @return list<string>
+     */
+    public static function split(string $pattern, string $subject, int $limit = -1, int $flags = 0): array
+    {
+        if (($flags & PREG_SPLIT_OFFSET_CAPTURE) !== 0) {
+            throw new \InvalidArgumentException('PREG_SPLIT_OFFSET_CAPTURE is not supported as it changes the type of $matches, use splitWithOffsets() instead');
+        }
+
+        $result = preg_split($pattern, $subject, $limit, $flags);
+        if ($result === false) {
+            throw PcreException::fromFunction('preg_split', $pattern);
+        }
+
+        return $result;
+    }
+
+    /**
+     * @param int-mask<PREG_SPLIT_NO_EMPTY|PREG_SPLIT_DELIM_CAPTURE|PREG_SPLIT_OFFSET_CAPTURE> $flags PREG_SPLIT_NO_EMPTY or PREG_SPLIT_DELIM_CAPTURE, PREG_SPLIT_OFFSET_CAPTURE is always set
+     * @return list<array{string, int}>
+     * @phpstan-return list<array{string, int<0, max>}>
+     */
+    public static function splitWithOffsets(string $pattern, string $subject, int $limit = -1, int $flags = 0): array
+    {
+        $result = preg_split($pattern, $subject, $limit, $flags | PREG_SPLIT_OFFSET_CAPTURE);
+        if ($result === false) {
+            throw PcreException::fromFunction('preg_split', $pattern);
+        }
+
+        return $result;
+    }
+
+    /**
+     * @template T of string|\Stringable
+     * @param string   $pattern
+     * @param array<T> $array
+     * @param int-mask<PREG_GREP_INVERT> $flags PREG_GREP_INVERT
+     * @return array<T>
+     */
+    public static function grep(string $pattern, array $array, int $flags = 0): array
+    {
+        $result = preg_grep($pattern, $array, $flags);
+        if ($result === false) {
+            throw PcreException::fromFunction('preg_grep', $pattern);
+        }
+
+        return $result;
+    }
+
+    /**
+     * Variant of match() which returns a bool instead of int
+     *
+     * @param non-empty-string   $pattern
+     * @param array<string|null> $matches Set by method
+     * @param int-mask<PREG_UNMATCHED_AS_NULL> $flags PREG_UNMATCHED_AS_NULL is always set, no other flags are supported
+     *
+     * @param-out array<int|string, string|null> $matches
+     */
+    public static function isMatch(string $pattern, string $subject, ?array &$matches = null, int $flags = 0, int $offset = 0): bool
+    {
+        return (bool) static::match($pattern, $subject, $matches, $flags, $offset);
+    }
+
+    /**
+     * Variant of `isMatch()` which outputs non-null matches (or throws)
+     *
+     * @param non-empty-string $pattern
+     * @param array<string> $matches Set by method
+     * @param int-mask<PREG_UNMATCHED_AS_NULL> $flags PREG_UNMATCHED_AS_NULL is always set, no other flags are supported
+     * @throws UnexpectedNullMatchException
+     *
+     * @param-out array<int|string, string> $matches
+     */
+    public static function isMatchStrictGroups(string $pattern, string $subject, ?array &$matches = null, int $flags = 0, int $offset = 0): bool
+    {
+        return (bool) self::matchStrictGroups($pattern, $subject, $matches, $flags, $offset);
+    }
+
+    /**
+     * Variant of matchAll() which returns a bool instead of int
+     *
+     * @param non-empty-string   $pattern
+     * @param array<int|string, list<string|null>> $matches Set by method
+     * @param int-mask<PREG_UNMATCHED_AS_NULL> $flags PREG_UNMATCHED_AS_NULL is always set, no other flags are supported
+     *
+     * @param-out array<int|string, list<string|null>> $matches
+     */
+    public static function isMatchAll(string $pattern, string $subject, ?array &$matches = null, int $flags = 0, int $offset = 0): bool
+    {
+        return (bool) static::matchAll($pattern, $subject, $matches, $flags, $offset);
+    }
+
+    /**
+     * Variant of `isMatchAll()` which outputs non-null matches (or throws)
+     *
+     * @param non-empty-string $pattern
+     * @param array<int|string, list<string>> $matches Set by method
+     * @param int-mask<PREG_UNMATCHED_AS_NULL> $flags PREG_UNMATCHED_AS_NULL is always set, no other flags are supported
+     *
+     * @param-out array<int|string, list<string>> $matches
+     */
+    public static function isMatchAllStrictGroups(string $pattern, string $subject, ?array &$matches = null, int $flags = 0, int $offset = 0): bool
+    {
+        return (bool) self::matchAllStrictGroups($pattern, $subject, $matches, $flags, $offset);
+    }
+
+    /**
+     * Variant of matchWithOffsets() which returns a bool instead of int
+     *
+     * Runs preg_match with PREG_OFFSET_CAPTURE
+     *
+     * @param non-empty-string   $pattern
+     * @param array<int|string, array{string|null, int}> $matches Set by method
+     * @param int-mask<PREG_UNMATCHED_AS_NULL> $flags PREG_UNMATCHED_AS_NULL is always set, no other flags are supported
+     *
+     * @param-out array<int|string, array{string|null, int<-1, max>}> $matches
+     */
+    public static function isMatchWithOffsets(string $pattern, string $subject, ?array &$matches, int $flags = 0, int $offset = 0): bool
+    {
+        return (bool) static::matchWithOffsets($pattern, $subject, $matches, $flags, $offset);
+    }
+
+    /**
+     * Variant of matchAllWithOffsets() which returns a bool instead of int
+     *
+     * Runs preg_match_all with PREG_OFFSET_CAPTURE
+     *
+     * @param non-empty-string   $pattern
+     * @param array<int|string, list<array{string|null, int}>> $matches Set by method
+     * @param int-mask<PREG_UNMATCHED_AS_NULL> $flags PREG_UNMATCHED_AS_NULL is always set, no other flags are supported
+     *
+     * @param-out array<int|string, list<array{string|null, int<-1, max>}>> $matches
+     */
+    public static function isMatchAllWithOffsets(string $pattern, string $subject, ?array &$matches, int $flags = 0, int $offset = 0): bool
+    {
+        return (bool) static::matchAllWithOffsets($pattern, $subject, $matches, $flags, $offset);
+    }
+
+    private static function checkOffsetCapture(int $flags, string $useFunctionName): void
+    {
+        if (($flags & PREG_OFFSET_CAPTURE) !== 0) {
+            throw new \InvalidArgumentException('PREG_OFFSET_CAPTURE is not supported as it changes the type of $matches, use ' . $useFunctionName . '() instead');
+        }
+    }
+
+    private static function checkSetOrder(int $flags): void
+    {
+        if (($flags & PREG_SET_ORDER) !== 0) {
+            throw new \InvalidArgumentException('PREG_SET_ORDER is not supported as it changes the type of $matches');
+        }
+    }
+
+    /**
+     * @param array<int|string, string|null> $matches
+     * @return array<int|string, string>
+     * @throws UnexpectedNullMatchException
+     */
+    private static function enforceNonNullMatches(string $pattern, array $matches, string $variantMethod)
+    {
+        foreach ($matches as $group => $match) {
+            if (null === $match) {
+                throw new UnexpectedNullMatchException('Pattern "'.$pattern.'" had an unexpected unmatched group "'.$group.'", make sure the pattern always matches or use '.$variantMethod.'() instead.');
+            }
+        }
+
+        /** @var array<string> */
+        return $matches;
+    }
+
+    /**
+     * @param array<int|string, list<string|null>> $matches
+     * @return array<int|string, list<string>>
+     * @throws UnexpectedNullMatchException
+     */
+    private static function enforceNonNullMatchAll(string $pattern, array $matches, string $variantMethod)
+    {
+        foreach ($matches as $group => $groupMatches) {
+            foreach ($groupMatches as $match) {
+                if (null === $match) {
+                    throw new UnexpectedNullMatchException('Pattern "'.$pattern.'" had an unexpected unmatched group "'.$group.'", make sure the pattern always matches or use '.$variantMethod.'() instead.');
+                }
+            }
+        }
+
+        /** @var array<int|string, list<string>> */
+        return $matches;
+    }
+}

vendor/composer/pcre/src/Regex.php

@@ -0,0 +1,174 @@
+<?php
+
+/*
+ * This file is part of composer/pcre.
+ *
+ * (c) Composer <https://github.com/composer>
+ *
+ * For the full copyright and license information, please view
+ * the LICENSE file that was distributed with this source code.
+ */
+
+namespace Composer\Pcre;
+
+class Regex
+{
+    /**
+     * @param non-empty-string $pattern
+     */
+    public static function isMatch(string $pattern, string $subject, int $offset = 0): bool
+    {
+        return (bool) Preg::match($pattern, $subject, $matches, 0, $offset);
+    }
+
+    /**
+     * @param non-empty-string $pattern
+     * @param int-mask<PREG_UNMATCHED_AS_NULL> $flags PREG_UNMATCHED_AS_NULL is always set, no other flags are supported
+     */
+    public static function match(string $pattern, string $subject, int $flags = 0, int $offset = 0): MatchResult
+    {
+        self::checkOffsetCapture($flags, 'matchWithOffsets');
+
+        $count = Preg::match($pattern, $subject, $matches, $flags, $offset);
+
+        return new MatchResult($count, $matches);
+    }
+
+    /**
+     * Variant of `match()` which returns non-null matches (or throws)
+     *
+     * @param non-empty-string $pattern
+     * @param int-mask<PREG_UNMATCHED_AS_NULL> $flags PREG_UNMATCHED_AS_NULL is always set, no other flags are supported
+     * @throws UnexpectedNullMatchException
+     */
+    public static function matchStrictGroups(string $pattern, string $subject, int $flags = 0, int $offset = 0): MatchStrictGroupsResult
+    {
+        $count = Preg::matchStrictGroups($pattern, $subject, $matches, $flags, $offset);
+
+        return new MatchStrictGroupsResult($count, $matches);
+    }
+
+    /**
+     * Runs preg_match with PREG_OFFSET_CAPTURE
+     *
+     * @param non-empty-string $pattern
+     * @param int-mask<PREG_UNMATCHED_AS_NULL|PREG_OFFSET_CAPTURE> $flags PREG_UNMATCHED_AS_NULL and PREG_MATCH_OFFSET are always set, no other flags are supported
+     */
+    public static function matchWithOffsets(string $pattern, string $subject, int $flags = 0, int $offset = 0): MatchWithOffsetsResult
+    {
+        $count = Preg::matchWithOffsets($pattern, $subject, $matches, $flags, $offset);
+
+        return new MatchWithOffsetsResult($count, $matches);
+    }
+
+    /**
+     * @param non-empty-string $pattern
+     * @param int-mask<PREG_UNMATCHED_AS_NULL> $flags PREG_UNMATCHED_AS_NULL is always set, no other flags are supported
+     */
+    public static function matchAll(string $pattern, string $subject, int $flags = 0, int $offset = 0): MatchAllResult
+    {
+        self::checkOffsetCapture($flags, 'matchAllWithOffsets');
+        self::checkSetOrder($flags);
+
+        $count = Preg::matchAll($pattern, $subject, $matches, $flags, $offset);
+
+        return new MatchAllResult($count, $matches);
+    }
+
+    /**
+     * Variant of `matchAll()` which returns non-null matches (or throws)
+     *
+     * @param non-empty-string $pattern
+     * @param int-mask<PREG_UNMATCHED_AS_NULL> $flags PREG_UNMATCHED_AS_NULL is always set, no other flags are supported
+     * @throws UnexpectedNullMatchException
+     */
+    public static function matchAllStrictGroups(string $pattern, string $subject, int $flags = 0, int $offset = 0): MatchAllStrictGroupsResult
+    {
+        self::checkOffsetCapture($flags, 'matchAllWithOffsets');
+        self::checkSetOrder($flags);
+
+        $count = Preg::matchAllStrictGroups($pattern, $subject, $matches, $flags, $offset);
+
+        return new MatchAllStrictGroupsResult($count, $matches);
+    }
+
+    /**
+     * Runs preg_match_all with PREG_OFFSET_CAPTURE
+     *
+     * @param non-empty-string $pattern
+     * @param int-mask<PREG_UNMATCHED_AS_NULL|PREG_OFFSET_CAPTURE> $flags PREG_UNMATCHED_AS_NULL and PREG_MATCH_OFFSET are always set, no other flags are supported
+     */
+    public static function matchAllWithOffsets(string $pattern, string $subject, int $flags = 0, int $offset = 0): MatchAllWithOffsetsResult
+    {
+        self::checkSetOrder($flags);
+
+        $count = Preg::matchAllWithOffsets($pattern, $subject, $matches, $flags, $offset);
+
+        return new MatchAllWithOffsetsResult($count, $matches);
+    }
+    /**
+     * @param string|string[] $pattern
+     * @param string|string[] $replacement
+     * @param string          $subject
+     */
+    public static function replace($pattern, $replacement, $subject, int $limit = -1): ReplaceResult
+    {
+        $result = Preg::replace($pattern, $replacement, $subject, $limit, $count);
+
+        return new ReplaceResult($count, $result);
+    }
+
+    /**
+     * @param string|string[] $pattern
+     * @param callable(array<int|string, string|null>): string $replacement
+     * @param string          $subject
+     * @param int-mask<PREG_UNMATCHED_AS_NULL|PREG_OFFSET_CAPTURE> $flags PREG_OFFSET_CAPTURE is supported, PREG_UNMATCHED_AS_NULL is always set
+     */
+    public static function replaceCallback($pattern, callable $replacement, $subject, int $limit = -1, int $flags = 0): ReplaceResult
+    {
+        $result = Preg::replaceCallback($pattern, $replacement, $subject, $limit, $count, $flags);
+
+        return new ReplaceResult($count, $result);
+    }
+
+    /**
+     * Variant of `replaceCallback()` which outputs non-null matches (or throws)
+     *
+     * @param string $pattern
+     * @param callable(array<int|string, string>): string $replacement
+     * @param string          $subject
+     * @param int-mask<PREG_UNMATCHED_AS_NULL|PREG_OFFSET_CAPTURE> $flags PREG_OFFSET_CAPTURE or PREG_UNMATCHED_AS_NULL, only available on PHP 7.4+
+     */
+    public static function replaceCallbackStrictGroups($pattern, callable $replacement, $subject, int $limit = -1, int $flags = 0): ReplaceResult
+    {
+        $result = Preg::replaceCallbackStrictGroups($pattern, $replacement, $subject, $limit, $count, $flags);
+
+        return new ReplaceResult($count, $result);
+    }
+
+    /**
+     * @param array<string, callable(array<int|string, string|null>): string> $pattern
+     * @param string $subject
+     * @param int-mask<PREG_UNMATCHED_AS_NULL|PREG_OFFSET_CAPTURE> $flags PREG_OFFSET_CAPTURE is supported, PREG_UNMATCHED_AS_NULL is always set
+     */
+    public static function replaceCallbackArray(array $pattern, $subject, int $limit = -1, int $flags = 0): ReplaceResult
+    {
+        $result = Preg::replaceCallbackArray($pattern, $subject, $limit, $count, $flags);
+
+        return new ReplaceResult($count, $result);
+    }
+
+    private static function checkOffsetCapture(int $flags, string $useFunctionName): void
+    {
+        if (($flags & PREG_OFFSET_CAPTURE) !== 0) {
+            throw new \InvalidArgumentException('PREG_OFFSET_CAPTURE is not supported as it changes the return type, use '.$useFunctionName.'() instead');
+        }
+    }
+
+    private static function checkSetOrder(int $flags): void
+    {
+        if (($flags & PREG_SET_ORDER) !== 0) {
+            throw new \InvalidArgumentException('PREG_SET_ORDER is not supported as it changes the return type');
+        }
+    }
+}

vendor/composer/pcre/src/ReplaceResult.php

@@ -0,0 +1,43 @@
+<?php
+
+/*
+ * This file is part of composer/pcre.
+ *
+ * (c) Composer <https://github.com/composer>
+ *
+ * For the full copyright and license information, please view
+ * the LICENSE file that was distributed with this source code.
+ */
+
+namespace Composer\Pcre;
+
+final class ReplaceResult
+{
+    /**
+     * @readonly
+     * @var string
+     */
+    public $result;
+
+    /**
+     * @readonly
+     * @var 0|positive-int
+     */
+    public $count;
+
+    /**
+     * @readonly
+     * @var bool
+     */
+    public $matched;
+
+    /**
+     * @param 0|positive-int $count
+     */
+    public function __construct(int $count, string $result)
+    {
+        $this->count = $count;
+        $this->matched = (bool) $count;
+        $this->result = $result;
+    }
+}

vendor/composer/pcre/src/UnexpectedNullMatchException.php

@@ -0,0 +1,20 @@
+<?php
+
+/*
+ * This file is part of composer/pcre.
+ *
+ * (c) Composer <https://github.com/composer>
+ *
+ * For the full copyright and license information, please view
+ * the LICENSE file that was distributed with this source code.
+ */
+
+namespace Composer\Pcre;
+
+class UnexpectedNullMatchException extends PcreException
+{
+    public static function fromFunction($function, $pattern)
+    {
+        throw new \LogicException('fromFunction should not be called on '.self::class.', use '.PcreException::class);
+    }
+}

vendor/doctrine/cache/LICENSE

@@ -0,0 +1,19 @@
+Copyright (c) 2006-2015 Doctrine Project
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.

vendor/doctrine/cache/README.md

@@ -0,0 +1,13 @@
+# Doctrine Cache
+
+[![Build Status](https://github.com/doctrine/cache/workflows/Continuous%20Integration/badge.svg)](https://github.com/doctrine/cache/actions)
+[![Code Coverage](https://codecov.io/gh/doctrine/cache/branch/1.10.x/graph/badge.svg)](https://codecov.io/gh/doctrine/cache/branch/1.10.x)
+
+[![Latest Stable Version](https://img.shields.io/packagist/v/doctrine/cache.svg?style=flat-square)](https://packagist.org/packages/doctrine/cache)
+[![Total Downloads](https://img.shields.io/packagist/dt/doctrine/cache.svg?style=flat-square)](https://packagist.org/packages/doctrine/cache)
+
+Cache component extracted from the Doctrine Common project. [Documentation](https://www.doctrine-project.org/projects/doctrine-cache/en/current/index.html)
+
+This library is deprecated and will no longer receive bug fixes from the
+Doctrine Project. Please use a different cache library, preferably PSR-6 or
+PSR-16 instead.