Merge pull request #34895 from mlaventure/containerd-1.0-client
Containerd 1.0 client
This commit is contained in:
commit
402540708c
502 changed files with 92787 additions and 8862 deletions
api/server/router/container
builder/dockerfile
cmd/dockerd
config.goconfig_unix.goconfig_windows.godaemon.godaemon_linux.godaemon_solaris.godaemon_unix.godaemon_windows.go
container
daemon
checkpoint.go
config
daemon.godaemon_unix.godaemon_windows.godelete.goerrors.goexec.goexec
exec_linux.goexec_solaris.goexec_windows.goinfo_unix.gokill.gologger
monitor.gomonitor_linux.gomonitor_solaris.gomonitor_windows.gooci_linux.gopause.goreload.goresize.gostart.gostart_unix.gostart_windows.gotop_unix.gotop_unix_test.gotop_windows.gounpause.goupdate.goupdate_linux.goupdate_windows.gohack
integration-cli
daemon
docker_api_stats_test.godocker_cli_attach_test.godocker_cli_build_unix_test.godocker_cli_daemon_test.godocker_cli_events_test.godocker_cli_exec_test.godocker_cli_logs_test.godocker_cli_network_unix_test.godocker_cli_pull_test.godocker_cli_run_test.godocker_cli_run_unix_test.godocker_cli_service_logs_test.godocker_cli_stats_test.godocker_deprecated_api_v124_test.goevents_utils_test.gointegration/service
libcontainerd
client.goclient_daemon.goclient_daemon_linux.goclient_daemon_windows.goclient_linux.goclient_local_windows.goclient_solaris.goclient_unix.goclient_windows.gocontainer.gocontainer_unix.gocontainer_windows.goerrors.goio.goio_unix.goio_windows.gooom_linux.gooom_solaris.gopausemonitor_unix.goprocess.goprocess_unix.goprocess_windows.goqueue.goqueue_test.goremote.goremote_daemon.goremote_daemon_options.goremote_daemon_options_unix.goremote_daemon_process.go
|
@ -126,7 +126,7 @@ func (s *containerRouter) postContainerExecStart(ctx context.Context, w http.Res
|
|||
return err
|
||||
}
|
||||
stdout.Write([]byte(err.Error() + "\r\n"))
|
||||
logrus.Errorf("Error running exec in container: %v", err)
|
||||
logrus.Errorf("Error running exec %s in container: %v", execName, err)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
|
|
@ -102,7 +102,7 @@ func (c *containerManager) Run(ctx context.Context, cID string, stdout, stderr i
|
|||
|
||||
func logCancellationError(cancelErrCh chan error, msg string) {
|
||||
if cancelErr := <-cancelErrCh; cancelErr != nil {
|
||||
logrus.Debugf("Build cancelled (%v): ", cancelErr, msg)
|
||||
logrus.Debugf("Build cancelled (%v): %s", cancelErr, msg)
|
||||
}
|
||||
}
|
||||
|
||||
|
|
|
@ -27,6 +27,8 @@ func installCommonConfigFlags(conf *config.Config, flags *pflag.FlagSet) {
|
|||
flags.Var(opts.NewNamedListOptsRef("exec-opts", &conf.ExecOptions, nil), "exec-opt", "Runtime execution options")
|
||||
flags.StringVarP(&conf.Pidfile, "pidfile", "p", defaultPidFile, "Path to use for daemon PID file")
|
||||
flags.StringVarP(&conf.Root, "graph", "g", defaultDataRoot, "Root of the Docker runtime")
|
||||
flags.StringVar(&conf.ExecRoot, "exec-root", defaultExecRoot, "Root directory for execution state files")
|
||||
flags.StringVar(&conf.ContainerdAddr, "containerd", "", "containerd grpc address")
|
||||
|
||||
// "--graph" is "soft-deprecated" in favor of "data-root". This flag was added
|
||||
// before Docker 1.0, so won't be removed, only hidden, to discourage its usage.
|
||||
|
|
|
@ -29,13 +29,11 @@ func installConfigFlags(conf *config.Config, flags *pflag.FlagSet) {
|
|||
flags.BoolVar(&conf.BridgeConfig.EnableIPForward, "ip-forward", true, "Enable net.ipv4.ip_forward")
|
||||
flags.BoolVar(&conf.BridgeConfig.EnableIPMasq, "ip-masq", true, "Enable IP masquerading")
|
||||
flags.BoolVar(&conf.BridgeConfig.EnableIPv6, "ipv6", false, "Enable IPv6 networking")
|
||||
flags.StringVar(&conf.ExecRoot, "exec-root", defaultExecRoot, "Root directory for execution state files")
|
||||
flags.StringVar(&conf.BridgeConfig.FixedCIDRv6, "fixed-cidr-v6", "", "IPv6 subnet for fixed IPs")
|
||||
flags.BoolVar(&conf.BridgeConfig.EnableUserlandProxy, "userland-proxy", true, "Use userland proxy for loopback traffic")
|
||||
flags.StringVar(&conf.BridgeConfig.UserlandProxyPath, "userland-proxy-path", "", "Path to the userland proxy binary")
|
||||
flags.StringVar(&conf.CgroupParent, "cgroup-parent", "", "Set parent cgroup for all containers")
|
||||
flags.StringVar(&conf.RemappedRoot, "userns-remap", "", "User/Group setting for user namespaces")
|
||||
flags.StringVar(&conf.ContainerdAddr, "containerd", "", "Path to containerd socket")
|
||||
flags.BoolVar(&conf.LiveRestoreEnabled, "live-restore", false, "Enable live restore of docker when containers are still running")
|
||||
flags.IntVar(&conf.OOMScoreAdjust, "oom-score-adjust", -500, "Set the oom_score_adj for the daemon")
|
||||
flags.BoolVar(&conf.Init, "init", false, "Run an init in the container to forward signals and reap processes")
|
||||
|
|
|
@ -11,6 +11,7 @@ import (
|
|||
var (
|
||||
defaultPidFile string
|
||||
defaultDataRoot = filepath.Join(os.Getenv("programdata"), "docker")
|
||||
defaultExecRoot = filepath.Join(os.Getenv("programdata"), "docker", "exec-root")
|
||||
)
|
||||
|
||||
// installConfigFlags adds flags to the pflag.FlagSet to configure the daemon
|
||||
|
|
|
@ -204,7 +204,11 @@ func (cli *DaemonCli) start(opts *daemonOptions) (err error) {
|
|||
return err
|
||||
}
|
||||
|
||||
containerdRemote, err := libcontainerd.New(cli.getLibcontainerdRoot(), cli.getPlatformRemoteOptions()...)
|
||||
rOpts, err := cli.getRemoteOptions()
|
||||
if err != nil {
|
||||
return fmt.Errorf("Failed to generate containerd options: %s", err)
|
||||
}
|
||||
containerdRemote, err := libcontainerd.New(filepath.Join(cli.Config.Root, "containerd"), filepath.Join(cli.Config.ExecRoot, "containerd"), rOpts...)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
@ -560,6 +564,17 @@ func (cli *DaemonCli) initMiddlewares(s *apiserver.Server, cfg *apiserver.Config
|
|||
return nil
|
||||
}
|
||||
|
||||
func (cli *DaemonCli) getRemoteOptions() ([]libcontainerd.RemoteOption, error) {
|
||||
opts := []libcontainerd.RemoteOption{}
|
||||
|
||||
pOpts, err := cli.getPlatformRemoteOptions()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
opts = append(opts, pOpts...)
|
||||
return opts, nil
|
||||
}
|
||||
|
||||
// validates that the plugins requested with the --authorization-plugin flag are valid AuthzDriver
|
||||
// plugins present on the host and available to the daemon
|
||||
func validateAuthzPlugins(requestedPlugins []string, pg plugingetter.PluginGetter) error {
|
||||
|
|
|
@ -11,5 +11,5 @@ func preNotifySystem() {
|
|||
// notifySystem sends a message to the host when the server is ready to be used
|
||||
func notifySystem() {
|
||||
// Tell the init daemon we are accepting requests
|
||||
go systemdDaemon.SdNotify("READY=1")
|
||||
go systemdDaemon.SdNotify(false, "READY=1")
|
||||
}
|
||||
|
|
|
@ -41,20 +41,8 @@ func preNotifySystem() {
|
|||
func notifySystem() {
|
||||
}
|
||||
|
||||
func (cli *DaemonCli) getPlatformRemoteOptions() []libcontainerd.RemoteOption {
|
||||
opts := []libcontainerd.RemoteOption{}
|
||||
if cli.Config.ContainerdAddr != "" {
|
||||
opts = append(opts, libcontainerd.WithRemoteAddr(cli.Config.ContainerdAddr))
|
||||
} else {
|
||||
opts = append(opts, libcontainerd.WithStartDaemon(true))
|
||||
}
|
||||
return opts
|
||||
}
|
||||
|
||||
// getLibcontainerdRoot gets the root directory for libcontainerd/containerd to
|
||||
// store their state.
|
||||
func (cli *DaemonCli) getLibcontainerdRoot() string {
|
||||
return filepath.Join(cli.Config.ExecRoot, "libcontainerd")
|
||||
func (cli *DaemonCli) getPlatformRemoteOptions() ([]libcontainerd.RemoteOption, error) {
|
||||
return nil, nil
|
||||
}
|
||||
|
||||
// getSwarmRunRoot gets the root directory for swarm to store runtime state
|
||||
|
|
|
@ -10,9 +10,11 @@ import (
|
|||
"path/filepath"
|
||||
"strconv"
|
||||
|
||||
"github.com/containerd/containerd/linux"
|
||||
"github.com/docker/docker/cmd/dockerd/hack"
|
||||
"github.com/docker/docker/daemon"
|
||||
"github.com/docker/docker/libcontainerd"
|
||||
"github.com/docker/docker/pkg/parsers/kernel"
|
||||
"github.com/docker/libnetwork/portallocator"
|
||||
"golang.org/x/sys/unix"
|
||||
)
|
||||
|
@ -35,6 +37,39 @@ func getDaemonConfDir(_ string) string {
|
|||
return "/etc/docker"
|
||||
}
|
||||
|
||||
func (cli *DaemonCli) getPlatformRemoteOptions() ([]libcontainerd.RemoteOption, error) {
|
||||
// On older kernel, letting putting the containerd-shim in its own
|
||||
// namespace will effectively prevent operations such as unlink, rename
|
||||
// and remove on mountpoints that were present at the time the shim
|
||||
// namespace was created. This would led to a famous EBUSY will trying to
|
||||
// remove shm mounts.
|
||||
var noNewNS bool
|
||||
if !kernel.CheckKernelVersion(3, 18, 0) {
|
||||
noNewNS = true
|
||||
}
|
||||
|
||||
opts := []libcontainerd.RemoteOption{
|
||||
libcontainerd.WithOOMScore(cli.Config.OOMScoreAdjust),
|
||||
libcontainerd.WithPlugin("linux", &linux.Config{
|
||||
Shim: daemon.DefaultShimBinary,
|
||||
Runtime: daemon.DefaultRuntimeBinary,
|
||||
RuntimeRoot: filepath.Join(cli.Config.Root, "runc"),
|
||||
ShimDebug: cli.Config.Debug,
|
||||
ShimNoMountNS: noNewNS,
|
||||
}),
|
||||
}
|
||||
if cli.Config.Debug {
|
||||
opts = append(opts, libcontainerd.WithLogLevel("debug"))
|
||||
}
|
||||
if cli.Config.ContainerdAddr != "" {
|
||||
opts = append(opts, libcontainerd.WithRemoteAddr(cli.Config.ContainerdAddr))
|
||||
} else {
|
||||
opts = append(opts, libcontainerd.WithStartDaemon(true))
|
||||
}
|
||||
|
||||
return opts, nil
|
||||
}
|
||||
|
||||
// setupConfigReloadTrap configures the USR2 signal to reload the configuration.
|
||||
func (cli *DaemonCli) setupConfigReloadTrap() {
|
||||
c := make(chan os.Signal, 1)
|
||||
|
@ -46,33 +81,6 @@ func (cli *DaemonCli) setupConfigReloadTrap() {
|
|||
}()
|
||||
}
|
||||
|
||||
func (cli *DaemonCli) getPlatformRemoteOptions() []libcontainerd.RemoteOption {
|
||||
opts := []libcontainerd.RemoteOption{
|
||||
libcontainerd.WithDebugLog(cli.Config.Debug),
|
||||
libcontainerd.WithOOMScore(cli.Config.OOMScoreAdjust),
|
||||
}
|
||||
if cli.Config.ContainerdAddr != "" {
|
||||
opts = append(opts, libcontainerd.WithRemoteAddr(cli.Config.ContainerdAddr))
|
||||
} else {
|
||||
opts = append(opts, libcontainerd.WithStartDaemon(true))
|
||||
}
|
||||
if daemon.UsingSystemd(cli.Config) {
|
||||
args := []string{"--systemd-cgroup=true"}
|
||||
opts = append(opts, libcontainerd.WithRuntimeArgs(args))
|
||||
}
|
||||
if cli.Config.LiveRestoreEnabled {
|
||||
opts = append(opts, libcontainerd.WithLiveRestore(true))
|
||||
}
|
||||
opts = append(opts, libcontainerd.WithRuntimePath(daemon.DefaultRuntimeBinary))
|
||||
return opts
|
||||
}
|
||||
|
||||
// getLibcontainerdRoot gets the root directory for libcontainerd/containerd to
|
||||
// store their state.
|
||||
func (cli *DaemonCli) getLibcontainerdRoot() string {
|
||||
return filepath.Join(cli.Config.ExecRoot, "libcontainerd")
|
||||
}
|
||||
|
||||
// getSwarmRunRoot gets the root directory for swarm to store runtime state
|
||||
// For example, the control socket
|
||||
func (cli *DaemonCli) getSwarmRunRoot() string {
|
||||
|
|
|
@ -48,6 +48,10 @@ func notifyShutdown(err error) {
|
|||
}
|
||||
}
|
||||
|
||||
func (cli *DaemonCli) getPlatformRemoteOptions() ([]libcontainerd.RemoteOption, error) {
|
||||
return nil, nil
|
||||
}
|
||||
|
||||
// setupConfigReloadTrap configures a Win32 event to reload the configuration.
|
||||
func (cli *DaemonCli) setupConfigReloadTrap() {
|
||||
go func() {
|
||||
|
@ -65,17 +69,6 @@ func (cli *DaemonCli) setupConfigReloadTrap() {
|
|||
}()
|
||||
}
|
||||
|
||||
func (cli *DaemonCli) getPlatformRemoteOptions() []libcontainerd.RemoteOption {
|
||||
return nil
|
||||
}
|
||||
|
||||
// getLibcontainerdRoot gets the root directory for libcontainerd to store its
|
||||
// state. The Windows libcontainerd implementation does not need to write a spec
|
||||
// or state to disk, so this is a no-op.
|
||||
func (cli *DaemonCli) getLibcontainerdRoot() string {
|
||||
return ""
|
||||
}
|
||||
|
||||
// getSwarmRunRoot gets the root directory for swarm to store runtime state
|
||||
// For example, the control socket
|
||||
func (cli *DaemonCli) getSwarmRunRoot() string {
|
||||
|
|
|
@ -15,6 +15,7 @@ import (
|
|||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/containerd/containerd"
|
||||
containertypes "github.com/docker/docker/api/types/container"
|
||||
mounttypes "github.com/docker/docker/api/types/mount"
|
||||
networktypes "github.com/docker/docker/api/types/network"
|
||||
|
@ -61,6 +62,18 @@ var (
|
|||
errInvalidNetwork = errors.New("invalid network settings while building port map info")
|
||||
)
|
||||
|
||||
// ExitStatus provides exit reasons for a container.
|
||||
type ExitStatus struct {
|
||||
// The exit code with which the container exited.
|
||||
ExitCode int
|
||||
|
||||
// Whether the container encountered an OOM.
|
||||
OOMKilled bool
|
||||
|
||||
// Time at which the container died
|
||||
ExitedAt time.Time
|
||||
}
|
||||
|
||||
// Container holds the structure defining a container object.
|
||||
type Container struct {
|
||||
StreamConfig *stream.Config
|
||||
|
@ -996,10 +1009,10 @@ func (container *Container) CloseStreams() error {
|
|||
}
|
||||
|
||||
// InitializeStdio is called by libcontainerd to connect the stdio.
|
||||
func (container *Container) InitializeStdio(iop libcontainerd.IOPipe) error {
|
||||
func (container *Container) InitializeStdio(iop *libcontainerd.IOPipe) (containerd.IO, error) {
|
||||
if err := container.startLogging(); err != nil {
|
||||
container.Reset(false)
|
||||
return err
|
||||
return nil, err
|
||||
}
|
||||
|
||||
container.StreamConfig.CopyToPipe(iop)
|
||||
|
@ -1012,7 +1025,7 @@ func (container *Container) InitializeStdio(iop libcontainerd.IOPipe) error {
|
|||
}
|
||||
}
|
||||
|
||||
return nil
|
||||
return &cio{IO: iop, sc: container.StreamConfig}, nil
|
||||
}
|
||||
|
||||
// SecretMountPath returns the path of the secret mount for the container
|
||||
|
@ -1069,3 +1082,21 @@ func (container *Container) CreateDaemonEnvironment(tty bool, linkedEnv []string
|
|||
env = ReplaceOrAppendEnvValues(env, container.Config.Env)
|
||||
return env
|
||||
}
|
||||
|
||||
type cio struct {
|
||||
containerd.IO
|
||||
|
||||
sc *stream.Config
|
||||
}
|
||||
|
||||
func (i *cio) Close() error {
|
||||
i.IO.Close()
|
||||
|
||||
return i.sc.CloseStreams()
|
||||
}
|
||||
|
||||
func (i *cio) Wait() {
|
||||
i.sc.Wait()
|
||||
|
||||
i.IO.Wait()
|
||||
}
|
||||
|
|
|
@ -24,15 +24,6 @@ const (
|
|||
containerSecretMountPath = "/run/secrets"
|
||||
)
|
||||
|
||||
// ExitStatus provides exit reasons for a container.
|
||||
type ExitStatus struct {
|
||||
// The exit code with which the container exited.
|
||||
ExitCode int
|
||||
|
||||
// Whether the container encountered an OOM.
|
||||
OOMKilled bool
|
||||
}
|
||||
|
||||
// TrySetNetworkMount attempts to set the network mounts given a provided destination and
|
||||
// the path to use for it; return true if the given destination was a network mount file
|
||||
func (container *Container) TrySetNetworkMount(destination string, path string) bool {
|
||||
|
|
|
@ -18,12 +18,6 @@ const (
|
|||
containerInternalConfigsDirPath = `C:\ProgramData\Docker\internal\configs`
|
||||
)
|
||||
|
||||
// ExitStatus provides exit reasons for a container.
|
||||
type ExitStatus struct {
|
||||
// The exit code with which the container exited.
|
||||
ExitCode int
|
||||
}
|
||||
|
||||
// UnmountIpcMount unmounts Ipc related mounts.
|
||||
// This is a NOOP on windows.
|
||||
func (container *Container) UnmountIpcMount(unmount func(pth string) error) error {
|
||||
|
|
|
@ -276,6 +276,7 @@ func (s *State) SetExitCode(ec int) {
|
|||
// SetRunning sets the state of the container to "running".
|
||||
func (s *State) SetRunning(pid int, initial bool) {
|
||||
s.ErrorMsg = ""
|
||||
s.Paused = false
|
||||
s.Running = true
|
||||
s.Restarting = false
|
||||
if initial {
|
||||
|
@ -294,9 +295,14 @@ func (s *State) SetStopped(exitStatus *ExitStatus) {
|
|||
s.Paused = false
|
||||
s.Restarting = false
|
||||
s.Pid = 0
|
||||
s.FinishedAt = time.Now().UTC()
|
||||
s.setFromExitStatus(exitStatus)
|
||||
close(s.waitStop) // Fire waiters for stop
|
||||
if exitStatus.ExitedAt.IsZero() {
|
||||
s.FinishedAt = time.Now().UTC()
|
||||
} else {
|
||||
s.FinishedAt = exitStatus.ExitedAt
|
||||
}
|
||||
s.ExitCodeValue = exitStatus.ExitCode
|
||||
s.OOMKilled = exitStatus.OOMKilled
|
||||
close(s.waitStop) // fire waiters for stop
|
||||
s.waitStop = make(chan struct{})
|
||||
}
|
||||
|
||||
|
@ -310,8 +316,9 @@ func (s *State) SetRestarting(exitStatus *ExitStatus) {
|
|||
s.Paused = false
|
||||
s.Pid = 0
|
||||
s.FinishedAt = time.Now().UTC()
|
||||
s.setFromExitStatus(exitStatus)
|
||||
close(s.waitStop) // Fire waiters for stop
|
||||
s.ExitCodeValue = exitStatus.ExitCode
|
||||
s.OOMKilled = exitStatus.OOMKilled
|
||||
close(s.waitStop) // fire waiters for stop
|
||||
s.waitStop = make(chan struct{})
|
||||
}
|
||||
|
||||
|
|
|
@ -1,10 +0,0 @@
|
|||
// +build linux freebsd
|
||||
|
||||
package container
|
||||
|
||||
// setFromExitStatus is a platform specific helper function to set the state
|
||||
// based on the ExitStatus structure.
|
||||
func (s *State) setFromExitStatus(exitStatus *ExitStatus) {
|
||||
s.ExitCodeValue = exitStatus.ExitCode
|
||||
s.OOMKilled = exitStatus.OOMKilled
|
||||
}
|
|
@ -1,7 +0,0 @@
|
|||
package container
|
||||
|
||||
// setFromExitStatus is a platform specific helper function to set the state
|
||||
// based on the ExitStatus structure.
|
||||
func (s *State) setFromExitStatus(exitStatus *ExitStatus) {
|
||||
s.ExitCodeValue = exitStatus.ExitCode
|
||||
}
|
|
@ -114,12 +114,12 @@ func (c *Config) CloseStreams() error {
|
|||
}
|
||||
|
||||
// CopyToPipe connects streamconfig with a libcontainerd.IOPipe
|
||||
func (c *Config) CopyToPipe(iop libcontainerd.IOPipe) {
|
||||
func (c *Config) CopyToPipe(iop *libcontainerd.IOPipe) {
|
||||
copyFunc := func(w io.Writer, r io.ReadCloser) {
|
||||
c.Add(1)
|
||||
go func() {
|
||||
if _, err := pools.Copy(w, r); err != nil {
|
||||
logrus.Errorf("stream copy error: %+v", err)
|
||||
logrus.Errorf("stream copy error: %v", err)
|
||||
}
|
||||
r.Close()
|
||||
c.Done()
|
||||
|
@ -138,7 +138,7 @@ func (c *Config) CopyToPipe(iop libcontainerd.IOPipe) {
|
|||
go func() {
|
||||
pools.Copy(iop.Stdin, stdin)
|
||||
if err := iop.Stdin.Close(); err != nil {
|
||||
logrus.Warnf("failed to close stdin: %+v", err)
|
||||
logrus.Warnf("failed to close stdin: %v", err)
|
||||
}
|
||||
}()
|
||||
}
|
||||
|
|
|
@ -1,6 +1,7 @@
|
|||
package daemon
|
||||
|
||||
import (
|
||||
"context"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"io/ioutil"
|
||||
|
@ -17,7 +18,7 @@ var (
|
|||
)
|
||||
|
||||
// getCheckpointDir verifies checkpoint directory for create,remove, list options and checks if checkpoint already exists
|
||||
func getCheckpointDir(checkDir, checkpointID string, ctrName string, ctrID string, ctrCheckpointDir string, create bool) (string, error) {
|
||||
func getCheckpointDir(checkDir, checkpointID, ctrName, ctrID, ctrCheckpointDir string, create bool) (string, error) {
|
||||
var checkpointDir string
|
||||
var err2 error
|
||||
if checkDir != "" {
|
||||
|
@ -32,7 +33,10 @@ func getCheckpointDir(checkDir, checkpointID string, ctrName string, ctrID strin
|
|||
case err == nil && stat.IsDir():
|
||||
err2 = fmt.Errorf("checkpoint with name %s already exists for container %s", checkpointID, ctrName)
|
||||
case err != nil && os.IsNotExist(err):
|
||||
err2 = nil
|
||||
err2 = os.MkdirAll(checkpointAbsDir, 0700)
|
||||
if os.IsExist(err2) {
|
||||
err2 = nil
|
||||
}
|
||||
case err != nil:
|
||||
err2 = err
|
||||
case err == nil:
|
||||
|
@ -48,7 +52,7 @@ func getCheckpointDir(checkDir, checkpointID string, ctrName string, ctrID strin
|
|||
err2 = fmt.Errorf("%s exists and is not a directory", checkpointAbsDir)
|
||||
}
|
||||
}
|
||||
return checkpointDir, err2
|
||||
return checkpointAbsDir, err2
|
||||
}
|
||||
|
||||
// CheckpointCreate checkpoints the process running in a container with CRIU
|
||||
|
@ -62,6 +66,10 @@ func (daemon *Daemon) CheckpointCreate(name string, config types.CheckpointCreat
|
|||
return fmt.Errorf("Container %s not running", name)
|
||||
}
|
||||
|
||||
if container.Config.Tty {
|
||||
return fmt.Errorf("checkpoint not support on containers with tty")
|
||||
}
|
||||
|
||||
if !validCheckpointNamePattern.MatchString(config.CheckpointID) {
|
||||
return fmt.Errorf("Invalid checkpoint ID (%s), only %s are allowed", config.CheckpointID, validCheckpointNameChars)
|
||||
}
|
||||
|
@ -71,8 +79,9 @@ func (daemon *Daemon) CheckpointCreate(name string, config types.CheckpointCreat
|
|||
return fmt.Errorf("cannot checkpoint container %s: %s", name, err)
|
||||
}
|
||||
|
||||
err = daemon.containerd.CreateCheckpoint(container.ID, config.CheckpointID, checkpointDir, config.Exit)
|
||||
err = daemon.containerd.CreateCheckpoint(context.Background(), container.ID, checkpointDir, config.Exit)
|
||||
if err != nil {
|
||||
os.RemoveAll(checkpointDir)
|
||||
return fmt.Errorf("Cannot checkpoint container %s: %s", name, err)
|
||||
}
|
||||
|
||||
|
|
|
@ -101,6 +101,7 @@ type CommonConfig struct {
|
|||
RawLogs bool `json:"raw-logs,omitempty"`
|
||||
RootDeprecated string `json:"graph,omitempty"`
|
||||
Root string `json:"data-root,omitempty"`
|
||||
ExecRoot string `json:"exec-root,omitempty"`
|
||||
SocketGroup string `json:"group,omitempty"`
|
||||
CorsHeaders string `json:"api-cors-header,omitempty"`
|
||||
|
||||
|
@ -172,6 +173,10 @@ type CommonConfig struct {
|
|||
NodeGenericResources string `json:"node-generic-resources,omitempty"`
|
||||
// NetworkControlPlaneMTU allows to specify the control plane MTU, this will allow to optimize the network use in some components
|
||||
NetworkControlPlaneMTU int `json:"network-control-plane-mtu,omitempty"`
|
||||
|
||||
// ContainerAddr is the address used to connect to containerd if we're
|
||||
// not starting it ourselves
|
||||
ContainerdAddr string `json:"containerd,omitempty"`
|
||||
}
|
||||
|
||||
// IsValueSet returns true if a configuration value
|
||||
|
|
|
@ -11,8 +11,6 @@ import (
|
|||
// CommonUnixConfig defines configuration of a docker daemon that is
|
||||
// common across Unix platforms.
|
||||
type CommonUnixConfig struct {
|
||||
ExecRoot string `json:"exec-root,omitempty"`
|
||||
ContainerdAddr string `json:"containerd,omitempty"`
|
||||
Runtimes map[string]types.Runtime `json:"runtimes,omitempty"`
|
||||
DefaultRuntime string `json:"default-runtime,omitempty"`
|
||||
DefaultInitBinary string `json:"default-init,omitempty"`
|
||||
|
|
125
daemon/daemon.go
125
daemon/daemon.go
|
@ -18,7 +18,7 @@ import (
|
|||
"sync"
|
||||
"time"
|
||||
|
||||
containerd "github.com/containerd/containerd/api/grpc/types"
|
||||
"github.com/docker/docker/api/errdefs"
|
||||
"github.com/docker/docker/api/types"
|
||||
containertypes "github.com/docker/docker/api/types/container"
|
||||
"github.com/docker/docker/api/types/swarm"
|
||||
|
@ -62,11 +62,10 @@ import (
|
|||
"github.com/pkg/errors"
|
||||
)
|
||||
|
||||
var (
|
||||
// DefaultRuntimeBinary is the default runtime to be used by
|
||||
// containerd if none is specified
|
||||
DefaultRuntimeBinary = "docker-runc"
|
||||
// MainNamespace is the name of the namespace used for users containers
|
||||
const MainNamespace = "moby"
|
||||
|
||||
var (
|
||||
errSystemNotSupported = errors.New("the Docker daemon is not supported on this platform")
|
||||
)
|
||||
|
||||
|
@ -170,7 +169,7 @@ func (daemon *Daemon) restore() error {
|
|||
continue
|
||||
}
|
||||
container.RWLayer = rwlayer
|
||||
logrus.Debugf("Loaded container %v", container.ID)
|
||||
logrus.Debugf("Loaded container %v, isRunning: %v", container.ID, container.IsRunning())
|
||||
|
||||
containers[container.ID] = container
|
||||
} else {
|
||||
|
@ -209,8 +208,10 @@ func (daemon *Daemon) restore() error {
|
|||
}
|
||||
}
|
||||
|
||||
var wg sync.WaitGroup
|
||||
var mapLock sync.Mutex
|
||||
var (
|
||||
wg sync.WaitGroup
|
||||
mapLock sync.Mutex
|
||||
)
|
||||
for _, c := range containers {
|
||||
wg.Add(1)
|
||||
go func(c *container.Container) {
|
||||
|
@ -221,11 +222,74 @@ func (daemon *Daemon) restore() error {
|
|||
}
|
||||
|
||||
daemon.setStateCounter(c)
|
||||
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"container": c.ID,
|
||||
"running": c.IsRunning(),
|
||||
"paused": c.IsPaused(),
|
||||
}).Debug("restoring container")
|
||||
|
||||
var (
|
||||
err error
|
||||
alive bool
|
||||
ec uint32
|
||||
exitedAt time.Time
|
||||
)
|
||||
|
||||
alive, _, err = daemon.containerd.Restore(context.Background(), c.ID, c.InitializeStdio)
|
||||
if err != nil && !errdefs.IsNotFound(err) {
|
||||
logrus.Errorf("Failed to restore container %s with containerd: %s", c.ID, err)
|
||||
return
|
||||
}
|
||||
if !alive {
|
||||
ec, exitedAt, err = daemon.containerd.DeleteTask(context.Background(), c.ID)
|
||||
if err != nil && !errdefs.IsNotFound(err) {
|
||||
logrus.WithError(err).Errorf("Failed to delete container %s from containerd", c.ID)
|
||||
return
|
||||
}
|
||||
}
|
||||
|
||||
if c.IsRunning() || c.IsPaused() {
|
||||
c.RestartManager().Cancel() // manually start containers because some need to wait for swarm networking
|
||||
if err := daemon.containerd.Restore(c.ID, c.InitializeStdio); err != nil {
|
||||
logrus.Errorf("Failed to restore %s with containerd: %s", c.ID, err)
|
||||
return
|
||||
|
||||
if c.IsPaused() && alive {
|
||||
s, err := daemon.containerd.Status(context.Background(), c.ID)
|
||||
if err != nil {
|
||||
logrus.WithError(err).WithField("container", c.ID).
|
||||
Errorf("Failed to get container status")
|
||||
} else {
|
||||
logrus.WithField("container", c.ID).WithField("state", s).
|
||||
Info("restored container paused")
|
||||
switch s {
|
||||
case libcontainerd.StatusPaused, libcontainerd.StatusPausing:
|
||||
// nothing to do
|
||||
case libcontainerd.StatusStopped:
|
||||
alive = false
|
||||
case libcontainerd.StatusUnknown:
|
||||
logrus.WithField("container", c.ID).
|
||||
Error("Unknown status for container during restore")
|
||||
default:
|
||||
// running
|
||||
c.Lock()
|
||||
c.Paused = false
|
||||
daemon.setStateCounter(c)
|
||||
if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
||||
logrus.WithError(err).WithField("container", c.ID).
|
||||
Error("Failed to update stopped container state")
|
||||
}
|
||||
c.Unlock()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if !alive {
|
||||
c.Lock()
|
||||
c.SetStopped(&container.ExitStatus{ExitCode: int(ec), ExitedAt: exitedAt})
|
||||
daemon.Cleanup(c)
|
||||
if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
||||
logrus.Errorf("Failed to update stopped container %s state: %v", c.ID, err)
|
||||
}
|
||||
c.Unlock()
|
||||
}
|
||||
|
||||
// we call Mount and then Unmount to get BaseFs of the container
|
||||
|
@ -253,11 +317,9 @@ func (daemon *Daemon) restore() error {
|
|||
activeSandboxes[c.NetworkSettings.SandboxID] = options
|
||||
mapLock.Unlock()
|
||||
}
|
||||
} else {
|
||||
// get list of containers we need to restart
|
||||
|
||||
}
|
||||
// fixme: only if not running
|
||||
// get list of containers we need to restart
|
||||
if !c.IsRunning() && !c.IsPaused() {
|
||||
// Do not autostart containers which
|
||||
// has endpoints in a swarm scope
|
||||
// network yet since the cluster is
|
||||
|
@ -289,7 +351,7 @@ func (daemon *Daemon) restore() error {
|
|||
c.RemovalInProgress = false
|
||||
c.Dead = true
|
||||
if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
||||
logrus.Errorf("Failed to update container %s state: %v", c.ID, err)
|
||||
logrus.Errorf("Failed to update RemovalInProgress container %s state: %v", c.ID, err)
|
||||
}
|
||||
}
|
||||
c.Unlock()
|
||||
|
@ -569,6 +631,7 @@ func NewDaemon(config *config.Config, registryService registry.Service, containe
|
|||
|
||||
d := &Daemon{
|
||||
configStore: config,
|
||||
PluginStore: pluginStore,
|
||||
startupDone: make(chan struct{}),
|
||||
}
|
||||
// Ensure the daemon is properly shutdown if there is a failure during
|
||||
|
@ -616,6 +679,16 @@ func NewDaemon(config *config.Config, registryService registry.Service, containe
|
|||
return nil, err
|
||||
}
|
||||
|
||||
// Create the directory where we'll store the runtime scripts (i.e. in
|
||||
// order to support runtimeArgs)
|
||||
daemonRuntimes := filepath.Join(config.Root, "runtimes")
|
||||
if err := system.MkdirAll(daemonRuntimes, 0700, ""); err != nil && !os.IsExist(err) {
|
||||
return nil, err
|
||||
}
|
||||
if err := d.loadRuntimes(); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
if runtime.GOOS == "windows" {
|
||||
if err := system.MkdirAll(filepath.Join(config.Root, "credentialspecs"), 0, ""); err != nil && !os.IsExist(err) {
|
||||
return nil, err
|
||||
|
@ -645,7 +718,6 @@ func NewDaemon(config *config.Config, registryService registry.Service, containe
|
|||
}
|
||||
|
||||
d.RegistryService = registryService
|
||||
d.PluginStore = pluginStore
|
||||
logger.RegisterPluginGetter(d.PluginStore)
|
||||
|
||||
metricsSockPath, err := d.listenMetricsSock()
|
||||
|
@ -655,7 +727,7 @@ func NewDaemon(config *config.Config, registryService registry.Service, containe
|
|||
registerMetricsPluginCallback(d.PluginStore, metricsSockPath)
|
||||
|
||||
createPluginExec := func(m *plugin.Manager) (plugin.Executor, error) {
|
||||
return pluginexec.New(containerdRemote, m)
|
||||
return pluginexec.New(getPluginExecRoot(config.Root), containerdRemote, m)
|
||||
}
|
||||
|
||||
// Plugin system initialization should happen before restore. Do not change order.
|
||||
|
@ -812,13 +884,13 @@ func NewDaemon(config *config.Config, registryService registry.Service, containe
|
|||
d.idMappings = idMappings
|
||||
d.seccompEnabled = sysInfo.Seccomp
|
||||
d.apparmorEnabled = sysInfo.AppArmor
|
||||
d.containerdRemote = containerdRemote
|
||||
|
||||
d.linkIndex = newLinkIndex()
|
||||
d.containerdRemote = containerdRemote
|
||||
|
||||
go d.execCommandGC()
|
||||
|
||||
d.containerd, err = containerdRemote.Client(d)
|
||||
d.containerd, err = containerdRemote.NewClient(MainNamespace, d)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
@ -1181,19 +1253,6 @@ func (daemon *Daemon) networkOptions(dconfig *config.Config, pg plugingetter.Plu
|
|||
return options, nil
|
||||
}
|
||||
|
||||
func copyBlkioEntry(entries []*containerd.BlkioStatsEntry) []types.BlkioStatEntry {
|
||||
out := make([]types.BlkioStatEntry, len(entries))
|
||||
for i, re := range entries {
|
||||
out[i] = types.BlkioStatEntry{
|
||||
Major: re.Major,
|
||||
Minor: re.Minor,
|
||||
Op: re.Op,
|
||||
Value: re.Value,
|
||||
}
|
||||
}
|
||||
return out
|
||||
}
|
||||
|
||||
// GetCluster returns the cluster
|
||||
func (daemon *Daemon) GetCluster() Cluster {
|
||||
return daemon.cluster
|
||||
|
|
|
@ -5,6 +5,7 @@ package daemon
|
|||
import (
|
||||
"bufio"
|
||||
"bytes"
|
||||
"context"
|
||||
"fmt"
|
||||
"io/ioutil"
|
||||
"net"
|
||||
|
@ -16,6 +17,7 @@ import (
|
|||
"strings"
|
||||
"time"
|
||||
|
||||
containerd_cgroups "github.com/containerd/cgroups"
|
||||
"github.com/docker/docker/api/types"
|
||||
"github.com/docker/docker/api/types/blkiodev"
|
||||
pblkiodev "github.com/docker/docker/api/types/blkiodev"
|
||||
|
@ -26,6 +28,7 @@ import (
|
|||
"github.com/docker/docker/opts"
|
||||
"github.com/docker/docker/pkg/containerfs"
|
||||
"github.com/docker/docker/pkg/idtools"
|
||||
"github.com/docker/docker/pkg/ioutils"
|
||||
"github.com/docker/docker/pkg/parsers"
|
||||
"github.com/docker/docker/pkg/parsers/kernel"
|
||||
"github.com/docker/docker/pkg/sysinfo"
|
||||
|
@ -38,7 +41,6 @@ import (
|
|||
"github.com/docker/libnetwork/netutils"
|
||||
"github.com/docker/libnetwork/options"
|
||||
lntypes "github.com/docker/libnetwork/types"
|
||||
"github.com/golang/protobuf/ptypes"
|
||||
"github.com/opencontainers/runc/libcontainer/cgroups"
|
||||
rsystem "github.com/opencontainers/runc/libcontainer/system"
|
||||
specs "github.com/opencontainers/runtime-spec/specs-go"
|
||||
|
@ -50,6 +52,14 @@ import (
|
|||
)
|
||||
|
||||
const (
|
||||
// DefaultShimBinary is the default shim to be used by containerd if none
|
||||
// is specified
|
||||
DefaultShimBinary = "docker-containerd-shim"
|
||||
|
||||
// DefaultRuntimeBinary is the default runtime to be used by
|
||||
// containerd if none is specified
|
||||
DefaultRuntimeBinary = "docker-runc"
|
||||
|
||||
// See https://git.kernel.org/cgit/linux/kernel/git/tip/tip.git/tree/kernel/sched/sched.h?id=8cd9234c64c584432f6992fe944ca9e46ca8ea76#n269
|
||||
linuxMinCPUShares = 2
|
||||
linuxMaxCPUShares = 262144
|
||||
|
@ -63,6 +73,10 @@ const (
|
|||
// constant for cgroup drivers
|
||||
cgroupFsDriver = "cgroupfs"
|
||||
cgroupSystemdDriver = "systemd"
|
||||
|
||||
// DefaultRuntimeName is the default runtime to be used by
|
||||
// containerd if none is specified
|
||||
DefaultRuntimeName = "docker-runc"
|
||||
)
|
||||
|
||||
type containerGetter interface {
|
||||
|
@ -623,6 +637,54 @@ func verifyPlatformContainerSettings(daemon *Daemon, hostConfig *containertypes.
|
|||
return warnings, nil
|
||||
}
|
||||
|
||||
func (daemon *Daemon) loadRuntimes() error {
|
||||
return daemon.initRuntimes(daemon.configStore.Runtimes)
|
||||
}
|
||||
|
||||
func (daemon *Daemon) initRuntimes(runtimes map[string]types.Runtime) (err error) {
|
||||
runtimeDir := filepath.Join(daemon.configStore.Root, "runtimes")
|
||||
// Remove old temp directory if any
|
||||
os.RemoveAll(runtimeDir + "-old")
|
||||
tmpDir, err := ioutils.TempDir(daemon.configStore.Root, "gen-runtimes")
|
||||
if err != nil {
|
||||
return errors.Wrapf(err, "failed to get temp dir to generate runtime scripts")
|
||||
}
|
||||
defer func() {
|
||||
if err != nil {
|
||||
if err1 := os.RemoveAll(tmpDir); err1 != nil {
|
||||
logrus.WithError(err1).WithField("dir", tmpDir).
|
||||
Warnf("failed to remove tmp dir")
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
if err = os.Rename(runtimeDir, runtimeDir+"-old"); err != nil {
|
||||
return
|
||||
}
|
||||
if err = os.Rename(tmpDir, runtimeDir); err != nil {
|
||||
err = errors.Wrapf(err, "failed to setup runtimes dir, new containers may not start")
|
||||
return
|
||||
}
|
||||
if err = os.RemoveAll(runtimeDir + "-old"); err != nil {
|
||||
logrus.WithError(err).WithField("dir", tmpDir).
|
||||
Warnf("failed to remove old runtimes dir")
|
||||
}
|
||||
}()
|
||||
|
||||
for name, rt := range runtimes {
|
||||
if len(rt.Args) == 0 {
|
||||
continue
|
||||
}
|
||||
|
||||
script := filepath.Join(tmpDir, name)
|
||||
content := fmt.Sprintf("#!/bin/sh\n%s %s $@\n", rt.Path, strings.Join(rt.Args, " "))
|
||||
if err := ioutil.WriteFile(script, []byte(content), 0700); err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// reloadPlatform updates configuration with platform specific options
|
||||
// and updates the passed attributes
|
||||
func (daemon *Daemon) reloadPlatform(conf *config.Config, attributes map[string]string) error {
|
||||
|
@ -631,9 +693,12 @@ func (daemon *Daemon) reloadPlatform(conf *config.Config, attributes map[string]
|
|||
}
|
||||
|
||||
if conf.IsValueSet("runtimes") {
|
||||
daemon.configStore.Runtimes = conf.Runtimes
|
||||
// Always set the default one
|
||||
daemon.configStore.Runtimes[config.StockRuntimeName] = types.Runtime{Path: DefaultRuntimeBinary}
|
||||
conf.Runtimes[config.StockRuntimeName] = types.Runtime{Path: DefaultRuntimeBinary}
|
||||
if err := daemon.initRuntimes(conf.Runtimes); err != nil {
|
||||
return err
|
||||
}
|
||||
daemon.configStore.Runtimes = conf.Runtimes
|
||||
}
|
||||
|
||||
if conf.DefaultRuntime != "" {
|
||||
|
@ -692,7 +757,7 @@ func verifyDaemonSettings(conf *config.Config) error {
|
|||
if conf.Runtimes == nil {
|
||||
conf.Runtimes = make(map[string]types.Runtime)
|
||||
}
|
||||
conf.Runtimes[config.StockRuntimeName] = types.Runtime{Path: DefaultRuntimeBinary}
|
||||
conf.Runtimes[config.StockRuntimeName] = types.Runtime{Path: DefaultRuntimeName}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
@ -1214,11 +1279,24 @@ func (daemon *Daemon) conditionalUnmountOnCleanup(container *container.Container
|
|||
return daemon.Unmount(container)
|
||||
}
|
||||
|
||||
func copyBlkioEntry(entries []*containerd_cgroups.BlkIOEntry) []types.BlkioStatEntry {
|
||||
out := make([]types.BlkioStatEntry, len(entries))
|
||||
for i, re := range entries {
|
||||
out[i] = types.BlkioStatEntry{
|
||||
Major: re.Major,
|
||||
Minor: re.Minor,
|
||||
Op: re.Op,
|
||||
Value: re.Value,
|
||||
}
|
||||
}
|
||||
return out
|
||||
}
|
||||
|
||||
func (daemon *Daemon) stats(c *container.Container) (*types.StatsJSON, error) {
|
||||
if !c.IsRunning() {
|
||||
return nil, errNotRunning(c.ID)
|
||||
}
|
||||
stats, err := daemon.containerd.Stats(c.ID)
|
||||
cs, err := daemon.containerd.Stats(context.Background(), c.ID)
|
||||
if err != nil {
|
||||
if strings.Contains(err.Error(), "container not found") {
|
||||
return nil, containerNotFound(c.ID)
|
||||
|
@ -1226,54 +1304,98 @@ func (daemon *Daemon) stats(c *container.Container) (*types.StatsJSON, error) {
|
|||
return nil, err
|
||||
}
|
||||
s := &types.StatsJSON{}
|
||||
cgs := stats.CgroupStats
|
||||
if cgs != nil {
|
||||
s.Read = cs.Read
|
||||
stats := cs.Metrics
|
||||
if stats.Blkio != nil {
|
||||
s.BlkioStats = types.BlkioStats{
|
||||
IoServiceBytesRecursive: copyBlkioEntry(cgs.BlkioStats.IoServiceBytesRecursive),
|
||||
IoServicedRecursive: copyBlkioEntry(cgs.BlkioStats.IoServicedRecursive),
|
||||
IoQueuedRecursive: copyBlkioEntry(cgs.BlkioStats.IoQueuedRecursive),
|
||||
IoServiceTimeRecursive: copyBlkioEntry(cgs.BlkioStats.IoServiceTimeRecursive),
|
||||
IoWaitTimeRecursive: copyBlkioEntry(cgs.BlkioStats.IoWaitTimeRecursive),
|
||||
IoMergedRecursive: copyBlkioEntry(cgs.BlkioStats.IoMergedRecursive),
|
||||
IoTimeRecursive: copyBlkioEntry(cgs.BlkioStats.IoTimeRecursive),
|
||||
SectorsRecursive: copyBlkioEntry(cgs.BlkioStats.SectorsRecursive),
|
||||
IoServiceBytesRecursive: copyBlkioEntry(stats.Blkio.IoServiceBytesRecursive),
|
||||
IoServicedRecursive: copyBlkioEntry(stats.Blkio.IoServicedRecursive),
|
||||
IoQueuedRecursive: copyBlkioEntry(stats.Blkio.IoQueuedRecursive),
|
||||
IoServiceTimeRecursive: copyBlkioEntry(stats.Blkio.IoServiceTimeRecursive),
|
||||
IoWaitTimeRecursive: copyBlkioEntry(stats.Blkio.IoWaitTimeRecursive),
|
||||
IoMergedRecursive: copyBlkioEntry(stats.Blkio.IoMergedRecursive),
|
||||
IoTimeRecursive: copyBlkioEntry(stats.Blkio.IoTimeRecursive),
|
||||
SectorsRecursive: copyBlkioEntry(stats.Blkio.SectorsRecursive),
|
||||
}
|
||||
cpu := cgs.CpuStats
|
||||
}
|
||||
if stats.CPU != nil {
|
||||
s.CPUStats = types.CPUStats{
|
||||
CPUUsage: types.CPUUsage{
|
||||
TotalUsage: cpu.CpuUsage.TotalUsage,
|
||||
PercpuUsage: cpu.CpuUsage.PercpuUsage,
|
||||
UsageInKernelmode: cpu.CpuUsage.UsageInKernelmode,
|
||||
UsageInUsermode: cpu.CpuUsage.UsageInUsermode,
|
||||
TotalUsage: stats.CPU.Usage.Total,
|
||||
PercpuUsage: stats.CPU.Usage.PerCPU,
|
||||
UsageInKernelmode: stats.CPU.Usage.Kernel,
|
||||
UsageInUsermode: stats.CPU.Usage.User,
|
||||
},
|
||||
ThrottlingData: types.ThrottlingData{
|
||||
Periods: cpu.ThrottlingData.Periods,
|
||||
ThrottledPeriods: cpu.ThrottlingData.ThrottledPeriods,
|
||||
ThrottledTime: cpu.ThrottlingData.ThrottledTime,
|
||||
Periods: stats.CPU.Throttling.Periods,
|
||||
ThrottledPeriods: stats.CPU.Throttling.ThrottledPeriods,
|
||||
ThrottledTime: stats.CPU.Throttling.ThrottledTime,
|
||||
},
|
||||
}
|
||||
mem := cgs.MemoryStats.Usage
|
||||
s.MemoryStats = types.MemoryStats{
|
||||
Usage: mem.Usage,
|
||||
MaxUsage: mem.MaxUsage,
|
||||
Stats: cgs.MemoryStats.Stats,
|
||||
Failcnt: mem.Failcnt,
|
||||
Limit: mem.Limit,
|
||||
}
|
||||
// if the container does not set memory limit, use the machineMemory
|
||||
if mem.Limit > daemon.machineMemory && daemon.machineMemory > 0 {
|
||||
s.MemoryStats.Limit = daemon.machineMemory
|
||||
}
|
||||
if cgs.PidsStats != nil {
|
||||
s.PidsStats = types.PidsStats{
|
||||
Current: cgs.PidsStats.Current,
|
||||
}
|
||||
|
||||
if stats.Memory != nil {
|
||||
raw := make(map[string]uint64)
|
||||
raw["cache"] = stats.Memory.Cache
|
||||
raw["rss"] = stats.Memory.RSS
|
||||
raw["rss_huge"] = stats.Memory.RSSHuge
|
||||
raw["mapped_file"] = stats.Memory.MappedFile
|
||||
raw["dirty"] = stats.Memory.Dirty
|
||||
raw["writeback"] = stats.Memory.Writeback
|
||||
raw["pgpgin"] = stats.Memory.PgPgIn
|
||||
raw["pgpgout"] = stats.Memory.PgPgOut
|
||||
raw["pgfault"] = stats.Memory.PgFault
|
||||
raw["pgmajfault"] = stats.Memory.PgMajFault
|
||||
raw["inactive_anon"] = stats.Memory.InactiveAnon
|
||||
raw["active_anon"] = stats.Memory.ActiveAnon
|
||||
raw["inactive_file"] = stats.Memory.InactiveFile
|
||||
raw["active_file"] = stats.Memory.ActiveFile
|
||||
raw["unevictable"] = stats.Memory.Unevictable
|
||||
raw["hierarchical_memory_limit"] = stats.Memory.HierarchicalMemoryLimit
|
||||
raw["hierarchical_memsw_limit"] = stats.Memory.HierarchicalSwapLimit
|
||||
raw["total_cache"] = stats.Memory.TotalCache
|
||||
raw["total_rss"] = stats.Memory.TotalRSS
|
||||
raw["total_rss_huge"] = stats.Memory.TotalRSSHuge
|
||||
raw["total_mapped_file"] = stats.Memory.TotalMappedFile
|
||||
raw["total_dirty"] = stats.Memory.TotalDirty
|
||||
raw["total_writeback"] = stats.Memory.TotalWriteback
|
||||
raw["total_pgpgin"] = stats.Memory.TotalPgPgIn
|
||||
raw["total_pgpgout"] = stats.Memory.TotalPgPgOut
|
||||
raw["total_pgfault"] = stats.Memory.TotalPgFault
|
||||
raw["total_pgmajfault"] = stats.Memory.TotalPgMajFault
|
||||
raw["total_inactive_anon"] = stats.Memory.TotalInactiveAnon
|
||||
raw["total_active_anon"] = stats.Memory.TotalActiveAnon
|
||||
raw["total_inactive_file"] = stats.Memory.TotalInactiveFile
|
||||
raw["total_active_file"] = stats.Memory.TotalActiveFile
|
||||
raw["total_unevictable"] = stats.Memory.TotalUnevictable
|
||||
|
||||
if stats.Memory.Usage != nil {
|
||||
s.MemoryStats = types.MemoryStats{
|
||||
Stats: raw,
|
||||
Usage: stats.Memory.Usage.Usage,
|
||||
MaxUsage: stats.Memory.Usage.Max,
|
||||
Limit: stats.Memory.Usage.Limit,
|
||||
Failcnt: stats.Memory.Usage.Failcnt,
|
||||
}
|
||||
} else {
|
||||
s.MemoryStats = types.MemoryStats{
|
||||
Stats: raw,
|
||||
}
|
||||
}
|
||||
|
||||
// if the container does not set memory limit, use the machineMemory
|
||||
if s.MemoryStats.Limit > daemon.machineMemory && daemon.machineMemory > 0 {
|
||||
s.MemoryStats.Limit = daemon.machineMemory
|
||||
}
|
||||
}
|
||||
s.Read, err = ptypes.Timestamp(stats.Timestamp)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
|
||||
if stats.Pids != nil {
|
||||
s.PidsStats = types.PidsStats{
|
||||
Current: stats.Pids.Current,
|
||||
Limit: stats.Pids.Limit,
|
||||
}
|
||||
}
|
||||
|
||||
return s, nil
|
||||
}
|
||||
|
||||
|
|
|
@ -1,6 +1,7 @@
|
|||
package daemon
|
||||
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
"os"
|
||||
"path/filepath"
|
||||
|
@ -532,7 +533,7 @@ func (daemon *Daemon) stats(c *container.Container) (*types.StatsJSON, error) {
|
|||
}
|
||||
|
||||
// Obtain the stats from HCS via libcontainerd
|
||||
stats, err := daemon.containerd.Stats(c.ID)
|
||||
stats, err := daemon.containerd.Stats(context.Background(), c.ID)
|
||||
if err != nil {
|
||||
if strings.Contains(err.Error(), "container not found") {
|
||||
return nil, containerNotFound(c.ID)
|
||||
|
@ -542,49 +543,48 @@ func (daemon *Daemon) stats(c *container.Container) (*types.StatsJSON, error) {
|
|||
|
||||
// Start with an empty structure
|
||||
s := &types.StatsJSON{}
|
||||
|
||||
// Populate the CPU/processor statistics
|
||||
s.CPUStats = types.CPUStats{
|
||||
CPUUsage: types.CPUUsage{
|
||||
TotalUsage: stats.Processor.TotalRuntime100ns,
|
||||
UsageInKernelmode: stats.Processor.RuntimeKernel100ns,
|
||||
UsageInUsermode: stats.Processor.RuntimeKernel100ns,
|
||||
},
|
||||
}
|
||||
|
||||
// Populate the memory statistics
|
||||
s.MemoryStats = types.MemoryStats{
|
||||
Commit: stats.Memory.UsageCommitBytes,
|
||||
CommitPeak: stats.Memory.UsageCommitPeakBytes,
|
||||
PrivateWorkingSet: stats.Memory.UsagePrivateWorkingSetBytes,
|
||||
}
|
||||
|
||||
// Populate the storage statistics
|
||||
s.StorageStats = types.StorageStats{
|
||||
ReadCountNormalized: stats.Storage.ReadCountNormalized,
|
||||
ReadSizeBytes: stats.Storage.ReadSizeBytes,
|
||||
WriteCountNormalized: stats.Storage.WriteCountNormalized,
|
||||
WriteSizeBytes: stats.Storage.WriteSizeBytes,
|
||||
}
|
||||
|
||||
// Populate the network statistics
|
||||
s.Networks = make(map[string]types.NetworkStats)
|
||||
|
||||
for _, nstats := range stats.Network {
|
||||
s.Networks[nstats.EndpointId] = types.NetworkStats{
|
||||
RxBytes: nstats.BytesReceived,
|
||||
RxPackets: nstats.PacketsReceived,
|
||||
RxDropped: nstats.DroppedPacketsIncoming,
|
||||
TxBytes: nstats.BytesSent,
|
||||
TxPackets: nstats.PacketsSent,
|
||||
TxDropped: nstats.DroppedPacketsOutgoing,
|
||||
}
|
||||
}
|
||||
|
||||
// Set the timestamp
|
||||
s.Stats.Read = stats.Timestamp
|
||||
s.Stats.Read = stats.Read
|
||||
s.Stats.NumProcs = platform.NumProcs()
|
||||
|
||||
if stats.HCSStats != nil {
|
||||
hcss := stats.HCSStats
|
||||
// Populate the CPU/processor statistics
|
||||
s.CPUStats = types.CPUStats{
|
||||
CPUUsage: types.CPUUsage{
|
||||
TotalUsage: hcss.Processor.TotalRuntime100ns,
|
||||
UsageInKernelmode: hcss.Processor.RuntimeKernel100ns,
|
||||
UsageInUsermode: hcss.Processor.RuntimeKernel100ns,
|
||||
},
|
||||
}
|
||||
|
||||
// Populate the memory statistics
|
||||
s.MemoryStats = types.MemoryStats{
|
||||
Commit: hcss.Memory.UsageCommitBytes,
|
||||
CommitPeak: hcss.Memory.UsageCommitPeakBytes,
|
||||
PrivateWorkingSet: hcss.Memory.UsagePrivateWorkingSetBytes,
|
||||
}
|
||||
|
||||
// Populate the storage statistics
|
||||
s.StorageStats = types.StorageStats{
|
||||
ReadCountNormalized: hcss.Storage.ReadCountNormalized,
|
||||
ReadSizeBytes: hcss.Storage.ReadSizeBytes,
|
||||
WriteCountNormalized: hcss.Storage.WriteCountNormalized,
|
||||
WriteSizeBytes: hcss.Storage.WriteSizeBytes,
|
||||
}
|
||||
|
||||
// Populate the network statistics
|
||||
s.Networks = make(map[string]types.NetworkStats)
|
||||
for _, nstats := range hcss.Network {
|
||||
s.Networks[nstats.EndpointId] = types.NetworkStats{
|
||||
RxBytes: nstats.BytesReceived,
|
||||
RxPackets: nstats.PacketsReceived,
|
||||
RxDropped: nstats.DroppedPacketsIncoming,
|
||||
TxBytes: nstats.BytesSent,
|
||||
TxPackets: nstats.PacketsSent,
|
||||
TxDropped: nstats.DroppedPacketsOutgoing,
|
||||
}
|
||||
}
|
||||
}
|
||||
return s, nil
|
||||
}
|
||||
|
||||
|
@ -664,3 +664,11 @@ func getRealPath(path string) (string, error) {
|
|||
}
|
||||
return fileutils.ReadSymlinkedDirectory(path)
|
||||
}
|
||||
|
||||
func (daemon *Daemon) loadRuntimes() error {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (daemon *Daemon) initRuntimes(_ map[string]types.Runtime) error {
|
||||
return nil
|
||||
}
|
||||
|
|
|
@ -141,6 +141,7 @@ func (daemon *Daemon) cleanupContainer(container *container.Container, forceRemo
|
|||
}
|
||||
container.SetRemoved()
|
||||
stateCtr.del(container.ID)
|
||||
|
||||
daemon.LogContainerEvent(container, "destroy")
|
||||
return nil
|
||||
}
|
||||
|
|
|
@ -64,6 +64,11 @@ func errExecPaused(id string) error {
|
|||
return stateConflictError{cause}
|
||||
}
|
||||
|
||||
func errNotPaused(id string) error {
|
||||
cause := errors.Errorf("Container %s is already paused", id)
|
||||
return stateConflictError{cause}
|
||||
}
|
||||
|
||||
type nameConflictError struct {
|
||||
id string
|
||||
name string
|
||||
|
|
|
@ -13,10 +13,10 @@ import (
|
|||
"github.com/docker/docker/container"
|
||||
"github.com/docker/docker/container/stream"
|
||||
"github.com/docker/docker/daemon/exec"
|
||||
"github.com/docker/docker/libcontainerd"
|
||||
"github.com/docker/docker/pkg/pools"
|
||||
"github.com/docker/docker/pkg/signal"
|
||||
"github.com/docker/docker/pkg/term"
|
||||
specs "github.com/opencontainers/runtime-spec/specs-go"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
@ -31,6 +31,14 @@ func (d *Daemon) registerExecCommand(container *container.Container, config *exe
|
|||
d.execCommands.Add(config.ID, config)
|
||||
}
|
||||
|
||||
func (d *Daemon) registerExecPidUnlocked(container *container.Container, config *exec.Config) {
|
||||
logrus.Debugf("registering pid %v for exec %v", config.Pid, config.ID)
|
||||
// Storing execs in container in order to kill them gracefully whenever the container is stopped or removed.
|
||||
container.ExecCommands.SetPidUnlocked(config.ID, config.Pid)
|
||||
// Storing execs in daemon for easy access via Engine API.
|
||||
d.execCommands.SetPidUnlocked(config.ID, config.Pid)
|
||||
}
|
||||
|
||||
// ExecExists looks up the exec instance and returns a bool if it exists or not.
|
||||
// It will also return the error produced by `getConfig`
|
||||
func (d *Daemon) ExecExists(name string) (bool, error) {
|
||||
|
@ -70,8 +78,8 @@ func (d *Daemon) getExecConfig(name string) (*exec.Config, error) {
|
|||
}
|
||||
|
||||
func (d *Daemon) unregisterExecCommand(container *container.Container, execConfig *exec.Config) {
|
||||
container.ExecCommands.Delete(execConfig.ID)
|
||||
d.execCommands.Delete(execConfig.ID)
|
||||
container.ExecCommands.Delete(execConfig.ID, execConfig.Pid)
|
||||
d.execCommands.Delete(execConfig.ID, execConfig.Pid)
|
||||
}
|
||||
|
||||
func (d *Daemon) getActiveContainer(name string) (*container.Container, error) {
|
||||
|
@ -181,7 +189,7 @@ func (d *Daemon) ContainerExecStart(ctx context.Context, name string, stdin io.R
|
|||
logrus.Errorf("failed to cleanup exec %s streams: %s", c.ID, err)
|
||||
}
|
||||
ec.Unlock()
|
||||
c.ExecCommands.Delete(ec.ID)
|
||||
c.ExecCommands.Delete(ec.ID, ec.Pid)
|
||||
}
|
||||
}()
|
||||
|
||||
|
@ -207,13 +215,17 @@ func (d *Daemon) ContainerExecStart(ctx context.Context, name string, stdin io.R
|
|||
ec.StreamConfig.NewNopInputPipe()
|
||||
}
|
||||
|
||||
p := libcontainerd.Process{
|
||||
p := &specs.Process{
|
||||
Args: append([]string{ec.Entrypoint}, ec.Args...),
|
||||
Env: ec.Env,
|
||||
Terminal: ec.Tty,
|
||||
Cwd: c.Config.WorkingDir,
|
||||
}
|
||||
if p.Cwd == "" {
|
||||
p.Cwd = "/"
|
||||
}
|
||||
|
||||
if err := execSetPlatformOpt(c, ec, &p); err != nil {
|
||||
if err := d.execSetPlatformOpt(c, ec, p); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
|
@ -231,22 +243,28 @@ func (d *Daemon) ContainerExecStart(ctx context.Context, name string, stdin io.R
|
|||
ec.StreamConfig.AttachStreams(&attachConfig)
|
||||
attachErr := ec.StreamConfig.CopyStreams(ctx, &attachConfig)
|
||||
|
||||
systemPid, err := d.containerd.AddProcess(ctx, c.ID, name, p, ec.InitializeStdio)
|
||||
// Synchronize with libcontainerd event loop
|
||||
ec.Lock()
|
||||
c.ExecCommands.Lock()
|
||||
systemPid, err := d.containerd.Exec(ctx, c.ID, ec.ID, p, cStdin != nil, ec.InitializeStdio)
|
||||
if err != nil {
|
||||
c.ExecCommands.Unlock()
|
||||
ec.Unlock()
|
||||
return translateContainerdStartErr(ec.Entrypoint, ec.SetExitCode, err)
|
||||
}
|
||||
ec.Lock()
|
||||
ec.Pid = systemPid
|
||||
d.registerExecPidUnlocked(c, ec)
|
||||
c.ExecCommands.Unlock()
|
||||
ec.Unlock()
|
||||
|
||||
select {
|
||||
case <-ctx.Done():
|
||||
logrus.Debugf("Sending TERM signal to process %v in container %v", name, c.ID)
|
||||
d.containerd.SignalProcess(c.ID, name, int(signal.SignalMap["TERM"]))
|
||||
d.containerd.SignalProcess(ctx, c.ID, name, int(signal.SignalMap["TERM"]))
|
||||
select {
|
||||
case <-time.After(termProcessTimeout * time.Second):
|
||||
logrus.Infof("Container %v, process %v failed to exit within %d seconds of signal TERM - using the force", c.ID, name, termProcessTimeout)
|
||||
d.containerd.SignalProcess(c.ID, name, int(signal.SignalMap["KILL"]))
|
||||
d.containerd.SignalProcess(ctx, c.ID, name, int(signal.SignalMap["KILL"]))
|
||||
case <-attachErr:
|
||||
// TERM signal worked
|
||||
}
|
||||
|
@ -273,7 +291,7 @@ func (d *Daemon) execCommandGC() {
|
|||
for id, config := range d.execCommands.Commands() {
|
||||
if config.CanRemove {
|
||||
cleaned++
|
||||
d.execCommands.Delete(id)
|
||||
d.execCommands.Delete(id, config.Pid)
|
||||
} else {
|
||||
if _, exists := liveExecCommands[id]; !exists {
|
||||
config.CanRemove = true
|
||||
|
|
|
@ -4,6 +4,7 @@ import (
|
|||
"runtime"
|
||||
"sync"
|
||||
|
||||
"github.com/containerd/containerd"
|
||||
"github.com/docker/docker/container/stream"
|
||||
"github.com/docker/docker/libcontainerd"
|
||||
"github.com/docker/docker/pkg/stringid"
|
||||
|
@ -42,8 +43,26 @@ func NewConfig() *Config {
|
|||
}
|
||||
}
|
||||
|
||||
type cio struct {
|
||||
containerd.IO
|
||||
|
||||
sc *stream.Config
|
||||
}
|
||||
|
||||
func (i *cio) Close() error {
|
||||
i.IO.Close()
|
||||
|
||||
return i.sc.CloseStreams()
|
||||
}
|
||||
|
||||
func (i *cio) Wait() {
|
||||
i.sc.Wait()
|
||||
|
||||
i.IO.Wait()
|
||||
}
|
||||
|
||||
// InitializeStdio is called by libcontainerd to connect the stdio.
|
||||
func (c *Config) InitializeStdio(iop libcontainerd.IOPipe) error {
|
||||
func (c *Config) InitializeStdio(iop *libcontainerd.IOPipe) (containerd.IO, error) {
|
||||
c.StreamConfig.CopyToPipe(iop)
|
||||
|
||||
if c.StreamConfig.Stdin() == nil && !c.Tty && runtime.GOOS == "windows" {
|
||||
|
@ -54,7 +73,7 @@ func (c *Config) InitializeStdio(iop libcontainerd.IOPipe) error {
|
|||
}
|
||||
}
|
||||
|
||||
return nil
|
||||
return &cio{IO: iop, sc: c.StreamConfig}, nil
|
||||
}
|
||||
|
||||
// CloseStreams closes the stdio streams for the exec
|
||||
|
@ -69,45 +88,66 @@ func (c *Config) SetExitCode(code int) {
|
|||
|
||||
// Store keeps track of the exec configurations.
|
||||
type Store struct {
|
||||
commands map[string]*Config
|
||||
byID map[string]*Config
|
||||
byPid map[int]*Config
|
||||
sync.RWMutex
|
||||
}
|
||||
|
||||
// NewStore initializes a new exec store.
|
||||
func NewStore() *Store {
|
||||
return &Store{commands: make(map[string]*Config)}
|
||||
return &Store{
|
||||
byID: make(map[string]*Config),
|
||||
byPid: make(map[int]*Config),
|
||||
}
|
||||
}
|
||||
|
||||
// Commands returns the exec configurations in the store.
|
||||
func (e *Store) Commands() map[string]*Config {
|
||||
e.RLock()
|
||||
commands := make(map[string]*Config, len(e.commands))
|
||||
for id, config := range e.commands {
|
||||
commands[id] = config
|
||||
byID := make(map[string]*Config, len(e.byID))
|
||||
for id, config := range e.byID {
|
||||
byID[id] = config
|
||||
}
|
||||
e.RUnlock()
|
||||
return commands
|
||||
return byID
|
||||
}
|
||||
|
||||
// Add adds a new exec configuration to the store.
|
||||
func (e *Store) Add(id string, Config *Config) {
|
||||
e.Lock()
|
||||
e.commands[id] = Config
|
||||
e.byID[id] = Config
|
||||
e.Unlock()
|
||||
}
|
||||
|
||||
// SetPidUnlocked adds an association between a Pid and a config, it does not
|
||||
// synchronized with other operations.
|
||||
func (e *Store) SetPidUnlocked(id string, pid int) {
|
||||
if config, ok := e.byID[id]; ok {
|
||||
e.byPid[pid] = config
|
||||
}
|
||||
}
|
||||
|
||||
// Get returns an exec configuration by its id.
|
||||
func (e *Store) Get(id string) *Config {
|
||||
e.RLock()
|
||||
res := e.commands[id]
|
||||
res := e.byID[id]
|
||||
e.RUnlock()
|
||||
return res
|
||||
}
|
||||
|
||||
// ByPid returns an exec configuration by its pid.
|
||||
func (e *Store) ByPid(pid int) *Config {
|
||||
e.RLock()
|
||||
res := e.byPid[pid]
|
||||
e.RUnlock()
|
||||
return res
|
||||
}
|
||||
|
||||
// Delete removes an exec configuration from the store.
|
||||
func (e *Store) Delete(id string) {
|
||||
func (e *Store) Delete(id string, pid int) {
|
||||
e.Lock()
|
||||
delete(e.commands, id)
|
||||
delete(e.byPid, pid)
|
||||
delete(e.byID, id)
|
||||
e.Unlock()
|
||||
}
|
||||
|
||||
|
@ -115,7 +155,7 @@ func (e *Store) Delete(id string) {
|
|||
func (e *Store) List() []string {
|
||||
var IDs []string
|
||||
e.RLock()
|
||||
for id := range e.commands {
|
||||
for id := range e.byID {
|
||||
IDs = append(IDs, id)
|
||||
}
|
||||
e.RUnlock()
|
||||
|
|
|
@ -4,25 +4,30 @@ import (
|
|||
"github.com/docker/docker/container"
|
||||
"github.com/docker/docker/daemon/caps"
|
||||
"github.com/docker/docker/daemon/exec"
|
||||
"github.com/docker/docker/libcontainerd"
|
||||
"github.com/opencontainers/runc/libcontainer/apparmor"
|
||||
"github.com/opencontainers/runtime-spec/specs-go"
|
||||
)
|
||||
|
||||
func execSetPlatformOpt(c *container.Container, ec *exec.Config, p *libcontainerd.Process) error {
|
||||
func (daemon *Daemon) execSetPlatformOpt(c *container.Container, ec *exec.Config, p *specs.Process) error {
|
||||
if len(ec.User) > 0 {
|
||||
uid, gid, additionalGids, err := getUser(c, ec.User)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
p.User = &specs.User{
|
||||
p.User = specs.User{
|
||||
UID: uid,
|
||||
GID: gid,
|
||||
AdditionalGids: additionalGids,
|
||||
}
|
||||
}
|
||||
if ec.Privileged {
|
||||
p.Capabilities = caps.GetAllCapabilities()
|
||||
if p.Capabilities == nil {
|
||||
p.Capabilities = &specs.LinuxCapabilities{}
|
||||
}
|
||||
p.Capabilities.Bounding = caps.GetAllCapabilities()
|
||||
p.Capabilities.Permitted = p.Capabilities.Bounding
|
||||
p.Capabilities.Inheritable = p.Capabilities.Bounding
|
||||
p.Capabilities.Effective = p.Capabilities.Bounding
|
||||
}
|
||||
if apparmor.IsEnabled() {
|
||||
var appArmorProfile string
|
||||
|
@ -46,5 +51,6 @@ func execSetPlatformOpt(c *container.Container, ec *exec.Config, p *libcontainer
|
|||
}
|
||||
}
|
||||
}
|
||||
daemon.setRlimits(&specs.Spec{Process: p}, c)
|
||||
return nil
|
||||
}
|
||||
|
|
|
@ -3,9 +3,9 @@ package daemon
|
|||
import (
|
||||
"github.com/docker/docker/container"
|
||||
"github.com/docker/docker/daemon/exec"
|
||||
"github.com/docker/docker/libcontainerd"
|
||||
specs "github.com/opencontainers/runtime-spec/specs-go"
|
||||
)
|
||||
|
||||
func execSetPlatformOpt(c *container.Container, ec *exec.Config, p *libcontainerd.Process) error {
|
||||
func (daemon *Daemon) execSetPlatformOpt(_ *container.Container, _ *exec.Config, _ *specs.Process) error {
|
||||
return nil
|
||||
}
|
||||
|
|
|
@ -3,10 +3,10 @@ package daemon
|
|||
import (
|
||||
"github.com/docker/docker/container"
|
||||
"github.com/docker/docker/daemon/exec"
|
||||
"github.com/docker/docker/libcontainerd"
|
||||
specs "github.com/opencontainers/runtime-spec/specs-go"
|
||||
)
|
||||
|
||||
func execSetPlatformOpt(c *container.Container, ec *exec.Config, p *libcontainerd.Process) error {
|
||||
func (daemon *Daemon) execSetPlatformOpt(c *container.Container, ec *exec.Config, p *specs.Process) error {
|
||||
// Process arguments need to be escaped before sending to OCI.
|
||||
if c.OS == "windows" {
|
||||
p.Args = escapeArgs(p.Args)
|
||||
|
|
|
@ -3,7 +3,6 @@
|
|||
package daemon
|
||||
|
||||
import (
|
||||
"context"
|
||||
"os/exec"
|
||||
"strings"
|
||||
|
||||
|
@ -28,16 +27,8 @@ func (daemon *Daemon) FillPlatformInfo(v *types.Info, sysInfo *sysinfo.SysInfo)
|
|||
v.DefaultRuntime = daemon.configStore.GetDefaultRuntimeName()
|
||||
v.InitBinary = daemon.configStore.GetInitPath()
|
||||
|
||||
v.ContainerdCommit.Expected = dockerversion.ContainerdCommitID
|
||||
if sv, err := daemon.containerd.GetServerVersion(context.Background()); err == nil {
|
||||
v.ContainerdCommit.ID = sv.Revision
|
||||
} else {
|
||||
logrus.Warnf("failed to retrieve containerd version: %v", err)
|
||||
v.ContainerdCommit.ID = "N/A"
|
||||
}
|
||||
|
||||
v.RuncCommit.Expected = dockerversion.RuncCommitID
|
||||
defaultRuntimeBinary := daemon.configStore.GetRuntime(daemon.configStore.GetDefaultRuntimeName()).Path
|
||||
defaultRuntimeBinary := daemon.configStore.GetRuntime(v.DefaultRuntime).Path
|
||||
if rv, err := exec.Command(defaultRuntimeBinary, "--version").Output(); err == nil {
|
||||
parts := strings.Split(strings.TrimSpace(string(rv)), "\n")
|
||||
if len(parts) == 3 {
|
||||
|
@ -56,6 +47,24 @@ func (daemon *Daemon) FillPlatformInfo(v *types.Info, sysInfo *sysinfo.SysInfo)
|
|||
v.RuncCommit.ID = "N/A"
|
||||
}
|
||||
|
||||
v.ContainerdCommit.Expected = dockerversion.ContainerdCommitID
|
||||
if rv, err := exec.Command("docker-containerd", "--version").Output(); err == nil {
|
||||
parts := strings.Split(strings.TrimSpace(string(rv)), " ")
|
||||
if len(parts) == 3 {
|
||||
v.ContainerdCommit.ID = parts[2]
|
||||
}
|
||||
switch {
|
||||
case v.ContainerdCommit.ID == "":
|
||||
logrus.Warnf("failed to retrieve docker-containerd version: unknown format", string(rv))
|
||||
v.ContainerdCommit.ID = "N/A"
|
||||
case strings.HasSuffix(v.ContainerdCommit.ID, "-g"+v.ContainerdCommit.ID[len(v.ContainerdCommit.ID)-7:]):
|
||||
v.ContainerdCommit.ID = v.ContainerdCommit.Expected
|
||||
}
|
||||
} else {
|
||||
logrus.Warnf("failed to retrieve docker-containerd version: %v", err)
|
||||
v.ContainerdCommit.ID = "N/A"
|
||||
}
|
||||
|
||||
defaultInitBinary := daemon.configStore.GetInitPath()
|
||||
if rv, err := exec.Command(defaultInitBinary, "--version").Output(); err == nil {
|
||||
ver, err := parseInitVersion(string(rv))
|
||||
|
|
|
@ -9,6 +9,7 @@ import (
|
|||
"time"
|
||||
|
||||
containerpkg "github.com/docker/docker/container"
|
||||
"github.com/docker/docker/libcontainerd"
|
||||
"github.com/docker/docker/pkg/signal"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/sirupsen/logrus"
|
||||
|
@ -108,7 +109,7 @@ func (daemon *Daemon) killWithSignal(container *containerpkg.Container, sig int)
|
|||
|
||||
if unpause {
|
||||
// above kill signal will be sent once resume is finished
|
||||
if err := daemon.containerd.Resume(container.ID); err != nil {
|
||||
if err := daemon.containerd.Resume(context.Background(), container.ID); err != nil {
|
||||
logrus.Warn("Cannot unpause container %s: %s", container.ID, err)
|
||||
}
|
||||
}
|
||||
|
@ -177,5 +178,5 @@ func (daemon *Daemon) killPossiblyDeadProcess(container *containerpkg.Container,
|
|||
}
|
||||
|
||||
func (daemon *Daemon) kill(c *containerpkg.Container, sig int) error {
|
||||
return daemon.containerd.Signal(c.ID, sig)
|
||||
return daemon.containerd.SignalProcess(context.Background(), c.ID, libcontainerd.InitProcessName, sig)
|
||||
}
|
||||
|
|
|
@ -6,8 +6,8 @@ import (
|
|||
"context"
|
||||
"io"
|
||||
|
||||
"github.com/containerd/fifo"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/tonistiigi/fifo"
|
||||
"golang.org/x/sys/unix"
|
||||
)
|
||||
|
||||
|
|
|
@ -1,6 +1,7 @@
|
|||
package daemon
|
||||
|
||||
import (
|
||||
"context"
|
||||
"errors"
|
||||
"fmt"
|
||||
"runtime"
|
||||
|
@ -25,15 +26,15 @@ func (daemon *Daemon) setStateCounter(c *container.Container) {
|
|||
}
|
||||
}
|
||||
|
||||
// StateChanged updates daemon state changes from containerd
|
||||
func (daemon *Daemon) StateChanged(id string, e libcontainerd.StateInfo) error {
|
||||
c := daemon.containers.Get(id)
|
||||
if c == nil {
|
||||
// ProcessEvent is called by libcontainerd whenever an event occurs
|
||||
func (daemon *Daemon) ProcessEvent(id string, e libcontainerd.EventType, ei libcontainerd.EventInfo) error {
|
||||
c, err := daemon.GetContainer(id)
|
||||
if c == nil || err != nil {
|
||||
return fmt.Errorf("no such container: %s", id)
|
||||
}
|
||||
|
||||
switch e.State {
|
||||
case libcontainerd.StateOOM:
|
||||
switch e {
|
||||
case libcontainerd.EventOOM:
|
||||
// StateOOM is Linux specific and should never be hit on Windows
|
||||
if runtime.GOOS == "windows" {
|
||||
return errors.New("received StateOOM from libcontainerd on Windows. This should never happen")
|
||||
|
@ -43,63 +44,72 @@ func (daemon *Daemon) StateChanged(id string, e libcontainerd.StateInfo) error {
|
|||
return err
|
||||
}
|
||||
daemon.LogContainerEvent(c, "oom")
|
||||
case libcontainerd.StateExit:
|
||||
case libcontainerd.EventExit:
|
||||
if int(ei.Pid) == c.Pid {
|
||||
_, _, err := daemon.containerd.DeleteTask(context.Background(), c.ID)
|
||||
if err != nil {
|
||||
logrus.WithError(err).Warnf("failed to delete container %s from containerd", c.ID)
|
||||
}
|
||||
|
||||
c.Lock()
|
||||
c.StreamConfig.Wait()
|
||||
c.Reset(false)
|
||||
c.Lock()
|
||||
c.StreamConfig.Wait()
|
||||
c.Reset(false)
|
||||
|
||||
// If daemon is being shutdown, don't let the container restart
|
||||
restart, wait, err := c.RestartManager().ShouldRestart(e.ExitCode, daemon.IsShuttingDown() || c.HasBeenManuallyStopped, time.Since(c.StartedAt))
|
||||
if err == nil && restart {
|
||||
c.RestartCount++
|
||||
c.SetRestarting(platformConstructExitStatus(e))
|
||||
} else {
|
||||
c.SetStopped(platformConstructExitStatus(e))
|
||||
defer daemon.autoRemove(c)
|
||||
}
|
||||
exitStatus := container.ExitStatus{
|
||||
ExitCode: int(ei.ExitCode),
|
||||
ExitedAt: ei.ExitedAt,
|
||||
OOMKilled: ei.OOMKilled,
|
||||
}
|
||||
restart, wait, err := c.RestartManager().ShouldRestart(ei.ExitCode, daemon.IsShuttingDown() || c.HasBeenManuallyStopped, time.Since(c.StartedAt))
|
||||
if err == nil && restart {
|
||||
c.RestartCount++
|
||||
c.SetRestarting(&exitStatus)
|
||||
} else {
|
||||
c.SetStopped(&exitStatus)
|
||||
defer daemon.autoRemove(c)
|
||||
}
|
||||
|
||||
// cancel healthcheck here, they will be automatically
|
||||
// restarted if/when the container is started again
|
||||
daemon.stopHealthchecks(c)
|
||||
attributes := map[string]string{
|
||||
"exitCode": strconv.Itoa(int(e.ExitCode)),
|
||||
}
|
||||
daemon.LogContainerEventWithAttributes(c, "die", attributes)
|
||||
daemon.Cleanup(c)
|
||||
// cancel healthcheck here, they will be automatically
|
||||
// restarted if/when the container is started again
|
||||
daemon.stopHealthchecks(c)
|
||||
attributes := map[string]string{
|
||||
"exitCode": strconv.Itoa(int(ei.ExitCode)),
|
||||
}
|
||||
daemon.LogContainerEventWithAttributes(c, "die", attributes)
|
||||
daemon.Cleanup(c)
|
||||
|
||||
if err == nil && restart {
|
||||
go func() {
|
||||
err := <-wait
|
||||
if err == nil {
|
||||
// daemon.netController is initialized when daemon is restoring containers.
|
||||
// But containerStart will use daemon.netController segment.
|
||||
// So to avoid panic at startup process, here must wait util daemon restore done.
|
||||
daemon.waitForStartupDone()
|
||||
if err = daemon.containerStart(c, "", "", false); err != nil {
|
||||
logrus.Debugf("failed to restart container: %+v", err)
|
||||
if err == nil && restart {
|
||||
go func() {
|
||||
err := <-wait
|
||||
if err == nil {
|
||||
// daemon.netController is initialized when daemon is restoring containers.
|
||||
// But containerStart will use daemon.netController segment.
|
||||
// So to avoid panic at startup process, here must wait util daemon restore done.
|
||||
daemon.waitForStartupDone()
|
||||
if err = daemon.containerStart(c, "", "", false); err != nil {
|
||||
logrus.Debugf("failed to restart container: %+v", err)
|
||||
}
|
||||
}
|
||||
}
|
||||
if err != nil {
|
||||
c.SetStopped(platformConstructExitStatus(e))
|
||||
defer daemon.autoRemove(c)
|
||||
if err != restartmanager.ErrRestartCanceled {
|
||||
logrus.Errorf("restartmanger wait error: %+v", err)
|
||||
if err != nil {
|
||||
c.SetStopped(&exitStatus)
|
||||
defer daemon.autoRemove(c)
|
||||
if err != restartmanager.ErrRestartCanceled {
|
||||
logrus.Errorf("restartmanger wait error: %+v", err)
|
||||
}
|
||||
}
|
||||
}
|
||||
}()
|
||||
}()
|
||||
}
|
||||
|
||||
daemon.setStateCounter(c)
|
||||
defer c.Unlock()
|
||||
if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
||||
return err
|
||||
}
|
||||
return daemon.postRunProcessing(c, ei)
|
||||
}
|
||||
|
||||
daemon.setStateCounter(c)
|
||||
|
||||
defer c.Unlock()
|
||||
if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
||||
return err
|
||||
}
|
||||
return daemon.postRunProcessing(c, e)
|
||||
case libcontainerd.StateExitProcess:
|
||||
if execConfig := c.ExecCommands.Get(e.ProcessID); execConfig != nil {
|
||||
ec := int(e.ExitCode)
|
||||
if execConfig := c.ExecCommands.ByPid(int(ei.Pid)); execConfig != nil {
|
||||
ec := int(ei.ExitCode)
|
||||
execConfig.Lock()
|
||||
defer execConfig.Unlock()
|
||||
execConfig.ExitCode = &ec
|
||||
|
@ -111,42 +121,59 @@ func (daemon *Daemon) StateChanged(id string, e libcontainerd.StateInfo) error {
|
|||
|
||||
// remove the exec command from the container's store only and not the
|
||||
// daemon's store so that the exec command can be inspected.
|
||||
c.ExecCommands.Delete(execConfig.ID)
|
||||
c.ExecCommands.Delete(execConfig.ID, execConfig.Pid)
|
||||
} else {
|
||||
logrus.Warnf("Ignoring StateExitProcess for %v but no exec command found", e)
|
||||
logrus.WithFields(logrus.Fields{
|
||||
"container": c.ID,
|
||||
"exec-pid": ei.Pid,
|
||||
}).Warnf("Ignoring Exit Event, no such exec command found")
|
||||
}
|
||||
case libcontainerd.StateStart, libcontainerd.StateRestore:
|
||||
// Container is already locked in this case
|
||||
c.SetRunning(int(e.Pid), e.State == libcontainerd.StateStart)
|
||||
c.HasBeenManuallyStopped = false
|
||||
c.HasBeenStartedBefore = true
|
||||
daemon.setStateCounter(c)
|
||||
case libcontainerd.EventStart:
|
||||
c.Lock()
|
||||
defer c.Unlock()
|
||||
|
||||
daemon.initHealthMonitor(c)
|
||||
if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
||||
c.Reset(false)
|
||||
return err
|
||||
// This is here to handle start not generated by docker
|
||||
if !c.Running {
|
||||
c.SetRunning(int(ei.Pid), false)
|
||||
c.HasBeenManuallyStopped = false
|
||||
c.HasBeenStartedBefore = true
|
||||
daemon.setStateCounter(c)
|
||||
|
||||
daemon.initHealthMonitor(c)
|
||||
|
||||
if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
||||
return err
|
||||
}
|
||||
daemon.LogContainerEvent(c, "start")
|
||||
}
|
||||
|
||||
daemon.LogContainerEvent(c, "start")
|
||||
case libcontainerd.StatePause:
|
||||
// Container is already locked in this case
|
||||
c.Paused = true
|
||||
daemon.setStateCounter(c)
|
||||
daemon.updateHealthMonitor(c)
|
||||
if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
||||
return err
|
||||
case libcontainerd.EventPaused:
|
||||
c.Lock()
|
||||
defer c.Unlock()
|
||||
|
||||
if !c.Paused {
|
||||
c.Paused = true
|
||||
daemon.setStateCounter(c)
|
||||
daemon.updateHealthMonitor(c)
|
||||
if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
||||
return err
|
||||
}
|
||||
daemon.LogContainerEvent(c, "pause")
|
||||
}
|
||||
daemon.LogContainerEvent(c, "pause")
|
||||
case libcontainerd.StateResume:
|
||||
// Container is already locked in this case
|
||||
c.Paused = false
|
||||
daemon.setStateCounter(c)
|
||||
daemon.updateHealthMonitor(c)
|
||||
if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
||||
return err
|
||||
case libcontainerd.EventResumed:
|
||||
c.Lock()
|
||||
defer c.Unlock()
|
||||
|
||||
if c.Paused {
|
||||
c.Paused = false
|
||||
daemon.setStateCounter(c)
|
||||
daemon.updateHealthMonitor(c)
|
||||
|
||||
if err := c.CheckpointTo(daemon.containersReplica); err != nil {
|
||||
return err
|
||||
}
|
||||
daemon.LogContainerEvent(c, "unpause")
|
||||
}
|
||||
daemon.LogContainerEvent(c, "unpause")
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
|
|
@ -5,15 +5,7 @@ import (
|
|||
"github.com/docker/docker/libcontainerd"
|
||||
)
|
||||
|
||||
// platformConstructExitStatus returns a platform specific exit status structure
|
||||
func platformConstructExitStatus(e libcontainerd.StateInfo) *container.ExitStatus {
|
||||
return &container.ExitStatus{
|
||||
ExitCode: int(e.ExitCode),
|
||||
OOMKilled: e.OOMKilled,
|
||||
}
|
||||
}
|
||||
|
||||
// postRunProcessing perfoms any processing needed on the container after it has stopped.
|
||||
func (daemon *Daemon) postRunProcessing(container *container.Container, e libcontainerd.StateInfo) error {
|
||||
func (daemon *Daemon) postRunProcessing(_ *container.Container, _ libcontainerd.EventInfo) error {
|
||||
return nil
|
||||
}
|
||||
|
|
|
@ -5,14 +5,7 @@ import (
|
|||
"github.com/docker/docker/libcontainerd"
|
||||
)
|
||||
|
||||
// platformConstructExitStatus returns a platform specific exit status structure
|
||||
func platformConstructExitStatus(e libcontainerd.StateInfo) *container.ExitStatus {
|
||||
return &container.ExitStatus{
|
||||
ExitCode: int(e.ExitCode),
|
||||
}
|
||||
}
|
||||
|
||||
// postRunProcessing perfoms any processing needed on the container after it has stopped.
|
||||
func (daemon *Daemon) postRunProcessing(container *container.Container, e libcontainerd.StateInfo) error {
|
||||
func (daemon *Daemon) postRunProcessing(_ *container.Container, _ libcontainerd.EventInfo) error {
|
||||
return nil
|
||||
}
|
||||
|
|
|
@ -1,40 +1,52 @@
|
|||
package daemon
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"context"
|
||||
|
||||
"github.com/docker/docker/container"
|
||||
"github.com/docker/docker/libcontainerd"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// platformConstructExitStatus returns a platform specific exit status structure
|
||||
func platformConstructExitStatus(e libcontainerd.StateInfo) *container.ExitStatus {
|
||||
return &container.ExitStatus{
|
||||
ExitCode: int(e.ExitCode),
|
||||
}
|
||||
}
|
||||
|
||||
// postRunProcessing perfoms any processing needed on the container after it has stopped.
|
||||
func (daemon *Daemon) postRunProcessing(container *container.Container, e libcontainerd.StateInfo) error {
|
||||
if e.ExitCode == 0 && e.UpdatePending {
|
||||
spec, err := daemon.createSpec(container)
|
||||
// postRunProcessing starts a servicing container if required
|
||||
func (daemon *Daemon) postRunProcessing(c *container.Container, ei libcontainerd.EventInfo) error {
|
||||
if ei.ExitCode == 0 && ei.UpdatePending {
|
||||
spec, err := daemon.createSpec(c)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// Turn on servicing
|
||||
spec.Windows.Servicing = true
|
||||
|
||||
copts, err := daemon.getLibcontainerdCreateOptions(container)
|
||||
copts, err := daemon.getLibcontainerdCreateOptions(c)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// Create a new servicing container, which will start, complete the update, and merge back the
|
||||
// results if it succeeded, all as part of the below function call.
|
||||
if err := daemon.containerd.Create((container.ID + "_servicing"), "", "", *spec, container.InitializeStdio, copts...); err != nil {
|
||||
container.SetExitCode(-1)
|
||||
return fmt.Errorf("Post-run update servicing failed: %s", err)
|
||||
// Create a new servicing container, which will start, complete the
|
||||
// update, and merge back the results if it succeeded, all as part of
|
||||
// the below function call.
|
||||
ctx := context.Background()
|
||||
svcID := c.ID + "_servicing"
|
||||
logger := logrus.WithField("container", svcID)
|
||||
if err := daemon.containerd.Create(ctx, svcID, spec, copts); err != nil {
|
||||
c.SetExitCode(-1)
|
||||
return errors.Wrap(err, "post-run update servicing failed")
|
||||
}
|
||||
_, err = daemon.containerd.Start(ctx, svcID, "", false, nil)
|
||||
if err != nil {
|
||||
logger.WithError(err).Warn("failed to run servicing container")
|
||||
if err := daemon.containerd.Delete(ctx, svcID); err != nil {
|
||||
logger.WithError(err).Warn("failed to delete servicing container")
|
||||
}
|
||||
} else {
|
||||
if _, _, err := daemon.containerd.DeleteTask(ctx, svcID); err != nil {
|
||||
logger.WithError(err).Warn("failed to delete servicing container task")
|
||||
}
|
||||
if err := daemon.containerd.Delete(ctx, svcID); err != nil {
|
||||
logger.WithError(err).Warn("failed to delete servicing container")
|
||||
}
|
||||
}
|
||||
}
|
||||
return nil
|
||||
|
|
|
@ -156,7 +156,7 @@ func setDevices(s *specs.Spec, c *container.Container) error {
|
|||
return nil
|
||||
}
|
||||
|
||||
func setRlimits(daemon *Daemon, s *specs.Spec, c *container.Container) error {
|
||||
func (daemon *Daemon) setRlimits(s *specs.Spec, c *container.Container) error {
|
||||
var rlimits []specs.POSIXRlimit
|
||||
|
||||
// We want to leave the original HostConfig alone so make a copy here
|
||||
|
@ -755,6 +755,7 @@ func (daemon *Daemon) createSpec(c *container.Container) (*specs.Spec, error) {
|
|||
if err := setResources(&s, c.HostConfig.Resources); err != nil {
|
||||
return nil, fmt.Errorf("linux runtime spec resources: %v", err)
|
||||
}
|
||||
s.Process.OOMScoreAdj = &c.HostConfig.OomScoreAdj
|
||||
s.Linux.Sysctl = c.HostConfig.Sysctls
|
||||
|
||||
p := s.Linux.CgroupsPath
|
||||
|
@ -763,11 +764,11 @@ func (daemon *Daemon) createSpec(c *container.Container) (*specs.Spec, error) {
|
|||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
p, _ = cgroups.GetOwnCgroup("cpu")
|
||||
_, err = cgroups.GetOwnCgroup("cpu")
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
p = filepath.Join(initPath, p)
|
||||
p = filepath.Join(initPath, s.Linux.CgroupsPath)
|
||||
}
|
||||
|
||||
// Clean path to guard against things like ../../../BAD
|
||||
|
@ -782,7 +783,7 @@ func (daemon *Daemon) createSpec(c *container.Container) (*specs.Spec, error) {
|
|||
if err := setDevices(&s, c); err != nil {
|
||||
return nil, fmt.Errorf("linux runtime spec devices: %v", err)
|
||||
}
|
||||
if err := setRlimits(daemon, &s, c); err != nil {
|
||||
if err := daemon.setRlimits(&s, c); err != nil {
|
||||
return nil, fmt.Errorf("linux runtime spec rlimits: %v", err)
|
||||
}
|
||||
if err := setUser(&s, c); err != nil {
|
||||
|
|
|
@ -1,9 +1,11 @@
|
|||
package daemon
|
||||
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
|
||||
"github.com/docker/docker/container"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// ContainerPause pauses a container
|
||||
|
@ -33,7 +35,7 @@ func (daemon *Daemon) containerPause(container *container.Container) error {
|
|||
|
||||
// We cannot Pause the container which is already paused
|
||||
if container.Paused {
|
||||
return fmt.Errorf("Container %s is already paused", container.ID)
|
||||
return errNotPaused(container.ID)
|
||||
}
|
||||
|
||||
// We cannot Pause the container which is restarting
|
||||
|
@ -41,9 +43,18 @@ func (daemon *Daemon) containerPause(container *container.Container) error {
|
|||
return errContainerIsRestarting(container.ID)
|
||||
}
|
||||
|
||||
if err := daemon.containerd.Pause(container.ID); err != nil {
|
||||
if err := daemon.containerd.Pause(context.Background(), container.ID); err != nil {
|
||||
return fmt.Errorf("Cannot pause container %s: %s", container.ID, err)
|
||||
}
|
||||
|
||||
container.Paused = true
|
||||
daemon.setStateCounter(container)
|
||||
daemon.updateHealthMonitor(container)
|
||||
daemon.LogContainerEvent(container, "pause")
|
||||
|
||||
if err := container.CheckpointTo(daemon.containersReplica); err != nil {
|
||||
logrus.WithError(err).Warn("could not save container to disk")
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
|
|
@ -6,7 +6,6 @@ import (
|
|||
|
||||
"github.com/docker/docker/daemon/config"
|
||||
"github.com/docker/docker/daemon/discovery"
|
||||
"github.com/docker/docker/libcontainerd"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
|
@ -303,9 +302,6 @@ func (daemon *Daemon) reloadLiveRestore(conf *config.Config, attributes map[stri
|
|||
// update corresponding configuration
|
||||
if conf.IsValueSet("live-restore") {
|
||||
daemon.configStore.LiveRestoreEnabled = conf.LiveRestoreEnabled
|
||||
if err := daemon.containerdRemote.UpdateOptions(libcontainerd.WithLiveRestore(conf.LiveRestoreEnabled)); err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
|
||||
// prepare reload event attributes with updatable configurations
|
||||
|
|
|
@ -1,6 +1,7 @@
|
|||
package daemon
|
||||
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
|
||||
"github.com/docker/docker/libcontainerd"
|
||||
|
@ -18,7 +19,7 @@ func (daemon *Daemon) ContainerResize(name string, height, width int) error {
|
|||
return errNotRunning(container.ID)
|
||||
}
|
||||
|
||||
if err = daemon.containerd.Resize(container.ID, libcontainerd.InitFriendlyName, width, height); err == nil {
|
||||
if err = daemon.containerd.ResizeTerminal(context.Background(), container.ID, libcontainerd.InitProcessName, width, height); err == nil {
|
||||
attributes := map[string]string{
|
||||
"height": fmt.Sprintf("%d", height),
|
||||
"width": fmt.Sprintf("%d", width),
|
||||
|
@ -36,5 +37,5 @@ func (daemon *Daemon) ContainerExecResize(name string, height, width int) error
|
|||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return daemon.containerd.Resize(ec.ContainerID, ec.ID, width, height)
|
||||
return daemon.containerd.ResizeTerminal(context.Background(), ec.ContainerID, ec.ID, width, height)
|
||||
}
|
||||
|
|
|
@ -1,6 +1,7 @@
|
|||
package daemon
|
||||
|
||||
import (
|
||||
"context"
|
||||
"runtime"
|
||||
"time"
|
||||
|
||||
|
@ -113,6 +114,11 @@ func (daemon *Daemon) containerStart(container *container.Container, checkpoint
|
|||
return stateConflictError{errors.New("container is marked for removal and cannot be started")}
|
||||
}
|
||||
|
||||
if checkpointDir != "" {
|
||||
// TODO(mlaventure): how would we support that?
|
||||
return notAllowedError{errors.New("custom checkpointdir is not supported")}
|
||||
}
|
||||
|
||||
// if we encounter an error during start we need to ensure that any other
|
||||
// setup has been cleaned up properly
|
||||
defer func() {
|
||||
|
@ -152,28 +158,56 @@ func (daemon *Daemon) containerStart(container *container.Container, checkpoint
|
|||
return systemError{err}
|
||||
}
|
||||
|
||||
createOptions, err := daemon.getLibcontainerdCreateOptions(container)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if resetRestartManager {
|
||||
container.ResetRestartManager(true)
|
||||
}
|
||||
|
||||
if checkpointDir == "" {
|
||||
checkpointDir = container.CheckpointDir()
|
||||
}
|
||||
|
||||
if daemon.saveApparmorConfig(container); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if err := daemon.containerd.Create(container.ID, checkpoint, checkpointDir, *spec, container.InitializeStdio, createOptions...); err != nil {
|
||||
return translateContainerdStartErr(container.Path, container.SetExitCode, err)
|
||||
|
||||
if checkpoint != "" {
|
||||
checkpointDir, err = getCheckpointDir(checkpointDir, checkpoint, container.Name, container.ID, container.CheckpointDir(), false)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
|
||||
createOptions, err := daemon.getLibcontainerdCreateOptions(container)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
err = daemon.containerd.Create(context.Background(), container.ID, spec, createOptions)
|
||||
if err != nil {
|
||||
return translateContainerdStartErr(container.Path, container.SetExitCode, err)
|
||||
}
|
||||
|
||||
// TODO(mlaventure): we need to specify checkpoint options here
|
||||
pid, err := daemon.containerd.Start(context.Background(), container.ID, checkpointDir,
|
||||
container.StreamConfig.Stdin() != nil || container.Config.Tty,
|
||||
container.InitializeStdio)
|
||||
if err != nil {
|
||||
if err := daemon.containerd.Delete(context.Background(), container.ID); err != nil {
|
||||
logrus.WithError(err).WithField("container", container.ID).
|
||||
Error("failed to delete failed start container")
|
||||
}
|
||||
return translateContainerdStartErr(container.Path, container.SetExitCode, err)
|
||||
}
|
||||
|
||||
container.SetRunning(pid, true)
|
||||
container.HasBeenManuallyStopped = false
|
||||
container.HasBeenStartedBefore = true
|
||||
daemon.setStateCounter(container)
|
||||
|
||||
daemon.initHealthMonitor(container)
|
||||
|
||||
if err := container.CheckpointTo(daemon.containersReplica); err != nil {
|
||||
logrus.WithError(err).WithField("container", container.ID).
|
||||
Errorf("failed to store container")
|
||||
}
|
||||
|
||||
daemon.LogContainerEvent(container, "start")
|
||||
containerActions.WithValues("start").UpdateSince(start)
|
||||
|
||||
return nil
|
||||
|
@ -209,5 +243,10 @@ func (daemon *Daemon) Cleanup(container *container.Container) {
|
|||
logrus.Warnf("%s cleanup: Failed to umount volumes: %v", container.ID, err)
|
||||
}
|
||||
}
|
||||
|
||||
container.CancelAttachContext()
|
||||
|
||||
if err := daemon.containerd.Delete(context.Background(), container.ID); err != nil {
|
||||
logrus.Errorf("%s cleanup: failed to delete container from containerd: %v", container.ID, err)
|
||||
}
|
||||
}
|
||||
|
|
|
@ -3,29 +3,54 @@
|
|||
package daemon
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"os/exec"
|
||||
"path/filepath"
|
||||
|
||||
"github.com/containerd/containerd/linux/runcopts"
|
||||
"github.com/docker/docker/container"
|
||||
"github.com/docker/docker/libcontainerd"
|
||||
"github.com/pkg/errors"
|
||||
)
|
||||
|
||||
// getLibcontainerdCreateOptions callers must hold a lock on the container
|
||||
func (daemon *Daemon) getLibcontainerdCreateOptions(container *container.Container) ([]libcontainerd.CreateOption, error) {
|
||||
createOptions := []libcontainerd.CreateOption{}
|
||||
func (daemon *Daemon) getRuntimeScript(container *container.Container) (string, error) {
|
||||
name := container.HostConfig.Runtime
|
||||
rt := daemon.configStore.GetRuntime(name)
|
||||
if rt == nil {
|
||||
return "", validationError{errors.Errorf("no such runtime '%s'", name)}
|
||||
}
|
||||
|
||||
if len(rt.Args) > 0 {
|
||||
// First check that the target exist, as using it in a script won't
|
||||
// give us the right error
|
||||
if _, err := exec.LookPath(rt.Path); err != nil {
|
||||
return "", translateContainerdStartErr(container.Path, container.SetExitCode, err)
|
||||
}
|
||||
return filepath.Join(daemon.configStore.Root, "runtimes", name), nil
|
||||
}
|
||||
return rt.Path, nil
|
||||
}
|
||||
|
||||
// getLibcontainerdCreateOptions callers must hold a lock on the container
|
||||
func (daemon *Daemon) getLibcontainerdCreateOptions(container *container.Container) (interface{}, error) {
|
||||
// Ensure a runtime has been assigned to this container
|
||||
if container.HostConfig.Runtime == "" {
|
||||
container.HostConfig.Runtime = daemon.configStore.GetDefaultRuntimeName()
|
||||
container.CheckpointTo(daemon.containersReplica)
|
||||
}
|
||||
|
||||
rt := daemon.configStore.GetRuntime(container.HostConfig.Runtime)
|
||||
if rt == nil {
|
||||
return nil, validationError{errors.Errorf("no such runtime '%s'", container.HostConfig.Runtime)}
|
||||
path, err := daemon.getRuntimeScript(container)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
if UsingSystemd(daemon.configStore) {
|
||||
rt.Args = append(rt.Args, "--systemd-cgroup=true")
|
||||
opts := &runcopts.RuncOptions{
|
||||
Runtime: path,
|
||||
RuntimeRoot: filepath.Join(daemon.configStore.ExecRoot,
|
||||
fmt.Sprintf("runtime-%s", container.HostConfig.Runtime)),
|
||||
}
|
||||
createOptions = append(createOptions, libcontainerd.WithRuntime(rt.Path, rt.Args))
|
||||
|
||||
return createOptions, nil
|
||||
if UsingSystemd(daemon.configStore) {
|
||||
opts.SystemdCgroup = true
|
||||
}
|
||||
|
||||
return opts, nil
|
||||
}
|
||||
|
|
|
@ -3,12 +3,9 @@ package daemon
|
|||
import (
|
||||
"github.com/Microsoft/opengcs/client"
|
||||
"github.com/docker/docker/container"
|
||||
"github.com/docker/docker/libcontainerd"
|
||||
)
|
||||
|
||||
func (daemon *Daemon) getLibcontainerdCreateOptions(container *container.Container) ([]libcontainerd.CreateOption, error) {
|
||||
createOptions := []libcontainerd.CreateOption{}
|
||||
|
||||
func (daemon *Daemon) getLibcontainerdCreateOptions(container *container.Container) (interface{}, error) {
|
||||
// LCOW options.
|
||||
if container.OS == "linux" {
|
||||
config := &client.Config{}
|
||||
|
@ -33,11 +30,9 @@ func (daemon *Daemon) getLibcontainerdCreateOptions(container *container.Contain
|
|||
if err := config.Validate(); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
lcowOpts := &libcontainerd.LCOWOption{
|
||||
Config: config,
|
||||
}
|
||||
createOptions = append(createOptions, lcowOpts)
|
||||
|
||||
return config, nil
|
||||
}
|
||||
|
||||
return createOptions, nil
|
||||
return nil, nil
|
||||
}
|
||||
|
|
|
@ -3,6 +3,7 @@
|
|||
package daemon
|
||||
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
"os/exec"
|
||||
"regexp"
|
||||
|
@ -50,16 +51,16 @@ func appendProcess2ProcList(procList *container.ContainerTopOKBody, fields []str
|
|||
procList.Processes = append(procList.Processes, process)
|
||||
}
|
||||
|
||||
func hasPid(pids []int, pid int) bool {
|
||||
for _, i := range pids {
|
||||
if i == pid {
|
||||
func hasPid(procs []uint32, pid int) bool {
|
||||
for _, p := range procs {
|
||||
if int(p) == pid {
|
||||
return true
|
||||
}
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
func parsePSOutput(output []byte, pids []int) (*container.ContainerTopOKBody, error) {
|
||||
func parsePSOutput(output []byte, procs []uint32) (*container.ContainerTopOKBody, error) {
|
||||
procList := &container.ContainerTopOKBody{}
|
||||
|
||||
lines := strings.Split(string(output), "\n")
|
||||
|
@ -101,7 +102,7 @@ func parsePSOutput(output []byte, pids []int) (*container.ContainerTopOKBody, er
|
|||
return nil, fmt.Errorf("Unexpected pid '%s': %s", fields[pidIndex], err)
|
||||
}
|
||||
|
||||
if hasPid(pids, p) {
|
||||
if hasPid(procs, p) {
|
||||
preContainedPidFlag = true
|
||||
appendProcess2ProcList(procList, fields)
|
||||
continue
|
||||
|
@ -138,7 +139,7 @@ func (daemon *Daemon) ContainerTop(name string, psArgs string) (*container.Conta
|
|||
return nil, errContainerIsRestarting(container.ID)
|
||||
}
|
||||
|
||||
pids, err := daemon.containerd.GetPidsForContainer(container.ID)
|
||||
procs, err := daemon.containerd.ListPids(context.Background(), container.ID)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
@ -147,7 +148,7 @@ func (daemon *Daemon) ContainerTop(name string, psArgs string) (*container.Conta
|
|||
if err != nil {
|
||||
return nil, fmt.Errorf("Error running ps: %v", err)
|
||||
}
|
||||
procList, err := parsePSOutput(output, pids)
|
||||
procList, err := parsePSOutput(output, procs)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
|
|
@ -36,7 +36,7 @@ func TestContainerTopValidatePSArgs(t *testing.T) {
|
|||
func TestContainerTopParsePSOutput(t *testing.T) {
|
||||
tests := []struct {
|
||||
output []byte
|
||||
pids []int
|
||||
pids []uint32
|
||||
errExpected bool
|
||||
}{
|
||||
{[]byte(` PID COMMAND
|
||||
|
@ -44,26 +44,26 @@ func TestContainerTopParsePSOutput(t *testing.T) {
|
|||
43 bar
|
||||
- -
|
||||
100 baz
|
||||
`), []int{42, 43}, false},
|
||||
`), []uint32{42, 43}, false},
|
||||
{[]byte(` UID COMMAND
|
||||
42 foo
|
||||
43 bar
|
||||
- -
|
||||
100 baz
|
||||
`), []int{42, 43}, true},
|
||||
`), []uint32{42, 43}, true},
|
||||
// unicode space (U+2003, 0xe2 0x80 0x83)
|
||||
{[]byte(` PID COMMAND
|
||||
42 foo
|
||||
43 bar
|
||||
- -
|
||||
100 baz
|
||||
`), []int{42, 43}, true},
|
||||
`), []uint32{42, 43}, true},
|
||||
// the first space is U+2003, the second one is ascii.
|
||||
{[]byte(` PID COMMAND
|
||||
42 foo
|
||||
43 bar
|
||||
100 baz
|
||||
`), []int{42, 43}, true},
|
||||
`), []uint32{42, 43}, true},
|
||||
}
|
||||
|
||||
for _, f := range tests {
|
||||
|
|
|
@ -1,6 +1,7 @@
|
|||
package daemon
|
||||
|
||||
import (
|
||||
"context"
|
||||
"errors"
|
||||
"fmt"
|
||||
"time"
|
||||
|
@ -34,7 +35,15 @@ func (daemon *Daemon) ContainerTop(name string, psArgs string) (*containertypes.
|
|||
return nil, err
|
||||
}
|
||||
|
||||
s, err := daemon.containerd.Summary(container.ID)
|
||||
if !container.IsRunning() {
|
||||
return nil, errNotRunning(container.ID)
|
||||
}
|
||||
|
||||
if container.IsRestarting() {
|
||||
return nil, errContainerIsRestarting(container.ID)
|
||||
}
|
||||
|
||||
s, err := daemon.containerd.Summary(context.Background(), container.ID)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
@ -49,5 +58,6 @@ func (daemon *Daemon) ContainerTop(name string, psArgs string) (*containertypes.
|
|||
fmt.Sprintf("%02d:%02d:%02d.%03d", int(d.Hours()), int(d.Minutes())%60, int(d.Seconds())%60, int(d.Nanoseconds()/1000000)%1000),
|
||||
units.HumanSize(float64(j.MemoryWorkingSetPrivateBytes))})
|
||||
}
|
||||
|
||||
return procList, nil
|
||||
}
|
||||
|
|
|
@ -1,9 +1,11 @@
|
|||
package daemon
|
||||
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
|
||||
"github.com/docker/docker/container"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// ContainerUnpause unpauses a container
|
||||
|
@ -30,9 +32,18 @@ func (daemon *Daemon) containerUnpause(container *container.Container) error {
|
|||
return fmt.Errorf("Container %s is not paused", container.ID)
|
||||
}
|
||||
|
||||
if err := daemon.containerd.Resume(container.ID); err != nil {
|
||||
if err := daemon.containerd.Resume(context.Background(), container.ID); err != nil {
|
||||
return fmt.Errorf("Cannot unpause container %s: %s", container.ID, err)
|
||||
}
|
||||
|
||||
container.Paused = false
|
||||
daemon.setStateCounter(container)
|
||||
daemon.updateHealthMonitor(container)
|
||||
daemon.LogContainerEvent(container, "unpause")
|
||||
|
||||
if err := container.CheckpointTo(daemon.containersReplica); err != nil {
|
||||
logrus.WithError(err).Warnf("could not save container to disk")
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
|
|
@ -1,6 +1,7 @@
|
|||
package daemon
|
||||
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
|
||||
"github.com/docker/docker/api/types/container"
|
||||
|
@ -76,7 +77,7 @@ func (daemon *Daemon) update(name string, hostConfig *container.HostConfig) erro
|
|||
// If container is running (including paused), we need to update configs
|
||||
// to the real world.
|
||||
if container.IsRunning() && !container.IsRestarting() {
|
||||
if err := daemon.containerd.UpdateResources(container.ID, toContainerdResources(hostConfig.Resources)); err != nil {
|
||||
if err := daemon.containerd.UpdateResources(context.Background(), container.ID, toContainerdResources(hostConfig.Resources)); err != nil {
|
||||
restoreConfig = true
|
||||
// TODO: it would be nice if containerd responded with better errors here so we can classify this better.
|
||||
return errCannotUpdate(container.ID, systemError{err})
|
||||
|
|
|
@ -7,26 +7,43 @@ import (
|
|||
|
||||
"github.com/docker/docker/api/types/container"
|
||||
"github.com/docker/docker/libcontainerd"
|
||||
specs "github.com/opencontainers/runtime-spec/specs-go"
|
||||
)
|
||||
|
||||
func toContainerdResources(resources container.Resources) libcontainerd.Resources {
|
||||
func toContainerdResources(resources container.Resources) *libcontainerd.Resources {
|
||||
var r libcontainerd.Resources
|
||||
r.BlkioWeight = uint64(resources.BlkioWeight)
|
||||
r.CpuShares = uint64(resources.CPUShares)
|
||||
|
||||
r.BlockIO = &specs.LinuxBlockIO{
|
||||
Weight: &resources.BlkioWeight,
|
||||
}
|
||||
|
||||
shares := uint64(resources.CPUShares)
|
||||
r.CPU = &specs.LinuxCPU{
|
||||
Shares: &shares,
|
||||
Cpus: resources.CpusetCpus,
|
||||
Mems: resources.CpusetMems,
|
||||
}
|
||||
|
||||
var (
|
||||
period uint64
|
||||
quota int64
|
||||
)
|
||||
if resources.NanoCPUs != 0 {
|
||||
r.CpuPeriod = uint64(100 * time.Millisecond / time.Microsecond)
|
||||
r.CpuQuota = uint64(resources.NanoCPUs) * r.CpuPeriod / 1e9
|
||||
} else {
|
||||
r.CpuPeriod = uint64(resources.CPUPeriod)
|
||||
r.CpuQuota = uint64(resources.CPUQuota)
|
||||
period = uint64(100 * time.Millisecond / time.Microsecond)
|
||||
quota = resources.NanoCPUs * int64(period) / 1e9
|
||||
}
|
||||
r.CpusetCpus = resources.CpusetCpus
|
||||
r.CpusetMems = resources.CpusetMems
|
||||
r.MemoryLimit = uint64(resources.Memory)
|
||||
r.CPU.Period = &period
|
||||
r.CPU.Quota = "a
|
||||
|
||||
r.Memory = &specs.LinuxMemory{
|
||||
Limit: &resources.Memory,
|
||||
Reservation: &resources.MemoryReservation,
|
||||
Kernel: &resources.KernelMemory,
|
||||
}
|
||||
|
||||
if resources.MemorySwap > 0 {
|
||||
r.MemorySwap = uint64(resources.MemorySwap)
|
||||
r.Memory.Swap = &resources.MemorySwap
|
||||
}
|
||||
r.MemoryReservation = uint64(resources.MemoryReservation)
|
||||
r.KernelMemoryLimit = uint64(resources.KernelMemory)
|
||||
return r
|
||||
|
||||
return &r
|
||||
}
|
||||
|
|
|
@ -7,7 +7,7 @@ import (
|
|||
"github.com/docker/docker/libcontainerd"
|
||||
)
|
||||
|
||||
func toContainerdResources(resources container.Resources) libcontainerd.Resources {
|
||||
var r libcontainerd.Resources
|
||||
return r
|
||||
func toContainerdResources(resources container.Resources) *libcontainerd.Resources {
|
||||
// We don't support update, so do nothing
|
||||
return nil
|
||||
}
|
||||
|
|
|
@ -4,7 +4,7 @@ TOMLV_COMMIT=9baf8a8a9f2ed20a8e54160840c492f937eeaf9a
|
|||
|
||||
# When updating RUNC_COMMIT, also update runc in vendor.conf accordingly
|
||||
RUNC_COMMIT=0351df1c5a66838d0c392b4ac4cf9450de844e2d
|
||||
CONTAINERD_COMMIT=06b9cb35161009dcb7123345749fef02f7cea8e0
|
||||
CONTAINERD_COMMIT=992280e8e265f491f7a624ab82f3e238be086e49
|
||||
TINI_COMMIT=949e6facb77383876aeff8a6944dde66b3089574
|
||||
LIBNETWORK_COMMIT=7b2b1feb1de4817d522cc372af149ff48d25028e
|
||||
VNDR_COMMIT=a6e196d8b4b0cbbdc29aebdb20c59ac6926bb384
|
||||
|
|
|
@ -32,7 +32,10 @@ install_containerd() {
|
|||
git clone https://github.com/containerd/containerd.git "$GOPATH/src/github.com/containerd/containerd"
|
||||
cd "$GOPATH/src/github.com/containerd/containerd"
|
||||
git checkout -q "$CONTAINERD_COMMIT"
|
||||
make $1
|
||||
(
|
||||
export GOPATH
|
||||
make $1
|
||||
)
|
||||
cp bin/containerd /usr/local/bin/docker-containerd
|
||||
cp bin/containerd-shim /usr/local/bin/docker-containerd-shim
|
||||
cp bin/ctr /usr/local/bin/docker-containerd-ctr
|
||||
|
@ -103,7 +106,7 @@ do
|
|||
;;
|
||||
|
||||
containerd)
|
||||
install_containerd static
|
||||
install_containerd
|
||||
;;
|
||||
|
||||
containerd-dynamic)
|
||||
|
|
|
@ -17,6 +17,7 @@ const (
|
|||
Version string = "$VERSION"
|
||||
BuildTime string = "$BUILDTIME"
|
||||
IAmStatic string = "${IAMSTATIC:-true}"
|
||||
ContainerdCommitID string = "${CONTAINERD_COMMIT}"
|
||||
)
|
||||
|
||||
// AUTOGENERATED FILE; see /go/src/github.com/docker/docker/hack/make/.go-autogen
|
||||
|
@ -31,9 +32,8 @@ package dockerversion
|
|||
// Default build-time variable for library-import.
|
||||
// This file is overridden on build with build-time informations.
|
||||
const (
|
||||
ContainerdCommitID string = "${CONTAINERD_COMMIT}"
|
||||
RuncCommitID string = "${RUNC_COMMIT}"
|
||||
InitCommitID string = "${TINI_COMMIT}"
|
||||
RuncCommitID string = "${RUNC_COMMIT}"
|
||||
InitCommitID string = "${TINI_COMMIT}"
|
||||
)
|
||||
|
||||
// AUTOGENERATED FILE; see /go/src/github.com/docker/docker/hack/make/.go-autogen
|
||||
|
|
|
@ -222,7 +222,7 @@ func (d *Daemon) StartWithLogFile(out *os.File, providedArgs ...string) error {
|
|||
return errors.Wrapf(err, "[%s] could not find docker binary in $PATH", d.id)
|
||||
}
|
||||
args := append(d.GlobalFlags,
|
||||
"--containerd", "/var/run/docker/libcontainerd/docker-containerd.sock",
|
||||
"--containerd", "/var/run/docker/containerd/docker-containerd.sock",
|
||||
"--data-root", d.Root,
|
||||
"--exec-root", d.execRoot,
|
||||
"--pidfile", fmt.Sprintf("%s/docker.pid", d.Folder),
|
||||
|
@ -457,6 +457,8 @@ out2:
|
|||
return err
|
||||
}
|
||||
|
||||
d.cmd.Wait()
|
||||
|
||||
if err := os.Remove(fmt.Sprintf("%s/docker.pid", d.Folder)); err != nil {
|
||||
return err
|
||||
}
|
||||
|
|
|
@ -285,7 +285,7 @@ func (s *DockerSuite) TestAPIStatsNoStreamConnectedContainers(c *check.C) {
|
|||
id2 := strings.TrimSpace(out2)
|
||||
c.Assert(waitRun(id2), checker.IsNil)
|
||||
|
||||
ch := make(chan error)
|
||||
ch := make(chan error, 1)
|
||||
go func() {
|
||||
resp, body, err := request.Get(fmt.Sprintf("/containers/%s/stats?stream=false", id2))
|
||||
defer body.Close()
|
||||
|
|
|
@ -147,7 +147,10 @@ func (s *DockerSuite) TestAttachDisconnect(c *check.C) {
|
|||
c.Assert(err, check.IsNil)
|
||||
defer stdout.Close()
|
||||
c.Assert(cmd.Start(), check.IsNil)
|
||||
defer cmd.Process.Kill()
|
||||
defer func() {
|
||||
cmd.Process.Kill()
|
||||
cmd.Wait()
|
||||
}()
|
||||
|
||||
_, err = stdin.Write([]byte("hello\n"))
|
||||
c.Assert(err, check.IsNil)
|
||||
|
|
|
@ -149,6 +149,11 @@ func (s *DockerSuite) TestBuildCancellationKillsSleep(c *check.C) {
|
|||
if err := buildCmd.Start(); err != nil {
|
||||
c.Fatalf("failed to run build: %s", err)
|
||||
}
|
||||
// always clean up
|
||||
defer func() {
|
||||
buildCmd.Process.Kill()
|
||||
buildCmd.Wait()
|
||||
}()
|
||||
|
||||
matchCID := regexp.MustCompile("Running in (.+)")
|
||||
scanner := bufio.NewScanner(stdoutBuild)
|
||||
|
|
|
@ -28,6 +28,7 @@ import (
|
|||
"github.com/docker/docker/api"
|
||||
"github.com/docker/docker/api/types"
|
||||
"github.com/docker/docker/client"
|
||||
moby_daemon "github.com/docker/docker/daemon"
|
||||
"github.com/docker/docker/integration-cli/checker"
|
||||
"github.com/docker/docker/integration-cli/cli"
|
||||
"github.com/docker/docker/integration-cli/daemon"
|
||||
|
@ -48,6 +49,7 @@ import (
|
|||
func (s *DockerDaemonSuite) TestLegacyDaemonCommand(c *check.C) {
|
||||
cmd := exec.Command(dockerBinary, "daemon", "--storage-driver=vfs", "--debug")
|
||||
err := cmd.Start()
|
||||
go cmd.Wait()
|
||||
c.Assert(err, checker.IsNil, check.Commentf("could not start daemon using 'docker daemon'"))
|
||||
|
||||
c.Assert(cmd.Process.Kill(), checker.IsNil)
|
||||
|
@ -1448,7 +1450,8 @@ func (s *DockerDaemonSuite) TestCleanupMountsAfterDaemonAndContainerKill(c *chec
|
|||
c.Assert(strings.Contains(string(mountOut), id), check.Equals, true, comment)
|
||||
|
||||
// kill the container
|
||||
icmd.RunCommand(ctrBinary, "--address", "unix:///var/run/docker/libcontainerd/docker-containerd.sock", "containers", "kill", id).Assert(c, icmd.Success)
|
||||
icmd.RunCommand(ctrBinary, "--address", "/var/run/docker/containerd/docker-containerd.sock",
|
||||
"--namespace", moby_daemon.MainNamespace, "tasks", "kill", id).Assert(c, icmd.Success)
|
||||
|
||||
// restart daemon.
|
||||
d.Restart(c)
|
||||
|
@ -1987,7 +1990,6 @@ func (s *DockerDaemonSuite) TestDaemonRestartWithNames(c *check.C) {
|
|||
|
||||
// TestDaemonRestartWithKilledRunningContainer requires live restore of running containers
|
||||
func (s *DockerDaemonSuite) TestDaemonRestartWithKilledRunningContainer(t *check.C) {
|
||||
// TODO(mlaventure): Not sure what would the exit code be on windows
|
||||
testRequires(t, DaemonIsLinux)
|
||||
s.d.StartWithBusybox(t)
|
||||
|
||||
|
@ -2008,7 +2010,8 @@ func (s *DockerDaemonSuite) TestDaemonRestartWithKilledRunningContainer(t *check
|
|||
}
|
||||
|
||||
// kill the container
|
||||
icmd.RunCommand(ctrBinary, "--address", "unix:///var/run/docker/libcontainerd/docker-containerd.sock", "containers", "kill", cid).Assert(t, icmd.Success)
|
||||
icmd.RunCommand(ctrBinary, "--address", "/var/run/docker/containerd/docker-containerd.sock",
|
||||
"--namespace", moby_daemon.MainNamespace, "tasks", "kill", cid).Assert(t, icmd.Success)
|
||||
|
||||
// Give time to containerd to process the command if we don't
|
||||
// the exit event might be received after we do the inspect
|
||||
|
@ -2076,7 +2079,6 @@ func (s *DockerDaemonSuite) TestCleanupMountsAfterDaemonCrash(c *check.C) {
|
|||
|
||||
// TestDaemonRestartWithUnpausedRunningContainer requires live restore of running containers.
|
||||
func (s *DockerDaemonSuite) TestDaemonRestartWithUnpausedRunningContainer(t *check.C) {
|
||||
// TODO(mlaventure): Not sure what would the exit code be on windows
|
||||
testRequires(t, DaemonIsLinux)
|
||||
s.d.StartWithBusybox(t, "--live-restore")
|
||||
|
||||
|
@ -2103,8 +2105,9 @@ func (s *DockerDaemonSuite) TestDaemonRestartWithUnpausedRunningContainer(t *che
|
|||
// resume the container
|
||||
result := icmd.RunCommand(
|
||||
ctrBinary,
|
||||
"--address", "unix:///var/run/docker/libcontainerd/docker-containerd.sock",
|
||||
"containers", "resume", cid)
|
||||
"--address", "/var/run/docker/containerd/docker-containerd.sock",
|
||||
"--namespace", moby_daemon.MainNamespace,
|
||||
"tasks", "resume", cid)
|
||||
result.Assert(t, icmd.Success)
|
||||
|
||||
// Give time to containerd to process the command if we don't
|
||||
|
|
|
@ -86,6 +86,7 @@ func (s *DockerSuite) TestEventsLimit(c *check.C) {
|
|||
// timeouts creating so many containers simultaneously. This is a due to
|
||||
// a bug in the Windows platform. It will be fixed in a Windows Update.
|
||||
numContainers := 17
|
||||
eventPerContainer := 7 // create, attach, network connect, start, die, network disconnect, destroy
|
||||
numConcurrentContainers := numContainers
|
||||
if testEnv.DaemonPlatform() == "windows" {
|
||||
numConcurrentContainers = 4
|
||||
|
@ -93,17 +94,19 @@ func (s *DockerSuite) TestEventsLimit(c *check.C) {
|
|||
sem := make(chan bool, numConcurrentContainers)
|
||||
errChan := make(chan error, numContainers)
|
||||
|
||||
startTime := daemonUnixTime(c)
|
||||
|
||||
args := []string{"run", "--rm", "busybox", "true"}
|
||||
for i := 0; i < numContainers; i++ {
|
||||
sem <- true
|
||||
go func() {
|
||||
go func(i int) {
|
||||
defer func() { <-sem }()
|
||||
out, err := exec.Command(dockerBinary, args...).CombinedOutput()
|
||||
if err != nil {
|
||||
err = fmt.Errorf("%v: %s", err, string(out))
|
||||
}
|
||||
errChan <- err
|
||||
}()
|
||||
}(i)
|
||||
}
|
||||
|
||||
// Wait for all goroutines to finish
|
||||
|
@ -116,10 +119,10 @@ func (s *DockerSuite) TestEventsLimit(c *check.C) {
|
|||
c.Assert(err, checker.IsNil, check.Commentf("%q failed with error", strings.Join(args, " ")))
|
||||
}
|
||||
|
||||
out, _ := dockerCmd(c, "events", "--since=0", "--until", daemonUnixTime(c))
|
||||
out, _ := dockerCmd(c, "events", "--since="+startTime, "--until", daemonUnixTime(c))
|
||||
events := strings.Split(out, "\n")
|
||||
nEvents := len(events) - 1
|
||||
c.Assert(nEvents, checker.Equals, 256, check.Commentf("events should be limited to 256, but received %d", nEvents))
|
||||
c.Assert(nEvents, checker.Equals, numContainers*eventPerContainer, check.Commentf("events should be limited to 256, but received %d", nEvents))
|
||||
}
|
||||
|
||||
func (s *DockerSuite) TestEventsContainerEvents(c *check.C) {
|
||||
|
@ -533,7 +536,10 @@ func (s *DockerSuite) TestEventsAttach(c *check.C) {
|
|||
c.Assert(err, checker.IsNil)
|
||||
defer stdout.Close()
|
||||
c.Assert(cmd.Start(), checker.IsNil)
|
||||
defer cmd.Process.Kill()
|
||||
defer func() {
|
||||
cmd.Process.Kill()
|
||||
cmd.Wait()
|
||||
}()
|
||||
|
||||
// Make sure we're done attaching by writing/reading some stuff
|
||||
_, err = stdin.Write([]byte("hello\n"))
|
||||
|
|
|
@ -229,18 +229,18 @@ func (s *DockerSuite) TestExecStopNotHanging(c *check.C) {
|
|||
testRequires(c, DaemonIsLinux)
|
||||
dockerCmd(c, "run", "-d", "--name", "testing", "busybox", "top")
|
||||
|
||||
err := exec.Command(dockerBinary, "exec", "testing", "top").Start()
|
||||
c.Assert(err, checker.IsNil)
|
||||
result := icmd.StartCmd(icmd.Command(dockerBinary, "exec", "testing", "top"))
|
||||
result.Assert(c, icmd.Success)
|
||||
go icmd.WaitOnCmd(0, result)
|
||||
|
||||
type dstop struct {
|
||||
out []byte
|
||||
out string
|
||||
err error
|
||||
}
|
||||
|
||||
ch := make(chan dstop)
|
||||
go func() {
|
||||
out, err := exec.Command(dockerBinary, "stop", "testing").CombinedOutput()
|
||||
ch <- dstop{out, err}
|
||||
result := icmd.RunCommand(dockerBinary, "stop", "testing")
|
||||
ch <- dstop{result.Combined(), result.Error}
|
||||
close(ch)
|
||||
}()
|
||||
select {
|
||||
|
|
|
@ -230,6 +230,7 @@ func (s *DockerSuite) TestLogsFollowSlowStdoutConsumer(c *check.C) {
|
|||
stdout, err := logCmd.StdoutPipe()
|
||||
c.Assert(err, checker.IsNil)
|
||||
c.Assert(logCmd.Start(), checker.IsNil)
|
||||
defer func() { go logCmd.Wait() }()
|
||||
|
||||
// First read slowly
|
||||
bytes1, err := ConsumeWithSpeed(stdout, 10, 50*time.Millisecond, stopSlowRead)
|
||||
|
@ -279,6 +280,7 @@ func (s *DockerSuite) TestLogsFollowGoroutinesWithStdout(c *check.C) {
|
|||
r, w := io.Pipe()
|
||||
cmd.Stdout = w
|
||||
c.Assert(cmd.Start(), checker.IsNil)
|
||||
go cmd.Wait()
|
||||
|
||||
// Make sure pipe is written to
|
||||
chErr := make(chan error)
|
||||
|
@ -304,6 +306,7 @@ func (s *DockerSuite) TestLogsFollowGoroutinesNoOutput(c *check.C) {
|
|||
c.Assert(err, checker.IsNil)
|
||||
cmd := exec.Command(dockerBinary, "logs", "-f", id)
|
||||
c.Assert(cmd.Start(), checker.IsNil)
|
||||
go cmd.Wait()
|
||||
time.Sleep(200 * time.Millisecond)
|
||||
c.Assert(cmd.Process.Kill(), checker.IsNil)
|
||||
cmd.Wait()
|
||||
|
|
|
@ -1625,6 +1625,7 @@ func (s *DockerSuite) TestEmbeddedDNSInvalidInput(c *check.C) {
|
|||
func (s *DockerSuite) TestDockerNetworkConnectFailsNoInspectChange(c *check.C) {
|
||||
dockerCmd(c, "run", "-d", "--name=bb", "busybox", "top")
|
||||
c.Assert(waitRun("bb"), check.IsNil)
|
||||
defer dockerCmd(c, "stop", "bb")
|
||||
|
||||
ns0 := inspectField(c, "bb", "NetworkSettings.Networks.bridge")
|
||||
|
||||
|
|
|
@ -244,6 +244,7 @@ func (s *DockerHubPullSuite) TestPullClientDisconnect(c *check.C) {
|
|||
c.Assert(err, checker.IsNil)
|
||||
err = pullCmd.Start()
|
||||
c.Assert(err, checker.IsNil)
|
||||
go pullCmd.Wait()
|
||||
|
||||
// Cancel as soon as we get some output.
|
||||
buf := make([]byte, 10)
|
||||
|
|
|
@ -2249,6 +2249,7 @@ func (s *DockerSuite) TestRunSlowStdoutConsumer(c *check.C) {
|
|||
if err := cont.Start(); err != nil {
|
||||
c.Fatal(err)
|
||||
}
|
||||
defer func() { go cont.Wait() }()
|
||||
n, err := ConsumeWithSpeed(stdout, 10000, 5*time.Millisecond, nil)
|
||||
if err != nil {
|
||||
c.Fatal(err)
|
||||
|
|
|
@ -226,6 +226,7 @@ func (s *DockerSuite) TestRunAttachDetachFromInvalidFlag(c *check.C) {
|
|||
if err := cmd.Start(); err != nil {
|
||||
c.Fatal(err)
|
||||
}
|
||||
go cmd.Wait()
|
||||
|
||||
bufReader := bufio.NewReader(stdout)
|
||||
out, err := bufReader.ReadString('\n')
|
||||
|
@ -424,6 +425,7 @@ func (s *DockerSuite) TestRunAttachInvalidDetachKeySequencePreserved(c *check.C)
|
|||
if err := cmd.Start(); err != nil {
|
||||
c.Fatal(err)
|
||||
}
|
||||
go cmd.Wait()
|
||||
c.Assert(waitRun(name), check.IsNil)
|
||||
|
||||
// Invalid escape sequence aba, should print aba in output
|
||||
|
|
|
@ -172,6 +172,7 @@ func (s *DockerSwarmSuite) TestServiceLogsFollow(c *check.C) {
|
|||
cmd.Stdout = w
|
||||
cmd.Stderr = w
|
||||
c.Assert(cmd.Start(), checker.IsNil)
|
||||
go cmd.Wait()
|
||||
|
||||
// Make sure pipe is written to
|
||||
ch := make(chan *logMessage)
|
||||
|
|
|
@ -131,6 +131,7 @@ func (s *DockerSuite) TestStatsAllNewContainersAdded(c *check.C) {
|
|||
stdout, err := statsCmd.StdoutPipe()
|
||||
c.Assert(err, check.IsNil)
|
||||
c.Assert(statsCmd.Start(), check.IsNil)
|
||||
go statsCmd.Wait()
|
||||
defer statsCmd.Process.Kill()
|
||||
|
||||
go func() {
|
||||
|
|
|
@ -206,8 +206,10 @@ func (s *DockerSuite) TestDeprecatedPostContainersStartWithLinksInHostConfigIdLi
|
|||
testRequires(c, DaemonIsLinux)
|
||||
name := "test-host-config-links"
|
||||
out, _ := dockerCmd(c, "run", "--name", "link0", "-d", "busybox", "top")
|
||||
defer dockerCmd(c, "stop", "link0")
|
||||
id := strings.TrimSpace(out)
|
||||
dockerCmd(c, "create", "--name", name, "--link", id, "busybox", "top")
|
||||
defer dockerCmd(c, "stop", name)
|
||||
|
||||
hc := inspectFieldJSON(c, name, "HostConfig")
|
||||
config := `{"HostConfig":` + hc + `}`
|
||||
|
|
|
@ -69,7 +69,7 @@ func (e *eventObserver) Start() error {
|
|||
// Stop stops the events command.
|
||||
func (e *eventObserver) Stop() {
|
||||
e.command.Process.Kill()
|
||||
e.command.Process.Release()
|
||||
e.command.Wait()
|
||||
}
|
||||
|
||||
// Match tries to match the events output with a given matcher.
|
||||
|
|
|
@ -1,6 +1,7 @@
|
|||
package service
|
||||
|
||||
import (
|
||||
"runtime"
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
|
@ -42,8 +43,15 @@ func TestCreateWithLBSandbox(t *testing.T) {
|
|||
})
|
||||
require.NoError(t, err)
|
||||
|
||||
pollSettings := func(config *poll.Settings) {
|
||||
if runtime.GOARCH == "arm" {
|
||||
config.Timeout = 30 * time.Second
|
||||
config.Delay = 100 * time.Millisecond
|
||||
}
|
||||
}
|
||||
|
||||
serviceID := serviceResp.ID
|
||||
poll.WaitOn(t, serviceRunningTasksCount(client, serviceID, instances))
|
||||
poll.WaitOn(t, serviceRunningTasksCount(client, serviceID, instances), pollSettings)
|
||||
|
||||
_, _, err = client.ServiceInspectWithRaw(context.Background(), serviceID, types.ServiceInspectOptions{})
|
||||
require.NoError(t, err)
|
||||
|
@ -55,7 +63,7 @@ func TestCreateWithLBSandbox(t *testing.T) {
|
|||
err = client.ServiceRemove(context.Background(), serviceID)
|
||||
require.NoError(t, err)
|
||||
|
||||
poll.WaitOn(t, serviceIsRemoved(client, serviceID))
|
||||
poll.WaitOn(t, serviceIsRemoved(client, serviceID), pollSettings)
|
||||
err = client.NetworkRemove(context.Background(), overlayID)
|
||||
require.NoError(t, err)
|
||||
|
||||
|
|
|
@ -1,46 +0,0 @@
|
|||
package libcontainerd
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"sync"
|
||||
|
||||
"github.com/docker/docker/pkg/locker"
|
||||
)
|
||||
|
||||
// clientCommon contains the platform agnostic fields used in the client structure
|
||||
type clientCommon struct {
|
||||
backend Backend
|
||||
containers map[string]*container
|
||||
locker *locker.Locker
|
||||
mapMutex sync.RWMutex // protects read/write operations from containers map
|
||||
}
|
||||
|
||||
func (clnt *client) lock(containerID string) {
|
||||
clnt.locker.Lock(containerID)
|
||||
}
|
||||
|
||||
func (clnt *client) unlock(containerID string) {
|
||||
clnt.locker.Unlock(containerID)
|
||||
}
|
||||
|
||||
// must hold a lock for cont.containerID
|
||||
func (clnt *client) appendContainer(cont *container) {
|
||||
clnt.mapMutex.Lock()
|
||||
clnt.containers[cont.containerID] = cont
|
||||
clnt.mapMutex.Unlock()
|
||||
}
|
||||
func (clnt *client) deleteContainer(containerID string) {
|
||||
clnt.mapMutex.Lock()
|
||||
delete(clnt.containers, containerID)
|
||||
clnt.mapMutex.Unlock()
|
||||
}
|
||||
|
||||
func (clnt *client) getContainer(containerID string) (*container, error) {
|
||||
clnt.mapMutex.RLock()
|
||||
container, ok := clnt.containers[containerID]
|
||||
defer clnt.mapMutex.RUnlock()
|
||||
if !ok {
|
||||
return nil, fmt.Errorf("invalid container: %s", containerID) // fixme: typed error
|
||||
}
|
||||
return container, nil
|
||||
}
|
802
libcontainerd/client_daemon.go
Normal file
802
libcontainerd/client_daemon.go
Normal file
|
@ -0,0 +1,802 @@
|
|||
// +build !windows
|
||||
|
||||
package libcontainerd
|
||||
|
||||
import (
|
||||
"context"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"io"
|
||||
"os"
|
||||
"path/filepath"
|
||||
"reflect"
|
||||
"runtime"
|
||||
"strings"
|
||||
"sync"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"google.golang.org/grpc"
|
||||
|
||||
"github.com/containerd/containerd"
|
||||
eventsapi "github.com/containerd/containerd/api/services/events/v1"
|
||||
"github.com/containerd/containerd/api/types"
|
||||
"github.com/containerd/containerd/archive"
|
||||
"github.com/containerd/containerd/content"
|
||||
"github.com/containerd/containerd/images"
|
||||
"github.com/containerd/containerd/linux/runcopts"
|
||||
"github.com/containerd/typeurl"
|
||||
"github.com/docker/docker/pkg/ioutils"
|
||||
"github.com/opencontainers/image-spec/specs-go/v1"
|
||||
"github.com/opencontainers/runtime-spec/specs-go"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
// InitProcessName is the name given to the first process of a
|
||||
// container
|
||||
const InitProcessName = "init"
|
||||
|
||||
type container struct {
|
||||
sync.Mutex
|
||||
|
||||
bundleDir string
|
||||
ctr containerd.Container
|
||||
task containerd.Task
|
||||
execs map[string]containerd.Process
|
||||
oomKilled bool
|
||||
}
|
||||
|
||||
type client struct {
|
||||
sync.RWMutex // protects containers map
|
||||
|
||||
remote *containerd.Client
|
||||
stateDir string
|
||||
logger *logrus.Entry
|
||||
|
||||
namespace string
|
||||
backend Backend
|
||||
eventQ queue
|
||||
containers map[string]*container
|
||||
}
|
||||
|
||||
func (c *client) Restore(ctx context.Context, id string, attachStdio StdioCallback) (alive bool, pid int, err error) {
|
||||
c.Lock()
|
||||
defer c.Unlock()
|
||||
|
||||
var cio containerd.IO
|
||||
defer func() {
|
||||
err = wrapError(err)
|
||||
}()
|
||||
|
||||
ctr, err := c.remote.LoadContainer(ctx, id)
|
||||
if err != nil {
|
||||
return false, -1, errors.WithStack(err)
|
||||
}
|
||||
|
||||
defer func() {
|
||||
if err != nil && cio != nil {
|
||||
cio.Cancel()
|
||||
cio.Close()
|
||||
}
|
||||
}()
|
||||
|
||||
t, err := ctr.Task(ctx, func(fifos *containerd.FIFOSet) (containerd.IO, error) {
|
||||
io, err := newIOPipe(fifos)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
cio, err = attachStdio(io)
|
||||
return cio, err
|
||||
})
|
||||
if err != nil && !strings.Contains(err.Error(), "no running task found") {
|
||||
return false, -1, err
|
||||
}
|
||||
|
||||
if t != nil {
|
||||
s, err := t.Status(ctx)
|
||||
if err != nil {
|
||||
return false, -1, err
|
||||
}
|
||||
|
||||
alive = s.Status != containerd.Stopped
|
||||
pid = int(t.Pid())
|
||||
}
|
||||
c.containers[id] = &container{
|
||||
bundleDir: filepath.Join(c.stateDir, id),
|
||||
ctr: ctr,
|
||||
task: t,
|
||||
// TODO(mlaventure): load execs
|
||||
}
|
||||
|
||||
c.logger.WithFields(logrus.Fields{
|
||||
"container": id,
|
||||
"alive": alive,
|
||||
"pid": pid,
|
||||
}).Debug("restored container")
|
||||
|
||||
return alive, pid, nil
|
||||
}
|
||||
|
||||
func (c *client) Create(ctx context.Context, id string, ociSpec *specs.Spec, runtimeOptions interface{}) error {
|
||||
if ctr := c.getContainer(id); ctr != nil {
|
||||
return errors.WithStack(newConflictError("id already in use"))
|
||||
}
|
||||
|
||||
bdir, err := prepareBundleDir(filepath.Join(c.stateDir, id), ociSpec)
|
||||
if err != nil {
|
||||
return wrapSystemError(errors.Wrap(err, "prepare bundle dir failed"))
|
||||
}
|
||||
|
||||
c.logger.WithField("bundle", bdir).WithField("root", ociSpec.Root.Path).Debug("bundle dir created")
|
||||
|
||||
cdCtr, err := c.remote.NewContainer(ctx, id,
|
||||
containerd.WithSpec(ociSpec),
|
||||
// TODO(mlaventure): when containerd support lcow, revisit runtime value
|
||||
containerd.WithRuntime(fmt.Sprintf("io.containerd.runtime.v1.%s", runtime.GOOS), runtimeOptions))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
c.Lock()
|
||||
c.containers[id] = &container{
|
||||
bundleDir: bdir,
|
||||
ctr: cdCtr,
|
||||
}
|
||||
c.Unlock()
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Start create and start a task for the specified containerd id
|
||||
func (c *client) Start(ctx context.Context, id, checkpointDir string, withStdin bool, attachStdio StdioCallback) (int, error) {
|
||||
ctr := c.getContainer(id)
|
||||
switch {
|
||||
case ctr == nil:
|
||||
return -1, errors.WithStack(newNotFoundError("no such container"))
|
||||
case ctr.task != nil:
|
||||
return -1, errors.WithStack(newConflictError("container already started"))
|
||||
}
|
||||
|
||||
var (
|
||||
cp *types.Descriptor
|
||||
t containerd.Task
|
||||
cio containerd.IO
|
||||
err error
|
||||
stdinCloseSync = make(chan struct{})
|
||||
)
|
||||
|
||||
if checkpointDir != "" {
|
||||
// write checkpoint to the content store
|
||||
tar := archive.Diff(ctx, "", checkpointDir)
|
||||
cp, err = c.writeContent(ctx, images.MediaTypeContainerd1Checkpoint, checkpointDir, tar)
|
||||
// remove the checkpoint when we're done
|
||||
defer func() {
|
||||
if cp != nil {
|
||||
err := c.remote.ContentStore().Delete(context.Background(), cp.Digest)
|
||||
if err != nil {
|
||||
c.logger.WithError(err).WithFields(logrus.Fields{
|
||||
"ref": checkpointDir,
|
||||
"digest": cp.Digest,
|
||||
}).Warnf("failed to delete temporary checkpoint entry")
|
||||
}
|
||||
}
|
||||
}()
|
||||
if err := tar.Close(); err != nil {
|
||||
return -1, errors.Wrap(err, "failed to close checkpoint tar stream")
|
||||
}
|
||||
if err != nil {
|
||||
return -1, errors.Wrapf(err, "failed to upload checkpoint to containerd")
|
||||
}
|
||||
}
|
||||
|
||||
spec, err := ctr.ctr.Spec(ctx)
|
||||
if err != nil {
|
||||
return -1, errors.Wrap(err, "failed to retrieve spec")
|
||||
}
|
||||
uid, gid := getSpecUser(spec)
|
||||
t, err = ctr.ctr.NewTask(ctx,
|
||||
func(id string) (containerd.IO, error) {
|
||||
cio, err = c.createIO(ctr.bundleDir, id, InitProcessName, stdinCloseSync, withStdin, spec.Process.Terminal, attachStdio)
|
||||
return cio, err
|
||||
},
|
||||
func(_ context.Context, _ *containerd.Client, info *containerd.TaskInfo) error {
|
||||
info.Checkpoint = cp
|
||||
info.Options = &runcopts.CreateOptions{
|
||||
IoUid: uint32(uid),
|
||||
IoGid: uint32(gid),
|
||||
}
|
||||
return nil
|
||||
})
|
||||
if err != nil {
|
||||
close(stdinCloseSync)
|
||||
if cio != nil {
|
||||
cio.Cancel()
|
||||
cio.Close()
|
||||
}
|
||||
return -1, err
|
||||
}
|
||||
|
||||
c.Lock()
|
||||
c.containers[id].task = t
|
||||
c.Unlock()
|
||||
|
||||
// Signal c.createIO that it can call CloseIO
|
||||
close(stdinCloseSync)
|
||||
|
||||
if err := t.Start(ctx); err != nil {
|
||||
if _, err := t.Delete(ctx); err != nil {
|
||||
c.logger.WithError(err).WithField("container", id).
|
||||
Error("failed to delete task after fail start")
|
||||
}
|
||||
c.Lock()
|
||||
c.containers[id].task = nil
|
||||
c.Unlock()
|
||||
return -1, err
|
||||
}
|
||||
|
||||
return int(t.Pid()), nil
|
||||
}
|
||||
|
||||
func (c *client) Exec(ctx context.Context, containerID, processID string, spec *specs.Process, withStdin bool, attachStdio StdioCallback) (int, error) {
|
||||
ctr := c.getContainer(containerID)
|
||||
switch {
|
||||
case ctr == nil:
|
||||
return -1, errors.WithStack(newNotFoundError("no such container"))
|
||||
case ctr.task == nil:
|
||||
return -1, errors.WithStack(newInvalidParameterError("container is not running"))
|
||||
case ctr.execs != nil && ctr.execs[processID] != nil:
|
||||
return -1, errors.WithStack(newConflictError("id already in use"))
|
||||
}
|
||||
|
||||
var (
|
||||
p containerd.Process
|
||||
cio containerd.IO
|
||||
err error
|
||||
stdinCloseSync = make(chan struct{})
|
||||
)
|
||||
defer func() {
|
||||
if err != nil {
|
||||
if cio != nil {
|
||||
cio.Cancel()
|
||||
cio.Close()
|
||||
}
|
||||
}
|
||||
}()
|
||||
|
||||
p, err = ctr.task.Exec(ctx, processID, spec, func(id string) (containerd.IO, error) {
|
||||
cio, err = c.createIO(ctr.bundleDir, containerID, processID, stdinCloseSync, withStdin, spec.Terminal, attachStdio)
|
||||
return cio, err
|
||||
})
|
||||
if err != nil {
|
||||
close(stdinCloseSync)
|
||||
if cio != nil {
|
||||
cio.Cancel()
|
||||
cio.Close()
|
||||
}
|
||||
return -1, err
|
||||
}
|
||||
|
||||
ctr.Lock()
|
||||
if ctr.execs == nil {
|
||||
ctr.execs = make(map[string]containerd.Process)
|
||||
}
|
||||
ctr.execs[processID] = p
|
||||
ctr.Unlock()
|
||||
|
||||
// Signal c.createIO that it can call CloseIO
|
||||
close(stdinCloseSync)
|
||||
|
||||
if err = p.Start(ctx); err != nil {
|
||||
p.Delete(context.Background())
|
||||
ctr.Lock()
|
||||
delete(ctr.execs, processID)
|
||||
ctr.Unlock()
|
||||
return -1, err
|
||||
}
|
||||
|
||||
return int(p.Pid()), nil
|
||||
}
|
||||
|
||||
func (c *client) SignalProcess(ctx context.Context, containerID, processID string, signal int) error {
|
||||
p, err := c.getProcess(containerID, processID)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return p.Kill(ctx, syscall.Signal(signal))
|
||||
}
|
||||
|
||||
func (c *client) ResizeTerminal(ctx context.Context, containerID, processID string, width, height int) error {
|
||||
p, err := c.getProcess(containerID, processID)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return p.Resize(ctx, uint32(width), uint32(height))
|
||||
}
|
||||
|
||||
func (c *client) CloseStdin(ctx context.Context, containerID, processID string) error {
|
||||
p, err := c.getProcess(containerID, processID)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return p.CloseIO(ctx, containerd.WithStdinCloser)
|
||||
}
|
||||
|
||||
func (c *client) Pause(ctx context.Context, containerID string) error {
|
||||
p, err := c.getProcess(containerID, InitProcessName)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return p.(containerd.Task).Pause(ctx)
|
||||
}
|
||||
|
||||
func (c *client) Resume(ctx context.Context, containerID string) error {
|
||||
p, err := c.getProcess(containerID, InitProcessName)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return p.(containerd.Task).Resume(ctx)
|
||||
}
|
||||
|
||||
func (c *client) Stats(ctx context.Context, containerID string) (*Stats, error) {
|
||||
p, err := c.getProcess(containerID, InitProcessName)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
m, err := p.(containerd.Task).Metrics(ctx)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
v, err := typeurl.UnmarshalAny(m.Data)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return interfaceToStats(m.Timestamp, v), nil
|
||||
}
|
||||
|
||||
func (c *client) ListPids(ctx context.Context, containerID string) ([]uint32, error) {
|
||||
p, err := c.getProcess(containerID, InitProcessName)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
pis, err := p.(containerd.Task).Pids(ctx)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
var pids []uint32
|
||||
for _, i := range pis {
|
||||
pids = append(pids, i.Pid)
|
||||
}
|
||||
|
||||
return pids, nil
|
||||
}
|
||||
|
||||
func (c *client) Summary(ctx context.Context, containerID string) ([]Summary, error) {
|
||||
p, err := c.getProcess(containerID, InitProcessName)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
pis, err := p.(containerd.Task).Pids(ctx)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
var infos []Summary
|
||||
for _, pi := range pis {
|
||||
i, err := typeurl.UnmarshalAny(pi.Info)
|
||||
if err != nil {
|
||||
return nil, errors.Wrap(err, "unable to decode process details")
|
||||
}
|
||||
s, err := summaryFromInterface(i)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
infos = append(infos, *s)
|
||||
}
|
||||
|
||||
return infos, nil
|
||||
}
|
||||
|
||||
func (c *client) DeleteTask(ctx context.Context, containerID string) (uint32, time.Time, error) {
|
||||
p, err := c.getProcess(containerID, InitProcessName)
|
||||
if err != nil {
|
||||
return 255, time.Now(), nil
|
||||
}
|
||||
|
||||
status, err := p.(containerd.Task).Delete(ctx)
|
||||
if err != nil {
|
||||
return 255, time.Now(), nil
|
||||
}
|
||||
|
||||
c.Lock()
|
||||
if ctr, ok := c.containers[containerID]; ok {
|
||||
ctr.task = nil
|
||||
}
|
||||
c.Unlock()
|
||||
|
||||
return status.ExitCode(), status.ExitTime(), nil
|
||||
}
|
||||
|
||||
func (c *client) Delete(ctx context.Context, containerID string) error {
|
||||
ctr := c.getContainer(containerID)
|
||||
if ctr == nil {
|
||||
return errors.WithStack(newNotFoundError("no such container"))
|
||||
}
|
||||
|
||||
if err := ctr.ctr.Delete(ctx); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if os.Getenv("LIBCONTAINERD_NOCLEAN") == "1" {
|
||||
if err := os.RemoveAll(ctr.bundleDir); err != nil {
|
||||
c.logger.WithError(err).WithFields(logrus.Fields{
|
||||
"container": containerID,
|
||||
"bundle": ctr.bundleDir,
|
||||
}).Error("failed to remove state dir")
|
||||
}
|
||||
}
|
||||
|
||||
c.removeContainer(containerID)
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (c *client) Status(ctx context.Context, containerID string) (Status, error) {
|
||||
ctr := c.getContainer(containerID)
|
||||
if ctr == nil {
|
||||
return StatusUnknown, errors.WithStack(newNotFoundError("no such container"))
|
||||
}
|
||||
|
||||
s, err := ctr.task.Status(ctx)
|
||||
if err != nil {
|
||||
return StatusUnknown, err
|
||||
}
|
||||
|
||||
return Status(s.Status), nil
|
||||
}
|
||||
|
||||
func (c *client) CreateCheckpoint(ctx context.Context, containerID, checkpointDir string, exit bool) error {
|
||||
p, err := c.getProcess(containerID, InitProcessName)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
img, err := p.(containerd.Task).Checkpoint(ctx)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
// Whatever happens, delete the checkpoint from containerd
|
||||
defer func() {
|
||||
err := c.remote.ImageService().Delete(context.Background(), img.Name())
|
||||
if err != nil {
|
||||
c.logger.WithError(err).WithField("digest", img.Target().Digest).
|
||||
Warnf("failed to delete checkpoint image")
|
||||
}
|
||||
}()
|
||||
|
||||
b, err := content.ReadBlob(ctx, c.remote.ContentStore(), img.Target().Digest)
|
||||
if err != nil {
|
||||
return wrapSystemError(errors.Wrapf(err, "failed to retrieve checkpoint data"))
|
||||
}
|
||||
var index v1.Index
|
||||
if err := json.Unmarshal(b, &index); err != nil {
|
||||
return wrapSystemError(errors.Wrapf(err, "failed to decode checkpoint data"))
|
||||
}
|
||||
|
||||
var cpDesc *v1.Descriptor
|
||||
for _, m := range index.Manifests {
|
||||
if m.MediaType == images.MediaTypeContainerd1Checkpoint {
|
||||
cpDesc = &m
|
||||
break
|
||||
}
|
||||
}
|
||||
if cpDesc == nil {
|
||||
return wrapSystemError(errors.Wrapf(err, "invalid checkpoint"))
|
||||
}
|
||||
|
||||
rat, err := c.remote.ContentStore().ReaderAt(ctx, cpDesc.Digest)
|
||||
if err != nil {
|
||||
return wrapSystemError(errors.Wrapf(err, "failed to get checkpoint reader"))
|
||||
}
|
||||
defer rat.Close()
|
||||
_, err = archive.Apply(ctx, checkpointDir, content.NewReader(rat))
|
||||
if err != nil {
|
||||
return wrapSystemError(errors.Wrapf(err, "failed to read checkpoint reader"))
|
||||
}
|
||||
|
||||
return err
|
||||
}
|
||||
|
||||
func (c *client) getContainer(id string) *container {
|
||||
c.RLock()
|
||||
ctr := c.containers[id]
|
||||
c.RUnlock()
|
||||
|
||||
return ctr
|
||||
}
|
||||
|
||||
func (c *client) removeContainer(id string) {
|
||||
c.Lock()
|
||||
delete(c.containers, id)
|
||||
c.Unlock()
|
||||
}
|
||||
|
||||
func (c *client) getProcess(containerID, processID string) (containerd.Process, error) {
|
||||
ctr := c.getContainer(containerID)
|
||||
switch {
|
||||
case ctr == nil:
|
||||
return nil, errors.WithStack(newNotFoundError("no such container"))
|
||||
case ctr.task == nil:
|
||||
return nil, errors.WithStack(newNotFoundError("container is not running"))
|
||||
case processID == InitProcessName:
|
||||
return ctr.task, nil
|
||||
default:
|
||||
ctr.Lock()
|
||||
defer ctr.Unlock()
|
||||
if ctr.execs == nil {
|
||||
return nil, errors.WithStack(newNotFoundError("no execs"))
|
||||
}
|
||||
}
|
||||
|
||||
p := ctr.execs[processID]
|
||||
if p == nil {
|
||||
return nil, errors.WithStack(newNotFoundError("no such exec"))
|
||||
}
|
||||
|
||||
return p, nil
|
||||
}
|
||||
|
||||
// createIO creates the io to be used by a process
|
||||
// This needs to get a pointer to interface as upon closure the process may not have yet been registered
|
||||
func (c *client) createIO(bundleDir, containerID, processID string, stdinCloseSync chan struct{}, withStdin, withTerminal bool, attachStdio StdioCallback) (containerd.IO, error) {
|
||||
fifos := newFIFOSet(bundleDir, containerID, processID, withStdin, withTerminal)
|
||||
io, err := newIOPipe(fifos)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
if io.Stdin != nil {
|
||||
var (
|
||||
err error
|
||||
stdinOnce sync.Once
|
||||
)
|
||||
pipe := io.Stdin
|
||||
io.Stdin = ioutils.NewWriteCloserWrapper(pipe, func() error {
|
||||
stdinOnce.Do(func() {
|
||||
err = pipe.Close()
|
||||
// Do the rest in a new routine to avoid a deadlock if the
|
||||
// Exec/Start call failed.
|
||||
go func() {
|
||||
<-stdinCloseSync
|
||||
p, err := c.getProcess(containerID, processID)
|
||||
if err == nil {
|
||||
err = p.CloseIO(context.Background(), containerd.WithStdinCloser)
|
||||
if err != nil && strings.Contains(err.Error(), "transport is closing") {
|
||||
err = nil
|
||||
}
|
||||
}
|
||||
}()
|
||||
})
|
||||
return err
|
||||
})
|
||||
}
|
||||
|
||||
cio, err := attachStdio(io)
|
||||
if err != nil {
|
||||
io.Cancel()
|
||||
io.Close()
|
||||
}
|
||||
return cio, err
|
||||
}
|
||||
|
||||
func (c *client) processEvent(ctr *container, et EventType, ei EventInfo) {
|
||||
c.eventQ.append(ei.ContainerID, func() {
|
||||
err := c.backend.ProcessEvent(ei.ContainerID, et, ei)
|
||||
if err != nil {
|
||||
c.logger.WithError(err).WithFields(logrus.Fields{
|
||||
"container": ei.ContainerID,
|
||||
"event": et,
|
||||
"event-info": ei,
|
||||
}).Error("failed to process event")
|
||||
}
|
||||
|
||||
if et == EventExit && ei.ProcessID != ei.ContainerID {
|
||||
var p containerd.Process
|
||||
ctr.Lock()
|
||||
if ctr.execs != nil {
|
||||
p = ctr.execs[ei.ProcessID]
|
||||
}
|
||||
ctr.Unlock()
|
||||
if p == nil {
|
||||
c.logger.WithError(errors.New("no such process")).
|
||||
WithFields(logrus.Fields{
|
||||
"container": ei.ContainerID,
|
||||
"process": ei.ProcessID,
|
||||
}).Error("exit event")
|
||||
return
|
||||
}
|
||||
_, err = p.Delete(context.Background())
|
||||
if err != nil {
|
||||
c.logger.WithError(err).WithFields(logrus.Fields{
|
||||
"container": ei.ContainerID,
|
||||
"process": ei.ProcessID,
|
||||
}).Warn("failed to delete process")
|
||||
}
|
||||
c.Lock()
|
||||
delete(ctr.execs, ei.ProcessID)
|
||||
c.Unlock()
|
||||
}
|
||||
})
|
||||
}
|
||||
|
||||
func (c *client) processEventStream(ctx context.Context) {
|
||||
var (
|
||||
err error
|
||||
eventStream eventsapi.Events_SubscribeClient
|
||||
ev *eventsapi.Envelope
|
||||
et EventType
|
||||
ei EventInfo
|
||||
ctr *container
|
||||
)
|
||||
defer func() {
|
||||
if err != nil {
|
||||
select {
|
||||
case <-ctx.Done():
|
||||
c.logger.WithError(ctx.Err()).
|
||||
Info("stopping event stream following graceful shutdown")
|
||||
default:
|
||||
go c.processEventStream(ctx)
|
||||
}
|
||||
}
|
||||
}()
|
||||
|
||||
eventStream, err = c.remote.EventService().Subscribe(ctx, &eventsapi.SubscribeRequest{
|
||||
Filters: []string{"namespace==" + c.namespace + ",topic~=/tasks/.+"},
|
||||
}, grpc.FailFast(false))
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
|
||||
var oomKilled bool
|
||||
for {
|
||||
ev, err = eventStream.Recv()
|
||||
if err != nil {
|
||||
c.logger.WithError(err).Error("failed to get event")
|
||||
return
|
||||
}
|
||||
|
||||
if ev.Event == nil {
|
||||
c.logger.WithField("event", ev).Warn("invalid event")
|
||||
continue
|
||||
}
|
||||
|
||||
v, err := typeurl.UnmarshalAny(ev.Event)
|
||||
if err != nil {
|
||||
c.logger.WithError(err).WithField("event", ev).Warn("failed to unmarshal event")
|
||||
continue
|
||||
}
|
||||
|
||||
c.logger.WithField("topic", ev.Topic).Debug("event")
|
||||
|
||||
switch t := v.(type) {
|
||||
case *eventsapi.TaskCreate:
|
||||
et = EventCreate
|
||||
ei = EventInfo{
|
||||
ContainerID: t.ContainerID,
|
||||
ProcessID: t.ContainerID,
|
||||
Pid: t.Pid,
|
||||
}
|
||||
case *eventsapi.TaskStart:
|
||||
et = EventStart
|
||||
ei = EventInfo{
|
||||
ContainerID: t.ContainerID,
|
||||
ProcessID: t.ContainerID,
|
||||
Pid: t.Pid,
|
||||
}
|
||||
case *eventsapi.TaskExit:
|
||||
et = EventExit
|
||||
ei = EventInfo{
|
||||
ContainerID: t.ContainerID,
|
||||
ProcessID: t.ID,
|
||||
Pid: t.Pid,
|
||||
ExitCode: t.ExitStatus,
|
||||
ExitedAt: t.ExitedAt,
|
||||
}
|
||||
case *eventsapi.TaskOOM:
|
||||
et = EventOOM
|
||||
ei = EventInfo{
|
||||
ContainerID: t.ContainerID,
|
||||
OOMKilled: true,
|
||||
}
|
||||
oomKilled = true
|
||||
case *eventsapi.TaskExecAdded:
|
||||
et = EventExecAdded
|
||||
ei = EventInfo{
|
||||
ContainerID: t.ContainerID,
|
||||
ProcessID: t.ExecID,
|
||||
}
|
||||
case *eventsapi.TaskExecStarted:
|
||||
et = EventExecStarted
|
||||
ei = EventInfo{
|
||||
ContainerID: t.ContainerID,
|
||||
ProcessID: t.ExecID,
|
||||
Pid: t.Pid,
|
||||
}
|
||||
case *eventsapi.TaskPaused:
|
||||
et = EventPaused
|
||||
ei = EventInfo{
|
||||
ContainerID: t.ContainerID,
|
||||
}
|
||||
case *eventsapi.TaskResumed:
|
||||
et = EventResumed
|
||||
ei = EventInfo{
|
||||
ContainerID: t.ContainerID,
|
||||
}
|
||||
default:
|
||||
c.logger.WithFields(logrus.Fields{
|
||||
"topic": ev.Topic,
|
||||
"type": reflect.TypeOf(t)},
|
||||
).Info("ignoring event")
|
||||
continue
|
||||
}
|
||||
|
||||
ctr = c.getContainer(ei.ContainerID)
|
||||
if ctr == nil {
|
||||
c.logger.WithField("container", ei.ContainerID).Warn("unknown container")
|
||||
continue
|
||||
}
|
||||
|
||||
if oomKilled {
|
||||
ctr.oomKilled = true
|
||||
oomKilled = false
|
||||
}
|
||||
ei.OOMKilled = ctr.oomKilled
|
||||
|
||||
c.processEvent(ctr, et, ei)
|
||||
}
|
||||
}
|
||||
|
||||
func (c *client) writeContent(ctx context.Context, mediaType, ref string, r io.Reader) (*types.Descriptor, error) {
|
||||
writer, err := c.remote.ContentStore().Writer(ctx, ref, 0, "")
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
defer writer.Close()
|
||||
size, err := io.Copy(writer, r)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
labels := map[string]string{
|
||||
"containerd.io/gc.root": time.Now().UTC().Format(time.RFC3339),
|
||||
}
|
||||
if err := writer.Commit(ctx, 0, "", content.WithLabels(labels)); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &types.Descriptor{
|
||||
MediaType: mediaType,
|
||||
Digest: writer.Digest(),
|
||||
Size_: size,
|
||||
}, nil
|
||||
}
|
||||
|
||||
func wrapError(err error) error {
|
||||
if err != nil {
|
||||
msg := err.Error()
|
||||
for _, s := range []string{"container does not exist", "not found", "no such container"} {
|
||||
if strings.Contains(msg, s) {
|
||||
return wrapNotFoundError(err)
|
||||
}
|
||||
}
|
||||
}
|
||||
return err
|
||||
}
|
96
libcontainerd/client_daemon_linux.go
Normal file
96
libcontainerd/client_daemon_linux.go
Normal file
|
@ -0,0 +1,96 @@
|
|||
package libcontainerd
|
||||
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
"os"
|
||||
"path/filepath"
|
||||
"strings"
|
||||
|
||||
"github.com/containerd/containerd"
|
||||
"github.com/docker/docker/pkg/idtools"
|
||||
specs "github.com/opencontainers/runtime-spec/specs-go"
|
||||
)
|
||||
|
||||
func summaryFromInterface(i interface{}) (*Summary, error) {
|
||||
return &Summary{}, nil
|
||||
}
|
||||
|
||||
func (c *client) UpdateResources(ctx context.Context, containerID string, resources *Resources) error {
|
||||
p, err := c.getProcess(containerID, InitProcessName)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// go doesn't like the alias in 1.8, this means this need to be
|
||||
// platform specific
|
||||
return p.(containerd.Task).Update(ctx, containerd.WithResources((*specs.LinuxResources)(resources)))
|
||||
}
|
||||
|
||||
func hostIDFromMap(id uint32, mp []specs.LinuxIDMapping) int {
|
||||
for _, m := range mp {
|
||||
if id >= m.ContainerID && id <= m.ContainerID+m.Size-1 {
|
||||
return int(m.HostID + id - m.ContainerID)
|
||||
}
|
||||
}
|
||||
return 0
|
||||
}
|
||||
|
||||
func getSpecUser(ociSpec *specs.Spec) (int, int) {
|
||||
var (
|
||||
uid int
|
||||
gid int
|
||||
)
|
||||
|
||||
for _, ns := range ociSpec.Linux.Namespaces {
|
||||
if ns.Type == specs.UserNamespace {
|
||||
uid = hostIDFromMap(0, ociSpec.Linux.UIDMappings)
|
||||
gid = hostIDFromMap(0, ociSpec.Linux.GIDMappings)
|
||||
break
|
||||
}
|
||||
}
|
||||
|
||||
return uid, gid
|
||||
}
|
||||
|
||||
func prepareBundleDir(bundleDir string, ociSpec *specs.Spec) (string, error) {
|
||||
uid, gid := getSpecUser(ociSpec)
|
||||
if uid == 0 && gid == 0 {
|
||||
return bundleDir, idtools.MkdirAllAndChownNew(bundleDir, 0755, idtools.IDPair{0, 0})
|
||||
}
|
||||
|
||||
p := string(filepath.Separator)
|
||||
components := strings.Split(bundleDir, string(filepath.Separator))
|
||||
for _, d := range components[1:] {
|
||||
p = filepath.Join(p, d)
|
||||
fi, err := os.Stat(p)
|
||||
if err != nil && !os.IsNotExist(err) {
|
||||
return "", err
|
||||
}
|
||||
if os.IsNotExist(err) || fi.Mode()&1 == 0 {
|
||||
p = fmt.Sprintf("%s.%d.%d", p, uid, gid)
|
||||
if err := idtools.MkdirAndChown(p, 0700, idtools.IDPair{uid, gid}); err != nil && !os.IsExist(err) {
|
||||
return "", err
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return p, nil
|
||||
}
|
||||
|
||||
func newFIFOSet(bundleDir, containerID, processID string, withStdin, withTerminal bool) *containerd.FIFOSet {
|
||||
fifos := &containerd.FIFOSet{
|
||||
Terminal: withTerminal,
|
||||
Out: filepath.Join(bundleDir, processID+"-stdout"),
|
||||
}
|
||||
|
||||
if withStdin {
|
||||
fifos.In = filepath.Join(bundleDir, processID+"-stdin")
|
||||
}
|
||||
|
||||
if !fifos.Terminal {
|
||||
fifos.Err = filepath.Join(bundleDir, processID+"-stderr")
|
||||
}
|
||||
|
||||
return fifos
|
||||
}
|
53
libcontainerd/client_daemon_windows.go
Normal file
53
libcontainerd/client_daemon_windows.go
Normal file
|
@ -0,0 +1,53 @@
|
|||
package libcontainerd
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
|
||||
"github.com/containerd/containerd"
|
||||
"github.com/containerd/containerd/windows/hcsshimtypes"
|
||||
specs "github.com/opencontainers/runtime-spec/specs-go"
|
||||
"github.com/pkg/errors"
|
||||
)
|
||||
|
||||
func summaryFromInterface(i interface{}) (*Summary, error) {
|
||||
switch pd := i.(type) {
|
||||
case *hcsshimtypes.ProcessDetails:
|
||||
return &Summary{
|
||||
CreateTimestamp: pd.CreatedAt,
|
||||
ImageName: pd.ImageName,
|
||||
KernelTime100ns: pd.KernelTime_100Ns,
|
||||
MemoryCommitBytes: pd.MemoryCommitBytes,
|
||||
MemoryWorkingSetPrivateBytes: pd.MemoryWorkingSetPrivateBytes,
|
||||
MemoryWorkingSetSharedBytes: pd.MemoryWorkingSetSharedBytes,
|
||||
ProcessId: pd.ProcessID,
|
||||
UserTime100ns: pd.UserTime_100Ns,
|
||||
}, nil
|
||||
default:
|
||||
return nil, errors.Errorf("Unknown process details type %T", pd)
|
||||
}
|
||||
}
|
||||
|
||||
func prepareBundleDir(bundleDir string, ociSpec *specs.Spec) (string, error) {
|
||||
return bundleDir, nil
|
||||
}
|
||||
|
||||
func pipeName(containerID, processID, name string) string {
|
||||
return fmt.Sprintf(`\\.\pipe\containerd-%s-%s-%s`, containerID, processID, name)
|
||||
}
|
||||
|
||||
func newFIFOSet(bundleDir, containerID, processID string, withStdin, withTerminal bool) *containerd.FIFOSet {
|
||||
fifos := &containerd.FIFOSet{
|
||||
Terminal: withTerminal,
|
||||
Out: pipeName(containerID, processID, "stdout"),
|
||||
}
|
||||
|
||||
if withStdin {
|
||||
fifos.In = pipeName(containerID, processID, "stdin")
|
||||
}
|
||||
|
||||
if !fifos.Terminal {
|
||||
fifos.Err = pipeName(containerID, processID, "stderr")
|
||||
}
|
||||
|
||||
return fifos
|
||||
}
|
|
@ -1,616 +0,0 @@
|
|||
package libcontainerd
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"os"
|
||||
"strings"
|
||||
"sync"
|
||||
"time"
|
||||
|
||||
containerd "github.com/containerd/containerd/api/grpc/types"
|
||||
containerd_runtime_types "github.com/containerd/containerd/runtime"
|
||||
"github.com/docker/docker/pkg/ioutils"
|
||||
"github.com/docker/docker/pkg/mount"
|
||||
"github.com/golang/protobuf/ptypes"
|
||||
"github.com/golang/protobuf/ptypes/timestamp"
|
||||
specs "github.com/opencontainers/runtime-spec/specs-go"
|
||||
"github.com/sirupsen/logrus"
|
||||
"golang.org/x/net/context"
|
||||
"golang.org/x/sys/unix"
|
||||
)
|
||||
|
||||
type client struct {
|
||||
clientCommon
|
||||
|
||||
// Platform specific properties below here.
|
||||
remote *remote
|
||||
q queue
|
||||
exitNotifiers map[string]*exitNotifier
|
||||
liveRestore bool
|
||||
}
|
||||
|
||||
// GetServerVersion returns the connected server version information
|
||||
func (clnt *client) GetServerVersion(ctx context.Context) (*ServerVersion, error) {
|
||||
resp, err := clnt.remote.apiClient.GetServerVersion(ctx, &containerd.GetServerVersionRequest{})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
sv := &ServerVersion{
|
||||
GetServerVersionResponse: *resp,
|
||||
}
|
||||
|
||||
return sv, nil
|
||||
}
|
||||
|
||||
// AddProcess is the handler for adding a process to an already running
|
||||
// container. It's called through docker exec. It returns the system pid of the
|
||||
// exec'd process.
|
||||
func (clnt *client) AddProcess(ctx context.Context, containerID, processFriendlyName string, specp Process, attachStdio StdioCallback) (pid int, err error) {
|
||||
clnt.lock(containerID)
|
||||
defer clnt.unlock(containerID)
|
||||
container, err := clnt.getContainer(containerID)
|
||||
if err != nil {
|
||||
return -1, err
|
||||
}
|
||||
|
||||
spec, err := container.spec()
|
||||
if err != nil {
|
||||
return -1, err
|
||||
}
|
||||
sp := spec.Process
|
||||
sp.Args = specp.Args
|
||||
sp.Terminal = specp.Terminal
|
||||
if len(specp.Env) > 0 {
|
||||
sp.Env = specp.Env
|
||||
}
|
||||
if specp.Cwd != nil {
|
||||
sp.Cwd = *specp.Cwd
|
||||
}
|
||||
if specp.User != nil {
|
||||
sp.User = specs.User{
|
||||
UID: specp.User.UID,
|
||||
GID: specp.User.GID,
|
||||
AdditionalGids: specp.User.AdditionalGids,
|
||||
}
|
||||
}
|
||||
if specp.Capabilities != nil {
|
||||
sp.Capabilities.Bounding = specp.Capabilities
|
||||
sp.Capabilities.Effective = specp.Capabilities
|
||||
sp.Capabilities.Inheritable = specp.Capabilities
|
||||
sp.Capabilities.Permitted = specp.Capabilities
|
||||
}
|
||||
|
||||
p := container.newProcess(processFriendlyName)
|
||||
|
||||
r := &containerd.AddProcessRequest{
|
||||
Args: sp.Args,
|
||||
Cwd: sp.Cwd,
|
||||
Terminal: sp.Terminal,
|
||||
Id: containerID,
|
||||
Env: sp.Env,
|
||||
User: &containerd.User{
|
||||
Uid: sp.User.UID,
|
||||
Gid: sp.User.GID,
|
||||
AdditionalGids: sp.User.AdditionalGids,
|
||||
},
|
||||
Pid: processFriendlyName,
|
||||
Stdin: p.fifo(unix.Stdin),
|
||||
Stdout: p.fifo(unix.Stdout),
|
||||
Stderr: p.fifo(unix.Stderr),
|
||||
Capabilities: sp.Capabilities.Effective,
|
||||
ApparmorProfile: sp.ApparmorProfile,
|
||||
SelinuxLabel: sp.SelinuxLabel,
|
||||
NoNewPrivileges: sp.NoNewPrivileges,
|
||||
Rlimits: convertRlimits(sp.Rlimits),
|
||||
}
|
||||
|
||||
fifoCtx, cancel := context.WithCancel(context.Background())
|
||||
defer func() {
|
||||
if err != nil {
|
||||
cancel()
|
||||
}
|
||||
}()
|
||||
|
||||
iopipe, err := p.openFifos(fifoCtx, sp.Terminal)
|
||||
if err != nil {
|
||||
return -1, err
|
||||
}
|
||||
|
||||
resp, err := clnt.remote.apiClient.AddProcess(ctx, r)
|
||||
if err != nil {
|
||||
p.closeFifos(iopipe)
|
||||
return -1, err
|
||||
}
|
||||
|
||||
var stdinOnce sync.Once
|
||||
stdin := iopipe.Stdin
|
||||
iopipe.Stdin = ioutils.NewWriteCloserWrapper(stdin, func() error {
|
||||
var err error
|
||||
stdinOnce.Do(func() { // on error from attach we don't know if stdin was already closed
|
||||
err = stdin.Close()
|
||||
if err2 := p.sendCloseStdin(); err == nil {
|
||||
err = err2
|
||||
}
|
||||
})
|
||||
return err
|
||||
})
|
||||
|
||||
container.processes[processFriendlyName] = p
|
||||
|
||||
if err := attachStdio(*iopipe); err != nil {
|
||||
p.closeFifos(iopipe)
|
||||
return -1, err
|
||||
}
|
||||
|
||||
return int(resp.SystemPid), nil
|
||||
}
|
||||
|
||||
func (clnt *client) SignalProcess(containerID string, pid string, sig int) error {
|
||||
clnt.lock(containerID)
|
||||
defer clnt.unlock(containerID)
|
||||
_, err := clnt.remote.apiClient.Signal(context.Background(), &containerd.SignalRequest{
|
||||
Id: containerID,
|
||||
Pid: pid,
|
||||
Signal: uint32(sig),
|
||||
})
|
||||
return err
|
||||
}
|
||||
|
||||
func (clnt *client) Resize(containerID, processFriendlyName string, width, height int) error {
|
||||
clnt.lock(containerID)
|
||||
defer clnt.unlock(containerID)
|
||||
if _, err := clnt.getContainer(containerID); err != nil {
|
||||
return err
|
||||
}
|
||||
_, err := clnt.remote.apiClient.UpdateProcess(context.Background(), &containerd.UpdateProcessRequest{
|
||||
Id: containerID,
|
||||
Pid: processFriendlyName,
|
||||
Width: uint32(width),
|
||||
Height: uint32(height),
|
||||
})
|
||||
return err
|
||||
}
|
||||
|
||||
func (clnt *client) Pause(containerID string) error {
|
||||
return clnt.setState(containerID, StatePause)
|
||||
}
|
||||
|
||||
func (clnt *client) setState(containerID, state string) error {
|
||||
clnt.lock(containerID)
|
||||
container, err := clnt.getContainer(containerID)
|
||||
if err != nil {
|
||||
clnt.unlock(containerID)
|
||||
return err
|
||||
}
|
||||
if container.systemPid == 0 {
|
||||
clnt.unlock(containerID)
|
||||
return fmt.Errorf("No active process for container %s", containerID)
|
||||
}
|
||||
st := "running"
|
||||
if state == StatePause {
|
||||
st = "paused"
|
||||
}
|
||||
chstate := make(chan struct{})
|
||||
_, err = clnt.remote.apiClient.UpdateContainer(context.Background(), &containerd.UpdateContainerRequest{
|
||||
Id: containerID,
|
||||
Pid: InitFriendlyName,
|
||||
Status: st,
|
||||
})
|
||||
if err != nil {
|
||||
clnt.unlock(containerID)
|
||||
return err
|
||||
}
|
||||
container.pauseMonitor.append(state, chstate)
|
||||
clnt.unlock(containerID)
|
||||
<-chstate
|
||||
return nil
|
||||
}
|
||||
|
||||
func (clnt *client) Resume(containerID string) error {
|
||||
return clnt.setState(containerID, StateResume)
|
||||
}
|
||||
|
||||
func (clnt *client) Stats(containerID string) (*Stats, error) {
|
||||
resp, err := clnt.remote.apiClient.Stats(context.Background(), &containerd.StatsRequest{containerID})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return (*Stats)(resp), nil
|
||||
}
|
||||
|
||||
// Take care of the old 1.11.0 behavior in case the version upgrade
|
||||
// happened without a clean daemon shutdown
|
||||
func (clnt *client) cleanupOldRootfs(containerID string) {
|
||||
// Unmount and delete the bundle folder
|
||||
if mts, err := mount.GetMounts(); err == nil {
|
||||
for _, mts := range mts {
|
||||
if strings.HasSuffix(mts.Mountpoint, containerID+"/rootfs") {
|
||||
if err := unix.Unmount(mts.Mountpoint, unix.MNT_DETACH); err == nil {
|
||||
os.RemoveAll(strings.TrimSuffix(mts.Mountpoint, "/rootfs"))
|
||||
}
|
||||
break
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (clnt *client) setExited(containerID string, exitCode uint32) error {
|
||||
clnt.lock(containerID)
|
||||
defer clnt.unlock(containerID)
|
||||
|
||||
err := clnt.backend.StateChanged(containerID, StateInfo{
|
||||
CommonStateInfo: CommonStateInfo{
|
||||
State: StateExit,
|
||||
ExitCode: exitCode,
|
||||
}})
|
||||
|
||||
clnt.cleanupOldRootfs(containerID)
|
||||
|
||||
return err
|
||||
}
|
||||
|
||||
func (clnt *client) GetPidsForContainer(containerID string) ([]int, error) {
|
||||
cont, err := clnt.getContainerdContainer(containerID)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
pids := make([]int, len(cont.Pids))
|
||||
for i, p := range cont.Pids {
|
||||
pids[i] = int(p)
|
||||
}
|
||||
return pids, nil
|
||||
}
|
||||
|
||||
// Summary returns a summary of the processes running in a container.
|
||||
// This is a no-op on Linux.
|
||||
func (clnt *client) Summary(containerID string) ([]Summary, error) {
|
||||
return nil, nil
|
||||
}
|
||||
|
||||
func (clnt *client) getContainerdContainer(containerID string) (*containerd.Container, error) {
|
||||
resp, err := clnt.remote.apiClient.State(context.Background(), &containerd.StateRequest{Id: containerID})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
for _, cont := range resp.Containers {
|
||||
if cont.Id == containerID {
|
||||
return cont, nil
|
||||
}
|
||||
}
|
||||
return nil, fmt.Errorf("invalid state response")
|
||||
}
|
||||
|
||||
func (clnt *client) UpdateResources(containerID string, resources Resources) error {
|
||||
clnt.lock(containerID)
|
||||
defer clnt.unlock(containerID)
|
||||
container, err := clnt.getContainer(containerID)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
if container.systemPid == 0 {
|
||||
return fmt.Errorf("No active process for container %s", containerID)
|
||||
}
|
||||
_, err = clnt.remote.apiClient.UpdateContainer(context.Background(), &containerd.UpdateContainerRequest{
|
||||
Id: containerID,
|
||||
Pid: InitFriendlyName,
|
||||
Resources: (*containerd.UpdateResource)(&resources),
|
||||
})
|
||||
return err
|
||||
}
|
||||
|
||||
func (clnt *client) getExitNotifier(containerID string) *exitNotifier {
|
||||
clnt.mapMutex.RLock()
|
||||
defer clnt.mapMutex.RUnlock()
|
||||
return clnt.exitNotifiers[containerID]
|
||||
}
|
||||
|
||||
func (clnt *client) getOrCreateExitNotifier(containerID string) *exitNotifier {
|
||||
clnt.mapMutex.Lock()
|
||||
w, ok := clnt.exitNotifiers[containerID]
|
||||
defer clnt.mapMutex.Unlock()
|
||||
if !ok {
|
||||
w = &exitNotifier{c: make(chan struct{}), client: clnt}
|
||||
clnt.exitNotifiers[containerID] = w
|
||||
}
|
||||
return w
|
||||
}
|
||||
|
||||
func (clnt *client) restore(cont *containerd.Container, lastEvent *containerd.Event, attachStdio StdioCallback, options ...CreateOption) (err error) {
|
||||
clnt.lock(cont.Id)
|
||||
defer clnt.unlock(cont.Id)
|
||||
|
||||
logrus.Debugf("libcontainerd: restore container %s state %s", cont.Id, cont.Status)
|
||||
|
||||
containerID := cont.Id
|
||||
if _, err := clnt.getContainer(containerID); err == nil {
|
||||
return fmt.Errorf("container %s is already active", containerID)
|
||||
}
|
||||
|
||||
defer func() {
|
||||
if err != nil {
|
||||
clnt.deleteContainer(cont.Id)
|
||||
}
|
||||
}()
|
||||
|
||||
container := clnt.newContainer(cont.BundlePath, options...)
|
||||
container.systemPid = systemPid(cont)
|
||||
|
||||
var terminal bool
|
||||
for _, p := range cont.Processes {
|
||||
if p.Pid == InitFriendlyName {
|
||||
terminal = p.Terminal
|
||||
}
|
||||
}
|
||||
|
||||
fifoCtx, cancel := context.WithCancel(context.Background())
|
||||
defer func() {
|
||||
if err != nil {
|
||||
cancel()
|
||||
}
|
||||
}()
|
||||
|
||||
iopipe, err := container.openFifos(fifoCtx, terminal)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
var stdinOnce sync.Once
|
||||
stdin := iopipe.Stdin
|
||||
iopipe.Stdin = ioutils.NewWriteCloserWrapper(stdin, func() error {
|
||||
var err error
|
||||
stdinOnce.Do(func() { // on error from attach we don't know if stdin was already closed
|
||||
err = stdin.Close()
|
||||
})
|
||||
return err
|
||||
})
|
||||
|
||||
if err := attachStdio(*iopipe); err != nil {
|
||||
container.closeFifos(iopipe)
|
||||
return err
|
||||
}
|
||||
|
||||
clnt.appendContainer(container)
|
||||
|
||||
err = clnt.backend.StateChanged(containerID, StateInfo{
|
||||
CommonStateInfo: CommonStateInfo{
|
||||
State: StateRestore,
|
||||
Pid: container.systemPid,
|
||||
}})
|
||||
|
||||
if err != nil {
|
||||
container.closeFifos(iopipe)
|
||||
return err
|
||||
}
|
||||
|
||||
if lastEvent != nil {
|
||||
// This should only be a pause or resume event
|
||||
if lastEvent.Type == StatePause || lastEvent.Type == StateResume {
|
||||
return clnt.backend.StateChanged(containerID, StateInfo{
|
||||
CommonStateInfo: CommonStateInfo{
|
||||
State: lastEvent.Type,
|
||||
Pid: container.systemPid,
|
||||
}})
|
||||
}
|
||||
|
||||
logrus.Warnf("libcontainerd: unexpected backlog event: %#v", lastEvent)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (clnt *client) getContainerLastEventSinceTime(id string, tsp *timestamp.Timestamp) (*containerd.Event, error) {
|
||||
er := &containerd.EventsRequest{
|
||||
Timestamp: tsp,
|
||||
StoredOnly: true,
|
||||
Id: id,
|
||||
}
|
||||
events, err := clnt.remote.apiClient.Events(context.Background(), er)
|
||||
if err != nil {
|
||||
logrus.Errorf("libcontainerd: failed to get container events stream for %s: %q", er.Id, err)
|
||||
return nil, err
|
||||
}
|
||||
|
||||
var ev *containerd.Event
|
||||
for {
|
||||
e, err := events.Recv()
|
||||
if err != nil {
|
||||
if err.Error() == "EOF" {
|
||||
break
|
||||
}
|
||||
logrus.Errorf("libcontainerd: failed to get container event for %s: %q", id, err)
|
||||
return nil, err
|
||||
}
|
||||
ev = e
|
||||
logrus.Debugf("libcontainerd: received past event %#v", ev)
|
||||
}
|
||||
|
||||
return ev, nil
|
||||
}
|
||||
|
||||
func (clnt *client) getContainerLastEvent(id string) (*containerd.Event, error) {
|
||||
ev, err := clnt.getContainerLastEventSinceTime(id, clnt.remote.restoreFromTimestamp)
|
||||
if err == nil && ev == nil {
|
||||
// If ev is nil and the container is running in containerd,
|
||||
// we already consumed all the event of the
|
||||
// container, included the "exit" one.
|
||||
// Thus, we request all events containerd has in memory for
|
||||
// this container in order to get the last one (which should
|
||||
// be an exit event)
|
||||
logrus.Warnf("libcontainerd: client is out of sync, restore was called on a fully synced container (%s).", id)
|
||||
// Request all events since beginning of time
|
||||
t := time.Unix(0, 0)
|
||||
tsp, err := ptypes.TimestampProto(t)
|
||||
if err != nil {
|
||||
logrus.Errorf("libcontainerd: getLastEventSinceTime() failed to convert timestamp: %q", err)
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return clnt.getContainerLastEventSinceTime(id, tsp)
|
||||
}
|
||||
|
||||
return ev, err
|
||||
}
|
||||
|
||||
func (clnt *client) Restore(containerID string, attachStdio StdioCallback, options ...CreateOption) error {
|
||||
// Synchronize with live events
|
||||
clnt.remote.Lock()
|
||||
defer clnt.remote.Unlock()
|
||||
// Check that containerd still knows this container.
|
||||
//
|
||||
// In the unlikely event that Restore for this container process
|
||||
// the its past event before the main loop, the event will be
|
||||
// processed twice. However, this is not an issue as all those
|
||||
// events will do is change the state of the container to be
|
||||
// exactly the same.
|
||||
cont, err := clnt.getContainerdContainer(containerID)
|
||||
// Get its last event
|
||||
ev, eerr := clnt.getContainerLastEvent(containerID)
|
||||
if err != nil || containerd_runtime_types.State(cont.Status) == containerd_runtime_types.Stopped {
|
||||
if err != nil {
|
||||
logrus.Warnf("libcontainerd: failed to retrieve container %s state: %v", containerID, err)
|
||||
}
|
||||
if ev != nil && (ev.Pid != InitFriendlyName || ev.Type != StateExit) {
|
||||
// Wait a while for the exit event
|
||||
timeout := time.NewTimer(10 * time.Second)
|
||||
tick := time.NewTicker(100 * time.Millisecond)
|
||||
stop:
|
||||
for {
|
||||
select {
|
||||
case <-timeout.C:
|
||||
break stop
|
||||
case <-tick.C:
|
||||
ev, eerr = clnt.getContainerLastEvent(containerID)
|
||||
if eerr != nil {
|
||||
break stop
|
||||
}
|
||||
if ev != nil && ev.Pid == InitFriendlyName && ev.Type == StateExit {
|
||||
break stop
|
||||
}
|
||||
}
|
||||
}
|
||||
timeout.Stop()
|
||||
tick.Stop()
|
||||
}
|
||||
|
||||
// get the exit status for this container, if we don't have
|
||||
// one, indicate an error
|
||||
ec := uint32(255)
|
||||
if eerr == nil && ev != nil && ev.Pid == InitFriendlyName && ev.Type == StateExit {
|
||||
ec = ev.Status
|
||||
}
|
||||
clnt.setExited(containerID, ec)
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// container is still alive
|
||||
if clnt.liveRestore {
|
||||
if err := clnt.restore(cont, ev, attachStdio, options...); err != nil {
|
||||
logrus.Errorf("libcontainerd: error restoring %s: %v", containerID, err)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// Kill the container if liveRestore == false
|
||||
w := clnt.getOrCreateExitNotifier(containerID)
|
||||
clnt.lock(cont.Id)
|
||||
container := clnt.newContainer(cont.BundlePath)
|
||||
container.systemPid = systemPid(cont)
|
||||
clnt.appendContainer(container)
|
||||
clnt.unlock(cont.Id)
|
||||
|
||||
container.discardFifos()
|
||||
|
||||
if err := clnt.Signal(containerID, int(unix.SIGTERM)); err != nil {
|
||||
logrus.Errorf("libcontainerd: error sending sigterm to %v: %v", containerID, err)
|
||||
}
|
||||
|
||||
// Let the main loop handle the exit event
|
||||
clnt.remote.Unlock()
|
||||
|
||||
if ev != nil && ev.Type == StatePause {
|
||||
// resume container, it depends on the main loop, so we do it after Unlock()
|
||||
logrus.Debugf("libcontainerd: %s was paused, resuming it so it can die", containerID)
|
||||
if err := clnt.Resume(containerID); err != nil {
|
||||
return fmt.Errorf("failed to resume container: %v", err)
|
||||
}
|
||||
}
|
||||
|
||||
select {
|
||||
case <-time.After(10 * time.Second):
|
||||
if err := clnt.Signal(containerID, int(unix.SIGKILL)); err != nil {
|
||||
logrus.Errorf("libcontainerd: error sending sigkill to %v: %v", containerID, err)
|
||||
}
|
||||
select {
|
||||
case <-time.After(2 * time.Second):
|
||||
case <-w.wait():
|
||||
// relock because of the defer
|
||||
clnt.remote.Lock()
|
||||
return nil
|
||||
}
|
||||
case <-w.wait():
|
||||
// relock because of the defer
|
||||
clnt.remote.Lock()
|
||||
return nil
|
||||
}
|
||||
// relock because of the defer
|
||||
clnt.remote.Lock()
|
||||
|
||||
clnt.deleteContainer(containerID)
|
||||
|
||||
return clnt.setExited(containerID, uint32(255))
|
||||
}
|
||||
|
||||
func (clnt *client) CreateCheckpoint(containerID string, checkpointID string, checkpointDir string, exit bool) error {
|
||||
clnt.lock(containerID)
|
||||
defer clnt.unlock(containerID)
|
||||
if _, err := clnt.getContainer(containerID); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
_, err := clnt.remote.apiClient.CreateCheckpoint(context.Background(), &containerd.CreateCheckpointRequest{
|
||||
Id: containerID,
|
||||
Checkpoint: &containerd.Checkpoint{
|
||||
Name: checkpointID,
|
||||
Exit: exit,
|
||||
Tcp: true,
|
||||
UnixSockets: true,
|
||||
Shell: false,
|
||||
EmptyNS: []string{"network"},
|
||||
},
|
||||
CheckpointDir: checkpointDir,
|
||||
})
|
||||
return err
|
||||
}
|
||||
|
||||
func (clnt *client) DeleteCheckpoint(containerID string, checkpointID string, checkpointDir string) error {
|
||||
clnt.lock(containerID)
|
||||
defer clnt.unlock(containerID)
|
||||
if _, err := clnt.getContainer(containerID); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
_, err := clnt.remote.apiClient.DeleteCheckpoint(context.Background(), &containerd.DeleteCheckpointRequest{
|
||||
Id: containerID,
|
||||
Name: checkpointID,
|
||||
CheckpointDir: checkpointDir,
|
||||
})
|
||||
return err
|
||||
}
|
||||
|
||||
func (clnt *client) ListCheckpoints(containerID string, checkpointDir string) (*Checkpoints, error) {
|
||||
clnt.lock(containerID)
|
||||
defer clnt.unlock(containerID)
|
||||
if _, err := clnt.getContainer(containerID); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
resp, err := clnt.remote.apiClient.ListCheckpoint(context.Background(), &containerd.ListCheckpointRequest{
|
||||
Id: containerID,
|
||||
CheckpointDir: checkpointDir,
|
||||
})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return (*Checkpoints)(resp), nil
|
||||
}
|
1340
libcontainerd/client_local_windows.go
Normal file
1340
libcontainerd/client_local_windows.go
Normal file
File diff suppressed because it is too large
Load diff
|
@ -1,104 +0,0 @@
|
|||
package libcontainerd
|
||||
|
||||
import (
|
||||
containerd "github.com/containerd/containerd/api/grpc/types"
|
||||
"golang.org/x/net/context"
|
||||
)
|
||||
|
||||
type client struct {
|
||||
clientCommon
|
||||
|
||||
// Platform specific properties below here.
|
||||
remote *remote
|
||||
q queue
|
||||
exitNotifiers map[string]*exitNotifier
|
||||
liveRestore bool
|
||||
}
|
||||
|
||||
// GetServerVersion returns the connected server version information
|
||||
func (clnt *client) GetServerVersion(ctx context.Context) (*ServerVersion, error) {
|
||||
resp, err := clnt.remote.apiClient.GetServerVersion(ctx, &containerd.GetServerVersionRequest{})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
sv := &ServerVersion{
|
||||
GetServerVersionResponse: *resp,
|
||||
}
|
||||
|
||||
return sv, nil
|
||||
}
|
||||
|
||||
func (clnt *client) AddProcess(ctx context.Context, containerID, processFriendlyName string, specp Process, attachStdio StdioCallback) (int, error) {
|
||||
return -1, nil
|
||||
}
|
||||
|
||||
func (clnt *client) SignalProcess(containerID string, pid string, sig int) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (clnt *client) Resize(containerID, processFriendlyName string, width, height int) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (clnt *client) Pause(containerID string) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (clnt *client) Resume(containerID string) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (clnt *client) Stats(containerID string) (*Stats, error) {
|
||||
return nil, nil
|
||||
}
|
||||
|
||||
func (clnt *client) getExitNotifier(containerID string) *exitNotifier {
|
||||
clnt.mapMutex.RLock()
|
||||
defer clnt.mapMutex.RUnlock()
|
||||
return clnt.exitNotifiers[containerID]
|
||||
}
|
||||
|
||||
func (clnt *client) getOrCreateExitNotifier(containerID string) *exitNotifier {
|
||||
clnt.mapMutex.Lock()
|
||||
defer clnt.mapMutex.Unlock()
|
||||
w, ok := clnt.exitNotifiers[containerID]
|
||||
if !ok {
|
||||
w = &exitNotifier{c: make(chan struct{}), client: clnt}
|
||||
clnt.exitNotifiers[containerID] = w
|
||||
}
|
||||
return w
|
||||
}
|
||||
|
||||
// Restore is the handler for restoring a container
|
||||
func (clnt *client) Restore(containerID string, attachStdio StdioCallback, options ...CreateOption) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (clnt *client) GetPidsForContainer(containerID string) ([]int, error) {
|
||||
return nil, nil
|
||||
}
|
||||
|
||||
// Summary returns a summary of the processes running in a container.
|
||||
func (clnt *client) Summary(containerID string) ([]Summary, error) {
|
||||
return nil, nil
|
||||
}
|
||||
|
||||
// UpdateResources updates resources for a running container.
|
||||
func (clnt *client) UpdateResources(containerID string, resources Resources) error {
|
||||
// Updating resource isn't supported on Solaris
|
||||
// but we should return nil for enabling updating container
|
||||
return nil
|
||||
}
|
||||
|
||||
func (clnt *client) CreateCheckpoint(containerID string, checkpointID string, checkpointDir string, exit bool) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (clnt *client) DeleteCheckpoint(containerID string, checkpointID string, checkpointDir string) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (clnt *client) ListCheckpoints(containerID string, checkpointDir string) (*Checkpoints, error) {
|
||||
return nil, nil
|
||||
}
|
|
@ -1,141 +0,0 @@
|
|||
// +build linux solaris
|
||||
|
||||
package libcontainerd
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"os"
|
||||
"path/filepath"
|
||||
"strings"
|
||||
"sync"
|
||||
|
||||
containerd "github.com/containerd/containerd/api/grpc/types"
|
||||
"github.com/docker/docker/pkg/idtools"
|
||||
specs "github.com/opencontainers/runtime-spec/specs-go"
|
||||
"github.com/sirupsen/logrus"
|
||||
"golang.org/x/net/context"
|
||||
)
|
||||
|
||||
func (clnt *client) prepareBundleDir(uid, gid int) (string, error) {
|
||||
root, err := filepath.Abs(clnt.remote.stateDir)
|
||||
if err != nil {
|
||||
return "", err
|
||||
}
|
||||
if uid == 0 && gid == 0 {
|
||||
return root, nil
|
||||
}
|
||||
p := string(filepath.Separator)
|
||||
for _, d := range strings.Split(root, string(filepath.Separator))[1:] {
|
||||
p = filepath.Join(p, d)
|
||||
fi, err := os.Stat(p)
|
||||
if err != nil && !os.IsNotExist(err) {
|
||||
return "", err
|
||||
}
|
||||
if os.IsNotExist(err) || fi.Mode()&1 == 0 {
|
||||
p = fmt.Sprintf("%s.%d.%d", p, uid, gid)
|
||||
if err := idtools.MkdirAndChown(p, 0700, idtools.IDPair{uid, gid}); err != nil && !os.IsExist(err) {
|
||||
return "", err
|
||||
}
|
||||
}
|
||||
}
|
||||
return p, nil
|
||||
}
|
||||
|
||||
func (clnt *client) Create(containerID string, checkpoint string, checkpointDir string, spec specs.Spec, attachStdio StdioCallback, options ...CreateOption) (err error) {
|
||||
clnt.lock(containerID)
|
||||
defer clnt.unlock(containerID)
|
||||
|
||||
if _, err := clnt.getContainer(containerID); err == nil {
|
||||
return fmt.Errorf("Container %s is already active", containerID)
|
||||
}
|
||||
|
||||
uid, gid, err := getRootIDs(spec)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
dir, err := clnt.prepareBundleDir(uid, gid)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
container := clnt.newContainer(filepath.Join(dir, containerID), options...)
|
||||
if err := container.clean(); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
defer func() {
|
||||
if err != nil {
|
||||
container.clean()
|
||||
clnt.deleteContainer(containerID)
|
||||
}
|
||||
}()
|
||||
|
||||
if err := idtools.MkdirAllAndChown(container.dir, 0700, idtools.IDPair{uid, gid}); err != nil && !os.IsExist(err) {
|
||||
return err
|
||||
}
|
||||
|
||||
f, err := os.Create(filepath.Join(container.dir, configFilename))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
defer f.Close()
|
||||
if err := json.NewEncoder(f).Encode(spec); err != nil {
|
||||
return err
|
||||
}
|
||||
return container.start(&spec, checkpoint, checkpointDir, attachStdio)
|
||||
}
|
||||
|
||||
func (clnt *client) Signal(containerID string, sig int) error {
|
||||
clnt.lock(containerID)
|
||||
defer clnt.unlock(containerID)
|
||||
_, err := clnt.remote.apiClient.Signal(context.Background(), &containerd.SignalRequest{
|
||||
Id: containerID,
|
||||
Pid: InitFriendlyName,
|
||||
Signal: uint32(sig),
|
||||
})
|
||||
return err
|
||||
}
|
||||
|
||||
func (clnt *client) newContainer(dir string, options ...CreateOption) *container {
|
||||
container := &container{
|
||||
containerCommon: containerCommon{
|
||||
process: process{
|
||||
dir: dir,
|
||||
processCommon: processCommon{
|
||||
containerID: filepath.Base(dir),
|
||||
client: clnt,
|
||||
friendlyName: InitFriendlyName,
|
||||
},
|
||||
},
|
||||
processes: make(map[string]*process),
|
||||
},
|
||||
}
|
||||
for _, option := range options {
|
||||
if err := option.Apply(container); err != nil {
|
||||
logrus.Errorf("libcontainerd: newContainer(): %v", err)
|
||||
}
|
||||
}
|
||||
return container
|
||||
}
|
||||
|
||||
type exitNotifier struct {
|
||||
id string
|
||||
client *client
|
||||
c chan struct{}
|
||||
once sync.Once
|
||||
}
|
||||
|
||||
func (en *exitNotifier) close() {
|
||||
en.once.Do(func() {
|
||||
close(en.c)
|
||||
en.client.mapMutex.Lock()
|
||||
if en == en.client.exitNotifiers[en.id] {
|
||||
delete(en.client.exitNotifiers, en.id)
|
||||
}
|
||||
en.client.mapMutex.Unlock()
|
||||
})
|
||||
}
|
||||
func (en *exitNotifier) wait() <-chan struct{} {
|
||||
return en.c
|
||||
}
|
|
@ -1,886 +0,0 @@
|
|||
package libcontainerd
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"fmt"
|
||||
"io"
|
||||
"io/ioutil"
|
||||
"os"
|
||||
"path"
|
||||
"path/filepath"
|
||||
"regexp"
|
||||
"strings"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"golang.org/x/net/context"
|
||||
|
||||
"github.com/Microsoft/hcsshim"
|
||||
opengcs "github.com/Microsoft/opengcs/client"
|
||||
"github.com/docker/docker/pkg/sysinfo"
|
||||
"github.com/docker/docker/pkg/system"
|
||||
specs "github.com/opencontainers/runtime-spec/specs-go"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
type client struct {
|
||||
clientCommon
|
||||
|
||||
// Platform specific properties below here (none presently on Windows)
|
||||
}
|
||||
|
||||
// Win32 error codes that are used for various workarounds
|
||||
// These really should be ALL_CAPS to match golangs syscall library and standard
|
||||
// Win32 error conventions, but golint insists on CamelCase.
|
||||
const (
|
||||
CoEClassstring = syscall.Errno(0x800401F3) // Invalid class string
|
||||
ErrorNoNetwork = syscall.Errno(1222) // The network is not present or not started
|
||||
ErrorBadPathname = syscall.Errno(161) // The specified path is invalid
|
||||
ErrorInvalidObject = syscall.Errno(0x800710D8) // The object identifier does not represent a valid object
|
||||
)
|
||||
|
||||
// defaultOwner is a tag passed to HCS to allow it to differentiate between
|
||||
// container creator management stacks. We hard code "docker" in the case
|
||||
// of docker.
|
||||
const defaultOwner = "docker"
|
||||
|
||||
// Create is the entrypoint to create a container from a spec, and if successfully
|
||||
// created, start it too. Table below shows the fields required for HCS JSON calling parameters,
|
||||
// where if not populated, is omitted.
|
||||
// +-----------------+--------------------------------------------+---------------------------------------------------+
|
||||
// | | Isolation=Process | Isolation=Hyper-V |
|
||||
// +-----------------+--------------------------------------------+---------------------------------------------------+
|
||||
// | VolumePath | \\?\\Volume{GUIDa} | |
|
||||
// | LayerFolderPath | %root%\windowsfilter\containerID | %root%\windowsfilter\containerID (servicing only) |
|
||||
// | Layers[] | ID=GUIDb;Path=%root%\windowsfilter\layerID | ID=GUIDb;Path=%root%\windowsfilter\layerID |
|
||||
// | HvRuntime | | ImagePath=%root%\BaseLayerID\UtilityVM |
|
||||
// +-----------------+--------------------------------------------+---------------------------------------------------+
|
||||
//
|
||||
// Isolation=Process example:
|
||||
//
|
||||
// {
|
||||
// "SystemType": "Container",
|
||||
// "Name": "5e0055c814a6005b8e57ac59f9a522066e0af12b48b3c26a9416e23907698776",
|
||||
// "Owner": "docker",
|
||||
// "VolumePath": "\\\\\\\\?\\\\Volume{66d1ef4c-7a00-11e6-8948-00155ddbef9d}",
|
||||
// "IgnoreFlushesDuringBoot": true,
|
||||
// "LayerFolderPath": "C:\\\\control\\\\windowsfilter\\\\5e0055c814a6005b8e57ac59f9a522066e0af12b48b3c26a9416e23907698776",
|
||||
// "Layers": [{
|
||||
// "ID": "18955d65-d45a-557b-bf1c-49d6dfefc526",
|
||||
// "Path": "C:\\\\control\\\\windowsfilter\\\\65bf96e5760a09edf1790cb229e2dfb2dbd0fcdc0bf7451bae099106bfbfea0c"
|
||||
// }],
|
||||
// "HostName": "5e0055c814a6",
|
||||
// "MappedDirectories": [],
|
||||
// "HvPartition": false,
|
||||
// "EndpointList": ["eef2649d-bb17-4d53-9937-295a8efe6f2c"],
|
||||
// "Servicing": false
|
||||
//}
|
||||
//
|
||||
// Isolation=Hyper-V example:
|
||||
//
|
||||
//{
|
||||
// "SystemType": "Container",
|
||||
// "Name": "475c2c58933b72687a88a441e7e0ca4bd72d76413c5f9d5031fee83b98f6045d",
|
||||
// "Owner": "docker",
|
||||
// "IgnoreFlushesDuringBoot": true,
|
||||
// "Layers": [{
|
||||
// "ID": "18955d65-d45a-557b-bf1c-49d6dfefc526",
|
||||
// "Path": "C:\\\\control\\\\windowsfilter\\\\65bf96e5760a09edf1790cb229e2dfb2dbd0fcdc0bf7451bae099106bfbfea0c"
|
||||
// }],
|
||||
// "HostName": "475c2c58933b",
|
||||
// "MappedDirectories": [],
|
||||
// "HvPartition": true,
|
||||
// "EndpointList": ["e1bb1e61-d56f-405e-b75d-fd520cefa0cb"],
|
||||
// "DNSSearchList": "a.com,b.com,c.com",
|
||||
// "HvRuntime": {
|
||||
// "ImagePath": "C:\\\\control\\\\windowsfilter\\\\65bf96e5760a09edf1790cb229e2dfb2dbd0fcdc0bf7451bae099106bfbfea0c\\\\UtilityVM"
|
||||
// },
|
||||
// "Servicing": false
|
||||
//}
|
||||
func (clnt *client) Create(containerID string, checkpoint string, checkpointDir string, spec specs.Spec, attachStdio StdioCallback, options ...CreateOption) error {
|
||||
clnt.lock(containerID)
|
||||
defer clnt.unlock(containerID)
|
||||
if b, err := json.Marshal(spec); err == nil {
|
||||
logrus.Debugln("libcontainerd: client.Create() with spec", string(b))
|
||||
}
|
||||
|
||||
// spec.Linux must be nil for Windows containers, but spec.Windows will be filled in regardless of container platform.
|
||||
// This is a temporary workaround due to LCOW requiring layer folder paths, which are stored under spec.Windows.
|
||||
// TODO: @darrenstahlmsft fix this once the OCI spec is updated to support layer folder paths for LCOW
|
||||
if spec.Linux == nil {
|
||||
return clnt.createWindows(containerID, checkpoint, checkpointDir, spec, attachStdio, options...)
|
||||
}
|
||||
return clnt.createLinux(containerID, checkpoint, checkpointDir, spec, attachStdio, options...)
|
||||
}
|
||||
|
||||
func (clnt *client) createWindows(containerID string, checkpoint string, checkpointDir string, spec specs.Spec, attachStdio StdioCallback, options ...CreateOption) error {
|
||||
configuration := &hcsshim.ContainerConfig{
|
||||
SystemType: "Container",
|
||||
Name: containerID,
|
||||
Owner: defaultOwner,
|
||||
IgnoreFlushesDuringBoot: spec.Windows.IgnoreFlushesDuringBoot,
|
||||
HostName: spec.Hostname,
|
||||
HvPartition: false,
|
||||
Servicing: spec.Windows.Servicing,
|
||||
}
|
||||
|
||||
if spec.Windows.Resources != nil {
|
||||
if spec.Windows.Resources.CPU != nil {
|
||||
if spec.Windows.Resources.CPU.Count != nil {
|
||||
// This check is being done here rather than in adaptContainerSettings
|
||||
// because we don't want to update the HostConfig in case this container
|
||||
// is moved to a host with more CPUs than this one.
|
||||
cpuCount := *spec.Windows.Resources.CPU.Count
|
||||
hostCPUCount := uint64(sysinfo.NumCPU())
|
||||
if cpuCount > hostCPUCount {
|
||||
logrus.Warnf("Changing requested CPUCount of %d to current number of processors, %d", cpuCount, hostCPUCount)
|
||||
cpuCount = hostCPUCount
|
||||
}
|
||||
configuration.ProcessorCount = uint32(cpuCount)
|
||||
}
|
||||
if spec.Windows.Resources.CPU.Shares != nil {
|
||||
configuration.ProcessorWeight = uint64(*spec.Windows.Resources.CPU.Shares)
|
||||
}
|
||||
if spec.Windows.Resources.CPU.Maximum != nil {
|
||||
configuration.ProcessorMaximum = int64(*spec.Windows.Resources.CPU.Maximum)
|
||||
}
|
||||
}
|
||||
if spec.Windows.Resources.Memory != nil {
|
||||
if spec.Windows.Resources.Memory.Limit != nil {
|
||||
configuration.MemoryMaximumInMB = int64(*spec.Windows.Resources.Memory.Limit) / 1024 / 1024
|
||||
}
|
||||
}
|
||||
if spec.Windows.Resources.Storage != nil {
|
||||
if spec.Windows.Resources.Storage.Bps != nil {
|
||||
configuration.StorageBandwidthMaximum = *spec.Windows.Resources.Storage.Bps
|
||||
}
|
||||
if spec.Windows.Resources.Storage.Iops != nil {
|
||||
configuration.StorageIOPSMaximum = *spec.Windows.Resources.Storage.Iops
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if spec.Windows.HyperV != nil {
|
||||
configuration.HvPartition = true
|
||||
}
|
||||
|
||||
if spec.Windows.Network != nil {
|
||||
configuration.EndpointList = spec.Windows.Network.EndpointList
|
||||
configuration.AllowUnqualifiedDNSQuery = spec.Windows.Network.AllowUnqualifiedDNSQuery
|
||||
if spec.Windows.Network.DNSSearchList != nil {
|
||||
configuration.DNSSearchList = strings.Join(spec.Windows.Network.DNSSearchList, ",")
|
||||
}
|
||||
configuration.NetworkSharedContainerName = spec.Windows.Network.NetworkSharedContainerName
|
||||
}
|
||||
|
||||
if cs, ok := spec.Windows.CredentialSpec.(string); ok {
|
||||
configuration.Credentials = cs
|
||||
}
|
||||
|
||||
// We must have least two layers in the spec, the bottom one being a base image,
|
||||
// the top one being the RW layer.
|
||||
if spec.Windows.LayerFolders == nil || len(spec.Windows.LayerFolders) < 2 {
|
||||
return fmt.Errorf("OCI spec is invalid - at least two LayerFolders must be supplied to the runtime")
|
||||
}
|
||||
|
||||
// Strip off the top-most layer as that's passed in separately to HCS
|
||||
configuration.LayerFolderPath = spec.Windows.LayerFolders[len(spec.Windows.LayerFolders)-1]
|
||||
layerFolders := spec.Windows.LayerFolders[:len(spec.Windows.LayerFolders)-1]
|
||||
|
||||
if configuration.HvPartition {
|
||||
// We don't currently support setting the utility VM image explicitly.
|
||||
// TODO @swernli/jhowardmsft circa RS3/4, this may be re-locatable.
|
||||
if spec.Windows.HyperV.UtilityVMPath != "" {
|
||||
return errors.New("runtime does not support an explicit utility VM path for Hyper-V containers")
|
||||
}
|
||||
|
||||
// Find the upper-most utility VM image.
|
||||
var uvmImagePath string
|
||||
for _, path := range layerFolders {
|
||||
fullPath := filepath.Join(path, "UtilityVM")
|
||||
_, err := os.Stat(fullPath)
|
||||
if err == nil {
|
||||
uvmImagePath = fullPath
|
||||
break
|
||||
}
|
||||
if !os.IsNotExist(err) {
|
||||
return err
|
||||
}
|
||||
}
|
||||
if uvmImagePath == "" {
|
||||
return errors.New("utility VM image could not be found")
|
||||
}
|
||||
configuration.HvRuntime = &hcsshim.HvRuntime{ImagePath: uvmImagePath}
|
||||
|
||||
if spec.Root.Path != "" {
|
||||
return errors.New("OCI spec is invalid - Root.Path must be omitted for a Hyper-V container")
|
||||
}
|
||||
} else {
|
||||
const volumeGUIDRegex = `^\\\\\?\\(Volume)\{{0,1}[0-9a-fA-F]{8}\-[0-9a-fA-F]{4}\-[0-9a-fA-F]{4}\-[0-9a-fA-F]{4}\-[0-9a-fA-F]{12}(\}){0,1}\}\\$`
|
||||
if _, err := regexp.MatchString(volumeGUIDRegex, spec.Root.Path); err != nil {
|
||||
return fmt.Errorf(`OCI spec is invalid - Root.Path '%s' must be a volume GUID path in the format '\\?\Volume{GUID}\'`, spec.Root.Path)
|
||||
}
|
||||
// HCS API requires the trailing backslash to be removed
|
||||
configuration.VolumePath = spec.Root.Path[:len(spec.Root.Path)-1]
|
||||
}
|
||||
|
||||
if spec.Root.Readonly {
|
||||
return errors.New(`OCI spec is invalid - Root.Readonly must not be set on Windows`)
|
||||
}
|
||||
|
||||
for _, layerPath := range layerFolders {
|
||||
_, filename := filepath.Split(layerPath)
|
||||
g, err := hcsshim.NameToGuid(filename)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
configuration.Layers = append(configuration.Layers, hcsshim.Layer{
|
||||
ID: g.ToString(),
|
||||
Path: layerPath,
|
||||
})
|
||||
}
|
||||
|
||||
// Add the mounts (volumes, bind mounts etc) to the structure
|
||||
var mds []hcsshim.MappedDir
|
||||
var mps []hcsshim.MappedPipe
|
||||
for _, mount := range spec.Mounts {
|
||||
const pipePrefix = `\\.\pipe\`
|
||||
if mount.Type != "" {
|
||||
return fmt.Errorf("OCI spec is invalid - Mount.Type '%s' must not be set", mount.Type)
|
||||
}
|
||||
if strings.HasPrefix(mount.Destination, pipePrefix) {
|
||||
mp := hcsshim.MappedPipe{
|
||||
HostPath: mount.Source,
|
||||
ContainerPipeName: mount.Destination[len(pipePrefix):],
|
||||
}
|
||||
mps = append(mps, mp)
|
||||
} else {
|
||||
md := hcsshim.MappedDir{
|
||||
HostPath: mount.Source,
|
||||
ContainerPath: mount.Destination,
|
||||
ReadOnly: false,
|
||||
}
|
||||
for _, o := range mount.Options {
|
||||
if strings.ToLower(o) == "ro" {
|
||||
md.ReadOnly = true
|
||||
}
|
||||
}
|
||||
mds = append(mds, md)
|
||||
}
|
||||
}
|
||||
configuration.MappedDirectories = mds
|
||||
if len(mps) > 0 && system.GetOSVersion().Build < 16210 { // replace with Win10 RS3 build number at RTM
|
||||
return errors.New("named pipe mounts are not supported on this version of Windows")
|
||||
}
|
||||
configuration.MappedPipes = mps
|
||||
|
||||
hcsContainer, err := hcsshim.CreateContainer(containerID, configuration)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// Construct a container object for calling start on it.
|
||||
container := &container{
|
||||
containerCommon: containerCommon{
|
||||
process: process{
|
||||
processCommon: processCommon{
|
||||
containerID: containerID,
|
||||
client: clnt,
|
||||
friendlyName: InitFriendlyName,
|
||||
},
|
||||
},
|
||||
processes: make(map[string]*process),
|
||||
},
|
||||
isWindows: true,
|
||||
ociSpec: spec,
|
||||
hcsContainer: hcsContainer,
|
||||
}
|
||||
|
||||
container.options = options
|
||||
for _, option := range options {
|
||||
if err := option.Apply(container); err != nil {
|
||||
logrus.Errorf("libcontainerd: %v", err)
|
||||
}
|
||||
}
|
||||
|
||||
// Call start, and if it fails, delete the container from our
|
||||
// internal structure, start will keep HCS in sync by deleting the
|
||||
// container there.
|
||||
logrus.Debugf("libcontainerd: createWindows() id=%s, Calling start()", containerID)
|
||||
if err := container.start(attachStdio); err != nil {
|
||||
clnt.deleteContainer(containerID)
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.Debugf("libcontainerd: createWindows() id=%s completed successfully", containerID)
|
||||
return nil
|
||||
|
||||
}
|
||||
|
||||
func (clnt *client) createLinux(containerID string, checkpoint string, checkpointDir string, spec specs.Spec, attachStdio StdioCallback, options ...CreateOption) error {
|
||||
logrus.Debugf("libcontainerd: createLinux(): containerId %s ", containerID)
|
||||
|
||||
var lcowOpt *LCOWOption
|
||||
for _, option := range options {
|
||||
if lcow, ok := option.(*LCOWOption); ok {
|
||||
lcowOpt = lcow
|
||||
}
|
||||
}
|
||||
if lcowOpt == nil || lcowOpt.Config == nil {
|
||||
return fmt.Errorf("lcow option must be supplied to the runtime")
|
||||
}
|
||||
|
||||
configuration := &hcsshim.ContainerConfig{
|
||||
HvPartition: true,
|
||||
Name: containerID,
|
||||
SystemType: "container",
|
||||
ContainerType: "linux",
|
||||
Owner: defaultOwner,
|
||||
TerminateOnLastHandleClosed: true,
|
||||
}
|
||||
|
||||
if lcowOpt.Config.ActualMode == opengcs.ModeActualVhdx {
|
||||
configuration.HvRuntime = &hcsshim.HvRuntime{
|
||||
ImagePath: lcowOpt.Config.Vhdx,
|
||||
BootSource: "Vhd",
|
||||
WritableBootSource: false,
|
||||
}
|
||||
} else {
|
||||
configuration.HvRuntime = &hcsshim.HvRuntime{
|
||||
ImagePath: lcowOpt.Config.KirdPath,
|
||||
LinuxKernelFile: lcowOpt.Config.KernelFile,
|
||||
LinuxInitrdFile: lcowOpt.Config.InitrdFile,
|
||||
LinuxBootParameters: lcowOpt.Config.BootParameters,
|
||||
}
|
||||
}
|
||||
|
||||
if spec.Windows == nil {
|
||||
return fmt.Errorf("spec.Windows must not be nil for LCOW containers")
|
||||
}
|
||||
|
||||
// We must have least one layer in the spec
|
||||
if spec.Windows.LayerFolders == nil || len(spec.Windows.LayerFolders) == 0 {
|
||||
return fmt.Errorf("OCI spec is invalid - at least one LayerFolders must be supplied to the runtime")
|
||||
}
|
||||
|
||||
// Strip off the top-most layer as that's passed in separately to HCS
|
||||
configuration.LayerFolderPath = spec.Windows.LayerFolders[len(spec.Windows.LayerFolders)-1]
|
||||
layerFolders := spec.Windows.LayerFolders[:len(spec.Windows.LayerFolders)-1]
|
||||
|
||||
for _, layerPath := range layerFolders {
|
||||
_, filename := filepath.Split(layerPath)
|
||||
g, err := hcsshim.NameToGuid(filename)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
configuration.Layers = append(configuration.Layers, hcsshim.Layer{
|
||||
ID: g.ToString(),
|
||||
Path: filepath.Join(layerPath, "layer.vhd"),
|
||||
})
|
||||
}
|
||||
|
||||
if spec.Windows.Network != nil {
|
||||
configuration.EndpointList = spec.Windows.Network.EndpointList
|
||||
configuration.AllowUnqualifiedDNSQuery = spec.Windows.Network.AllowUnqualifiedDNSQuery
|
||||
if spec.Windows.Network.DNSSearchList != nil {
|
||||
configuration.DNSSearchList = strings.Join(spec.Windows.Network.DNSSearchList, ",")
|
||||
}
|
||||
configuration.NetworkSharedContainerName = spec.Windows.Network.NetworkSharedContainerName
|
||||
}
|
||||
|
||||
// Add the mounts (volumes, bind mounts etc) to the structure. We have to do
|
||||
// some translation for both the mapped directories passed into HCS and in
|
||||
// the spec.
|
||||
//
|
||||
// For HCS, we only pass in the mounts from the spec which are type "bind".
|
||||
// Further, the "ContainerPath" field (which is a little mis-leadingly
|
||||
// named when it applies to the utility VM rather than the container in the
|
||||
// utility VM) is moved to under /tmp/gcs/<ID>/binds, where this is passed
|
||||
// by the caller through a 'uvmpath' option.
|
||||
//
|
||||
// We do similar translation for the mounts in the spec by stripping out
|
||||
// the uvmpath option, and translating the Source path to the location in the
|
||||
// utility VM calculated above.
|
||||
//
|
||||
// From inside the utility VM, you would see a 9p mount such as in the following
|
||||
// where a host folder has been mapped to /target. The line with /tmp/gcs/<ID>/binds
|
||||
// specifically:
|
||||
//
|
||||
// / # mount
|
||||
// rootfs on / type rootfs (rw,size=463736k,nr_inodes=115934)
|
||||
// proc on /proc type proc (rw,relatime)
|
||||
// sysfs on /sys type sysfs (rw,relatime)
|
||||
// udev on /dev type devtmpfs (rw,relatime,size=498100k,nr_inodes=124525,mode=755)
|
||||
// tmpfs on /run type tmpfs (rw,relatime)
|
||||
// cgroup on /sys/fs/cgroup type cgroup (rw,relatime,cpuset,cpu,cpuacct,blkio,memory,devices,freezer,net_cls,perf_event,net_prio,hugetlb,pids,rdma)
|
||||
// mqueue on /dev/mqueue type mqueue (rw,relatime)
|
||||
// devpts on /dev/pts type devpts (rw,relatime,mode=600,ptmxmode=000)
|
||||
// /binds/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/target on /binds/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/target type 9p (rw,sync,dirsync,relatime,trans=fd,rfdno=6,wfdno=6)
|
||||
// /dev/pmem0 on /tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/layer0 type ext4 (ro,relatime,block_validity,delalloc,norecovery,barrier,dax,user_xattr,acl)
|
||||
// /dev/sda on /tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/scratch type ext4 (rw,relatime,block_validity,delalloc,barrier,user_xattr,acl)
|
||||
// overlay on /tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/rootfs type overlay (rw,relatime,lowerdir=/tmp/base/:/tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/layer0,upperdir=/tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/scratch/upper,workdir=/tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc/scratch/work)
|
||||
//
|
||||
// /tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc # ls -l
|
||||
// total 16
|
||||
// drwx------ 3 0 0 60 Sep 7 18:54 binds
|
||||
// -rw-r--r-- 1 0 0 3345 Sep 7 18:54 config.json
|
||||
// drwxr-xr-x 10 0 0 4096 Sep 6 17:26 layer0
|
||||
// drwxr-xr-x 1 0 0 4096 Sep 7 18:54 rootfs
|
||||
// drwxr-xr-x 5 0 0 4096 Sep 7 18:54 scratch
|
||||
//
|
||||
// /tmp/gcs/b3ea9126d67702173647ece2744f7c11181c0150e9890fc9a431849838033edc # ls -l binds
|
||||
// total 0
|
||||
// drwxrwxrwt 2 0 0 4096 Sep 7 16:51 target
|
||||
|
||||
mds := []hcsshim.MappedDir{}
|
||||
specMounts := []specs.Mount{}
|
||||
for _, mount := range spec.Mounts {
|
||||
specMount := mount
|
||||
if mount.Type == "bind" {
|
||||
// Strip out the uvmpath from the options
|
||||
updatedOptions := []string{}
|
||||
uvmPath := ""
|
||||
readonly := false
|
||||
for _, opt := range mount.Options {
|
||||
dropOption := false
|
||||
elements := strings.SplitN(opt, "=", 2)
|
||||
switch elements[0] {
|
||||
case "uvmpath":
|
||||
uvmPath = elements[1]
|
||||
dropOption = true
|
||||
case "rw":
|
||||
case "ro":
|
||||
readonly = true
|
||||
case "rbind":
|
||||
default:
|
||||
return fmt.Errorf("unsupported option %q", opt)
|
||||
}
|
||||
if !dropOption {
|
||||
updatedOptions = append(updatedOptions, opt)
|
||||
}
|
||||
}
|
||||
mount.Options = updatedOptions
|
||||
if uvmPath == "" {
|
||||
return fmt.Errorf("no uvmpath for bind mount %+v", mount)
|
||||
}
|
||||
md := hcsshim.MappedDir{
|
||||
HostPath: mount.Source,
|
||||
ContainerPath: path.Join(uvmPath, mount.Destination),
|
||||
CreateInUtilityVM: true,
|
||||
ReadOnly: readonly,
|
||||
}
|
||||
mds = append(mds, md)
|
||||
specMount.Source = path.Join(uvmPath, mount.Destination)
|
||||
}
|
||||
specMounts = append(specMounts, specMount)
|
||||
}
|
||||
configuration.MappedDirectories = mds
|
||||
|
||||
hcsContainer, err := hcsshim.CreateContainer(containerID, configuration)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
spec.Mounts = specMounts
|
||||
|
||||
// Construct a container object for calling start on it.
|
||||
container := &container{
|
||||
containerCommon: containerCommon{
|
||||
process: process{
|
||||
processCommon: processCommon{
|
||||
containerID: containerID,
|
||||
client: clnt,
|
||||
friendlyName: InitFriendlyName,
|
||||
},
|
||||
},
|
||||
processes: make(map[string]*process),
|
||||
},
|
||||
ociSpec: spec,
|
||||
hcsContainer: hcsContainer,
|
||||
}
|
||||
|
||||
container.options = options
|
||||
for _, option := range options {
|
||||
if err := option.Apply(container); err != nil {
|
||||
logrus.Errorf("libcontainerd: createLinux() %v", err)
|
||||
}
|
||||
}
|
||||
|
||||
// Call start, and if it fails, delete the container from our
|
||||
// internal structure, start will keep HCS in sync by deleting the
|
||||
// container there.
|
||||
logrus.Debugf("libcontainerd: createLinux() id=%s, Calling start()", containerID)
|
||||
if err := container.start(attachStdio); err != nil {
|
||||
clnt.deleteContainer(containerID)
|
||||
return err
|
||||
}
|
||||
|
||||
logrus.Debugf("libcontainerd: createLinux() id=%s completed successfully", containerID)
|
||||
return nil
|
||||
}
|
||||
|
||||
// AddProcess is the handler for adding a process to an already running
|
||||
// container. It's called through docker exec. It returns the system pid of the
|
||||
// exec'd process.
|
||||
func (clnt *client) AddProcess(ctx context.Context, containerID, processFriendlyName string, procToAdd Process, attachStdio StdioCallback) (int, error) {
|
||||
clnt.lock(containerID)
|
||||
defer clnt.unlock(containerID)
|
||||
container, err := clnt.getContainer(containerID)
|
||||
if err != nil {
|
||||
return -1, err
|
||||
}
|
||||
|
||||
defer container.debugGCS()
|
||||
|
||||
// Note we always tell HCS to
|
||||
// create stdout as it's required regardless of '-i' or '-t' options, so that
|
||||
// docker can always grab the output through logs. We also tell HCS to always
|
||||
// create stdin, even if it's not used - it will be closed shortly. Stderr
|
||||
// is only created if it we're not -t.
|
||||
createProcessParms := hcsshim.ProcessConfig{
|
||||
CreateStdInPipe: true,
|
||||
CreateStdOutPipe: true,
|
||||
CreateStdErrPipe: !procToAdd.Terminal,
|
||||
}
|
||||
if procToAdd.Terminal {
|
||||
createProcessParms.EmulateConsole = true
|
||||
if procToAdd.ConsoleSize != nil {
|
||||
createProcessParms.ConsoleSize[0] = uint(procToAdd.ConsoleSize.Height)
|
||||
createProcessParms.ConsoleSize[1] = uint(procToAdd.ConsoleSize.Width)
|
||||
}
|
||||
}
|
||||
|
||||
// Take working directory from the process to add if it is defined,
|
||||
// otherwise take from the first process.
|
||||
if procToAdd.Cwd != "" {
|
||||
createProcessParms.WorkingDirectory = procToAdd.Cwd
|
||||
} else {
|
||||
createProcessParms.WorkingDirectory = container.ociSpec.Process.Cwd
|
||||
}
|
||||
|
||||
// Configure the environment for the process
|
||||
createProcessParms.Environment = setupEnvironmentVariables(procToAdd.Env)
|
||||
if container.isWindows {
|
||||
createProcessParms.CommandLine = strings.Join(procToAdd.Args, " ")
|
||||
} else {
|
||||
createProcessParms.CommandArgs = procToAdd.Args
|
||||
}
|
||||
createProcessParms.User = procToAdd.User.Username
|
||||
|
||||
logrus.Debugf("libcontainerd: commandLine: %s", createProcessParms.CommandLine)
|
||||
|
||||
// Start the command running in the container.
|
||||
var stdout, stderr io.ReadCloser
|
||||
var stdin io.WriteCloser
|
||||
newProcess, err := container.hcsContainer.CreateProcess(&createProcessParms)
|
||||
if err != nil {
|
||||
logrus.Errorf("libcontainerd: AddProcess(%s) CreateProcess() failed %s", containerID, err)
|
||||
return -1, err
|
||||
}
|
||||
|
||||
pid := newProcess.Pid()
|
||||
|
||||
stdin, stdout, stderr, err = newProcess.Stdio()
|
||||
if err != nil {
|
||||
logrus.Errorf("libcontainerd: %s getting std pipes failed %s", containerID, err)
|
||||
return -1, err
|
||||
}
|
||||
|
||||
iopipe := &IOPipe{Terminal: procToAdd.Terminal}
|
||||
iopipe.Stdin = createStdInCloser(stdin, newProcess)
|
||||
|
||||
// Convert io.ReadClosers to io.Readers
|
||||
if stdout != nil {
|
||||
iopipe.Stdout = ioutil.NopCloser(&autoClosingReader{ReadCloser: stdout})
|
||||
}
|
||||
if stderr != nil {
|
||||
iopipe.Stderr = ioutil.NopCloser(&autoClosingReader{ReadCloser: stderr})
|
||||
}
|
||||
|
||||
proc := &process{
|
||||
processCommon: processCommon{
|
||||
containerID: containerID,
|
||||
friendlyName: processFriendlyName,
|
||||
client: clnt,
|
||||
systemPid: uint32(pid),
|
||||
},
|
||||
hcsProcess: newProcess,
|
||||
}
|
||||
|
||||
// Add the process to the container's list of processes
|
||||
container.processes[processFriendlyName] = proc
|
||||
|
||||
// Tell the engine to attach streams back to the client
|
||||
if err := attachStdio(*iopipe); err != nil {
|
||||
return -1, err
|
||||
}
|
||||
|
||||
// Spin up a go routine waiting for exit to handle cleanup
|
||||
go container.waitExit(proc, false)
|
||||
|
||||
return pid, nil
|
||||
}
|
||||
|
||||
// Signal handles `docker stop` on Windows. While Linux has support for
|
||||
// the full range of signals, signals aren't really implemented on Windows.
|
||||
// We fake supporting regular stop and -9 to force kill.
|
||||
func (clnt *client) Signal(containerID string, sig int) error {
|
||||
var (
|
||||
cont *container
|
||||
err error
|
||||
)
|
||||
|
||||
// Get the container as we need it to get the container handle.
|
||||
clnt.lock(containerID)
|
||||
defer clnt.unlock(containerID)
|
||||
if cont, err = clnt.getContainer(containerID); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
cont.manualStopRequested = true
|
||||
|
||||
logrus.Debugf("libcontainerd: Signal() containerID=%s sig=%d pid=%d", containerID, sig, cont.systemPid)
|
||||
|
||||
if syscall.Signal(sig) == syscall.SIGKILL {
|
||||
// Terminate the compute system
|
||||
if err := cont.hcsContainer.Terminate(); err != nil {
|
||||
if !hcsshim.IsPending(err) {
|
||||
logrus.Errorf("libcontainerd: failed to terminate %s - %q", containerID, err)
|
||||
}
|
||||
}
|
||||
} else {
|
||||
// Shut down the container
|
||||
if err := cont.hcsContainer.Shutdown(); err != nil {
|
||||
if !hcsshim.IsPending(err) && !hcsshim.IsAlreadyStopped(err) {
|
||||
// ignore errors
|
||||
logrus.Warnf("libcontainerd: failed to shutdown container %s: %q", containerID, err)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// While Linux has support for the full range of signals, signals aren't really implemented on Windows.
|
||||
// We try to terminate the specified process whatever signal is requested.
|
||||
func (clnt *client) SignalProcess(containerID string, processFriendlyName string, sig int) error {
|
||||
clnt.lock(containerID)
|
||||
defer clnt.unlock(containerID)
|
||||
cont, err := clnt.getContainer(containerID)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
for _, p := range cont.processes {
|
||||
if p.friendlyName == processFriendlyName {
|
||||
return p.hcsProcess.Kill()
|
||||
}
|
||||
}
|
||||
|
||||
return fmt.Errorf("SignalProcess could not find process %s in %s", processFriendlyName, containerID)
|
||||
}
|
||||
|
||||
// Resize handles a CLI event to resize an interactive docker run or docker exec
|
||||
// window.
|
||||
func (clnt *client) Resize(containerID, processFriendlyName string, width, height int) error {
|
||||
// Get the libcontainerd container object
|
||||
clnt.lock(containerID)
|
||||
defer clnt.unlock(containerID)
|
||||
cont, err := clnt.getContainer(containerID)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
h, w := uint16(height), uint16(width)
|
||||
|
||||
if processFriendlyName == InitFriendlyName {
|
||||
logrus.Debugln("libcontainerd: resizing systemPID in", containerID, cont.process.systemPid)
|
||||
return cont.process.hcsProcess.ResizeConsole(w, h)
|
||||
}
|
||||
|
||||
for _, p := range cont.processes {
|
||||
if p.friendlyName == processFriendlyName {
|
||||
logrus.Debugln("libcontainerd: resizing exec'd process", containerID, p.systemPid)
|
||||
return p.hcsProcess.ResizeConsole(w, h)
|
||||
}
|
||||
}
|
||||
|
||||
return fmt.Errorf("Resize could not find containerID %s to resize", containerID)
|
||||
|
||||
}
|
||||
|
||||
// Pause handles pause requests for containers
|
||||
func (clnt *client) Pause(containerID string) error {
|
||||
unlockContainer := true
|
||||
// Get the libcontainerd container object
|
||||
clnt.lock(containerID)
|
||||
defer func() {
|
||||
if unlockContainer {
|
||||
clnt.unlock(containerID)
|
||||
}
|
||||
}()
|
||||
container, err := clnt.getContainer(containerID)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if container.ociSpec.Windows.HyperV == nil {
|
||||
return errors.New("cannot pause Windows Server Containers")
|
||||
}
|
||||
|
||||
err = container.hcsContainer.Pause()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// Unlock container before calling back into the daemon
|
||||
unlockContainer = false
|
||||
clnt.unlock(containerID)
|
||||
|
||||
return clnt.backend.StateChanged(containerID, StateInfo{
|
||||
CommonStateInfo: CommonStateInfo{
|
||||
State: StatePause,
|
||||
}})
|
||||
}
|
||||
|
||||
// Resume handles resume requests for containers
|
||||
func (clnt *client) Resume(containerID string) error {
|
||||
unlockContainer := true
|
||||
// Get the libcontainerd container object
|
||||
clnt.lock(containerID)
|
||||
defer func() {
|
||||
if unlockContainer {
|
||||
clnt.unlock(containerID)
|
||||
}
|
||||
}()
|
||||
container, err := clnt.getContainer(containerID)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// This should never happen, since Windows Server Containers cannot be paused
|
||||
|
||||
if container.ociSpec.Windows.HyperV == nil {
|
||||
return errors.New("cannot resume Windows Server Containers")
|
||||
}
|
||||
|
||||
err = container.hcsContainer.Resume()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// Unlock container before calling back into the daemon
|
||||
unlockContainer = false
|
||||
clnt.unlock(containerID)
|
||||
|
||||
return clnt.backend.StateChanged(containerID, StateInfo{
|
||||
CommonStateInfo: CommonStateInfo{
|
||||
State: StateResume,
|
||||
}})
|
||||
}
|
||||
|
||||
// Stats handles stats requests for containers
|
||||
func (clnt *client) Stats(containerID string) (*Stats, error) {
|
||||
// Get the libcontainerd container object
|
||||
clnt.lock(containerID)
|
||||
defer clnt.unlock(containerID)
|
||||
container, err := clnt.getContainer(containerID)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
s, err := container.hcsContainer.Statistics()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
st := Stats(s)
|
||||
return &st, nil
|
||||
}
|
||||
|
||||
// Restore is the handler for restoring a container
|
||||
func (clnt *client) Restore(containerID string, _ StdioCallback, unusedOnWindows ...CreateOption) error {
|
||||
logrus.Debugf("libcontainerd: Restore(%s)", containerID)
|
||||
|
||||
// TODO Windows: On RS1, a re-attach isn't possible.
|
||||
// However, there is a scenario in which there is an issue.
|
||||
// Consider a background container. The daemon dies unexpectedly.
|
||||
// HCS will still have the compute service alive and running.
|
||||
// For consistence, we call in to shoot it regardless if HCS knows about it
|
||||
// We explicitly just log a warning if the terminate fails.
|
||||
// Then we tell the backend the container exited.
|
||||
if hc, err := hcsshim.OpenContainer(containerID); err == nil {
|
||||
const terminateTimeout = time.Minute * 2
|
||||
err := hc.Terminate()
|
||||
|
||||
if hcsshim.IsPending(err) {
|
||||
err = hc.WaitTimeout(terminateTimeout)
|
||||
} else if hcsshim.IsAlreadyStopped(err) {
|
||||
err = nil
|
||||
}
|
||||
|
||||
if err != nil {
|
||||
logrus.Warnf("libcontainerd: failed to terminate %s on restore - %q", containerID, err)
|
||||
return err
|
||||
}
|
||||
}
|
||||
return clnt.backend.StateChanged(containerID, StateInfo{
|
||||
CommonStateInfo: CommonStateInfo{
|
||||
State: StateExit,
|
||||
ExitCode: 1 << 31,
|
||||
}})
|
||||
}
|
||||
|
||||
// GetPidsForContainer returns a list of process IDs running in a container.
|
||||
// Not used on Windows.
|
||||
func (clnt *client) GetPidsForContainer(containerID string) ([]int, error) {
|
||||
return nil, errors.New("not implemented on Windows")
|
||||
}
|
||||
|
||||
// Summary returns a summary of the processes running in a container.
|
||||
// This is present in Windows to support docker top. In linux, the
|
||||
// engine shells out to ps to get process information. On Windows, as
|
||||
// the containers could be Hyper-V containers, they would not be
|
||||
// visible on the container host. However, libcontainerd does have
|
||||
// that information.
|
||||
func (clnt *client) Summary(containerID string) ([]Summary, error) {
|
||||
|
||||
// Get the libcontainerd container object
|
||||
clnt.lock(containerID)
|
||||
defer clnt.unlock(containerID)
|
||||
container, err := clnt.getContainer(containerID)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
p, err := container.hcsContainer.ProcessList()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
pl := make([]Summary, len(p))
|
||||
for i := range p {
|
||||
pl[i] = Summary(p[i])
|
||||
}
|
||||
return pl, nil
|
||||
}
|
||||
|
||||
// UpdateResources updates resources for a running container.
|
||||
func (clnt *client) UpdateResources(containerID string, resources Resources) error {
|
||||
// Updating resource isn't supported on Windows
|
||||
// but we should return nil for enabling updating container
|
||||
return nil
|
||||
}
|
||||
|
||||
func (clnt *client) CreateCheckpoint(containerID string, checkpointID string, checkpointDir string, exit bool) error {
|
||||
return errors.New("Windows: Containers do not support checkpoints")
|
||||
}
|
||||
|
||||
func (clnt *client) DeleteCheckpoint(containerID string, checkpointID string, checkpointDir string) error {
|
||||
return errors.New("Windows: Containers do not support checkpoints")
|
||||
}
|
||||
|
||||
func (clnt *client) ListCheckpoints(containerID string, checkpointDir string) (*Checkpoints, error) {
|
||||
return nil, errors.New("Windows: Containers do not support checkpoints")
|
||||
}
|
||||
|
||||
func (clnt *client) GetServerVersion(ctx context.Context) (*ServerVersion, error) {
|
||||
return &ServerVersion{}, nil
|
||||
}
|
|
@ -1,13 +0,0 @@
|
|||
package libcontainerd
|
||||
|
||||
const (
|
||||
// InitFriendlyName is the name given in the lookup map of processes
|
||||
// for the first process started in a container.
|
||||
InitFriendlyName = "init"
|
||||
configFilename = "config.json"
|
||||
)
|
||||
|
||||
type containerCommon struct {
|
||||
process
|
||||
processes map[string]*process
|
||||
}
|
|
@ -1,246 +0,0 @@
|
|||
// +build linux solaris
|
||||
|
||||
package libcontainerd
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"io"
|
||||
"io/ioutil"
|
||||
"os"
|
||||
"path/filepath"
|
||||
"sync"
|
||||
"time"
|
||||
|
||||
containerd "github.com/containerd/containerd/api/grpc/types"
|
||||
"github.com/docker/docker/pkg/ioutils"
|
||||
specs "github.com/opencontainers/runtime-spec/specs-go"
|
||||
"github.com/sirupsen/logrus"
|
||||
"github.com/tonistiigi/fifo"
|
||||
"golang.org/x/net/context"
|
||||
"golang.org/x/sys/unix"
|
||||
)
|
||||
|
||||
type container struct {
|
||||
containerCommon
|
||||
|
||||
// Platform specific fields are below here.
|
||||
pauseMonitor
|
||||
oom bool
|
||||
runtime string
|
||||
runtimeArgs []string
|
||||
}
|
||||
|
||||
type runtime struct {
|
||||
path string
|
||||
args []string
|
||||
}
|
||||
|
||||
// WithRuntime sets the runtime to be used for the created container
|
||||
func WithRuntime(path string, args []string) CreateOption {
|
||||
return runtime{path, args}
|
||||
}
|
||||
|
||||
func (rt runtime) Apply(p interface{}) error {
|
||||
if pr, ok := p.(*container); ok {
|
||||
pr.runtime = rt.path
|
||||
pr.runtimeArgs = rt.args
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (ctr *container) clean() error {
|
||||
if os.Getenv("LIBCONTAINERD_NOCLEAN") == "1" {
|
||||
return nil
|
||||
}
|
||||
if _, err := os.Lstat(ctr.dir); err != nil {
|
||||
if os.IsNotExist(err) {
|
||||
return nil
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
if err := os.RemoveAll(ctr.dir); err != nil {
|
||||
return err
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// cleanProcess removes the fifos used by an additional process.
|
||||
// Caller needs to lock container ID before calling this method.
|
||||
func (ctr *container) cleanProcess(id string) {
|
||||
if p, ok := ctr.processes[id]; ok {
|
||||
for _, i := range []int{unix.Stdin, unix.Stdout, unix.Stderr} {
|
||||
if err := os.Remove(p.fifo(i)); err != nil && !os.IsNotExist(err) {
|
||||
logrus.Warnf("libcontainerd: failed to remove %v for process %v: %v", p.fifo(i), id, err)
|
||||
}
|
||||
}
|
||||
}
|
||||
delete(ctr.processes, id)
|
||||
}
|
||||
|
||||
func (ctr *container) spec() (*specs.Spec, error) {
|
||||
var spec specs.Spec
|
||||
dt, err := ioutil.ReadFile(filepath.Join(ctr.dir, configFilename))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
if err := json.Unmarshal(dt, &spec); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &spec, nil
|
||||
}
|
||||
|
||||
func (ctr *container) start(spec *specs.Spec, checkpoint, checkpointDir string, attachStdio StdioCallback) (err error) {
|
||||
ctx, cancel := context.WithCancel(context.Background())
|
||||
defer cancel()
|
||||
ready := make(chan struct{})
|
||||
|
||||
fifoCtx, cancel := context.WithCancel(context.Background())
|
||||
defer func() {
|
||||
if err != nil {
|
||||
cancel()
|
||||
}
|
||||
}()
|
||||
|
||||
iopipe, err := ctr.openFifos(fifoCtx, spec.Process.Terminal)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
var stdinOnce sync.Once
|
||||
|
||||
// we need to delay stdin closure after container start or else "stdin close"
|
||||
// event will be rejected by containerd.
|
||||
// stdin closure happens in attachStdio
|
||||
stdin := iopipe.Stdin
|
||||
iopipe.Stdin = ioutils.NewWriteCloserWrapper(stdin, func() error {
|
||||
var err error
|
||||
stdinOnce.Do(func() { // on error from attach we don't know if stdin was already closed
|
||||
err = stdin.Close()
|
||||
go func() {
|
||||
select {
|
||||
case <-ready:
|
||||
case <-ctx.Done():
|
||||
}
|
||||
select {
|
||||
case <-ready:
|
||||
if err := ctr.sendCloseStdin(); err != nil {
|
||||
logrus.Warnf("failed to close stdin: %+v", err)
|
||||
}
|
||||
default:
|
||||
}
|
||||
}()
|
||||
})
|
||||
return err
|
||||
})
|
||||
|
||||
r := &containerd.CreateContainerRequest{
|
||||
Id: ctr.containerID,
|
||||
BundlePath: ctr.dir,
|
||||
Stdin: ctr.fifo(unix.Stdin),
|
||||
Stdout: ctr.fifo(unix.Stdout),
|
||||
Stderr: ctr.fifo(unix.Stderr),
|
||||
Checkpoint: checkpoint,
|
||||
CheckpointDir: checkpointDir,
|
||||
// check to see if we are running in ramdisk to disable pivot root
|
||||
NoPivotRoot: os.Getenv("DOCKER_RAMDISK") != "",
|
||||
Runtime: ctr.runtime,
|
||||
RuntimeArgs: ctr.runtimeArgs,
|
||||
}
|
||||
ctr.client.appendContainer(ctr)
|
||||
|
||||
if err := attachStdio(*iopipe); err != nil {
|
||||
ctr.closeFifos(iopipe)
|
||||
return err
|
||||
}
|
||||
|
||||
resp, err := ctr.client.remote.apiClient.CreateContainer(context.Background(), r)
|
||||
if err != nil {
|
||||
ctr.closeFifos(iopipe)
|
||||
return err
|
||||
}
|
||||
ctr.systemPid = systemPid(resp.Container)
|
||||
close(ready)
|
||||
|
||||
return ctr.client.backend.StateChanged(ctr.containerID, StateInfo{
|
||||
CommonStateInfo: CommonStateInfo{
|
||||
State: StateStart,
|
||||
Pid: ctr.systemPid,
|
||||
}})
|
||||
|
||||
}
|
||||
|
||||
func (ctr *container) newProcess(friendlyName string) *process {
|
||||
return &process{
|
||||
dir: ctr.dir,
|
||||
processCommon: processCommon{
|
||||
containerID: ctr.containerID,
|
||||
friendlyName: friendlyName,
|
||||
client: ctr.client,
|
||||
},
|
||||
}
|
||||
}
|
||||
|
||||
func (ctr *container) handleEvent(e *containerd.Event) error {
|
||||
ctr.client.lock(ctr.containerID)
|
||||
defer ctr.client.unlock(ctr.containerID)
|
||||
switch e.Type {
|
||||
case StateExit, StatePause, StateResume, StateOOM:
|
||||
st := StateInfo{
|
||||
CommonStateInfo: CommonStateInfo{
|
||||
State: e.Type,
|
||||
ExitCode: e.Status,
|
||||
},
|
||||
OOMKilled: e.Type == StateExit && ctr.oom,
|
||||
}
|
||||
if e.Type == StateOOM {
|
||||
ctr.oom = true
|
||||
}
|
||||
if e.Type == StateExit && e.Pid != InitFriendlyName {
|
||||
st.ProcessID = e.Pid
|
||||
st.State = StateExitProcess
|
||||
}
|
||||
|
||||
// Remove process from list if we have exited
|
||||
switch st.State {
|
||||
case StateExit:
|
||||
ctr.clean()
|
||||
ctr.client.deleteContainer(e.Id)
|
||||
case StateExitProcess:
|
||||
ctr.cleanProcess(st.ProcessID)
|
||||
}
|
||||
ctr.client.q.append(e.Id, func() {
|
||||
if err := ctr.client.backend.StateChanged(e.Id, st); err != nil {
|
||||
logrus.Errorf("libcontainerd: backend.StateChanged(): %v", err)
|
||||
}
|
||||
if e.Type == StatePause || e.Type == StateResume {
|
||||
ctr.pauseMonitor.handle(e.Type)
|
||||
}
|
||||
if e.Type == StateExit {
|
||||
if en := ctr.client.getExitNotifier(e.Id); en != nil {
|
||||
en.close()
|
||||
}
|
||||
}
|
||||
})
|
||||
|
||||
default:
|
||||
logrus.Debugf("libcontainerd: event unhandled: %+v", e)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// discardFifos attempts to fully read the container fifos to unblock processes
|
||||
// that may be blocked on the writer side.
|
||||
func (ctr *container) discardFifos() {
|
||||
ctx, _ := context.WithTimeout(context.Background(), 3*time.Second)
|
||||
for _, i := range []int{unix.Stdout, unix.Stderr} {
|
||||
f, err := fifo.OpenFifo(ctx, ctr.fifo(i), unix.O_RDONLY|unix.O_NONBLOCK, 0)
|
||||
if err != nil {
|
||||
logrus.Warnf("error opening fifo %v for discarding: %+v", f, err)
|
||||
continue
|
||||
}
|
||||
go func() {
|
||||
io.Copy(ioutil.Discard, f)
|
||||
}()
|
||||
}
|
||||
}
|
|
@ -1,338 +0,0 @@
|
|||
package libcontainerd
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"io"
|
||||
"io/ioutil"
|
||||
"strings"
|
||||
"time"
|
||||
|
||||
"github.com/Microsoft/hcsshim"
|
||||
"github.com/opencontainers/runtime-spec/specs-go"
|
||||
"github.com/sirupsen/logrus"
|
||||
"golang.org/x/sys/windows"
|
||||
)
|
||||
|
||||
type container struct {
|
||||
containerCommon
|
||||
|
||||
// Platform specific fields are below here. There are none presently on Windows.
|
||||
options []CreateOption
|
||||
|
||||
// The ociSpec is required, as client.Create() needs a spec,
|
||||
// but can be called from the RestartManager context which does not
|
||||
// otherwise have access to the Spec
|
||||
ociSpec specs.Spec
|
||||
|
||||
isWindows bool
|
||||
manualStopRequested bool
|
||||
hcsContainer hcsshim.Container
|
||||
}
|
||||
|
||||
func (ctr *container) newProcess(friendlyName string) *process {
|
||||
return &process{
|
||||
processCommon: processCommon{
|
||||
containerID: ctr.containerID,
|
||||
friendlyName: friendlyName,
|
||||
client: ctr.client,
|
||||
},
|
||||
}
|
||||
}
|
||||
|
||||
// start starts a created container.
|
||||
// Caller needs to lock container ID before calling this method.
|
||||
func (ctr *container) start(attachStdio StdioCallback) error {
|
||||
var err error
|
||||
|
||||
// Start the container. If this is a servicing container, this call will block
|
||||
// until the container is done with the servicing execution.
|
||||
logrus.Debugln("libcontainerd: starting container ", ctr.containerID)
|
||||
if err = ctr.hcsContainer.Start(); err != nil {
|
||||
logrus.Errorf("libcontainerd: failed to start container: %s", err)
|
||||
ctr.debugGCS() // Before terminating!
|
||||
if err := ctr.terminate(); err != nil {
|
||||
logrus.Errorf("libcontainerd: failed to cleanup after a failed Start. %s", err)
|
||||
} else {
|
||||
logrus.Debugln("libcontainerd: cleaned up after failed Start by calling Terminate")
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
defer ctr.debugGCS()
|
||||
|
||||
// Note we always tell HCS to
|
||||
// create stdout as it's required regardless of '-i' or '-t' options, so that
|
||||
// docker can always grab the output through logs. We also tell HCS to always
|
||||
// create stdin, even if it's not used - it will be closed shortly. Stderr
|
||||
// is only created if it we're not -t.
|
||||
var (
|
||||
emulateConsole bool
|
||||
createStdErrPipe bool
|
||||
)
|
||||
if ctr.ociSpec.Process != nil {
|
||||
emulateConsole = ctr.ociSpec.Process.Terminal
|
||||
createStdErrPipe = !ctr.ociSpec.Process.Terminal && !ctr.ociSpec.Windows.Servicing
|
||||
}
|
||||
|
||||
createProcessParms := &hcsshim.ProcessConfig{
|
||||
EmulateConsole: emulateConsole,
|
||||
WorkingDirectory: ctr.ociSpec.Process.Cwd,
|
||||
CreateStdInPipe: !ctr.ociSpec.Windows.Servicing,
|
||||
CreateStdOutPipe: !ctr.ociSpec.Windows.Servicing,
|
||||
CreateStdErrPipe: createStdErrPipe,
|
||||
}
|
||||
|
||||
if ctr.ociSpec.Process != nil && ctr.ociSpec.Process.ConsoleSize != nil {
|
||||
createProcessParms.ConsoleSize[0] = uint(ctr.ociSpec.Process.ConsoleSize.Height)
|
||||
createProcessParms.ConsoleSize[1] = uint(ctr.ociSpec.Process.ConsoleSize.Width)
|
||||
}
|
||||
|
||||
// Configure the environment for the process
|
||||
createProcessParms.Environment = setupEnvironmentVariables(ctr.ociSpec.Process.Env)
|
||||
if ctr.isWindows {
|
||||
createProcessParms.CommandLine = strings.Join(ctr.ociSpec.Process.Args, " ")
|
||||
} else {
|
||||
createProcessParms.CommandArgs = ctr.ociSpec.Process.Args
|
||||
}
|
||||
createProcessParms.User = ctr.ociSpec.Process.User.Username
|
||||
|
||||
// LCOW requires the raw OCI spec passed through HCS and onwards to GCS for the utility VM.
|
||||
if !ctr.isWindows {
|
||||
ociBuf, err := json.Marshal(ctr.ociSpec)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
ociRaw := json.RawMessage(ociBuf)
|
||||
createProcessParms.OCISpecification = &ociRaw
|
||||
}
|
||||
|
||||
// Start the command running in the container.
|
||||
newProcess, err := ctr.hcsContainer.CreateProcess(createProcessParms)
|
||||
if err != nil {
|
||||
logrus.Errorf("libcontainerd: CreateProcess() failed %s", err)
|
||||
if err := ctr.terminate(); err != nil {
|
||||
logrus.Errorf("libcontainerd: failed to cleanup after a failed CreateProcess. %s", err)
|
||||
} else {
|
||||
logrus.Debugln("libcontainerd: cleaned up after failed CreateProcess by calling Terminate")
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
pid := newProcess.Pid()
|
||||
|
||||
// Save the hcs Process and PID
|
||||
ctr.process.friendlyName = InitFriendlyName
|
||||
ctr.process.hcsProcess = newProcess
|
||||
|
||||
// If this is a servicing container, wait on the process synchronously here and
|
||||
// if it succeeds, wait for it cleanly shutdown and merge into the parent container.
|
||||
if ctr.ociSpec.Windows.Servicing {
|
||||
exitCode := ctr.waitProcessExitCode(&ctr.process)
|
||||
|
||||
if exitCode != 0 {
|
||||
if err := ctr.terminate(); err != nil {
|
||||
logrus.Warnf("libcontainerd: terminating servicing container %s failed: %s", ctr.containerID, err)
|
||||
}
|
||||
return fmt.Errorf("libcontainerd: servicing container %s returned non-zero exit code %d", ctr.containerID, exitCode)
|
||||
}
|
||||
|
||||
return ctr.hcsContainer.WaitTimeout(time.Minute * 5)
|
||||
}
|
||||
|
||||
var stdout, stderr io.ReadCloser
|
||||
var stdin io.WriteCloser
|
||||
stdin, stdout, stderr, err = newProcess.Stdio()
|
||||
if err != nil {
|
||||
logrus.Errorf("libcontainerd: failed to get stdio pipes: %s", err)
|
||||
if err := ctr.terminate(); err != nil {
|
||||
logrus.Errorf("libcontainerd: failed to cleanup after a failed Stdio. %s", err)
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
iopipe := &IOPipe{Terminal: ctr.ociSpec.Process.Terminal}
|
||||
|
||||
iopipe.Stdin = createStdInCloser(stdin, newProcess)
|
||||
|
||||
// Convert io.ReadClosers to io.Readers
|
||||
if stdout != nil {
|
||||
iopipe.Stdout = ioutil.NopCloser(&autoClosingReader{ReadCloser: stdout})
|
||||
}
|
||||
if stderr != nil {
|
||||
iopipe.Stderr = ioutil.NopCloser(&autoClosingReader{ReadCloser: stderr})
|
||||
}
|
||||
|
||||
// Save the PID
|
||||
logrus.Debugf("libcontainerd: process started - PID %d", pid)
|
||||
ctr.systemPid = uint32(pid)
|
||||
|
||||
// Spin up a go routine waiting for exit to handle cleanup
|
||||
go ctr.waitExit(&ctr.process, true)
|
||||
|
||||
ctr.client.appendContainer(ctr)
|
||||
|
||||
if err := attachStdio(*iopipe); err != nil {
|
||||
// OK to return the error here, as waitExit will handle tear-down in HCS
|
||||
return err
|
||||
}
|
||||
|
||||
// Tell the docker engine that the container has started.
|
||||
si := StateInfo{
|
||||
CommonStateInfo: CommonStateInfo{
|
||||
State: StateStart,
|
||||
Pid: ctr.systemPid, // Not sure this is needed? Double-check monitor.go in daemon BUGBUG @jhowardmsft
|
||||
}}
|
||||
logrus.Debugf("libcontainerd: start() completed OK, %+v", si)
|
||||
return ctr.client.backend.StateChanged(ctr.containerID, si)
|
||||
|
||||
}
|
||||
|
||||
// waitProcessExitCode will wait for the given process to exit and return its error code.
|
||||
func (ctr *container) waitProcessExitCode(process *process) int {
|
||||
// Block indefinitely for the process to exit.
|
||||
err := process.hcsProcess.Wait()
|
||||
if err != nil {
|
||||
if herr, ok := err.(*hcsshim.ProcessError); ok && herr.Err != windows.ERROR_BROKEN_PIPE {
|
||||
logrus.Warnf("libcontainerd: Wait() failed (container may have been killed): %s", err)
|
||||
}
|
||||
// Fall through here, do not return. This ensures we attempt to continue the
|
||||
// shutdown in HCS and tell the docker engine that the process/container
|
||||
// has exited to avoid a container being dropped on the floor.
|
||||
}
|
||||
|
||||
exitCode, err := process.hcsProcess.ExitCode()
|
||||
if err != nil {
|
||||
if herr, ok := err.(*hcsshim.ProcessError); ok && herr.Err != windows.ERROR_BROKEN_PIPE {
|
||||
logrus.Warnf("libcontainerd: unable to get exit code from container %s", ctr.containerID)
|
||||
}
|
||||
// Since we got an error retrieving the exit code, make sure that the code we return
|
||||
// doesn't incorrectly indicate success.
|
||||
exitCode = -1
|
||||
|
||||
// Fall through here, do not return. This ensures we attempt to continue the
|
||||
// shutdown in HCS and tell the docker engine that the process/container
|
||||
// has exited to avoid a container being dropped on the floor.
|
||||
}
|
||||
|
||||
return exitCode
|
||||
}
|
||||
|
||||
// waitExit runs as a goroutine waiting for the process to exit. It's
|
||||
// equivalent to (in the linux containerd world) where events come in for
|
||||
// state change notifications from containerd.
|
||||
func (ctr *container) waitExit(process *process, isFirstProcessToStart bool) error {
|
||||
logrus.Debugln("libcontainerd: waitExit() on pid", process.systemPid)
|
||||
|
||||
exitCode := ctr.waitProcessExitCode(process)
|
||||
// Lock the container while removing the process/container from the list
|
||||
ctr.client.lock(ctr.containerID)
|
||||
|
||||
if !isFirstProcessToStart {
|
||||
ctr.cleanProcess(process.friendlyName)
|
||||
} else {
|
||||
ctr.client.deleteContainer(ctr.containerID)
|
||||
}
|
||||
|
||||
// Unlock here so other threads are unblocked
|
||||
ctr.client.unlock(ctr.containerID)
|
||||
|
||||
// Assume the container has exited
|
||||
si := StateInfo{
|
||||
CommonStateInfo: CommonStateInfo{
|
||||
State: StateExit,
|
||||
ExitCode: uint32(exitCode),
|
||||
Pid: process.systemPid,
|
||||
ProcessID: process.friendlyName,
|
||||
},
|
||||
UpdatePending: false,
|
||||
}
|
||||
|
||||
// But it could have been an exec'd process which exited
|
||||
if !isFirstProcessToStart {
|
||||
si.State = StateExitProcess
|
||||
} else {
|
||||
// Pending updates is only applicable for WCOW
|
||||
if ctr.isWindows {
|
||||
updatePending, err := ctr.hcsContainer.HasPendingUpdates()
|
||||
if err != nil {
|
||||
logrus.Warnf("libcontainerd: HasPendingUpdates() failed (container may have been killed): %s", err)
|
||||
} else {
|
||||
si.UpdatePending = updatePending
|
||||
}
|
||||
}
|
||||
|
||||
logrus.Debugf("libcontainerd: shutting down container %s", ctr.containerID)
|
||||
if err := ctr.shutdown(); err != nil {
|
||||
logrus.Debugf("libcontainerd: failed to shutdown container %s", ctr.containerID)
|
||||
} else {
|
||||
logrus.Debugf("libcontainerd: completed shutting down container %s", ctr.containerID)
|
||||
}
|
||||
if err := ctr.hcsContainer.Close(); err != nil {
|
||||
logrus.Error(err)
|
||||
}
|
||||
}
|
||||
|
||||
if err := process.hcsProcess.Close(); err != nil {
|
||||
logrus.Errorf("libcontainerd: hcsProcess.Close(): %v", err)
|
||||
}
|
||||
|
||||
// Call into the backend to notify it of the state change.
|
||||
logrus.Debugf("libcontainerd: waitExit() calling backend.StateChanged %+v", si)
|
||||
if err := ctr.client.backend.StateChanged(ctr.containerID, si); err != nil {
|
||||
logrus.Error(err)
|
||||
}
|
||||
|
||||
logrus.Debugf("libcontainerd: waitExit() completed OK, %+v", si)
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// cleanProcess removes process from the map.
|
||||
// Caller needs to lock container ID before calling this method.
|
||||
func (ctr *container) cleanProcess(id string) {
|
||||
delete(ctr.processes, id)
|
||||
}
|
||||
|
||||
// shutdown shuts down the container in HCS
|
||||
// Caller needs to lock container ID before calling this method.
|
||||
func (ctr *container) shutdown() error {
|
||||
const shutdownTimeout = time.Minute * 5
|
||||
err := ctr.hcsContainer.Shutdown()
|
||||
if hcsshim.IsPending(err) {
|
||||
// Explicit timeout to avoid a (remote) possibility that shutdown hangs indefinitely.
|
||||
err = ctr.hcsContainer.WaitTimeout(shutdownTimeout)
|
||||
} else if hcsshim.IsAlreadyStopped(err) {
|
||||
err = nil
|
||||
}
|
||||
|
||||
if err != nil {
|
||||
logrus.Debugf("libcontainerd: error shutting down container %s %v calling terminate", ctr.containerID, err)
|
||||
if err := ctr.terminate(); err != nil {
|
||||
return err
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// terminate terminates the container in HCS
|
||||
// Caller needs to lock container ID before calling this method.
|
||||
func (ctr *container) terminate() error {
|
||||
const terminateTimeout = time.Minute * 5
|
||||
err := ctr.hcsContainer.Terminate()
|
||||
|
||||
if hcsshim.IsPending(err) {
|
||||
err = ctr.hcsContainer.WaitTimeout(terminateTimeout)
|
||||
} else if hcsshim.IsAlreadyStopped(err) {
|
||||
err = nil
|
||||
}
|
||||
|
||||
if err != nil {
|
||||
logrus.Debugf("libcontainerd: error terminating container %s %v", ctr.containerID, err)
|
||||
return err
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
46
libcontainerd/errors.go
Normal file
46
libcontainerd/errors.go
Normal file
|
@ -0,0 +1,46 @@
|
|||
package libcontainerd
|
||||
|
||||
import "errors"
|
||||
|
||||
type liberr struct {
|
||||
err error
|
||||
}
|
||||
|
||||
func (e liberr) Error() string {
|
||||
return e.err.Error()
|
||||
}
|
||||
|
||||
func (e liberr) Cause() error {
|
||||
return e.err
|
||||
}
|
||||
|
||||
type notFoundErr struct {
|
||||
liberr
|
||||
}
|
||||
|
||||
func (notFoundErr) NotFound() {}
|
||||
|
||||
func newNotFoundError(err string) error { return notFoundErr{liberr{errors.New(err)}} }
|
||||
func wrapNotFoundError(err error) error { return notFoundErr{liberr{err}} }
|
||||
|
||||
type invalidParamErr struct {
|
||||
liberr
|
||||
}
|
||||
|
||||
func (invalidParamErr) InvalidParameter() {}
|
||||
|
||||
func newInvalidParameterError(err string) error { return invalidParamErr{liberr{errors.New(err)}} }
|
||||
|
||||
type conflictErr struct {
|
||||
liberr
|
||||
}
|
||||
|
||||
func (conflictErr) ConflictErr() {}
|
||||
|
||||
func newConflictError(err string) error { return conflictErr{liberr{errors.New(err)}} }
|
||||
|
||||
type sysErr struct {
|
||||
liberr
|
||||
}
|
||||
|
||||
func wrapSystemError(err error) error { return sysErr{liberr{err}} }
|
36
libcontainerd/io.go
Normal file
36
libcontainerd/io.go
Normal file
|
@ -0,0 +1,36 @@
|
|||
package libcontainerd
|
||||
|
||||
import "github.com/containerd/containerd"
|
||||
|
||||
// Config returns the containerd.IOConfig of this pipe set
|
||||
func (p *IOPipe) Config() containerd.IOConfig {
|
||||
return p.config
|
||||
}
|
||||
|
||||
// Cancel aborts ongoing operations if they have not completed yet
|
||||
func (p *IOPipe) Cancel() {
|
||||
p.cancel()
|
||||
}
|
||||
|
||||
// Wait waits for io operations to finish
|
||||
func (p *IOPipe) Wait() {
|
||||
}
|
||||
|
||||
// Close closes the underlying pipes
|
||||
func (p *IOPipe) Close() error {
|
||||
p.cancel()
|
||||
|
||||
if p.Stdin != nil {
|
||||
p.Stdin.Close()
|
||||
}
|
||||
|
||||
if p.Stdout != nil {
|
||||
p.Stdout.Close()
|
||||
}
|
||||
|
||||
if p.Stderr != nil {
|
||||
p.Stderr.Close()
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
60
libcontainerd/io_unix.go
Normal file
60
libcontainerd/io_unix.go
Normal file
|
@ -0,0 +1,60 @@
|
|||
// +build !windows
|
||||
|
||||
package libcontainerd
|
||||
|
||||
import (
|
||||
"context"
|
||||
"io"
|
||||
"syscall"
|
||||
|
||||
"github.com/containerd/containerd"
|
||||
"github.com/containerd/fifo"
|
||||
"github.com/pkg/errors"
|
||||
)
|
||||
|
||||
func newIOPipe(fifos *containerd.FIFOSet) (*IOPipe, error) {
|
||||
var (
|
||||
err error
|
||||
ctx, cancel = context.WithCancel(context.Background())
|
||||
f io.ReadWriteCloser
|
||||
iop = &IOPipe{
|
||||
Terminal: fifos.Terminal,
|
||||
cancel: cancel,
|
||||
config: containerd.IOConfig{
|
||||
Terminal: fifos.Terminal,
|
||||
Stdin: fifos.In,
|
||||
Stdout: fifos.Out,
|
||||
Stderr: fifos.Err,
|
||||
},
|
||||
}
|
||||
)
|
||||
defer func() {
|
||||
if err != nil {
|
||||
cancel()
|
||||
iop.Close()
|
||||
}
|
||||
}()
|
||||
|
||||
if fifos.In != "" {
|
||||
if f, err = fifo.OpenFifo(ctx, fifos.In, syscall.O_WRONLY|syscall.O_CREAT|syscall.O_NONBLOCK, 0700); err != nil {
|
||||
return nil, errors.WithStack(err)
|
||||
}
|
||||
iop.Stdin = f
|
||||
}
|
||||
|
||||
if fifos.Out != "" {
|
||||
if f, err = fifo.OpenFifo(ctx, fifos.Out, syscall.O_RDONLY|syscall.O_CREAT|syscall.O_NONBLOCK, 0700); err != nil {
|
||||
return nil, errors.WithStack(err)
|
||||
}
|
||||
iop.Stdout = f
|
||||
}
|
||||
|
||||
if fifos.Err != "" {
|
||||
if f, err = fifo.OpenFifo(ctx, fifos.Err, syscall.O_RDONLY|syscall.O_CREAT|syscall.O_NONBLOCK, 0700); err != nil {
|
||||
return nil, errors.WithStack(err)
|
||||
}
|
||||
iop.Stderr = f
|
||||
}
|
||||
|
||||
return iop, nil
|
||||
}
|
138
libcontainerd/io_windows.go
Normal file
138
libcontainerd/io_windows.go
Normal file
|
@ -0,0 +1,138 @@
|
|||
package libcontainerd
|
||||
|
||||
import (
|
||||
"context"
|
||||
"io"
|
||||
"net"
|
||||
"sync"
|
||||
|
||||
winio "github.com/Microsoft/go-winio"
|
||||
"github.com/containerd/containerd"
|
||||
"github.com/pkg/errors"
|
||||
)
|
||||
|
||||
type winpipe struct {
|
||||
sync.Mutex
|
||||
|
||||
ctx context.Context
|
||||
listener net.Listener
|
||||
readyCh chan struct{}
|
||||
readyErr error
|
||||
|
||||
client net.Conn
|
||||
}
|
||||
|
||||
func newWinpipe(ctx context.Context, pipe string) (*winpipe, error) {
|
||||
l, err := winio.ListenPipe(pipe, nil)
|
||||
if err != nil {
|
||||
return nil, errors.Wrapf(err, "%q pipe creation failed", pipe)
|
||||
}
|
||||
wp := &winpipe{
|
||||
ctx: ctx,
|
||||
listener: l,
|
||||
readyCh: make(chan struct{}),
|
||||
}
|
||||
go func() {
|
||||
go func() {
|
||||
defer close(wp.readyCh)
|
||||
defer wp.listener.Close()
|
||||
c, err := wp.listener.Accept()
|
||||
if err != nil {
|
||||
wp.Lock()
|
||||
if wp.readyErr == nil {
|
||||
wp.readyErr = err
|
||||
}
|
||||
wp.Unlock()
|
||||
return
|
||||
}
|
||||
wp.client = c
|
||||
}()
|
||||
|
||||
select {
|
||||
case <-wp.readyCh:
|
||||
case <-ctx.Done():
|
||||
wp.Lock()
|
||||
if wp.readyErr == nil {
|
||||
wp.listener.Close()
|
||||
wp.readyErr = ctx.Err()
|
||||
}
|
||||
wp.Unlock()
|
||||
}
|
||||
}()
|
||||
|
||||
return wp, nil
|
||||
}
|
||||
|
||||
func (wp *winpipe) Read(b []byte) (int, error) {
|
||||
select {
|
||||
case <-wp.ctx.Done():
|
||||
return 0, wp.ctx.Err()
|
||||
case <-wp.readyCh:
|
||||
return wp.client.Read(b)
|
||||
}
|
||||
}
|
||||
|
||||
func (wp *winpipe) Write(b []byte) (int, error) {
|
||||
select {
|
||||
case <-wp.ctx.Done():
|
||||
return 0, wp.ctx.Err()
|
||||
case <-wp.readyCh:
|
||||
return wp.client.Write(b)
|
||||
}
|
||||
}
|
||||
|
||||
func (wp *winpipe) Close() error {
|
||||
select {
|
||||
case <-wp.readyCh:
|
||||
return wp.client.Close()
|
||||
default:
|
||||
return nil
|
||||
}
|
||||
}
|
||||
|
||||
func newIOPipe(fifos *containerd.FIFOSet) (*IOPipe, error) {
|
||||
var (
|
||||
err error
|
||||
ctx, cancel = context.WithCancel(context.Background())
|
||||
p io.ReadWriteCloser
|
||||
iop = &IOPipe{
|
||||
Terminal: fifos.Terminal,
|
||||
cancel: cancel,
|
||||
config: containerd.IOConfig{
|
||||
Terminal: fifos.Terminal,
|
||||
Stdin: fifos.In,
|
||||
Stdout: fifos.Out,
|
||||
Stderr: fifos.Err,
|
||||
},
|
||||
}
|
||||
)
|
||||
defer func() {
|
||||
if err != nil {
|
||||
cancel()
|
||||
iop.Close()
|
||||
}
|
||||
}()
|
||||
|
||||
if fifos.In != "" {
|
||||
if p, err = newWinpipe(ctx, fifos.In); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
iop.Stdin = p
|
||||
}
|
||||
|
||||
if fifos.Out != "" {
|
||||
if p, err = newWinpipe(ctx, fifos.Out); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
iop.Stdout = p
|
||||
}
|
||||
|
||||
if fifos.Err != "" {
|
||||
if p, err = newWinpipe(ctx, fifos.Err); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
iop.Stderr = p
|
||||
}
|
||||
|
||||
return iop, nil
|
||||
}
|
|
@ -1,31 +0,0 @@
|
|||
package libcontainerd
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"os"
|
||||
"strconv"
|
||||
|
||||
"github.com/opencontainers/runc/libcontainer/system"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
func setOOMScore(pid, score int) error {
|
||||
oomScoreAdjPath := fmt.Sprintf("/proc/%d/oom_score_adj", pid)
|
||||
f, err := os.OpenFile(oomScoreAdjPath, os.O_WRONLY, 0)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
stringScore := strconv.Itoa(score)
|
||||
_, err = f.WriteString(stringScore)
|
||||
f.Close()
|
||||
if os.IsPermission(err) {
|
||||
// Setting oom_score_adj does not work in an
|
||||
// unprivileged container. Ignore the error, but log
|
||||
// it if we appear not to be in that situation.
|
||||
if !system.RunningInUserNS() {
|
||||
logrus.Debugf("Permission denied writing %q to %s", stringScore, oomScoreAdjPath)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
return err
|
||||
}
|
|
@ -1,5 +0,0 @@
|
|||
package libcontainerd
|
||||
|
||||
func setOOMScore(pid, score int) error {
|
||||
return nil
|
||||
}
|
|
@ -1,42 +0,0 @@
|
|||
// +build !windows
|
||||
|
||||
package libcontainerd
|
||||
|
||||
import (
|
||||
"sync"
|
||||
)
|
||||
|
||||
// pauseMonitor is helper to get notifications from pause state changes.
|
||||
type pauseMonitor struct {
|
||||
sync.Mutex
|
||||
waiters map[string][]chan struct{}
|
||||
}
|
||||
|
||||
func (m *pauseMonitor) handle(t string) {
|
||||
m.Lock()
|
||||
defer m.Unlock()
|
||||
if m.waiters == nil {
|
||||
return
|
||||
}
|
||||
q, ok := m.waiters[t]
|
||||
if !ok {
|
||||
return
|
||||
}
|
||||
if len(q) > 0 {
|
||||
close(q[0])
|
||||
m.waiters[t] = q[1:]
|
||||
}
|
||||
}
|
||||
|
||||
func (m *pauseMonitor) append(t string, waiter chan struct{}) {
|
||||
m.Lock()
|
||||
defer m.Unlock()
|
||||
if m.waiters == nil {
|
||||
m.waiters = make(map[string][]chan struct{})
|
||||
}
|
||||
_, ok := m.waiters[t]
|
||||
if !ok {
|
||||
m.waiters[t] = make([]chan struct{}, 0)
|
||||
}
|
||||
m.waiters[t] = append(m.waiters[t], waiter)
|
||||
}
|
|
@ -1,18 +0,0 @@
|
|||
package libcontainerd
|
||||
|
||||
// processCommon are the platform common fields as part of the process structure
|
||||
// which keeps the state for the main container process, as well as any exec
|
||||
// processes.
|
||||
type processCommon struct {
|
||||
client *client
|
||||
|
||||
// containerID is the Container ID
|
||||
containerID string
|
||||
|
||||
// friendlyName is an identifier for the process (or `InitFriendlyName`
|
||||
// for the first process)
|
||||
friendlyName string
|
||||
|
||||
// systemPid is the PID of the main container process
|
||||
systemPid uint32
|
||||
}
|
|
@ -1,107 +0,0 @@
|
|||
// +build linux solaris
|
||||
|
||||
package libcontainerd
|
||||
|
||||
import (
|
||||
"io"
|
||||
"io/ioutil"
|
||||
"os"
|
||||
"path/filepath"
|
||||
goruntime "runtime"
|
||||
"strings"
|
||||
|
||||
containerd "github.com/containerd/containerd/api/grpc/types"
|
||||
"github.com/tonistiigi/fifo"
|
||||
"golang.org/x/net/context"
|
||||
"golang.org/x/sys/unix"
|
||||
)
|
||||
|
||||
var fdNames = map[int]string{
|
||||
unix.Stdin: "stdin",
|
||||
unix.Stdout: "stdout",
|
||||
unix.Stderr: "stderr",
|
||||
}
|
||||
|
||||
// process keeps the state for both main container process and exec process.
|
||||
type process struct {
|
||||
processCommon
|
||||
|
||||
// Platform specific fields are below here.
|
||||
dir string
|
||||
}
|
||||
|
||||
func (p *process) openFifos(ctx context.Context, terminal bool) (pipe *IOPipe, err error) {
|
||||
if err := os.MkdirAll(p.dir, 0700); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
io := &IOPipe{}
|
||||
|
||||
io.Stdin, err = fifo.OpenFifo(ctx, p.fifo(unix.Stdin), unix.O_WRONLY|unix.O_CREAT|unix.O_NONBLOCK, 0700)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
defer func() {
|
||||
if err != nil {
|
||||
io.Stdin.Close()
|
||||
}
|
||||
}()
|
||||
|
||||
io.Stdout, err = fifo.OpenFifo(ctx, p.fifo(unix.Stdout), unix.O_RDONLY|unix.O_CREAT|unix.O_NONBLOCK, 0700)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
defer func() {
|
||||
if err != nil {
|
||||
io.Stdout.Close()
|
||||
}
|
||||
}()
|
||||
|
||||
if goruntime.GOOS == "solaris" || !terminal {
|
||||
// For Solaris terminal handling is done exclusively by the runtime therefore we make no distinction
|
||||
// in the processing for terminal and !terminal cases.
|
||||
io.Stderr, err = fifo.OpenFifo(ctx, p.fifo(unix.Stderr), unix.O_RDONLY|unix.O_CREAT|unix.O_NONBLOCK, 0700)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
defer func() {
|
||||
if err != nil {
|
||||
io.Stderr.Close()
|
||||
}
|
||||
}()
|
||||
} else {
|
||||
io.Stderr = ioutil.NopCloser(emptyReader{})
|
||||
}
|
||||
|
||||
return io, nil
|
||||
}
|
||||
|
||||
func (p *process) sendCloseStdin() error {
|
||||
_, err := p.client.remote.apiClient.UpdateProcess(context.Background(), &containerd.UpdateProcessRequest{
|
||||
Id: p.containerID,
|
||||
Pid: p.friendlyName,
|
||||
CloseStdin: true,
|
||||
})
|
||||
if err != nil && (strings.Contains(err.Error(), "container not found") || strings.Contains(err.Error(), "process not found")) {
|
||||
return nil
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
func (p *process) closeFifos(io *IOPipe) {
|
||||
io.Stdin.Close()
|
||||
io.Stdout.Close()
|
||||
io.Stderr.Close()
|
||||
}
|
||||
|
||||
type emptyReader struct{}
|
||||
|
||||
func (r emptyReader) Read(b []byte) (int, error) {
|
||||
return 0, io.EOF
|
||||
}
|
||||
|
||||
func (p *process) fifo(index int) string {
|
||||
return filepath.Join(p.dir, p.friendlyName+"-"+fdNames[index])
|
||||
}
|
|
@ -8,14 +8,6 @@ import (
|
|||
"github.com/docker/docker/pkg/ioutils"
|
||||
)
|
||||
|
||||
// process keeps the state for both main container process and exec process.
|
||||
type process struct {
|
||||
processCommon
|
||||
|
||||
// Platform specific fields are below here.
|
||||
hcsProcess hcsshim.Process
|
||||
}
|
||||
|
||||
type autoClosingReader struct {
|
||||
io.ReadCloser
|
||||
sync.Once
|
||||
|
@ -23,7 +15,7 @@ type autoClosingReader struct {
|
|||
|
||||
func (r *autoClosingReader) Read(b []byte) (n int, err error) {
|
||||
n, err = r.ReadCloser.Read(b)
|
||||
if err == io.EOF {
|
||||
if err != nil {
|
||||
r.Once.Do(func() { r.ReadCloser.Close() })
|
||||
}
|
||||
return
|
||||
|
@ -46,3 +38,7 @@ func createStdInCloser(pipe io.WriteCloser, process hcsshim.Process) io.WriteClo
|
|||
return nil
|
||||
})
|
||||
}
|
||||
|
||||
func (p *process) Cleanup() error {
|
||||
return nil
|
||||
}
|
||||
|
|
|
@ -1,5 +1,3 @@
|
|||
// +build linux solaris
|
||||
|
||||
package libcontainerd
|
||||
|
||||
import "sync"
|
|
@ -1,5 +1,3 @@
|
|||
// +build linux solaris
|
||||
|
||||
package libcontainerd
|
||||
|
||||
import (
|
|
@ -1,20 +0,0 @@
|
|||
package libcontainerd
|
||||
|
||||
// Remote on Linux defines the accesspoint to the containerd grpc API.
|
||||
// Remote on Windows is largely an unimplemented interface as there is
|
||||
// no remote containerd.
|
||||
type Remote interface {
|
||||
// Client returns a new Client instance connected with given Backend.
|
||||
Client(Backend) (Client, error)
|
||||
// Cleanup stops containerd if it was started by libcontainerd.
|
||||
// Note this is not used on Windows as there is no remote containerd.
|
||||
Cleanup()
|
||||
// UpdateOptions allows various remote options to be updated at runtime.
|
||||
UpdateOptions(...RemoteOption) error
|
||||
}
|
||||
|
||||
// RemoteOption allows to configure parameters of remotes.
|
||||
// This is unused on Windows.
|
||||
type RemoteOption interface {
|
||||
Apply(Remote) error
|
||||
}
|
317
libcontainerd/remote_daemon.go
Normal file
317
libcontainerd/remote_daemon.go
Normal file
|
@ -0,0 +1,317 @@
|
|||
// +build !windows
|
||||
|
||||
package libcontainerd
|
||||
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
"io"
|
||||
"io/ioutil"
|
||||
"os"
|
||||
"os/exec"
|
||||
"path/filepath"
|
||||
"strconv"
|
||||
"strings"
|
||||
"sync"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/BurntSushi/toml"
|
||||
"github.com/containerd/containerd"
|
||||
"github.com/containerd/containerd/server"
|
||||
"github.com/docker/docker/pkg/system"
|
||||
"github.com/pkg/errors"
|
||||
"github.com/sirupsen/logrus"
|
||||
)
|
||||
|
||||
const (
|
||||
maxConnectionRetryCount = 3
|
||||
healthCheckTimeout = 3 * time.Second
|
||||
shutdownTimeout = 15 * time.Second
|
||||
configFile = "containerd.toml"
|
||||
binaryName = "docker-containerd"
|
||||
pidFile = "docker-containerd.pid"
|
||||
)
|
||||
|
||||
type pluginConfigs struct {
|
||||
Plugins map[string]interface{} `toml:"plugins"`
|
||||
}
|
||||
|
||||
type remote struct {
|
||||
sync.RWMutex
|
||||
server.Config
|
||||
|
||||
daemonPid int
|
||||
logger *logrus.Entry
|
||||
|
||||
daemonWaitCh chan struct{}
|
||||
clients []*client
|
||||
shutdownContext context.Context
|
||||
shutdownCancel context.CancelFunc
|
||||
shutdown bool
|
||||
|
||||
// Options
|
||||
startDaemon bool
|
||||
rootDir string
|
||||
stateDir string
|
||||
snapshotter string
|
||||
pluginConfs pluginConfigs
|
||||
}
|
||||
|
||||
// New creates a fresh instance of libcontainerd remote.
|
||||
func New(rootDir, stateDir string, options ...RemoteOption) (rem Remote, err error) {
|
||||
defer func() {
|
||||
if err != nil {
|
||||
err = errors.Wrap(err, "Failed to connect to containerd")
|
||||
}
|
||||
}()
|
||||
|
||||
r := &remote{
|
||||
rootDir: rootDir,
|
||||
stateDir: stateDir,
|
||||
Config: server.Config{
|
||||
Root: filepath.Join(rootDir, "daemon"),
|
||||
State: filepath.Join(stateDir, "daemon"),
|
||||
},
|
||||
pluginConfs: pluginConfigs{make(map[string]interface{})},
|
||||
daemonPid: -1,
|
||||
logger: logrus.WithField("module", "libcontainerd"),
|
||||
}
|
||||
r.shutdownContext, r.shutdownCancel = context.WithCancel(context.Background())
|
||||
|
||||
rem = r
|
||||
for _, option := range options {
|
||||
if err = option.Apply(r); err != nil {
|
||||
return
|
||||
}
|
||||
}
|
||||
r.setDefaults()
|
||||
|
||||
if err = system.MkdirAll(stateDir, 0700, ""); err != nil {
|
||||
return
|
||||
}
|
||||
|
||||
if r.startDaemon {
|
||||
os.Remove(r.GRPC.Address)
|
||||
if err = r.startContainerd(); err != nil {
|
||||
return
|
||||
}
|
||||
defer func() {
|
||||
if err != nil {
|
||||
r.Cleanup()
|
||||
}
|
||||
}()
|
||||
}
|
||||
|
||||
// This connection is just used to monitor the connection
|
||||
client, err := containerd.New(r.GRPC.Address)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
if _, err := client.Version(context.Background()); err != nil {
|
||||
system.KillProcess(r.daemonPid)
|
||||
return nil, errors.Wrapf(err, "unable to get containerd version")
|
||||
}
|
||||
|
||||
go r.monitorConnection(client)
|
||||
|
||||
return r, nil
|
||||
}
|
||||
|
||||
func (r *remote) NewClient(ns string, b Backend) (Client, error) {
|
||||
c := &client{
|
||||
stateDir: r.stateDir,
|
||||
logger: r.logger.WithField("namespace", ns),
|
||||
namespace: ns,
|
||||
backend: b,
|
||||
containers: make(map[string]*container),
|
||||
}
|
||||
|
||||
rclient, err := containerd.New(r.GRPC.Address, containerd.WithDefaultNamespace(ns))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
c.remote = rclient
|
||||
|
||||
go c.processEventStream(r.shutdownContext)
|
||||
|
||||
r.Lock()
|
||||
r.clients = append(r.clients, c)
|
||||
r.Unlock()
|
||||
return c, nil
|
||||
}
|
||||
|
||||
func (r *remote) Cleanup() {
|
||||
if r.daemonPid != -1 {
|
||||
r.shutdownCancel()
|
||||
r.stopDaemon()
|
||||
}
|
||||
|
||||
// cleanup some files
|
||||
os.Remove(filepath.Join(r.stateDir, pidFile))
|
||||
|
||||
r.platformCleanup()
|
||||
}
|
||||
|
||||
func (r *remote) getContainerdPid() (int, error) {
|
||||
pidFile := filepath.Join(r.stateDir, pidFile)
|
||||
f, err := os.OpenFile(pidFile, os.O_RDWR, 0600)
|
||||
if err != nil {
|
||||
if os.IsNotExist(err) {
|
||||
return -1, nil
|
||||
}
|
||||
return -1, err
|
||||
}
|
||||
defer f.Close()
|
||||
|
||||
b := make([]byte, 8)
|
||||
n, err := f.Read(b)
|
||||
if err != nil && err != io.EOF {
|
||||
return -1, err
|
||||
}
|
||||
|
||||
if n > 0 {
|
||||
pid, err := strconv.ParseUint(string(b[:n]), 10, 64)
|
||||
if err != nil {
|
||||
return -1, err
|
||||
}
|
||||
if system.IsProcessAlive(int(pid)) {
|
||||
return int(pid), nil
|
||||
}
|
||||
}
|
||||
|
||||
return -1, nil
|
||||
}
|
||||
|
||||
func (r *remote) getContainerdConfig() (string, error) {
|
||||
path := filepath.Join(r.stateDir, configFile)
|
||||
f, err := os.OpenFile(path, os.O_CREATE|os.O_TRUNC|os.O_WRONLY, 0600)
|
||||
if err != nil {
|
||||
return "", errors.Wrapf(err, "failed to open containerd config file at %s", path)
|
||||
}
|
||||
defer f.Close()
|
||||
|
||||
enc := toml.NewEncoder(f)
|
||||
if err = enc.Encode(r.Config); err != nil {
|
||||
return "", errors.Wrapf(err, "failed to encode general config")
|
||||
}
|
||||
if err = enc.Encode(r.pluginConfs); err != nil {
|
||||
return "", errors.Wrapf(err, "failed to encode plugin configs")
|
||||
}
|
||||
|
||||
return path, nil
|
||||
}
|
||||
|
||||
func (r *remote) startContainerd() error {
|
||||
pid, err := r.getContainerdPid()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if pid != -1 {
|
||||
r.daemonPid = pid
|
||||
logrus.WithField("pid", pid).
|
||||
Infof("libcontainerd: %s is still running", binaryName)
|
||||
return nil
|
||||
}
|
||||
|
||||
configFile, err := r.getContainerdConfig()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
args := []string{"--config", configFile}
|
||||
cmd := exec.Command(binaryName, args...)
|
||||
// redirect containerd logs to docker logs
|
||||
cmd.Stdout = os.Stdout
|
||||
cmd.Stderr = os.Stderr
|
||||
cmd.SysProcAttr = containerdSysProcAttr()
|
||||
// clear the NOTIFY_SOCKET from the env when starting containerd
|
||||
cmd.Env = nil
|
||||
for _, e := range os.Environ() {
|
||||
if !strings.HasPrefix(e, "NOTIFY_SOCKET") {
|
||||
cmd.Env = append(cmd.Env, e)
|
||||
}
|
||||
}
|
||||
if err := cmd.Start(); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
r.daemonWaitCh = make(chan struct{})
|
||||
go func() {
|
||||
// Reap our child when needed
|
||||
if err := cmd.Wait(); err != nil {
|
||||
r.logger.WithError(err).Errorf("containerd did not exit successfully")
|
||||
}
|
||||
close(r.daemonWaitCh)
|
||||
}()
|
||||
|
||||
r.daemonPid = cmd.Process.Pid
|
||||
|
||||
err = ioutil.WriteFile(filepath.Join(r.stateDir, pidFile), []byte(fmt.Sprintf("%d", r.daemonPid)), 0660)
|
||||
if err != nil {
|
||||
system.KillProcess(r.daemonPid)
|
||||
return errors.Wrap(err, "libcontainerd: failed to save daemon pid to disk")
|
||||
}
|
||||
|
||||
logrus.WithField("pid", r.daemonPid).
|
||||
Infof("libcontainerd: started new %s process", binaryName)
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (r *remote) monitorConnection(client *containerd.Client) {
|
||||
var transientFailureCount = 0
|
||||
|
||||
ticker := time.NewTicker(500 * time.Millisecond)
|
||||
defer ticker.Stop()
|
||||
|
||||
for {
|
||||
<-ticker.C
|
||||
ctx, cancel := context.WithTimeout(r.shutdownContext, healthCheckTimeout)
|
||||
_, err := client.IsServing(ctx)
|
||||
cancel()
|
||||
if err == nil {
|
||||
transientFailureCount = 0
|
||||
continue
|
||||
}
|
||||
|
||||
select {
|
||||
case <-r.shutdownContext.Done():
|
||||
r.logger.Info("stopping healtcheck following graceful shutdown")
|
||||
client.Close()
|
||||
return
|
||||
default:
|
||||
}
|
||||
|
||||
r.logger.WithError(err).WithField("binary", binaryName).Debug("daemon is not responding")
|
||||
|
||||
if r.daemonPid != -1 {
|
||||
transientFailureCount++
|
||||
if transientFailureCount >= maxConnectionRetryCount || !system.IsProcessAlive(r.daemonPid) {
|
||||
transientFailureCount = 0
|
||||
if system.IsProcessAlive(r.daemonPid) {
|
||||
r.logger.WithField("pid", r.daemonPid).Info("killing and restarting containerd")
|
||||
// Try to get a stack trace
|
||||
syscall.Kill(r.daemonPid, syscall.SIGUSR1)
|
||||
<-time.After(100 * time.Millisecond)
|
||||
system.KillProcess(r.daemonPid)
|
||||
}
|
||||
<-r.daemonWaitCh
|
||||
var err error
|
||||
client.Close()
|
||||
os.Remove(r.GRPC.Address)
|
||||
if err = r.startContainerd(); err != nil {
|
||||
r.logger.WithError(err).Error("failed restarting containerd")
|
||||
} else {
|
||||
newClient, err := containerd.New(r.GRPC.Address)
|
||||
if err != nil {
|
||||
r.logger.WithError(err).Error("failed connect to containerd")
|
||||
} else {
|
||||
client = newClient
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
141
libcontainerd/remote_daemon_options.go
Normal file
141
libcontainerd/remote_daemon_options.go
Normal file
|
@ -0,0 +1,141 @@
|
|||
// +build !windows
|
||||
|
||||
package libcontainerd
|
||||
|
||||
import "fmt"
|
||||
|
||||
// WithRemoteAddr sets the external containerd socket to connect to.
|
||||
func WithRemoteAddr(addr string) RemoteOption {
|
||||
return rpcAddr(addr)
|
||||
}
|
||||
|
||||
type rpcAddr string
|
||||
|
||||
func (a rpcAddr) Apply(r Remote) error {
|
||||
if remote, ok := r.(*remote); ok {
|
||||
remote.GRPC.Address = string(a)
|
||||
return nil
|
||||
}
|
||||
return fmt.Errorf("WithRemoteAddr option not supported for this remote")
|
||||
}
|
||||
|
||||
// WithRemoteAddrUser sets the uid and gid to create the RPC address with
|
||||
func WithRemoteAddrUser(uid, gid int) RemoteOption {
|
||||
return rpcUser{uid, gid}
|
||||
}
|
||||
|
||||
type rpcUser struct {
|
||||
uid int
|
||||
gid int
|
||||
}
|
||||
|
||||
func (u rpcUser) Apply(r Remote) error {
|
||||
if remote, ok := r.(*remote); ok {
|
||||
remote.GRPC.Uid = u.uid
|
||||
remote.GRPC.Gid = u.gid
|
||||
return nil
|
||||
}
|
||||
return fmt.Errorf("WithRemoteAddr option not supported for this remote")
|
||||
}
|
||||
|
||||
// WithStartDaemon defines if libcontainerd should also run containerd daemon.
|
||||
func WithStartDaemon(start bool) RemoteOption {
|
||||
return startDaemon(start)
|
||||
}
|
||||
|
||||
type startDaemon bool
|
||||
|
||||
func (s startDaemon) Apply(r Remote) error {
|
||||
if remote, ok := r.(*remote); ok {
|
||||
remote.startDaemon = bool(s)
|
||||
return nil
|
||||
}
|
||||
return fmt.Errorf("WithStartDaemon option not supported for this remote")
|
||||
}
|
||||
|
||||
// WithLogLevel defines which log level to starts containerd with.
|
||||
// This only makes sense if WithStartDaemon() was set to true.
|
||||
func WithLogLevel(lvl string) RemoteOption {
|
||||
return logLevel(lvl)
|
||||
}
|
||||
|
||||
type logLevel string
|
||||
|
||||
func (l logLevel) Apply(r Remote) error {
|
||||
if remote, ok := r.(*remote); ok {
|
||||
remote.Debug.Level = string(l)
|
||||
return nil
|
||||
}
|
||||
return fmt.Errorf("WithDebugLog option not supported for this remote")
|
||||
}
|
||||
|
||||
// WithDebugAddress defines at which location the debug GRPC connection
|
||||
// should be made
|
||||
func WithDebugAddress(addr string) RemoteOption {
|
||||
return debugAddress(addr)
|
||||
}
|
||||
|
||||
type debugAddress string
|
||||
|
||||
func (d debugAddress) Apply(r Remote) error {
|
||||
if remote, ok := r.(*remote); ok {
|
||||
remote.Debug.Address = string(d)
|
||||
return nil
|
||||
}
|
||||
return fmt.Errorf("WithDebugAddress option not supported for this remote")
|
||||
}
|
||||
|
||||
// WithMetricsAddress defines at which location the debug GRPC connection
|
||||
// should be made
|
||||
func WithMetricsAddress(addr string) RemoteOption {
|
||||
return metricsAddress(addr)
|
||||
}
|
||||
|
||||
type metricsAddress string
|
||||
|
||||
func (m metricsAddress) Apply(r Remote) error {
|
||||
if remote, ok := r.(*remote); ok {
|
||||
remote.Metrics.Address = string(m)
|
||||
return nil
|
||||
}
|
||||
return fmt.Errorf("WithMetricsAddress option not supported for this remote")
|
||||
}
|
||||
|
||||
// WithSnapshotter defines snapshotter driver should be used
|
||||
func WithSnapshotter(name string) RemoteOption {
|
||||
return snapshotter(name)
|
||||
}
|
||||
|
||||
type snapshotter string
|
||||
|
||||
func (s snapshotter) Apply(r Remote) error {
|
||||
if remote, ok := r.(*remote); ok {
|
||||
remote.snapshotter = string(s)
|
||||
return nil
|
||||
}
|
||||
return fmt.Errorf("WithSnapshotter option not supported for this remote")
|
||||
}
|
||||
|
||||
// WithPlugin allow configuring a containerd plugin
|
||||
// configuration values passed needs to be quoted if quotes are needed in
|
||||
// the toml format.
|
||||
func WithPlugin(name string, conf interface{}) RemoteOption {
|
||||
return pluginConf{
|
||||
name: name,
|
||||
conf: conf,
|
||||
}
|
||||
}
|
||||
|
||||
type pluginConf struct {
|
||||
// Name is the name of the plugin
|
||||
name string
|
||||
conf interface{}
|
||||
}
|
||||
|
||||
func (p pluginConf) Apply(r Remote) error {
|
||||
if remote, ok := r.(*remote); ok {
|
||||
remote.pluginConfs.Plugins[p.name] = p.conf
|
||||
return nil
|
||||
}
|
||||
return fmt.Errorf("WithPlugin option not supported for this remote")
|
||||
}
|
36
libcontainerd/remote_daemon_options_unix.go
Normal file
36
libcontainerd/remote_daemon_options_unix.go
Normal file
|
@ -0,0 +1,36 @@
|
|||
// +build linux solaris
|
||||
|
||||
package libcontainerd
|
||||
|
||||
import "fmt"
|
||||
|
||||
// WithOOMScore defines the oom_score_adj to set for the containerd process.
|
||||
func WithOOMScore(score int) RemoteOption {
|
||||
return oomScore(score)
|
||||
}
|
||||
|
||||
type oomScore int
|
||||
|
||||
func (o oomScore) Apply(r Remote) error {
|
||||
if remote, ok := r.(*remote); ok {
|
||||
remote.OOMScore = int(o)
|
||||
return nil
|
||||
}
|
||||
return fmt.Errorf("WithOOMScore option not supported for this remote")
|
||||
}
|
||||
|
||||
// WithSubreaper sets whether containerd should register itself as a
|
||||
// subreaper
|
||||
func WithSubreaper(reap bool) RemoteOption {
|
||||
return subreaper(reap)
|
||||
}
|
||||
|
||||
type subreaper bool
|
||||
|
||||
func (s subreaper) Apply(r Remote) error {
|
||||
if remote, ok := r.(*remote); ok {
|
||||
remote.Subreaper = bool(s)
|
||||
return nil
|
||||
}
|
||||
return fmt.Errorf("WithSubreaper option not supported for this remote")
|
||||
}
|
56
libcontainerd/remote_daemon_process.go
Normal file
56
libcontainerd/remote_daemon_process.go
Normal file
|
@ -0,0 +1,56 @@
|
|||
// +build !windows
|
||||
|
||||
package libcontainerd
|
||||
|
||||
import "github.com/pkg/errors"
|
||||
|
||||
// process represents the state for the main container process or an exec.
|
||||
type process struct {
|
||||
// id is the logical name of the process
|
||||
id string
|
||||
|
||||
// cid is the container id to which this process belongs
|
||||
cid string
|
||||
|
||||
// pid is the identifier of the process
|
||||
pid uint32
|
||||
|
||||
// io holds the io reader/writer associated with the process
|
||||
io *IOPipe
|
||||
|
||||
// root is the state directory for the process
|
||||
root string
|
||||
}
|
||||
|
||||
func (p *process) ID() string {
|
||||
return p.id
|
||||
}
|
||||
|
||||
func (p *process) Pid() uint32 {
|
||||
return p.pid
|
||||
}
|
||||
|
||||
func (p *process) SetPid(pid uint32) error {
|
||||
if p.pid != 0 {
|
||||
return errors.Errorf("pid is already set to %d", pid)
|
||||
}
|
||||
|
||||
p.pid = pid
|
||||
return nil
|
||||
}
|
||||
|
||||
func (p *process) IOPipe() *IOPipe {
|
||||
return p.io
|
||||
}
|
||||
|
||||
func (p *process) CloseIO() {
|
||||
if p.io.Stdin != nil {
|
||||
p.io.Stdin.Close()
|
||||
}
|
||||
if p.io.Stdout != nil {
|
||||
p.io.Stdout.Close()
|
||||
}
|
||||
if p.io.Stderr != nil {
|
||||
p.io.Stderr.Close()
|
||||
}
|
||||
}
|
Some files were not shown because too many files have changed in this diff Show more
Loading…
Add table
Reference in a new issue