Document.cpp 29 KB

123456789101112131415161718192021222324252627282930313233343536373839404142434445464748495051525354555657585960616263646566676869707172737475767778798081828384858687888990919293949596979899100101102103104105106107108109110111112113114115116117118119120121122123124125126127128129130131132133134135136137138139140141142143144145146147148149150151152153154155156157158159160161162163164165166167168169170171172173174175176177178179180181182183184185186187188189190191192193194195196197198199200201202203204205206207208209210211212213214215216217218219220221222223224225226227228229230231232233234235236237238239240241242243244245246247248249250251252253254255256257258259260261262263264265266267268269270271272273274275276277278279280281282283284285286287288289290291292293294295296297298299300301302303304305306307308309310311312313314315316317318319320321322323324325326327328329330331332333334335336337338339340341342343344345346347348349350351352353354355356357358359360361362363364365366367368369370371372373374375376377378379380381382383384385386387388389390391392393394395396397398399400401402403404405406407408409410411412413414415416417418419420421422423424425426427428429430431432433434435436437438439440441442443444445446447448449450451452453454455456457458459460461462463464465466467468469470471472473474475476477478479480481482483484485486487488489490491492493494495496497498499500501502503504505506507508509510511512513514515516517518519520521522523524525526527528529530531532533534535536537538539540541542543544545546547548549550551552553554555556557558559560561562563564565566567568569570571572573574575576577578579580581582583584585586587588589590591592593594595596597598599600601602603604605606607608609610611612613614615616617618619620621622623624625626627628629630631632633634635636637638639640641642643644645646647648649650651652653654655656657658659660661662663664665666667668669670671672673674675676677678679680681682683684685686687688689690691692693694695696697698699700701702703704705706707708709710711712713714715716717718719720721722723724725726727728729730731732733734735736737738739740741742743744745746747748749750751752753754755756757758759760761762763764765766767768769770771772773774775776777778779780781782783784785786787788789790791792793794795796797798799800801802803804805806807808809810811812813814815816817818819820821822823824825826827828829830831832833834835836837838839840841842843844845846847848849850851852853854855856857858859860861862863864865866867868869870871872873874875876877878879880881882883884885886887888889890891892893894895896897898899900901902903904905906907908909910911912913914915916917918919
  1. /*
  2. * Copyright (c) 2018-2021, Andreas Kling <kling@serenityos.org>
  3. * Copyright (c) 2021, Linus Groh <linusg@serenityos.org>
  4. * Copyright (c) 2021, Luke Wilde <lukew@serenityos.org>
  5. *
  6. * SPDX-License-Identifier: BSD-2-Clause
  7. */
  8. #include <AK/StringBuilder.h>
  9. #include <AK/Utf8View.h>
  10. #include <LibCore/Timer.h>
  11. #include <LibJS/Interpreter.h>
  12. #include <LibJS/Parser.h>
  13. #include <LibJS/Runtime/Function.h>
  14. #include <LibWeb/Bindings/MainThreadVM.h>
  15. #include <LibWeb/Bindings/WindowObject.h>
  16. #include <LibWeb/CSS/StyleResolver.h>
  17. #include <LibWeb/Cookie/ParsedCookie.h>
  18. #include <LibWeb/DOM/Comment.h>
  19. #include <LibWeb/DOM/DOMException.h>
  20. #include <LibWeb/DOM/Document.h>
  21. #include <LibWeb/DOM/DocumentFragment.h>
  22. #include <LibWeb/DOM/DocumentType.h>
  23. #include <LibWeb/DOM/Element.h>
  24. #include <LibWeb/DOM/ElementFactory.h>
  25. #include <LibWeb/DOM/Event.h>
  26. #include <LibWeb/DOM/ExceptionOr.h>
  27. #include <LibWeb/DOM/HTMLCollection.h>
  28. #include <LibWeb/DOM/Range.h>
  29. #include <LibWeb/DOM/ShadowRoot.h>
  30. #include <LibWeb/DOM/Text.h>
  31. #include <LibWeb/DOM/Window.h>
  32. #include <LibWeb/Dump.h>
  33. #include <LibWeb/HTML/AttributeNames.h>
  34. #include <LibWeb/HTML/EventNames.h>
  35. #include <LibWeb/HTML/HTMLAnchorElement.h>
  36. #include <LibWeb/HTML/HTMLAreaElement.h>
  37. #include <LibWeb/HTML/HTMLBodyElement.h>
  38. #include <LibWeb/HTML/HTMLEmbedElement.h>
  39. #include <LibWeb/HTML/HTMLFormElement.h>
  40. #include <LibWeb/HTML/HTMLFrameSetElement.h>
  41. #include <LibWeb/HTML/HTMLHeadElement.h>
  42. #include <LibWeb/HTML/HTMLHtmlElement.h>
  43. #include <LibWeb/HTML/HTMLImageElement.h>
  44. #include <LibWeb/HTML/HTMLScriptElement.h>
  45. #include <LibWeb/HTML/HTMLTitleElement.h>
  46. #include <LibWeb/InProcessWebView.h>
  47. #include <LibWeb/Layout/BlockFormattingContext.h>
  48. #include <LibWeb/Layout/InitialContainingBlockBox.h>
  49. #include <LibWeb/Layout/TreeBuilder.h>
  50. #include <LibWeb/Namespace.h>
  51. #include <LibWeb/Origin.h>
  52. #include <LibWeb/Page/Frame.h>
  53. #include <LibWeb/SVG/TagNames.h>
  54. #include <LibWeb/UIEvents/MouseEvent.h>
  55. #include <ctype.h>
  56. namespace Web::DOM {
  57. Document::Document(const URL& url)
  58. : ParentNode(*this, NodeType::DOCUMENT_NODE)
  59. , m_style_resolver(make<CSS::StyleResolver>(*this))
  60. , m_style_sheets(CSS::StyleSheetList::create(*this))
  61. , m_url(url)
  62. , m_window(Window::create_with_document(*this))
  63. , m_implementation(DOMImplementation::create(*this))
  64. {
  65. m_style_update_timer = Core::Timer::create_single_shot(0, [this] {
  66. update_style();
  67. });
  68. m_forced_layout_timer = Core::Timer::create_single_shot(0, [this] {
  69. force_layout();
  70. });
  71. }
  72. Document::~Document()
  73. {
  74. }
  75. void Document::removed_last_ref()
  76. {
  77. VERIFY(!ref_count());
  78. VERIFY(!m_deletion_has_begun);
  79. if (m_referencing_node_count) {
  80. // The document has reached ref_count==0 but still has nodes keeping it alive.
  81. // At this point, sever all the node links we control.
  82. // If nodes remain elsewhere (e.g JS wrappers), they will keep the document alive.
  83. // NOTE: This makes sure we stay alive across for the duration of the cleanup below.
  84. increment_referencing_node_count();
  85. m_focused_element = nullptr;
  86. m_hovered_node = nullptr;
  87. m_pending_parsing_blocking_script = nullptr;
  88. m_inspected_node = nullptr;
  89. m_scripts_to_execute_when_parsing_has_finished.clear();
  90. m_scripts_to_execute_as_soon_as_possible.clear();
  91. m_associated_inert_template_document = nullptr;
  92. m_interpreter = nullptr;
  93. {
  94. // Gather up all the descendants of this document and prune them from the tree.
  95. // FIXME: This could definitely be more elegant.
  96. NonnullRefPtrVector<Node> descendants;
  97. for_each_in_inclusive_subtree([&](auto& node) {
  98. if (&node != this)
  99. descendants.append(node);
  100. return IterationDecision::Continue;
  101. });
  102. for (auto& node : descendants) {
  103. VERIFY(&node.document() == this);
  104. VERIFY(!node.is_document());
  105. if (node.parent())
  106. node.remove();
  107. }
  108. }
  109. m_in_removed_last_ref = false;
  110. decrement_referencing_node_count();
  111. return;
  112. }
  113. m_in_removed_last_ref = false;
  114. m_deletion_has_begun = true;
  115. delete this;
  116. }
  117. Origin Document::origin() const
  118. {
  119. if (!m_url.is_valid())
  120. return {};
  121. return { m_url.protocol(), m_url.host(), m_url.port() };
  122. }
  123. void Document::set_origin(const Origin& origin)
  124. {
  125. m_url.set_protocol(origin.protocol());
  126. m_url.set_host(origin.host());
  127. m_url.set_port(origin.port());
  128. }
  129. void Document::schedule_style_update()
  130. {
  131. if (m_style_update_timer->is_active())
  132. return;
  133. m_style_update_timer->start();
  134. }
  135. void Document::schedule_forced_layout()
  136. {
  137. if (m_forced_layout_timer->is_active())
  138. return;
  139. m_forced_layout_timer->start();
  140. }
  141. bool Document::is_child_allowed(const Node& node) const
  142. {
  143. switch (node.type()) {
  144. case NodeType::DOCUMENT_NODE:
  145. case NodeType::TEXT_NODE:
  146. return false;
  147. case NodeType::COMMENT_NODE:
  148. return true;
  149. case NodeType::DOCUMENT_TYPE_NODE:
  150. return !first_child_of_type<DocumentType>();
  151. case NodeType::ELEMENT_NODE:
  152. return !first_child_of_type<Element>();
  153. default:
  154. return false;
  155. }
  156. }
  157. Element* Document::document_element()
  158. {
  159. return first_child_of_type<Element>();
  160. }
  161. const Element* Document::document_element() const
  162. {
  163. return first_child_of_type<Element>();
  164. }
  165. HTML::HTMLHtmlElement* Document::html_element()
  166. {
  167. auto* html = document_element();
  168. if (is<HTML::HTMLHtmlElement>(html))
  169. return downcast<HTML::HTMLHtmlElement>(html);
  170. return nullptr;
  171. }
  172. HTML::HTMLHeadElement* Document::head()
  173. {
  174. auto* html = html_element();
  175. if (!html)
  176. return nullptr;
  177. return html->first_child_of_type<HTML::HTMLHeadElement>();
  178. }
  179. HTML::HTMLElement* Document::body()
  180. {
  181. auto* html = html_element();
  182. if (!html)
  183. return nullptr;
  184. auto* first_body = html->first_child_of_type<HTML::HTMLBodyElement>();
  185. if (first_body)
  186. return first_body;
  187. auto* first_frameset = html->first_child_of_type<HTML::HTMLFrameSetElement>();
  188. if (first_frameset)
  189. return first_frameset;
  190. return nullptr;
  191. }
  192. // https://html.spec.whatwg.org/multipage/dom.html#dom-document-body
  193. ExceptionOr<void> Document::set_body(HTML::HTMLElement& new_body)
  194. {
  195. if (!is<HTML::HTMLBodyElement>(new_body) && !is<HTML::HTMLFrameSetElement>(new_body))
  196. return DOM::HierarchyRequestError::create("Invalid document body element, must be 'body' or 'frameset'");
  197. auto* existing_body = body();
  198. if (existing_body) {
  199. TODO();
  200. return {};
  201. }
  202. auto* document_element = this->document_element();
  203. if (!document_element)
  204. return DOM::HierarchyRequestError::create("Missing document element");
  205. document_element->append_child(new_body);
  206. return {};
  207. }
  208. String Document::title() const
  209. {
  210. auto* head_element = head();
  211. if (!head_element)
  212. return {};
  213. auto* title_element = head_element->first_child_of_type<HTML::HTMLTitleElement>();
  214. if (!title_element)
  215. return {};
  216. auto raw_title = title_element->text_content();
  217. StringBuilder builder;
  218. bool last_was_space = false;
  219. for (auto code_point : Utf8View(raw_title)) {
  220. if (isspace(code_point)) {
  221. last_was_space = true;
  222. } else {
  223. if (last_was_space && !builder.is_empty())
  224. builder.append(' ');
  225. builder.append_code_point(code_point);
  226. last_was_space = false;
  227. }
  228. }
  229. return builder.to_string();
  230. }
  231. void Document::set_title(const String& title)
  232. {
  233. auto* head_element = const_cast<HTML::HTMLHeadElement*>(head());
  234. if (!head_element)
  235. return;
  236. RefPtr<HTML::HTMLTitleElement> title_element = head_element->first_child_of_type<HTML::HTMLTitleElement>();
  237. if (!title_element) {
  238. title_element = static_ptr_cast<HTML::HTMLTitleElement>(create_element(HTML::TagNames::title));
  239. head_element->append_child(*title_element);
  240. }
  241. title_element->remove_all_children(true);
  242. title_element->append_child(adopt_ref(*new Text(*this, title)));
  243. if (auto* page = this->page()) {
  244. if (frame() == &page->main_frame())
  245. page->client().page_did_change_title(title);
  246. }
  247. }
  248. void Document::attach_to_frame(Badge<Frame>, Frame& frame)
  249. {
  250. m_frame = frame;
  251. update_layout();
  252. }
  253. void Document::detach_from_frame(Badge<Frame>, Frame& frame)
  254. {
  255. VERIFY(&frame == m_frame);
  256. tear_down_layout_tree();
  257. m_frame = nullptr;
  258. }
  259. void Document::tear_down_layout_tree()
  260. {
  261. if (!m_layout_root)
  262. return;
  263. // Gather up all the layout nodes in a vector and detach them from parents
  264. // while the vector keeps them alive.
  265. NonnullRefPtrVector<Layout::Node> layout_nodes;
  266. m_layout_root->for_each_in_inclusive_subtree([&](auto& layout_node) {
  267. layout_nodes.append(layout_node);
  268. return IterationDecision::Continue;
  269. });
  270. for (auto& layout_node : layout_nodes) {
  271. if (layout_node.parent())
  272. layout_node.parent()->remove_child(layout_node);
  273. }
  274. m_layout_root = nullptr;
  275. }
  276. Color Document::background_color(const Palette& palette) const
  277. {
  278. auto default_color = palette.base();
  279. auto* body_element = body();
  280. if (!body_element)
  281. return default_color;
  282. auto* body_layout_node = body_element->layout_node();
  283. if (!body_layout_node)
  284. return default_color;
  285. auto color = body_layout_node->computed_values().background_color();
  286. if (!color.alpha())
  287. return default_color;
  288. return color;
  289. }
  290. RefPtr<Gfx::Bitmap> Document::background_image() const
  291. {
  292. auto* body_element = body();
  293. if (!body_element)
  294. return {};
  295. auto* body_layout_node = body_element->layout_node();
  296. if (!body_layout_node)
  297. return {};
  298. auto background_image = body_layout_node->background_image();
  299. if (!background_image)
  300. return {};
  301. return background_image->bitmap();
  302. }
  303. CSS::Repeat Document::background_repeat_x() const
  304. {
  305. auto* body_element = body();
  306. if (!body_element)
  307. return CSS::Repeat::Repeat;
  308. auto* body_layout_node = body_element->layout_node();
  309. if (!body_layout_node)
  310. return CSS::Repeat::Repeat;
  311. return body_layout_node->computed_values().background_repeat_x();
  312. }
  313. CSS::Repeat Document::background_repeat_y() const
  314. {
  315. auto* body_element = body();
  316. if (!body_element)
  317. return CSS::Repeat::Repeat;
  318. auto* body_layout_node = body_element->layout_node();
  319. if (!body_layout_node)
  320. return CSS::Repeat::Repeat;
  321. return body_layout_node->computed_values().background_repeat_y();
  322. }
  323. URL Document::complete_url(const String& string) const
  324. {
  325. return m_url.complete_url(string);
  326. }
  327. void Document::invalidate_layout()
  328. {
  329. tear_down_layout_tree();
  330. }
  331. void Document::force_layout()
  332. {
  333. invalidate_layout();
  334. update_layout();
  335. }
  336. void Document::update_layout()
  337. {
  338. if (!frame())
  339. return;
  340. if (!m_layout_root) {
  341. Layout::TreeBuilder tree_builder;
  342. m_layout_root = static_ptr_cast<Layout::InitialContainingBlockBox>(tree_builder.build(*this));
  343. }
  344. Layout::BlockFormattingContext root_formatting_context(*m_layout_root, nullptr);
  345. root_formatting_context.run(*m_layout_root, Layout::LayoutMode::Default);
  346. m_layout_root->set_needs_display();
  347. if (frame()->is_main_frame()) {
  348. if (auto* page = this->page())
  349. page->client().page_did_layout();
  350. }
  351. }
  352. static void update_style_recursively(DOM::Node& node)
  353. {
  354. node.for_each_child([&](auto& child) {
  355. if (child.needs_style_update()) {
  356. if (is<Element>(child))
  357. downcast<Element>(child).recompute_style();
  358. child.set_needs_style_update(false);
  359. }
  360. if (child.child_needs_style_update()) {
  361. update_style_recursively(child);
  362. child.set_child_needs_style_update(false);
  363. }
  364. return IterationDecision::Continue;
  365. });
  366. }
  367. void Document::update_style()
  368. {
  369. update_style_recursively(*this);
  370. update_layout();
  371. }
  372. RefPtr<Layout::Node> Document::create_layout_node()
  373. {
  374. return adopt_ref(*new Layout::InitialContainingBlockBox(*this, CSS::StyleProperties::create()));
  375. }
  376. void Document::set_link_color(Color color)
  377. {
  378. m_link_color = color;
  379. }
  380. void Document::set_active_link_color(Color color)
  381. {
  382. m_active_link_color = color;
  383. }
  384. void Document::set_visited_link_color(Color color)
  385. {
  386. m_visited_link_color = color;
  387. }
  388. const Layout::InitialContainingBlockBox* Document::layout_node() const
  389. {
  390. return static_cast<const Layout::InitialContainingBlockBox*>(Node::layout_node());
  391. }
  392. Layout::InitialContainingBlockBox* Document::layout_node()
  393. {
  394. return static_cast<Layout::InitialContainingBlockBox*>(Node::layout_node());
  395. }
  396. void Document::set_inspected_node(Node* node)
  397. {
  398. if (m_inspected_node == node)
  399. return;
  400. if (m_inspected_node && m_inspected_node->layout_node())
  401. m_inspected_node->layout_node()->set_needs_display();
  402. m_inspected_node = node;
  403. if (m_inspected_node && m_inspected_node->layout_node())
  404. m_inspected_node->layout_node()->set_needs_display();
  405. }
  406. void Document::set_hovered_node(Node* node)
  407. {
  408. if (m_hovered_node == node)
  409. return;
  410. RefPtr<Node> old_hovered_node = move(m_hovered_node);
  411. m_hovered_node = node;
  412. invalidate_style();
  413. }
  414. NonnullRefPtr<HTMLCollection> Document::get_elements_by_name(String const& name)
  415. {
  416. return HTMLCollection::create(*this, [name](Element const& element) {
  417. return element.name() == name;
  418. });
  419. }
  420. NonnullRefPtr<HTMLCollection> Document::get_elements_by_tag_name(FlyString const& tag_name)
  421. {
  422. // FIXME: Support "*" for tag_name
  423. // https://dom.spec.whatwg.org/#concept-getelementsbytagname
  424. return HTMLCollection::create(*this, [tag_name](Element const& element) {
  425. if (element.namespace_() == Namespace::HTML)
  426. return element.local_name().to_lowercase() == tag_name.to_lowercase();
  427. return element.local_name() == tag_name;
  428. });
  429. }
  430. NonnullRefPtr<HTMLCollection> Document::get_elements_by_class_name(FlyString const& class_name)
  431. {
  432. return HTMLCollection::create(*this, [class_name, quirks_mode = document().in_quirks_mode()](Element const& element) {
  433. return element.has_class(class_name, quirks_mode ? CaseSensitivity::CaseInsensitive : CaseSensitivity::CaseSensitive);
  434. });
  435. }
  436. // https://html.spec.whatwg.org/multipage/obsolete.html#dom-document-applets
  437. NonnullRefPtr<HTMLCollection> Document::applets()
  438. {
  439. // FIXME: This should return the same HTMLCollection object every time,
  440. // but that would cause a reference cycle since HTMLCollection refs the root.
  441. return HTMLCollection::create(*this, [] { return false; });
  442. }
  443. // https://html.spec.whatwg.org/multipage/obsolete.html#dom-document-anchors
  444. NonnullRefPtr<HTMLCollection> Document::anchors()
  445. {
  446. // FIXME: This should return the same HTMLCollection object every time,
  447. // but that would cause a reference cycle since HTMLCollection refs the root.
  448. return HTMLCollection::create(*this, [](Element const& element) {
  449. return is<HTML::HTMLAnchorElement>(element) && element.has_attribute(HTML::AttributeNames::name);
  450. });
  451. }
  452. // https://html.spec.whatwg.org/multipage/dom.html#dom-document-images
  453. NonnullRefPtr<HTMLCollection> Document::images()
  454. {
  455. // FIXME: This should return the same HTMLCollection object every time,
  456. // but that would cause a reference cycle since HTMLCollection refs the root.
  457. return HTMLCollection::create(*this, [](Element const& element) {
  458. return is<HTML::HTMLImageElement>(element);
  459. });
  460. }
  461. // https://html.spec.whatwg.org/multipage/dom.html#dom-document-embeds
  462. NonnullRefPtr<HTMLCollection> Document::embeds()
  463. {
  464. // FIXME: This should return the same HTMLCollection object every time,
  465. // but that would cause a reference cycle since HTMLCollection refs the root.
  466. return HTMLCollection::create(*this, [](Element const& element) {
  467. return is<HTML::HTMLEmbedElement>(element);
  468. });
  469. }
  470. // https://html.spec.whatwg.org/multipage/dom.html#dom-document-plugins
  471. NonnullRefPtr<HTMLCollection> Document::plugins()
  472. {
  473. return embeds();
  474. }
  475. // https://html.spec.whatwg.org/multipage/dom.html#dom-document-links
  476. NonnullRefPtr<HTMLCollection> Document::links()
  477. {
  478. // FIXME: This should return the same HTMLCollection object every time,
  479. // but that would cause a reference cycle since HTMLCollection refs the root.
  480. return HTMLCollection::create(*this, [](Element const& element) {
  481. return (is<HTML::HTMLAnchorElement>(element) || is<HTML::HTMLAreaElement>(element)) && element.has_attribute(HTML::AttributeNames::href);
  482. });
  483. }
  484. // https://html.spec.whatwg.org/multipage/dom.html#dom-document-forms
  485. NonnullRefPtr<HTMLCollection> Document::forms()
  486. {
  487. // FIXME: This should return the same HTMLCollection object every time,
  488. // but that would cause a reference cycle since HTMLCollection refs the root.
  489. return HTMLCollection::create(*this, [](Element const& element) {
  490. return is<HTML::HTMLFormElement>(element);
  491. });
  492. }
  493. // https://html.spec.whatwg.org/multipage/dom.html#dom-document-scripts
  494. NonnullRefPtr<HTMLCollection> Document::scripts()
  495. {
  496. // FIXME: This should return the same HTMLCollection object every time,
  497. // but that would cause a reference cycle since HTMLCollection refs the root.
  498. return HTMLCollection::create(*this, [](Element const& element) {
  499. return is<HTML::HTMLScriptElement>(element);
  500. });
  501. }
  502. Color Document::link_color() const
  503. {
  504. if (m_link_color.has_value())
  505. return m_link_color.value();
  506. if (!page())
  507. return Color::Blue;
  508. return page()->palette().link();
  509. }
  510. Color Document::active_link_color() const
  511. {
  512. if (m_active_link_color.has_value())
  513. return m_active_link_color.value();
  514. if (!page())
  515. return Color::Red;
  516. return page()->palette().active_link();
  517. }
  518. Color Document::visited_link_color() const
  519. {
  520. if (m_visited_link_color.has_value())
  521. return m_visited_link_color.value();
  522. if (!page())
  523. return Color::Magenta;
  524. return page()->palette().visited_link();
  525. }
  526. JS::Interpreter& Document::interpreter()
  527. {
  528. if (!m_interpreter) {
  529. auto& vm = Bindings::main_thread_vm();
  530. // TODO: Hook up vm.on_promise_unhandled_rejection and vm.on_promise_rejection_handled
  531. // See https://developer.mozilla.org/en-US/docs/Web/JavaScript/Guide/Using_promises#promise_rejection_events
  532. vm.on_call_stack_emptied = [this] {
  533. auto& vm = m_interpreter->vm();
  534. vm.run_queued_promise_jobs();
  535. // Note: This is not an exception check for the promise jobs, they will just leave any
  536. // exception that already exists intact and never throw a new one (without cleaning it
  537. // up, that is). Taking care of any previous unhandled exception just happens to be the
  538. // very last thing we want to do, even after running promise jobs.
  539. if (auto* exception = vm.exception()) {
  540. auto value = exception->value();
  541. if (value.is_object()) {
  542. auto& object = value.as_object();
  543. auto name = object.get_without_side_effects(vm.names.name).value_or(JS::js_undefined());
  544. auto message = object.get_without_side_effects(vm.names.message).value_or(JS::js_undefined());
  545. if (name.is_accessor() || name.is_native_property() || message.is_accessor() || message.is_native_property()) {
  546. // The result is not going to be useful, let's just print the value. This affects DOMExceptions, for example.
  547. dbgln("Unhandled JavaScript exception: {}", value);
  548. } else {
  549. dbgln("Unhandled JavaScript exception: [{}] {}", name, message);
  550. }
  551. } else {
  552. dbgln("Unhandled JavaScript exception: {}", value);
  553. }
  554. for (auto& traceback_frame : exception->traceback()) {
  555. auto& function_name = traceback_frame.function_name;
  556. auto& source_range = traceback_frame.source_range;
  557. dbgln(" {} at {}:{}:{}", function_name, source_range.filename, source_range.start.line, source_range.start.column);
  558. }
  559. }
  560. };
  561. m_interpreter = JS::Interpreter::create<Bindings::WindowObject>(vm, *m_window);
  562. }
  563. return *m_interpreter;
  564. }
  565. JS::Value Document::run_javascript(const StringView& source, const StringView& filename)
  566. {
  567. auto parser = JS::Parser(JS::Lexer(source, filename));
  568. auto program = parser.parse_program();
  569. if (parser.has_errors()) {
  570. parser.print_errors();
  571. return JS::js_undefined();
  572. }
  573. auto& interpreter = document().interpreter();
  574. auto& vm = interpreter.vm();
  575. interpreter.run(interpreter.global_object(), *program);
  576. if (vm.exception())
  577. vm.clear_exception();
  578. return vm.last_value();
  579. }
  580. // https://dom.spec.whatwg.org/#dom-document-createelement
  581. // FIXME: This only implements step 6 of the algorithm and does not take in options.
  582. NonnullRefPtr<Element> Document::create_element(const String& tag_name)
  583. {
  584. // FIXME: Let namespace be the HTML namespace, if this is an HTML document or this’s content type is "application/xhtml+xml", and null otherwise.
  585. return DOM::create_element(*this, tag_name, Namespace::HTML);
  586. }
  587. // https://dom.spec.whatwg.org/#internal-createelementns-steps
  588. // FIXME: This only implements step 4 of the algorithm and does not take in options.
  589. NonnullRefPtr<Element> Document::create_element_ns(const String& namespace_, const String& qualified_name)
  590. {
  591. return DOM::create_element(*this, qualified_name, namespace_);
  592. }
  593. NonnullRefPtr<DocumentFragment> Document::create_document_fragment()
  594. {
  595. return adopt_ref(*new DocumentFragment(*this));
  596. }
  597. NonnullRefPtr<Text> Document::create_text_node(const String& data)
  598. {
  599. return adopt_ref(*new Text(*this, data));
  600. }
  601. NonnullRefPtr<Comment> Document::create_comment(const String& data)
  602. {
  603. return adopt_ref(*new Comment(*this, data));
  604. }
  605. NonnullRefPtr<Range> Document::create_range()
  606. {
  607. return Range::create(*this);
  608. }
  609. // https://dom.spec.whatwg.org/#dom-document-createevent
  610. NonnullRefPtr<Event> Document::create_event(const String& interface)
  611. {
  612. auto interface_lowercase = interface.to_lowercase();
  613. RefPtr<Event> event;
  614. if (interface_lowercase == "beforeunloadevent") {
  615. event = Event::create(""); // FIXME: Create BeforeUnloadEvent
  616. } else if (interface_lowercase == "compositionevent") {
  617. event = Event::create(""); // FIXME: Create CompositionEvent
  618. } else if (interface_lowercase == "customevent") {
  619. event = Event::create(""); // FIXME: Create CustomEvent
  620. } else if (interface_lowercase == "devicemotionevent") {
  621. event = Event::create(""); // FIXME: Create DeviceMotionEvent
  622. } else if (interface_lowercase == "deviceorientationevent") {
  623. event = Event::create(""); // FIXME: Create DeviceOrientationEvent
  624. } else if (interface_lowercase == "dragevent") {
  625. event = Event::create(""); // FIXME: Create DragEvent
  626. } else if (interface_lowercase.is_one_of("event", "events")) {
  627. event = Event::create("");
  628. } else if (interface_lowercase == "focusevent") {
  629. event = Event::create(""); // FIXME: Create FocusEvent
  630. } else if (interface_lowercase == "hashchangeevent") {
  631. event = Event::create(""); // FIXME: Create HashChangeEvent
  632. } else if (interface_lowercase == "htmlevents") {
  633. event = Event::create("");
  634. } else if (interface_lowercase == "keyboardevent") {
  635. event = Event::create(""); // FIXME: Create KeyboardEvent
  636. } else if (interface_lowercase == "messageevent") {
  637. event = Event::create(""); // FIXME: Create MessageEvent
  638. } else if (interface_lowercase.is_one_of("mouseevent", "mouseevents")) {
  639. event = UIEvents::MouseEvent::create("", 0, 0, 0, 0);
  640. } else if (interface_lowercase == "storageevent") {
  641. event = Event::create(""); // FIXME: Create StorageEvent
  642. } else if (interface_lowercase == "svgevents") {
  643. event = Event::create("");
  644. } else if (interface_lowercase == "textevent") {
  645. event = Event::create(""); // FIXME: Create CompositionEvent
  646. } else if (interface_lowercase == "touchevent") {
  647. event = Event::create(""); // FIXME: Create TouchEvent
  648. } else if (interface_lowercase.is_one_of("uievent", "uievents")) {
  649. event = UIEvents::UIEvent::create("");
  650. } else {
  651. // FIXME:
  652. // 3. If constructor is null, then throw a "NotSupportedError" DOMException.
  653. // 4. If the interface indicated by constructor is not exposed on the relevant global object of this, then throw a "NotSupportedError" DOMException.
  654. TODO();
  655. }
  656. // Setting type to empty string is handled by each constructor.
  657. // FIXME:
  658. // 7. Initialize event’s timeStamp attribute to a DOMHighResTimeStamp representing the high resolution time from the time origin to now.
  659. event->set_is_trusted(false);
  660. event->set_initialized(false);
  661. return event.release_nonnull();
  662. }
  663. void Document::set_pending_parsing_blocking_script(Badge<HTML::HTMLScriptElement>, HTML::HTMLScriptElement* script)
  664. {
  665. m_pending_parsing_blocking_script = script;
  666. }
  667. NonnullRefPtr<HTML::HTMLScriptElement> Document::take_pending_parsing_blocking_script(Badge<HTML::HTMLDocumentParser>)
  668. {
  669. return m_pending_parsing_blocking_script.release_nonnull();
  670. }
  671. void Document::add_script_to_execute_when_parsing_has_finished(Badge<HTML::HTMLScriptElement>, HTML::HTMLScriptElement& script)
  672. {
  673. m_scripts_to_execute_when_parsing_has_finished.append(script);
  674. }
  675. NonnullRefPtrVector<HTML::HTMLScriptElement> Document::take_scripts_to_execute_when_parsing_has_finished(Badge<HTML::HTMLDocumentParser>)
  676. {
  677. return move(m_scripts_to_execute_when_parsing_has_finished);
  678. }
  679. void Document::add_script_to_execute_as_soon_as_possible(Badge<HTML::HTMLScriptElement>, HTML::HTMLScriptElement& script)
  680. {
  681. m_scripts_to_execute_as_soon_as_possible.append(script);
  682. }
  683. NonnullRefPtrVector<HTML::HTMLScriptElement> Document::take_scripts_to_execute_as_soon_as_possible(Badge<HTML::HTMLDocumentParser>)
  684. {
  685. return move(m_scripts_to_execute_as_soon_as_possible);
  686. }
  687. // https://dom.spec.whatwg.org/#concept-node-adopt
  688. void Document::adopt_node(Node& node)
  689. {
  690. auto& old_document = node.document();
  691. if (node.parent())
  692. node.remove();
  693. if (&old_document != this) {
  694. // FIXME: This should be shadow-including.
  695. node.for_each_in_inclusive_subtree([&](auto& inclusive_descendant) {
  696. inclusive_descendant.set_document({}, *this);
  697. // FIXME: If inclusiveDescendant is an element, then set the node document of each attribute in inclusiveDescendant’s attribute list to document.
  698. return IterationDecision::Continue;
  699. });
  700. // FIXME: For each inclusiveDescendant in node’s shadow-including inclusive descendants that is custom,
  701. // enqueue a custom element callback reaction with inclusiveDescendant, callback name "adoptedCallback",
  702. // and an argument list containing oldDocument and document.
  703. // FIXME: This should be shadow-including.
  704. node.for_each_in_inclusive_subtree([&](auto& inclusive_descendant) {
  705. inclusive_descendant.adopted_from(old_document);
  706. return IterationDecision::Continue;
  707. });
  708. }
  709. }
  710. // https://dom.spec.whatwg.org/#dom-document-adoptnode
  711. ExceptionOr<NonnullRefPtr<Node>> Document::adopt_node_binding(NonnullRefPtr<Node> node)
  712. {
  713. if (is<Document>(*node))
  714. return DOM ::NotSupportedError::create("Cannot adopt_ref a document into a document");
  715. if (is<ShadowRoot>(*node))
  716. return DOM::HierarchyRequestError::create("Cannot adopt_ref a shadow root into a document");
  717. if (is<DocumentFragment>(*node) && downcast<DocumentFragment>(*node).host())
  718. return node;
  719. adopt_node(*node);
  720. return node;
  721. }
  722. const DocumentType* Document::doctype() const
  723. {
  724. return first_child_of_type<DocumentType>();
  725. }
  726. const String& Document::compat_mode() const
  727. {
  728. static String back_compat = "BackCompat";
  729. static String css1_compat = "CSS1Compat";
  730. if (m_quirks_mode == QuirksMode::Yes)
  731. return back_compat;
  732. return css1_compat;
  733. }
  734. bool Document::is_editable() const
  735. {
  736. return m_editable;
  737. }
  738. void Document::set_focused_element(Element* element)
  739. {
  740. if (m_focused_element == element)
  741. return;
  742. m_focused_element = element;
  743. if (m_layout_root)
  744. m_layout_root->set_needs_display();
  745. }
  746. void Document::set_ready_state(const String& ready_state)
  747. {
  748. m_ready_state = ready_state;
  749. dispatch_event(Event::create(HTML::EventNames::readystatechange));
  750. }
  751. Page* Document::page()
  752. {
  753. return m_frame ? m_frame->page() : nullptr;
  754. }
  755. const Page* Document::page() const
  756. {
  757. return m_frame ? m_frame->page() : nullptr;
  758. }
  759. EventTarget* Document::get_parent(const Event& event)
  760. {
  761. if (event.type() == HTML::EventNames::load)
  762. return nullptr;
  763. return &window();
  764. }
  765. void Document::completely_finish_loading()
  766. {
  767. // FIXME: This needs to handle iframes.
  768. dispatch_event(DOM::Event::create(HTML::EventNames::load));
  769. }
  770. String Document::cookie(Cookie::Source source)
  771. {
  772. if (auto* page = this->page())
  773. return page->client().page_did_request_cookie(m_url, source);
  774. return {};
  775. }
  776. void Document::set_cookie(String cookie_string, Cookie::Source source)
  777. {
  778. auto cookie = Cookie::parse_cookie(cookie_string);
  779. if (!cookie.has_value())
  780. return;
  781. if (auto* page = this->page())
  782. page->client().page_did_set_cookie(m_url, cookie.value(), source);
  783. }
  784. }